ZA734779B - Dichlorobenzaldehyde-oxime carbonates - Google Patents
Dichlorobenzaldehyde-oxime carbonatesInfo
- Publication number
- ZA734779B ZA734779B ZA734779A ZA734779A ZA734779B ZA 734779 B ZA734779 B ZA 734779B ZA 734779 A ZA734779 A ZA 734779A ZA 734779 A ZA734779 A ZA 734779A ZA 734779 B ZA734779 B ZA 734779B
- Authority
- ZA
- South Africa
- Prior art keywords
- dichlorobenzaldehyde
- oxime carbonates
- oxime
- carbonates
- Prior art date
Links
- MAHBCPNDAJEESI-UHFFFAOYSA-N OC(O)=O.ON=CC1=CC=CC(Cl)=C1Cl Chemical class OC(O)=O.ON=CC1=CC=CC(Cl)=C1Cl MAHBCPNDAJEESI-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C249/00—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C249/04—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton of oximes
- C07C249/12—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton of oximes by reactions not involving the formation of oxyimino groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2234816A DE2234816A1 (de) | 1972-07-13 | 1972-07-13 | Dichlorbenzaldehydoximcarbonate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA734779B true ZA734779B (en) | 1974-06-26 |
Family
ID=5850707
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA734779A ZA734779B (en) | 1972-07-13 | 1973-07-13 | Dichlorobenzaldehyde-oxime carbonates |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3890385A (enFirst) |
| JP (1) | JPS5249470B2 (enFirst) |
| KR (1) | KR780000551B1 (enFirst) |
| AR (1) | AR206294A1 (enFirst) |
| AT (1) | AT325890B (enFirst) |
| AU (1) | AU474704B2 (enFirst) |
| BE (1) | BE802327A (enFirst) |
| CA (1) | CA1001162A (enFirst) |
| CH (1) | CH582660A5 (enFirst) |
| CS (1) | CS178890B2 (enFirst) |
| DD (1) | DD105709A5 (enFirst) |
| DE (1) | DE2234816A1 (enFirst) |
| DK (1) | DK133873C (enFirst) |
| ES (1) | ES415670A1 (enFirst) |
| FR (1) | FR2193010B1 (enFirst) |
| GB (1) | GB1435756A (enFirst) |
| HU (1) | HU169626B (enFirst) |
| IL (1) | IL42626A (enFirst) |
| IT (1) | IT994943B (enFirst) |
| NL (1) | NL7309772A (enFirst) |
| RO (1) | RO68552A (enFirst) |
| SU (2) | SU474140A3 (enFirst) |
| ZA (1) | ZA734779B (enFirst) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1509034A (en) * | 1975-06-30 | 1978-04-26 | Shell Int Research | Herbicides |
| JPS5633020U (enFirst) * | 1979-08-21 | 1981-04-01 | ||
| US5276187A (en) * | 1991-08-23 | 1994-01-04 | Alliedsignal Inc. | Ketoxime carbonates and process for the synthesis of ketoxime carbonates generally |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH399823A (de) * | 1959-04-28 | 1965-09-30 | Philips Nv | Mittel zur Beeinflussung des Wachstums von Pflanzen |
| US3644524A (en) * | 1967-11-30 | 1972-02-22 | Gulf Research Development Co | Combating weeds with o-acyl-3 5-dialkyl-4-hydroxybenzaldoximes |
| US3732306A (en) * | 1970-07-02 | 1973-05-08 | Stauffer Chemical Co | Certain oxime esters and their use as acaricides and in controlling fungi and bacteria |
-
1972
- 1972-07-13 DE DE2234816A patent/DE2234816A1/de not_active Withdrawn
-
1973
- 1973-01-01 AR AR249056A patent/AR206294A1/es active
- 1973-05-07 SU SU1952296A patent/SU474140A3/ru active
- 1973-05-07 SU SU1915351A patent/SU555827A3/ru active
- 1973-05-16 DK DK272173A patent/DK133873C/da active
- 1973-06-07 ES ES415670A patent/ES415670A1/es not_active Expired
- 1973-06-28 US US374496A patent/US3890385A/en not_active Expired - Lifetime
- 1973-06-29 IL IL42626A patent/IL42626A/en unknown
- 1973-07-04 CH CH974273A patent/CH582660A5/xx not_active IP Right Cessation
- 1973-07-04 AU AU57712/73A patent/AU474704B2/en not_active Expired
- 1973-07-05 DD DD172080A patent/DD105709A5/xx unknown
- 1973-07-09 GB GB3251973A patent/GB1435756A/en not_active Expired
- 1973-07-09 CA CA175,973A patent/CA1001162A/en not_active Expired
- 1973-07-11 AT AT610673A patent/AT325890B/de not_active IP Right Cessation
- 1973-07-12 HU HUSC437A patent/HU169626B/hu unknown
- 1973-07-12 CS CS7300005017A patent/CS178890B2/cs unknown
- 1973-07-12 FR FR7325545A patent/FR2193010B1/fr not_active Expired
- 1973-07-13 BE BE133467A patent/BE802327A/xx unknown
- 1973-07-13 IT IT26585/73A patent/IT994943B/it active
- 1973-07-13 JP JP48079205A patent/JPS5249470B2/ja not_active Expired
- 1973-07-13 ZA ZA734779A patent/ZA734779B/xx unknown
- 1973-07-13 NL NL7309772A patent/NL7309772A/xx not_active Application Discontinuation
- 1973-07-13 KR KR7301136A patent/KR780000551B1/ko not_active Expired
- 1973-07-13 RO RO7375460A patent/RO68552A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2193010B1 (enFirst) | 1976-11-12 |
| CA1001162A (en) | 1976-12-07 |
| AT325890B (de) | 1975-11-10 |
| IL42626A0 (en) | 1973-08-29 |
| DK133873B (da) | 1976-08-02 |
| HU169626B (enFirst) | 1976-12-28 |
| GB1435756A (en) | 1976-05-12 |
| BE802327A (fr) | 1974-01-14 |
| DK133873C (da) | 1976-12-27 |
| IT994943B (it) | 1975-10-20 |
| SU555827A3 (ru) | 1977-04-25 |
| KR780000551B1 (en) | 1978-11-08 |
| AR206294A1 (es) | 1976-07-15 |
| US3890385A (en) | 1975-06-17 |
| DD105709A5 (enFirst) | 1974-05-12 |
| AU5771273A (en) | 1975-01-09 |
| JPS5249470B2 (enFirst) | 1977-12-17 |
| CH582660A5 (enFirst) | 1976-12-15 |
| DE2234816A1 (de) | 1974-01-31 |
| JPS4942643A (enFirst) | 1974-04-22 |
| NL7309772A (enFirst) | 1974-01-15 |
| RO68552A (ro) | 1981-09-24 |
| AU474704B2 (en) | 1976-07-29 |
| CS178890B2 (en) | 1977-10-31 |
| ATA610673A (de) | 1975-01-15 |
| ES415670A1 (es) | 1976-01-16 |
| FR2193010A1 (enFirst) | 1974-02-15 |
| SU474140A3 (ru) | 1975-06-14 |
| IL42626A (en) | 1976-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS609973A2 (en) | Nosic informace | |
| CS283873A2 (en) | Zpusob rafinace tavenin zeleznych kovu | |
| GB1405253A (en) | 1- 2-substituted-chromonyloxy-w-hydroxy-3-phenoxy-propanes | |
| AU6329873A (en) | Flameprofing | |
| GB1407713A (en) | 2-alkoxy-cephalosporins | |
| AU5993373A (en) | N-sulphenylated carbamidoximes | |
| AU6362373A (en) | N-propargylacetanilide herbicedes | |
| GB1402226A (en) | 3-cyanochromones | |
| GB1401579A (en) | Indolo-quinolizines | |
| GB1408010A (en) | Sulphamoylphenyl-imidazolidinones | |
| IL41663A0 (en) | Cyano-phenyl carbonates | |
| GB1401735A (en) | Imino-lactams | |
| AU5711073A (en) | Benzenesulfonyl-ureas benzenesulfonyl-ureas | |
| AU5233473A (en) | Nitro-imidazolyl-pyrimidines | |
| AU5191873A (en) | Benzylpyrimidines | |
| AU6332973A (en) | Bulbholders | |
| IL42626A0 (en) | Dichlorobenzaldehyde-oxime carbonates | |
| GB1400667A (en) | 4-spirocyclopropyl-androstenes | |
| AU5983773A (en) | Alkylsulphonyl-2-trifluoromethyl-benzimidazoles | |
| GB1415691A (en) | Bracks | |
| GB1405254A (en) | Bis- substituted-henoxy- propanes | |
| GB1402045A (en) | 11-o-methanesulphonylerythromycins | |
| HK10479A (en) | Weatherbar | |
| AU5900173A (en) | Thiazolopyrimidines | |
| AU6379973A (en) | Goniolens |