ZA857477B - New diaryl compounds - Google Patents
New diaryl compoundsInfo
- Publication number
- ZA857477B ZA857477B ZA857477A ZA857477A ZA857477B ZA 857477 B ZA857477 B ZA 857477B ZA 857477 A ZA857477 A ZA 857477A ZA 857477 A ZA857477 A ZA 857477A ZA 857477 B ZA857477 B ZA 857477B
- Authority
- ZA
- South Africa
- Prior art keywords
- diaryl compounds
- new diaryl
- new
- compounds
- diaryl
- Prior art date
Links
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH465284 | 1984-09-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA857477B true ZA857477B (en) | 1986-05-28 |
Family
ID=4280111
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA857477A ZA857477B (en) | 1984-09-28 | 1985-09-27 | New diaryl compounds |
Country Status (14)
| Country | Link |
|---|---|
| KR (1) | KR930001404B1 (enFirst) |
| AU (1) | AU574842B2 (enFirst) |
| CA (1) | CA1291137C (enFirst) |
| DK (1) | DK440885A (enFirst) |
| ES (3) | ES8703148A1 (enFirst) |
| FI (1) | FI83957C (enFirst) |
| GR (1) | GR852364B (enFirst) |
| HU (1) | HU194210B (enFirst) |
| IE (1) | IE66677B1 (enFirst) |
| IL (1) | IL76511A (enFirst) |
| NO (1) | NO169586C (enFirst) |
| NZ (1) | NZ213629A (enFirst) |
| PT (1) | PT81209B (enFirst) |
| ZA (1) | ZA857477B (enFirst) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK704488D0 (da) * | 1988-12-19 | 1988-12-19 | Novo Industri As | Nye n-substituerede azaheterocykliske carboxylsyrer |
| DK142287A (da) * | 1986-03-27 | 1987-09-28 | Byk Gulden Lomberg Chem Fab | Optisk aktive 1,4-dihydropyridinderivater |
| EP0401256B1 (de) * | 1988-02-19 | 1993-05-26 | Byk Gulden Lomberg Chemische Fabrik GmbH | Optisch reines dexniguldipin und dessen derivate zur behandlung von tumorerkrankungen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI793848A7 (fi) * | 1978-12-18 | 1981-01-01 | Sandoz Ag | Bensoksadiatsoleja ja bensotiadiatsoleja, niiden valmistus ja farmaseuttisia yhdisteitä, jotka sisältävät näitä |
-
1985
- 1985-09-06 FI FI853415A patent/FI83957C/fi not_active IP Right Cessation
- 1985-09-25 HU HU853602A patent/HU194210B/hu unknown
- 1985-09-26 KR KR1019850007105A patent/KR930001404B1/ko not_active Expired - Fee Related
- 1985-09-27 PT PT81209A patent/PT81209B/pt not_active IP Right Cessation
- 1985-09-27 GR GR852364A patent/GR852364B/el unknown
- 1985-09-27 DK DK440885A patent/DK440885A/da not_active Application Discontinuation
- 1985-09-27 IE IE238485A patent/IE66677B1/en not_active IP Right Cessation
- 1985-09-27 IL IL76511A patent/IL76511A/xx not_active IP Right Cessation
- 1985-09-27 NO NO853833A patent/NO169586C/no unknown
- 1985-09-27 AU AU47948/85A patent/AU574842B2/en not_active Ceased
- 1985-09-27 ES ES547385A patent/ES8703148A1/es not_active Expired
- 1985-09-27 NZ NZ213629A patent/NZ213629A/xx unknown
- 1985-09-27 ZA ZA857477A patent/ZA857477B/xx unknown
- 1985-09-27 CA CA000491694A patent/CA1291137C/en not_active Expired
-
1986
- 1986-04-16 ES ES554068A patent/ES8708135A1/es not_active Expired
- 1986-04-16 ES ES554067A patent/ES8800201A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NZ213629A (en) | 1989-07-27 |
| HU194210B (en) | 1988-01-28 |
| HUT38627A (en) | 1986-06-30 |
| ES8703148A1 (es) | 1987-02-16 |
| ES554068A0 (es) | 1987-10-16 |
| ES554067A0 (es) | 1987-11-01 |
| PT81209A (de) | 1985-10-01 |
| FI853415L (fi) | 1986-03-29 |
| NO169586C (no) | 1992-07-15 |
| KR930001404B1 (ko) | 1993-02-27 |
| CA1291137C (en) | 1991-10-22 |
| IL76511A (en) | 1990-06-10 |
| AU574842B2 (en) | 1988-07-14 |
| FI853415A0 (fi) | 1985-09-06 |
| ES8800201A1 (es) | 1987-11-01 |
| FI83957C (fi) | 1991-09-25 |
| KR860002497A (ko) | 1986-04-26 |
| PT81209B (pt) | 1988-01-22 |
| DK440885A (da) | 1986-03-29 |
| IE852384L (en) | 1986-03-28 |
| AU4794885A (en) | 1986-04-10 |
| ES8708135A1 (es) | 1987-10-16 |
| NO853833L (no) | 1986-04-01 |
| DK440885D0 (da) | 1985-09-27 |
| GR852364B (enFirst) | 1985-12-13 |
| NO169586B (no) | 1992-04-06 |
| IE66677B1 (en) | 1996-01-24 |
| ES547385A0 (es) | 1987-02-16 |
| FI83957B (fi) | 1991-06-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3569932D1 (en) | Cotelomer compounds | |
| PT81055B (en) | New compounds | |
| GB8404584D0 (en) | Compounds | |
| GB8417171D0 (en) | Compounds | |
| GB8404586D0 (en) | Compounds | |
| GB8415540D0 (en) | Imidazoisoquinoline compounds | |
| GB8415377D0 (en) | Compounds | |
| GB8406689D0 (en) | Compounds | |
| GB8402086D0 (en) | Compounds | |
| GB8412862D0 (en) | Compounds | |
| ZA857477B (en) | New diaryl compounds | |
| GB8401868D0 (en) | Compounds | |
| GB8415924D0 (en) | Compounds | |
| GB8405955D0 (en) | Compounds | |
| GB8415312D0 (en) | Compounds | |
| GB8414786D0 (en) | Compounds | |
| GB8414647D0 (en) | Compounds | |
| GB8414457D0 (en) | Compounds | |
| GB8413651D0 (en) | Compounds | |
| GB8415376D0 (en) | Compounds | |
| GB8412584D0 (en) | Compounds | |
| GB8411560D0 (en) | Compounds | |
| GB8409987D0 (en) | Compounds | |
| GB8409699D0 (en) | Compounds | |
| GB8408322D0 (en) | Compounds |