ZA742209B - Benzofuran-5-yl sulphonates and their use on plants - Google Patents
Benzofuran-5-yl sulphonates and their use on plantsInfo
- Publication number
- ZA742209B ZA742209B ZA00742209A ZA742209A ZA742209B ZA 742209 B ZA742209 B ZA 742209B ZA 00742209 A ZA00742209 A ZA 00742209A ZA 742209 A ZA742209 A ZA 742209A ZA 742209 B ZA742209 B ZA 742209B
- Authority
- ZA
- South Africa
- Prior art keywords
- sulphonates
- benzofuran
- plants
- Prior art date
Links
- XRBBTJJZMLQXFS-UHFFFAOYSA-N 1-benzofuran-5-sulfonic acid Chemical class OS(=O)(=O)C1=CC=C2OC=CC2=C1 XRBBTJJZMLQXFS-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/86—Benzo [b] furans; Hydrogenated benzo [b] furans with an oxygen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1839573A GB1462375A (en) | 1973-04-17 | 1973-04-17 | 2-halo-5-benzofuranyl-sulphonates and their use in pesticidal compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA742209B true ZA742209B (en) | 1975-09-24 |
Family
ID=10111724
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00742209A ZA742209B (en) | 1973-04-17 | 1974-04-05 | Benzofuran-5-yl sulphonates and their use on plants |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3896151A (enExample) |
| JP (1) | JPS5029748A (enExample) |
| AU (1) | AU6776774A (enExample) |
| BE (1) | BE813617A (enExample) |
| BG (2) | BG23751A3 (enExample) |
| CS (1) | CS179442B2 (enExample) |
| DD (1) | DD113690A5 (enExample) |
| DE (1) | DE2418293A1 (enExample) |
| FR (1) | FR2226395B1 (enExample) |
| GB (1) | GB1462375A (enExample) |
| IL (1) | IL44593A0 (enExample) |
| NL (1) | NL7405091A (enExample) |
| ZA (1) | ZA742209B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4188202A (en) * | 1975-11-12 | 1980-02-12 | Fisons Limited | Composition |
| JPS6033847B2 (ja) * | 1977-09-20 | 1985-08-05 | 清平 石綿 | ポリウレタン手袋製造用ポリウレタン溶液の製造法 |
| WO1980000447A1 (en) * | 1978-08-21 | 1980-03-20 | Grow Group Inc | Aqueous dispersion coating composition and application to molded articles |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3689507A (en) * | 1969-05-20 | 1972-09-05 | Tysons Ltd | 2-organyloxy-2,3-dihydro-5-benzofuranyl esters of alkyl sulfonic acids |
-
1973
- 1973-04-17 GB GB1839573A patent/GB1462375A/en not_active Expired
-
1974
- 1974-04-05 ZA ZA00742209A patent/ZA742209B/xx unknown
- 1974-04-09 IL IL44593A patent/IL44593A0/xx unknown
- 1974-04-10 AU AU67767/74A patent/AU6776774A/en not_active Expired
- 1974-04-11 BE BE143116A patent/BE813617A/xx unknown
- 1974-04-11 US US460150A patent/US3896151A/en not_active Expired - Lifetime
- 1974-04-16 FR FR7413134A patent/FR2226395B1/fr not_active Expired
- 1974-04-16 CS CS7400002729A patent/CS179442B2/cs unknown
- 1974-04-16 DE DE2418293A patent/DE2418293A1/de active Pending
- 1974-04-16 NL NL7405091A patent/NL7405091A/xx unknown
- 1974-04-17 BG BG028091A patent/BG23751A3/xx unknown
- 1974-04-17 DD DD177956A patent/DD113690A5/xx unknown
- 1974-04-17 BG BG26438A patent/BG22057A3/xx unknown
- 1974-04-17 JP JP49042340A patent/JPS5029748A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1462375A (en) | 1977-01-26 |
| DD113690A5 (enExample) | 1975-06-20 |
| FR2226395B1 (enExample) | 1978-08-04 |
| IL44593A0 (en) | 1974-06-30 |
| BG22057A3 (enExample) | 1976-11-25 |
| CS179442B2 (en) | 1977-10-31 |
| BG23751A3 (en) | 1977-10-12 |
| NL7405091A (enExample) | 1974-10-21 |
| US3896151A (en) | 1975-07-22 |
| BE813617A (fr) | 1974-10-11 |
| DE2418293A1 (de) | 1974-11-07 |
| FR2226395A1 (enExample) | 1974-11-15 |
| JPS5029748A (enExample) | 1975-03-25 |
| AU6776774A (en) | 1975-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA722892B (en) | Artificial tendon | |
| IL48141A0 (en) | New acyldiamines and their preparation | |
| EG10809A (en) | 2-cyano-2-hydroxyiminoacetamides and acetates as plant disease control agents | |
| NL7410244A (nl) | Verknoopt fluorelastomeer alsmede fluorelasto- meerpreparaat. | |
| IL42504A0 (en) | Prosthetics | |
| PH9532A (en) | Trifluoromethylmercapto-acetamidocephalosporins and composition thereof | |
| AU2427871A (en) | Artificial aquarium plant | |
| GB1362737A (en) | Pruner | |
| IL43589A0 (en) | Novel omega-pentanorprostaglandis and their preparation | |
| IL42072A (en) | Dibenzfuran and dienzothiophene deribatives | |
| IL41227A0 (en) | Substituted 1-chromonyloxy-2-hydroxy-3-phenoxypropanes and their preparation | |
| GB1406622A (en) | Cyclopentanecarboxaldehydes and acetals thereof | |
| IL44959A (en) | -acylureido-cephalosporins and their preparation | |
| IL50308A0 (en) | Novel lactones and their preparation | |
| KE2878A (en) | New hydroxyridine carbamates and their use as insecticides | |
| IL43788A0 (en) | Novel phthalides and their preparation | |
| GB1435261A (en) | Substituted benzofurans | |
| IL49763A0 (en) | Novel 9,11-epoxy-pregnadienes and their preparation | |
| ZA742209B (en) | Benzofuran-5-yl sulphonates and their use on plants | |
| AU4943872A (en) | Plants | |
| IL48935A0 (en) | 5-hydroxy-1-amino-hydantoin and its preparation | |
| ZA74536B (en) | Turbo-engine | |
| ZA718002B (en) | Plant growth modification | |
| IL40441A0 (en) | Substituted trithiophosphonates and their use as insecticides | |
| IE37768B1 (en) | Oxazolopyridines and thiazolopyridines |