ZA721148B - 1-hydroxyanthraquinone aquatic herbicide - Google Patents
1-hydroxyanthraquinone aquatic herbicideInfo
- Publication number
- ZA721148B ZA721148B ZA721148A ZA721148A ZA721148B ZA 721148 B ZA721148 B ZA 721148B ZA 721148 A ZA721148 A ZA 721148A ZA 721148 A ZA721148 A ZA 721148A ZA 721148 B ZA721148 B ZA 721148B
- Authority
- ZA
- South Africa
- Prior art keywords
- hydroxyanthraquinone
- aquatic herbicide
- herbicide
- aquatic
- hydroxyanthraquinone aquatic
- Prior art date
Links
- BTLXPCBPYBNQNR-UHFFFAOYSA-N 1-hydroxyanthraquinone Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2O BTLXPCBPYBNQNR-UHFFFAOYSA-N 0.000 title 2
- 230000002363 herbicidal effect Effects 0.000 title 1
- 239000004009 herbicide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C66/00—Quinone carboxylic acids
- C07C66/02—Anthraquinone carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US12152071A | 1971-03-05 | 1971-03-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA721148B true ZA721148B (en) | 1972-10-25 |
Family
ID=22397219
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA721148A ZA721148B (en) | 1971-03-05 | 1972-02-21 | 1-hydroxyanthraquinone aquatic herbicide |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS5231011B1 (cg-RX-API-DMAC10.html) |
| BE (1) | BE780206A (cg-RX-API-DMAC10.html) |
| CA (1) | CA974520A (cg-RX-API-DMAC10.html) |
| CH (1) | CH566718A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2210654A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2128591B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1382721A (cg-RX-API-DMAC10.html) |
| IL (1) | IL38840A0 (cg-RX-API-DMAC10.html) |
| IT (1) | IT953441B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7202877A (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA721148B (cg-RX-API-DMAC10.html) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0134198A1 (de) * | 1983-08-10 | 1985-03-13 | Ciba-Geigy Ag | Verwendung von Chinonderivaten zum Schützen von Kulturpflanzen vor der phytotoxischen Wirkung von Herbiziden |
| DE4301424A1 (de) * | 1993-01-20 | 1994-07-21 | Basf Ag | Derivate des Azaanthrachinons und des Azaxanthons und diese enthaltende Herbizide und Pflanzenwachstumsregulatoren |
| JP6432766B2 (ja) * | 2014-09-17 | 2018-12-05 | 川崎化成工業株式会社 | 光ラジカル重合開始剤 |
| WO2023281509A1 (en) | 2021-07-08 | 2023-01-12 | Agrematch Ltd. | Herbicidal compositions |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1263352A (en) * | 1969-06-25 | 1972-02-09 | Ici Ltd | Quinone carbamates and their use as pesticides |
-
1972
- 1972-02-18 CA CA135,081A patent/CA974520A/en not_active Expired
- 1972-02-21 ZA ZA721148A patent/ZA721148B/xx unknown
- 1972-02-21 GB GB790872A patent/GB1382721A/en not_active Expired
- 1972-02-25 IL IL38840A patent/IL38840A0/xx unknown
- 1972-03-02 CH CH304172A patent/CH566718A5/xx not_active IP Right Cessation
- 1972-03-03 FR FR7207487A patent/FR2128591B1/fr not_active Expired
- 1972-03-03 NL NL7202877A patent/NL7202877A/xx unknown
- 1972-03-03 JP JP47022685A patent/JPS5231011B1/ja active Pending
- 1972-03-03 BE BE780206A patent/BE780206A/xx unknown
- 1972-03-04 IT IT21447/72A patent/IT953441B/it active
- 1972-03-06 DE DE19722210654 patent/DE2210654A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| BE780206A (fr) | 1972-09-04 |
| IL38840A0 (en) | 1972-04-27 |
| JPS5231011B1 (cg-RX-API-DMAC10.html) | 1977-08-12 |
| CH566718A5 (cg-RX-API-DMAC10.html) | 1975-09-30 |
| FR2128591B1 (cg-RX-API-DMAC10.html) | 1976-06-11 |
| GB1382721A (en) | 1975-02-05 |
| DE2210654A1 (de) | 1972-09-21 |
| NL7202877A (cg-RX-API-DMAC10.html) | 1972-09-07 |
| CA974520A (en) | 1975-09-16 |
| IT953441B (it) | 1973-08-10 |
| FR2128591A1 (cg-RX-API-DMAC10.html) | 1972-10-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5265085A (en) | Animal food | |
| ZA722519B (en) | Herbicide compositions | |
| JPS5678565A (en) | Animal food | |
| IL38669A0 (en) | Insecticidal device | |
| HK57176A (en) | Grooming implement | |
| ZA72741B (en) | Herbicidal n-acyl-biscarbamates | |
| PH10302A (en) | Carbamoyloxymino-azolidines as pesticides | |
| HK57076A (en) | Grooming implements | |
| ZA723587B (en) | Herbicides | |
| ZA724151B (en) | Herbicide | |
| BG23894A3 (en) | Herbicide | |
| EG10580A (en) | Malogeno-acetanilides as herbicides | |
| GB1401279A (en) | Pesticides | |
| EG10705A (en) | Herbicidal allophanimidates | |
| ZA721148B (en) | 1-hydroxyanthraquinone aquatic herbicide | |
| GB1401987A (en) | Cyanoalkylamino-s-triazines as herbicides | |
| CS180602B2 (en) | Herbicidal agent | |
| ZA722840B (en) | Herbicidal methylphenylcarbamates | |
| ZA721797B (en) | Herbicidal agents | |
| CS191164B2 (en) | Herbicide means | |
| ZA721216B (en) | Insecticidal agents | |
| ZA724000B (en) | Herbicides | |
| ZA72660B (en) | Agricultural implement | |
| MY7600046A (en) | Herbicide | |
| ZA725840B (en) | Herbicides |