ZA777359B - 3-phenoxypyridine monosulfate - Google Patents
3-phenoxypyridine monosulfateInfo
- Publication number
- ZA777359B ZA777359B ZA00777359A ZA777359A ZA777359B ZA 777359 B ZA777359 B ZA 777359B ZA 00777359 A ZA00777359 A ZA 00777359A ZA 777359 A ZA777359 A ZA 777359A ZA 777359 B ZA777359 B ZA 777359B
- Authority
- ZA
- South Africa
- Prior art keywords
- phenoxypyridine monosulfate
- phenoxypyridine
- monosulfate
- Prior art date
Links
- JTIUHKZUVGVPGO-UHFFFAOYSA-N [3-[(4-bromophenyl)carbamoyl]phenyl]boronic acid Chemical compound OB(O)C1=CC=CC(C(=O)NC=2C=CC(Br)=CC=2)=C1 JTIUHKZUVGVPGO-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/65—One oxygen atom attached in position 3 or 5
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75193376A | 1976-12-17 | 1976-12-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA777359B true ZA777359B (en) | 1979-07-25 |
Family
ID=25024143
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00777359A ZA777359B (en) | 1976-12-17 | 1977-12-09 | 3-phenoxypyridine monosulfate |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US4128555A (enFirst) |
| JP (1) | JPS5953909B2 (enFirst) |
| AR (1) | AR217458A1 (enFirst) |
| AT (1) | AT358038B (enFirst) |
| AU (1) | AU510436B2 (enFirst) |
| BE (1) | BE861649A (enFirst) |
| CA (1) | CA1060021A (enFirst) |
| CH (1) | CH625221A5 (enFirst) |
| DE (1) | DE2755016A1 (enFirst) |
| DK (1) | DK146387C (enFirst) |
| ES (1) | ES464922A1 (enFirst) |
| FR (1) | FR2392009A1 (enFirst) |
| GB (1) | GB1559918A (enFirst) |
| GR (1) | GR64011B (enFirst) |
| HK (1) | HK9184A (enFirst) |
| HU (1) | HU176300B (enFirst) |
| IL (1) | IL53579A0 (enFirst) |
| MX (1) | MX4520E (enFirst) |
| NZ (1) | NZ185930A (enFirst) |
| PH (1) | PH13387A (enFirst) |
| PT (1) | PT67386B (enFirst) |
| SE (1) | SE431542B (enFirst) |
| YU (1) | YU40021B (enFirst) |
| ZA (1) | ZA777359B (enFirst) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4218238A (en) * | 1978-06-19 | 1980-08-19 | Eli Lilly And Company | Herbicidal 1-alkyl-3-phenylpyridinium salts |
| US4174209A (en) * | 1978-06-19 | 1979-11-13 | Eli Lilly And Company | Herbicidal 1-alkyl-3-phenylpyridinium salts |
| US4434169A (en) * | 1983-01-03 | 1984-02-28 | Warner-Lambert Company | Pharmaceutical compositions and methods |
| US4666926A (en) * | 1986-02-27 | 1987-05-19 | Warner-Lambert Company | Transdermal formulations |
| US5232934A (en) * | 1992-07-17 | 1993-08-03 | Warner-Lambert Co. | Method for the treatment of psychomotor stimulant addiction |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2753352A (en) * | 1953-01-14 | 1956-07-03 | Olin Mathieson | Derivatives of isonicotinic acid hydrazide |
| CH434868A (de) * | 1964-02-10 | 1967-04-30 | Ciba Geigy | Schädlingsbekämpfungsmittel |
-
1977
- 1977-05-27 US US05/801,113 patent/US4128555A/en not_active Expired - Lifetime
- 1977-12-08 YU YU2894/77A patent/YU40021B/xx unknown
- 1977-12-08 BE BE183291A patent/BE861649A/xx not_active IP Right Cessation
- 1977-12-09 JP JP52147323A patent/JPS5953909B2/ja not_active Expired
- 1977-12-09 CA CA292,754A patent/CA1060021A/en not_active Expired
- 1977-12-09 MX MX776683U patent/MX4520E/es unknown
- 1977-12-09 ES ES464922A patent/ES464922A1/es not_active Expired
- 1977-12-09 SE SE7714012A patent/SE431542B/xx not_active IP Right Cessation
- 1977-12-09 FR FR7737159A patent/FR2392009A1/fr active Granted
- 1977-12-09 DK DK549677A patent/DK146387C/da active
- 1977-12-09 IL IL53579A patent/IL53579A0/xx not_active IP Right Cessation
- 1977-12-09 PT PT67386A patent/PT67386B/pt unknown
- 1977-12-09 GB GB51443/77A patent/GB1559918A/en not_active Expired
- 1977-12-09 PH PH20531A patent/PH13387A/en unknown
- 1977-12-09 AR AR270307A patent/AR217458A1/es active
- 1977-12-09 NZ NZ185930A patent/NZ185930A/xx unknown
- 1977-12-09 CH CH1516377A patent/CH625221A5/fr not_active IP Right Cessation
- 1977-12-09 DE DE19772755016 patent/DE2755016A1/de active Granted
- 1977-12-09 ZA ZA00777359A patent/ZA777359B/xx unknown
- 1977-12-09 AT AT880377A patent/AT358038B/de not_active IP Right Cessation
- 1977-12-09 HU HU77PA1298A patent/HU176300B/hu not_active IP Right Cessation
- 1977-12-09 GR GR54944A patent/GR64011B/el unknown
- 1977-12-09 AU AU31417/77A patent/AU510436B2/en not_active Expired
-
1984
- 1984-02-01 HK HK91/84A patent/HK9184A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AR217458A1 (es) | 1980-03-31 |
| PT67386B (en) | 1979-05-18 |
| GB1559918A (en) | 1980-01-30 |
| YU40021B (en) | 1985-06-30 |
| ES464922A1 (es) | 1978-09-01 |
| AU3141777A (en) | 1979-06-14 |
| DK146387C (da) | 1984-03-05 |
| JPS5953909B2 (ja) | 1984-12-27 |
| IL53579A0 (en) | 1978-03-10 |
| AU510436B2 (en) | 1980-06-26 |
| CA1060021A (en) | 1979-08-07 |
| NZ185930A (en) | 1979-08-31 |
| HU176300B (en) | 1981-01-28 |
| FR2392009B1 (enFirst) | 1980-04-04 |
| MX4520E (es) | 1982-06-02 |
| US4128555A (en) | 1978-12-05 |
| AT358038B (de) | 1980-08-11 |
| BE861649A (fr) | 1978-03-31 |
| DE2755016A1 (de) | 1978-06-29 |
| CH625221A5 (enFirst) | 1981-09-15 |
| SE7714012L (sv) | 1978-06-18 |
| JPS5377068A (en) | 1978-07-08 |
| PH13387A (en) | 1980-03-25 |
| DE2755016C2 (enFirst) | 1988-02-25 |
| FR2392009A1 (fr) | 1978-12-22 |
| DK146387B (da) | 1983-09-26 |
| HK9184A (en) | 1984-02-10 |
| PT67386A (en) | 1978-01-01 |
| DK549677A (da) | 1978-06-18 |
| YU289477A (en) | 1982-08-31 |
| GR64011B (en) | 1980-01-18 |
| SE431542B (sv) | 1984-02-13 |
| ATA880377A (de) | 1980-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EG13149A (en) | Heterocyclic compounds | |
| ZA771381B (en) | Heterocyclic compounds | |
| JPS52151168A (en) | Heterocyclic compound | |
| GB1549132A (en) | Pyridines | |
| ZA771963B (en) | Heterocyclic compounds | |
| GB1545708A (en) | Substituted cyanopyridines | |
| JPS52136170A (en) | Heterocyclic compound | |
| PH16561A (en) | Nitrogen heterocyclic carboximidamine compounds | |
| ZA774154B (en) | Heterocyclic compounds | |
| ZA777536B (en) | Heterocyclic compounds | |
| JPS5356669A (en) | 4aaarylloctahydroo1hh22 pyridines | |
| ZA777359B (en) | 3-phenoxypyridine monosulfate | |
| JPS5315383A (en) | Heterocyclic compound | |
| JPS5315371A (en) | Heterocyclic compound | |
| ZA766062B (en) | Tetrazoles | |
| GB1553049A (en) | Orthopaedie aid | |
| ZA775065B (en) | Anti-protozoal compounds | |
| JPS5315370A (en) | Heterocyclic compound | |
| ZA776857B (en) | Heterocyclic compounds | |
| JPS5285216A (en) | Azamethineemetal complex compounds | |
| JPS52148072A (en) | 11thiazylyl imidazolidinones | |
| JPS52155383A (en) | Aparratus for crossslinking | |
| JPS52149157A (en) | Case for watch | |
| JPS52132872A (en) | Independent part for watchband | |
| EG13362A (en) | Heterocyclic compounds |