YU44546B - Process for obtaining benzyl esther 1-/n-(1-etoxi carbonyl-3-oxo-3-phenyl-propyl)-l-alanyl/-l-proline - Google Patents
Process for obtaining benzyl esther 1-/n-(1-etoxi carbonyl-3-oxo-3-phenyl-propyl)-l-alanyl/-l-prolineInfo
- Publication number
- YU44546B YU44546B YU402/86A YU40286A YU44546B YU 44546 B YU44546 B YU 44546B YU 402/86 A YU402/86 A YU 402/86A YU 40286 A YU40286 A YU 40286A YU 44546 B YU44546 B YU 44546B
- Authority
- YU
- Yugoslavia
- Prior art keywords
- etoxi
- esther
- alanyl
- proline
- oxo
- Prior art date
Links
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 title 1
- -1 carbonyl-3-oxo-3-phenyl-propyl Chemical group 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES542440A ES8603405A1 (es) | 1985-04-22 | 1985-04-22 | "procedimiento para la obtencion del ester benzilico de 1-(n-(1--etoxicarbonil-3-oxo-fenilpropil)-l-alanil)-l-prolina". |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| YU40286A YU40286A (en) | 1987-12-31 |
| YU44546B true YU44546B (en) | 1990-08-31 |
Family
ID=8489045
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| YU402/86A YU44546B (en) | 1985-04-22 | 1986-03-17 | Process for obtaining benzyl esther 1-/n-(1-etoxi carbonyl-3-oxo-3-phenyl-propyl)-l-alanyl/-l-proline |
Country Status (3)
| Country | Link |
|---|---|
| CS (1) | CS266584B2 (cs) |
| ES (1) | ES8603405A1 (cs) |
| YU (1) | YU44546B (cs) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR100939598B1 (ko) * | 2004-03-30 | 2010-02-01 | 밀레니엄 파머슈티컬스 인코퍼레이티드 | 붕소산 에스테르와 산 화합물의 합성 |
-
1985
- 1985-04-22 ES ES542440A patent/ES8603405A1/es not_active Expired
-
1986
- 1986-03-17 YU YU402/86A patent/YU44546B/xx unknown
- 1986-04-18 CS CS862860A patent/CS266584B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CS286086A2 (en) | 1989-04-14 |
| CS266584B2 (en) | 1990-01-12 |
| ES542440A0 (es) | 1985-12-16 |
| ES8603405A1 (es) | 1985-12-16 |
| YU40286A (en) | 1987-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB8514002D0 (en) | Process | |
| AU95086S (en) | Clamping support | |
| AU94136S (en) | Penile clamp | |
| AU569358B2 (en) | Positioning and holding apparatus | |
| GB8626274D0 (en) | Hydrometallurgic process | |
| GB8617888D0 (en) | Fermentation process | |
| GB8615562D0 (en) | Aminoalcohols | |
| NO176816C (no) | Fremgangsmåte for fremstilling av en gel og anvendelse av gelen | |
| GB8507606D0 (en) | Process | |
| GB8603732D0 (en) | Cospinning process | |
| GB8508800D0 (en) | Microbiological process | |
| GB8615560D0 (en) | Aminoalcohols | |
| YU44546B (en) | Process for obtaining benzyl esther 1-/n-(1-etoxi carbonyl-3-oxo-3-phenyl-propyl)-l-alanyl/-l-proline | |
| GB2173885B (en) | Combustion apparatus and process | |
| DE3662097D1 (en) | 4-mercaptobenzonitriles and process for their preparation | |
| DE3664473D1 (en) | Epoxysteroid ucy1003 and process for preparing the same | |
| EP0213594A3 (en) | Polymerflood process | |
| DE3661635D1 (en) | Ketosultams and process for their preparation | |
| GB8502682D0 (en) | Clamp apparatus | |
| GB8511168D0 (en) | Process | |
| GB8618869D0 (en) | Pincer device | |
| EG18303A (en) | Process and intermediate for n-(s-3-alkyl-heptanoyl)-d-gamma-glutamyl-glycyl-d-alanine | |
| GB8623070D0 (en) | Biocatalysts | |
| GB8513309D0 (en) | Process | |
| GB8510937D0 (en) | Fermentation apparatus |