ZA706649B - A method for converting cephalosporin c to and organic solvent-soluble derivative and the compound resulting therefrom - Google Patents
A method for converting cephalosporin c to and organic solvent-soluble derivative and the compound resulting therefromInfo
- Publication number
- ZA706649B ZA706649B ZA706649*A ZA706649A ZA706649B ZA 706649 B ZA706649 B ZA 706649B ZA 706649 A ZA706649 A ZA 706649A ZA 706649 B ZA706649 B ZA 706649B
- Authority
- ZA
- South Africa
- Prior art keywords
- organic solvent
- resulting therefrom
- compound resulting
- soluble derivative
- converting cephalosporin
- Prior art date
Links
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N cephalosporin C Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 title 2
- 150000001875 compounds Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/02—Preparation
- C07D501/12—Separation; Purification
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US88603069A | 1969-12-17 | 1969-12-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA706649B true ZA706649B (en) | 1971-06-30 |
Family
ID=25388227
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA706649*A ZA706649B (en) | 1969-12-17 | 1970-09-29 | A method for converting cephalosporin c to and organic solvent-soluble derivative and the compound resulting therefrom |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3739002A (enExample) |
| AT (1) | AT301028B (enExample) |
| BE (1) | BE759064A (enExample) |
| CA (1) | CA968350A (enExample) |
| CH (1) | CH548418A (enExample) |
| CS (1) | CS161893B2 (enExample) |
| DE (1) | DE2056538A1 (enExample) |
| ES (1) | ES385447A1 (enExample) |
| FR (1) | FR2073473B1 (enExample) |
| GB (1) | GB1324419A (enExample) |
| IE (1) | IE34559B1 (enExample) |
| IL (1) | IL35682A (enExample) |
| NL (1) | NL7016789A (enExample) |
| RO (1) | RO56806A (enExample) |
| SU (1) | SU423303A3 (enExample) |
| ZA (1) | ZA706649B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE793037A (fr) * | 1971-12-23 | 1973-06-20 | Fujisawa Pharmaceutical Co | Procede de preparation de derives d'acide 7-acylamino-3-substitue-3-cephem-4-carboxylique et nouveaux produits ainsi obtenus |
| CA1015745A (en) * | 1972-06-27 | 1977-08-16 | Fujisawa Pharmaceutical Co. | 3-substituted-methyl-3-cephem-4-carboxylic acid derivatives and preparation thereof |
| US3943126A (en) * | 1973-11-15 | 1976-03-09 | Eli Lilly And Company | Process for acylating a 7-aminocephalosporin |
| US4283492A (en) * | 1975-06-21 | 1981-08-11 | Fujisawa Pharmaceutical Co., Ltd. | Production of antibiotics WS-3442 A, B, C, D and E, and their acyl derivatives |
| CN109232610B (zh) * | 2018-09-04 | 2020-06-30 | 华北制药河北华民药业有限责任公司 | 一种头孢尼西二苄基乙二胺盐的精制方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB847375A (en) * | 1956-02-21 | 1960-09-07 | Nat Res Dev | A process for the production of derivatives of cephalosporin c |
| US3227709A (en) * | 1961-11-28 | 1966-01-04 | Merck & Co Inc | Derivatives of cephalosporin c and process |
-
0
- BE BE759064D patent/BE759064A/xx unknown
-
1969
- 1969-12-17 US US00886030A patent/US3739002A/en not_active Expired - Lifetime
-
1970
- 1970-09-29 ZA ZA706649*A patent/ZA706649B/xx unknown
- 1970-10-02 CA CA094,658A patent/CA968350A/en not_active Expired
- 1970-10-02 IE IE1272/70A patent/IE34559B1/xx unknown
- 1970-10-12 GB GB4832070A patent/GB1324419A/en not_active Expired
- 1970-10-19 SU SU1484891A patent/SU423303A3/ru active
- 1970-11-11 ES ES385447A patent/ES385447A1/es not_active Expired
- 1970-11-13 RO RO64969A patent/RO56806A/ro unknown
- 1970-11-16 NL NL7016789A patent/NL7016789A/xx unknown
- 1970-11-16 AT AT1030470A patent/AT301028B/de not_active IP Right Cessation
- 1970-11-16 CH CH1695670A patent/CH548418A/xx not_active IP Right Cessation
- 1970-11-16 CS CS7717A patent/CS161893B2/cs unknown
- 1970-11-17 DE DE19702056538 patent/DE2056538A1/de active Pending
- 1970-11-17 FR FR7041175A patent/FR2073473B1/fr not_active Expired
- 1970-11-17 IL IL35682A patent/IL35682A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH548418A (de) | 1974-04-30 |
| IL35682A0 (en) | 1971-01-28 |
| GB1324419A (en) | 1973-07-25 |
| IE34559L (en) | 1971-06-17 |
| RO56806A (enExample) | 1974-07-01 |
| IE34559B1 (en) | 1975-06-11 |
| SU423303A3 (ru) | 1974-04-05 |
| CS161893B2 (enExample) | 1975-06-10 |
| US3739002A (en) | 1973-06-12 |
| BE759064A (fr) | 1971-05-17 |
| AT301028B (de) | 1972-08-25 |
| DE2056538A1 (de) | 1971-06-24 |
| FR2073473B1 (enExample) | 1975-10-10 |
| IL35682A (en) | 1974-05-16 |
| ES385447A1 (es) | 1973-04-16 |
| FR2073473A1 (enExample) | 1971-10-01 |
| NL7016789A (enExample) | 1971-06-21 |
| CA968350A (en) | 1975-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA959277A (en) | Compound power plant | |
| AU4652772A (en) | Organic compounds | |
| CA920809A (en) | Coal converting process | |
| ZM14971A1 (en) | Organic compounds | |
| AU3403671A (en) | Organic compounds | |
| CA934683A (en) | Process for conversion of coal | |
| AU3166471A (en) | Calcogen organic compounds | |
| ZA707662B (en) | Organic compounds | |
| ZA706649B (en) | A method for converting cephalosporin c to and organic solvent-soluble derivative and the compound resulting therefrom | |
| YU36539B (en) | Process for obtaining a cephalosporin compound | |
| ZA715976B (en) | Organic compounds | |
| ZA706287B (en) | Organic compounds | |
| AU3687071A (en) | Organic compounds | |
| BR6915011D0 (pt) | Conversao de ester de sulfocido de penicilina em um ester de desacetil cefalospocina | |
| IE33478L (en) | 6-aminopenicillanic acid derivatives | |
| ZA71932B (en) | Organic compounds | |
| ZA715793B (en) | Organic compounds | |
| ZA71331B (en) | Organic compounds and process | |
| AU3653071A (en) | Organic compounds | |
| AU3216371A (en) | Organic compounds | |
| AU3403771A (en) | Organic compounds | |
| ZA703138B (en) | Production of organic compounds | |
| AU3116571A (en) | Organic compounds | |
| ZA717047B (en) | Organic compounds | |
| MY7300180A (en) | Improved process for the conversion of carbobenzyloxybenzyl penicillin and carboaryloxybenzylpenicillins to carboxybenzylpenicillins |