ZA713537B - Quinolinecarboxylic acid derivatives - Google Patents
Quinolinecarboxylic acid derivativesInfo
- Publication number
- ZA713537B ZA713537B ZA713537A ZA713537A ZA713537B ZA 713537 B ZA713537 B ZA 713537B ZA 713537 A ZA713537 A ZA 713537A ZA 713537 A ZA713537 A ZA 713537A ZA 713537 B ZA713537 B ZA 713537B
- Authority
- ZA
- South Africa
- Prior art keywords
- acid derivatives
- quinolinecarboxylic acid
- quinolinecarboxylic
- derivatives
- acid
- Prior art date
Links
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical class C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/04—Ortho- or peri-condensed ring systems
- C07D221/06—Ring systems of three rings
- C07D221/16—Ring systems of three rings containing carbocyclic rings other than six-membered
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/87—Benzo [c] furans; Hydrogenated benzo [c] furans
- C07D307/88—Benzo [c] furans; Hydrogenated benzo [c] furans with one oxygen atom directly attached in position 1 or 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/87—Benzo [c] furans; Hydrogenated benzo [c] furans
- C07D307/89—Benzo [c] furans; Hydrogenated benzo [c] furans with two oxygen atoms directly attached in positions 1 and 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Filling Or Emptying Of Bunkers, Hoppers, And Tanks (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702030899 DE2030899A1 (de) | 1970-06-18 | 1970-06-18 | Chinolincarbonsäurederivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA713537B true ZA713537B (en) | 1972-01-26 |
Family
ID=5774701
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA713537A ZA713537B (en) | 1970-06-18 | 1971-06-01 | Quinolinecarboxylic acid derivatives |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3773769A (enExample) |
| AT (1) | AT303022B (enExample) |
| BE (1) | BE768697A (enExample) |
| CH (1) | CH561215A5 (enExample) |
| CS (1) | CS159276B2 (enExample) |
| DE (1) | DE2030899A1 (enExample) |
| DK (1) | DK130681B (enExample) |
| ES (1) | ES392290A1 (enExample) |
| FR (1) | FR2100775B1 (enExample) |
| GB (1) | GB1357449A (enExample) |
| IL (1) | IL37019A (enExample) |
| NL (1) | NL7108363A (enExample) |
| NO (1) | NO134116C (enExample) |
| SE (1) | SE362646B (enExample) |
| ZA (1) | ZA713537B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795265A (fr) * | 1972-02-09 | 1973-08-09 | Philips Nv | Nouveaux derives de quinoleine a activite pharmacologique |
| DE2222833A1 (de) * | 1972-05-10 | 1973-11-29 | Boehringer Mannheim Gmbh | Cyclopenteno-chinolonderivate und verfahren zur herstellung derselben |
| JPS5443000B2 (enExample) * | 1972-07-14 | 1979-12-17 | ||
| US4008237A (en) * | 1972-07-14 | 1977-02-15 | Sumitomo Chemical Company, Limited | 2,3,5,8-Tetrahydro-5-alkoxy-8-oxofuro(2,3-g)quinoline-7-carboxylic acid derivatives |
| DE2530412A1 (de) * | 1975-07-04 | 1977-01-20 | Schering Ag | Chinolincarbonsaeurederivate ii |
| US4474787A (en) * | 1977-05-04 | 1984-10-02 | Fisons Limited | 7,6 Dioxo-4H,6H-pyrano[3,2-g]quinoline dicarboxylic acids and anti-allergic use thereof |
| JPS54163596A (en) * | 1978-06-09 | 1979-12-26 | Daiichi Seiyaku Co | Flonaphlizine derivative |
| CA2382413A1 (en) | 1999-08-20 | 2001-03-01 | Shigenori Ohkawa | Tricyclic dihydrobenzofuran derivatives, process for preparing thereof and agent |
| AU2011235069B2 (en) * | 2010-04-02 | 2016-03-17 | Senomyx, Inc. | Sweet flavor modifier |
| RU2617700C2 (ru) | 2011-08-12 | 2017-04-26 | Синомикс, Инк. | Производные 4-аминохинолин-3-карбоновой кислоты и содержащие их композиции для усиления сладкого вкуса |
| BR112017008738B1 (pt) | 2014-11-07 | 2021-06-15 | Firmenich Incorporated | Ácidos 4-amino-5-(ciclohexilóxi)quinolina-3-carboxílicos substituídos como modificadores de sabores adoçantes |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3313818A (en) * | 1965-04-14 | 1967-04-11 | Sterling Drug Inc | 7, 10-dihydro-3, 10-dioxo-7-(lower-alkyl)-3h-pyrano[3, 2-f]quinoline-3-carboxylic acid derivatives |
| FR1597422A (enExample) * | 1968-07-18 | 1970-06-29 | ||
| US3506667A (en) * | 1969-05-01 | 1970-04-14 | Warner Lambert Pharmaceutical | Furo quinoline carboxylates |
-
1970
- 1970-06-18 DE DE19702030899 patent/DE2030899A1/de not_active Ceased
-
1971
- 1971-05-06 CS CS330871A patent/CS159276B2/cs unknown
- 1971-06-01 ZA ZA713537A patent/ZA713537B/xx unknown
- 1971-06-07 DK DK275471AA patent/DK130681B/da unknown
- 1971-06-08 AT AT497171A patent/AT303022B/de not_active IP Right Cessation
- 1971-06-10 IL IL37019A patent/IL37019A/xx unknown
- 1971-06-15 US US00153406A patent/US3773769A/en not_active Expired - Lifetime
- 1971-06-15 GB GB2800671A patent/GB1357449A/en not_active Expired
- 1971-06-16 ES ES392290A patent/ES392290A1/es not_active Expired
- 1971-06-17 SE SE07890/71A patent/SE362646B/xx unknown
- 1971-06-17 NO NO2279/71A patent/NO134116C/no unknown
- 1971-06-17 FR FR7121991A patent/FR2100775B1/fr not_active Expired
- 1971-06-17 NL NL7108363A patent/NL7108363A/xx unknown
- 1971-06-18 BE BE768697A patent/BE768697A/xx unknown
- 1971-06-18 CH CH897671A patent/CH561215A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SU399121A3 (enExample) | 1973-09-27 |
| SE362646B (enExample) | 1973-12-17 |
| DE2030899A1 (de) | 1971-12-23 |
| IL37019A0 (en) | 1971-08-25 |
| NO134116C (enExample) | 1976-08-18 |
| DK130681B (da) | 1975-03-24 |
| AT303022B (de) | 1972-11-10 |
| FR2100775A1 (enExample) | 1972-03-24 |
| CH561215A5 (enExample) | 1975-04-30 |
| GB1357449A (en) | 1974-06-19 |
| DK130681C (enExample) | 1975-09-01 |
| NO134116B (enExample) | 1976-05-10 |
| NL7108363A (enExample) | 1971-12-21 |
| FR2100775B1 (enExample) | 1974-08-30 |
| CS159276B2 (enExample) | 1974-12-27 |
| IL37019A (en) | 1975-04-25 |
| ES392290A1 (es) | 1973-11-16 |
| US3773769A (en) | 1973-11-20 |
| BE768697A (fr) | 1971-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL40521A (en) | 1-heterocyclyl-3-indolealkanoic acid derivatives | |
| ZA714729B (en) | Novel benzcyclobutene derivatives | |
| IE35639B1 (en) | Pyridoquinoline derivatives | |
| AU4847172A (en) | Cycloalkylaminoarylcarboxylic acid derivatives | |
| IL37019A0 (en) | Quinolinecarboxylic acid derivatives | |
| ZA718044B (en) | Triazolobenzodiazepine derivatives | |
| IE37237L (en) | Pyrroleacetic acid derivatives | |
| IL38096A0 (en) | Ergolene derivatives | |
| ZA716894B (en) | Penicillanic acid derivatives | |
| ZA717344B (en) | Nicotinic acid derivatives | |
| ZA71532B (en) | Benzocycloheptaisoquinoline derivatives | |
| PH11791A (en) | Triourea derivatives | |
| PH9332A (en) | 2-chloroethanephosphonic acid derivatives | |
| PH17276A (en) | N-substituted tetrachlorophthalamic acid derivatives | |
| ZA714137B (en) | Indenopyrrole derivatives | |
| GB1405794A (en) | Alpha-thioacetic acid derivatives | |
| PH9376A (en) | Triazolobenzodiazepine 5n-oxide derivatives | |
| ZA713111B (en) | Substituted carbamoyloxyphenylurea derivatives | |
| IL36933A0 (en) | 1-phenoxy-3-amino-propan-2-ol derivatives | |
| ZA715518B (en) | Prostanoic acid derivatives | |
| AU455494B2 (en) | Quinolinecarboxylic acid derivatives | |
| IE35890L (en) | Substituted piperidine-4-carboxylic acid derivatives | |
| AU2986571A (en) | Quinolinecarboxylic acid derivatives | |
| ZA718556B (en) | Pnenylacetic acid derivatives | |
| ZA711487B (en) | 2-amino-imidazol-2-ine derivatives |