ZA849242B - Process for the production of 4-nitrotoluene-2-sulfonic acid - Google Patents
Process for the production of 4-nitrotoluene-2-sulfonic acidInfo
- Publication number
- ZA849242B ZA849242B ZA849242A ZA849242A ZA849242B ZA 849242 B ZA849242 B ZA 849242B ZA 849242 A ZA849242 A ZA 849242A ZA 849242 A ZA849242 A ZA 849242A ZA 849242 B ZA849242 B ZA 849242B
- Authority
- ZA
- South Africa
- Prior art keywords
- nitrotoluene
- production
- sulfonic acid
- sulfonic
- acid
- Prior art date
Links
- ZDTXQHVBLWYPHS-UHFFFAOYSA-N 4-nitrotoluene-2-sulfonic acid Chemical compound CC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O ZDTXQHVBLWYPHS-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH635083 | 1983-11-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA849242B true ZA849242B (en) | 1985-07-31 |
Family
ID=4308193
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA849242A ZA849242B (en) | 1983-11-28 | 1984-11-27 | Process for the production of 4-nitrotoluene-2-sulfonic acid |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4922008A (enExample) |
| EP (1) | EP0143750B1 (enExample) |
| JP (1) | JPS60132950A (enExample) |
| AR (1) | AR240801A1 (enExample) |
| BR (1) | BR8406014A (enExample) |
| CA (1) | CA1230608A (enExample) |
| DE (1) | DE3463264D1 (enExample) |
| ES (1) | ES8601116A1 (enExample) |
| MX (1) | MX156322A (enExample) |
| ZA (1) | ZA849242B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH692246A5 (de) * | 1996-12-13 | 2002-04-15 | Basf Ag | Verfahren zur Herstellung von Aminsalzen von 4-Nitrotoluol-2-sulfonsäure. |
| US6384271B1 (en) | 2001-05-04 | 2002-05-07 | E.I. Du Pont De Nemours And Company | Sulfonation, sulfation and sulfamation |
| CN102786445B (zh) * | 2011-05-19 | 2014-07-02 | 中国科学院大连化学物理研究所 | 一种生产间硝基苯磺酸的方法和设备 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH478772A (de) * | 1967-03-09 | 1969-09-30 | Geigy Ag J R | Verfahren zur Herstellung von Nitroaromat-sulfonsäuren |
| GB1434020A (en) * | 1972-10-30 | 1976-04-28 | Koebner A | Sulphonation of aromatic compounds in the presence of solvents |
| US3923666A (en) * | 1973-02-26 | 1975-12-02 | Halliburton Co | Method and composition for acidizing and fracturing wells |
| IT986670B (it) * | 1973-03-20 | 1975-01-30 | Micol Ets | Procedimento perfezionato per ini bire la formazione di composti se condari indesiderati nella solfona zione solfatazione di composti organici |
| US3840591A (en) * | 1973-04-25 | 1974-10-08 | Ciba Geigy Corp | Process for the production of p-nitrotoluene-2-sulfonic acid |
| JPS5390219A (en) * | 1977-01-17 | 1978-08-08 | Kao Corp | Sulfonation process and its apparatus |
| DD140206A1 (de) * | 1978-12-01 | 1980-02-20 | Ingrid Hertel | Stufenreaktor zur durchfuehrung chemischer und/oder physikalischer operationen und seine anwendung |
| DE2916912A1 (de) * | 1979-04-26 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von 4-nitrotoluol-2-sulfonsaeure |
| DE3263947D1 (en) * | 1981-12-31 | 1985-07-04 | Ciba Geigy Ag | Process for the preparation of p-nitrotoluene sulfonic acid |
-
1984
- 1984-11-22 EP EP84810570A patent/EP0143750B1/de not_active Expired
- 1984-11-22 DE DE8484810570T patent/DE3463264D1/de not_active Expired
- 1984-11-26 AR AR298736A patent/AR240801A1/es active
- 1984-11-26 CA CA000468598A patent/CA1230608A/en not_active Expired
- 1984-11-27 BR BR8406014A patent/BR8406014A/pt not_active IP Right Cessation
- 1984-11-27 ES ES537987A patent/ES8601116A1/es not_active Expired
- 1984-11-27 ZA ZA849242A patent/ZA849242B/xx unknown
- 1984-11-27 MX MX203499A patent/MX156322A/es unknown
- 1984-11-28 JP JP59249809A patent/JPS60132950A/ja active Granted
-
1987
- 1987-04-29 US US07/045,734 patent/US4922008A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| MX156322A (es) | 1988-08-09 |
| AR240801A1 (es) | 1991-02-28 |
| ES537987A0 (es) | 1985-11-01 |
| EP0143750B1 (de) | 1987-04-22 |
| JPH0442378B2 (enExample) | 1992-07-13 |
| CA1230608A (en) | 1987-12-22 |
| DE3463264D1 (en) | 1987-05-27 |
| EP0143750A2 (de) | 1985-06-05 |
| EP0143750A3 (en) | 1985-07-24 |
| BR8406014A (pt) | 1985-08-27 |
| US4922008A (en) | 1990-05-01 |
| JPS60132950A (ja) | 1985-07-16 |
| ES8601116A1 (es) | 1985-11-01 |
| AR240801A2 (es) | 1991-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HUT34944A (en) | Process for the production of new hydroxy-alkane- and alkene-tetrahydrofuran- and tetrahydropyran-derivatives | |
| HUT36129A (en) | Process for producing //carboxy-alkenoyl/-amino/-cepheme-carboxylic acid derivatives | |
| ZA844660B (en) | Process for the production of ammonia | |
| DE3465066D1 (en) | Process for the production of nitrogen | |
| HUT37618A (en) | Process for production of new 2-phenil imadosoles | |
| HUT34499A (en) | Process for producing cepheme-carboxylic acid derivatives | |
| GB2102024B (en) | Process for the production of monascus-pigment | |
| HUT37432A (en) | Process for the production of condensed dibenzo-diazepine-derivatives | |
| HUT36137A (en) | Improved process for the production of tylosine | |
| HUT34962A (en) | Process for the production of pyrimidine-derivatives | |
| HUT37763A (en) | Process for production of new benzimidazols | |
| HUT37393A (en) | Process for the production of azulene-derivatives | |
| DE3166087D1 (en) | Process for the production of 2-hydroxynaphthalene-6-carboxylic acid | |
| ZA825858B (en) | Process for the production of 2- -d-ribofuranosylthiazole-4-carboxamide | |
| DE3164545D1 (en) | Process for the production of diacetone-keto-gulonic acid | |
| HUT34201A (en) | Process for producing 2-substituted-2-peneme-3-carboxylic acid derivatives | |
| DE3567199D1 (en) | Process for the production of ceraceous esters | |
| DE3460249D1 (en) | Process for the production of aromatic amino-sulphonic acids | |
| DE3460472D1 (en) | Process for the production of ketones | |
| ZA849242B (en) | Process for the production of 4-nitrotoluene-2-sulfonic acid | |
| HUT37133A (en) | Process for producing new acylamino-phenyl-esters of thiazolidine-carboxylic acid | |
| DE3561460D1 (en) | Process for the production of 1-amino-2-naphthol-4-sulphonic acid | |
| DE3469523D1 (en) | Process for the production of 2-cycloalkyl-4-methyl-6-hydroxypyrimidine | |
| HUT36125A (en) | Process for production of furoforans inhibiting the angiofenazing factor | |
| HUT35688A (en) | Process for producing 3-azido-3-cepheme-4-karboxylic acid derivatives |