WO2016097347A1 - IMIDAZOPYRIDAZINE DERIVATIVES AS ΡΙ3Κβ INHIBITORS - Google Patents
IMIDAZOPYRIDAZINE DERIVATIVES AS ΡΙ3Κβ INHIBITORS Download PDFInfo
- Publication number
- WO2016097347A1 WO2016097347A1 PCT/EP2015/080604 EP2015080604W WO2016097347A1 WO 2016097347 A1 WO2016097347 A1 WO 2016097347A1 EP 2015080604 W EP2015080604 W EP 2015080604W WO 2016097347 A1 WO2016097347 A1 WO 2016097347A1
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- alkyl
- substituents
- mmol
- formula
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 0 Cc(nc12)c(Cc3cccc(*)c3C)[n]1nc(C)cc2N Chemical compound Cc(nc12)c(Cc3cccc(*)c3C)[n]1nc(C)cc2N 0.000 description 6
- QKHJTYGUWNTBPG-UHFFFAOYSA-N CC1OCCN(C)C1 Chemical compound CC1OCCN(C)C1 QKHJTYGUWNTBPG-UHFFFAOYSA-N 0.000 description 2
- SJRJJKPEHAURKC-UHFFFAOYSA-N CN1CCOCC1 Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 2
- GCXKULANKFAPOX-UHFFFAOYSA-N Cc1c(C(F)(F)F)cccc1Cc1c(CO)nc(c(N)c2)[n]1nc2N1CCOCC1 Chemical compound Cc1c(C(F)(F)F)cccc1Cc1c(CO)nc(c(N)c2)[n]1nc2N1CCOCC1 GCXKULANKFAPOX-UHFFFAOYSA-N 0.000 description 2
- XLSZMDLNRCVEIJ-UHFFFAOYSA-N Cc1cnc[nH]1 Chemical compound Cc1cnc[nH]1 XLSZMDLNRCVEIJ-UHFFFAOYSA-N 0.000 description 2
- LXBGSDVWAMZHDD-UHFFFAOYSA-N Cc1ncc[nH]1 Chemical compound Cc1ncc[nH]1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 2
- XBPOMOUXADPZMK-UHFFFAOYSA-N CC(C)(C)Nc1cc(Cl)n[n]2c1nc(C)c2 Chemical compound CC(C)(C)Nc1cc(Cl)n[n]2c1nc(C)c2 XBPOMOUXADPZMK-UHFFFAOYSA-N 0.000 description 1
- IXNZTXZUOWAEGL-UHFFFAOYSA-N CC(C)(C)Nc1cc(Cl)n[n]2c1nc(COC(C)=O)c2Cc1c(C(CC2)CCN2C(OC(C)(C)C)=O)c(F)ccc1 Chemical compound CC(C)(C)Nc1cc(Cl)n[n]2c1nc(COC(C)=O)c2Cc1c(C(CC2)CCN2C(OC(C)(C)C)=O)c(F)ccc1 IXNZTXZUOWAEGL-UHFFFAOYSA-N 0.000 description 1
- CPZQOCYPYGPTMN-XZYGTATASA-N CC(C)(C)OC(N(CC1)CCC1c(c(C(F)(F)F)ccc1)c1Nc1c(C)nc(c(/N=C/N(C)C)c2)[n]1nc2N1CCOCC1)=O Chemical compound CC(C)(C)OC(N(CC1)CCC1c(c(C(F)(F)F)ccc1)c1Nc1c(C)nc(c(/N=C/N(C)C)c2)[n]1nc2N1CCOCC1)=O CPZQOCYPYGPTMN-XZYGTATASA-N 0.000 description 1
- BLTDRVXISGTQRT-UHFFFAOYSA-N CC(C)(C)OC(N(CC1)CCC1c1c(CCl)cccc1C(F)(F)F)=O Chemical compound CC(C)(C)OC(N(CC1)CCC1c1c(CCl)cccc1C(F)(F)F)=O BLTDRVXISGTQRT-UHFFFAOYSA-N 0.000 description 1
- OMBLPQUFCXKNBY-UHFFFAOYSA-N CC(C)(C)OC(N(CC1)Cc2c1c(Nc1c(C)nc(c(N)c3)[n]1nc3N1CCOCC1)ccc2)=O Chemical compound CC(C)(C)OC(N(CC1)Cc2c1c(Nc1c(C)nc(c(N)c3)[n]1nc3N1CCOCC1)ccc2)=O OMBLPQUFCXKNBY-UHFFFAOYSA-N 0.000 description 1
- LKOZIBJSUVQPAI-UHFFFAOYSA-N CC(C)N(CC1)Cc2c1cccc2Cc1c(C)nc(c(N)c2)[n]1nc2N1CCOCC1 Chemical compound CC(C)N(CC1)Cc2c1cccc2Cc1c(C)nc(c(N)c2)[n]1nc2N1CCOCC1 LKOZIBJSUVQPAI-UHFFFAOYSA-N 0.000 description 1
- YJHSPWNDAUJKEB-UHFFFAOYSA-N CC(C)N(CC1)Cc2c1cccc2Cc1c(C)nc(c(NC(C)(C)C)c2)[n]1nc2N1CCOCC1 Chemical compound CC(C)N(CC1)Cc2c1cccc2Cc1c(C)nc(c(NC(C)(C)C)c2)[n]1nc2N1CCOCC1 YJHSPWNDAUJKEB-UHFFFAOYSA-N 0.000 description 1
- OEVZSOZFNMWHHK-UHFFFAOYSA-N CC(c(nc1c(-c2c[nH]cn2)c2)c(Cc3c(C)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1)O Chemical compound CC(c(nc1c(-c2c[nH]cn2)c2)c(Cc3c(C)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1)O OEVZSOZFNMWHHK-UHFFFAOYSA-N 0.000 description 1
- NIKPJHALYZMARX-UHFFFAOYSA-N CCC1OCCN(C)C1 Chemical compound CCC1OCCN(C)C1 NIKPJHALYZMARX-UHFFFAOYSA-N 0.000 description 1
- VGTADGNSGCICTA-UHFFFAOYSA-N CN1CC(CO)OCC1 Chemical compound CN1CC(CO)OCC1 VGTADGNSGCICTA-UHFFFAOYSA-N 0.000 description 1
- CSHMCEYIMFSLSS-UHFFFAOYSA-N COC(C1(CC1)N)=O Chemical compound COC(C1(CC1)N)=O CSHMCEYIMFSLSS-UHFFFAOYSA-N 0.000 description 1
- VPAQCWYWPZCBAP-KCSSXMTESA-N Cc(nc1c(/N=C/N(C)C)c2)c(Nc3c(CN(CC4)CCC4S(C)(=O)=O)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1 Chemical compound Cc(nc1c(/N=C/N(C)C)c2)c(Nc3c(CN(CC4)CCC4S(C)(=O)=O)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1 VPAQCWYWPZCBAP-KCSSXMTESA-N 0.000 description 1
- JZHHSKXEUSYAAX-WPWMEQJKSA-N Cc(nc1c(/N=C/N(C)C)c2)c(Nc3c(CN4CCOCC4)c(F)ccc3)[n]1nc2N1CCOCC1 Chemical compound Cc(nc1c(/N=C/N(C)C)c2)c(Nc3c(CN4CCOCC4)c(F)ccc3)[n]1nc2N1CCOCC1 JZHHSKXEUSYAAX-WPWMEQJKSA-N 0.000 description 1
- ALEZVPBJEORJKY-UHFFFAOYSA-N Cc(nc1c(C(N)=O)c2)c(Cc3cccc(C)c3C)[n]1nc2N1CCOCC1 Chemical compound Cc(nc1c(C(N)=O)c2)c(Cc3cccc(C)c3C)[n]1nc2N1CCOCC1 ALEZVPBJEORJKY-UHFFFAOYSA-N 0.000 description 1
- AGFMFGYOSGMEBJ-UHFFFAOYSA-N Cc(nc1c(C(N)=O)c2)c(Nc(cccc3)c3N3CCOCC3)[n]1nc2N1CCOCC1 Chemical compound Cc(nc1c(C(N)=O)c2)c(Nc(cccc3)c3N3CCOCC3)[n]1nc2N1CCOCC1 AGFMFGYOSGMEBJ-UHFFFAOYSA-N 0.000 description 1
- XCSMMRSIYDAKAF-UHFFFAOYSA-N Cc(nc1c(I)c2)c(Nc3cccc(C(F)(F)F)c3C)[n]1nc2N1CCOCC1 Chemical compound Cc(nc1c(I)c2)c(Nc3cccc(C(F)(F)F)c3C)[n]1nc2N1CCOCC1 XCSMMRSIYDAKAF-UHFFFAOYSA-N 0.000 description 1
- ZZJLJRLRUJOOBP-UHFFFAOYSA-N Cc(nc1c(N)c2)c(Nc3c(C4C=CNCC4)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1 Chemical compound Cc(nc1c(N)c2)c(Nc3c(C4C=CNCC4)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1 ZZJLJRLRUJOOBP-UHFFFAOYSA-N 0.000 description 1
- CEVHTPZCVXYNBE-UHFFFAOYSA-N Cc(nc1c(N)c2)c(Nc3c(CN(CC4)CCC4S(C)(=O)=O)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1 Chemical compound Cc(nc1c(N)c2)c(Nc3c(CN(CC4)CCC4S(C)(=O)=O)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1 CEVHTPZCVXYNBE-UHFFFAOYSA-N 0.000 description 1
- LABCFLQTWZKPLP-UHFFFAOYSA-N Cc(nc1c(N)c2)c(Nc3c(CN(CC4)CCC4S(C)(O)=O)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1 Chemical compound Cc(nc1c(N)c2)c(Nc3c(CN(CC4)CCC4S(C)(O)=O)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1 LABCFLQTWZKPLP-UHFFFAOYSA-N 0.000 description 1
- PKOUCPVYMIIOIG-UHFFFAOYSA-N Cc(nc1c(N)c2)c(Nc3c(CN4CCOCC4)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1 Chemical compound Cc(nc1c(N)c2)c(Nc3c(CN4CCOCC4)c(C(F)(F)F)ccc3)[n]1nc2N1CCOCC1 PKOUCPVYMIIOIG-UHFFFAOYSA-N 0.000 description 1
- RBPFGYWBLYMGNQ-UHFFFAOYSA-N Cc(nc1c(N)c2)c(Nc3c(CN4CCOCC4)c(F)ccc3)[n]1nc2N1CCOCC1 Chemical compound Cc(nc1c(N)c2)c(Nc3c(CN4CCOCC4)c(F)ccc3)[n]1nc2N1CCOCC1 RBPFGYWBLYMGNQ-UHFFFAOYSA-N 0.000 description 1
- SOLRYQONXSBBDP-UHFFFAOYSA-N Cc1c(C(F)(F)F)cccc1Cc1c(CF)nc(c(I)c2)[n]1nc2N1CCOCC1 Chemical compound Cc1c(C(F)(F)F)cccc1Cc1c(CF)nc(c(I)c2)[n]1nc2N1CCOCC1 SOLRYQONXSBBDP-UHFFFAOYSA-N 0.000 description 1
- SEMWNEYJOCWBSP-UHFFFAOYSA-N Cc1c(CCl)cccc1F Chemical compound Cc1c(CCl)cccc1F SEMWNEYJOCWBSP-UHFFFAOYSA-N 0.000 description 1
- XKVUYEYANWFIJX-UHFFFAOYSA-N Cc1ccn[nH]1 Chemical compound Cc1ccn[nH]1 XKVUYEYANWFIJX-UHFFFAOYSA-N 0.000 description 1
- VROPEPIWPPXEAU-UHFFFAOYSA-N Nc1cc(N2CCOCC2)n[n]2c1nc(CO)c2Cc1c(C2CCN(CCO)CC2)c(C(F)(F)F)ccc1 Chemical compound Nc1cc(N2CCOCC2)n[n]2c1nc(CO)c2Cc1c(C2CCN(CCO)CC2)c(C(F)(F)F)ccc1 VROPEPIWPPXEAU-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/50—Pyridazines; Hydrogenated pyridazines
- A61K31/5025—Pyridazines; Hydrogenated pyridazines ortho- or peri-condensed with heterocyclic ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/18—Drugs for disorders of the alimentary tract or the digestive system for pancreatic disorders, e.g. pancreatic enzymes
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/06—Antiasthmatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/08—Drugs for disorders of the urinary system of the prostate
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/12—Drugs for disorders of the urinary system of the kidneys
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
- A61P15/08—Drugs for genital or sexual disorders; Contraceptives for gonadal disorders or for enhancing fertility, e.g. inducers of ovulation or of spermatogenesis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D519/00—Heterocyclic compounds containing more than one system of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring system not provided for in groups C07D453/00 or C07D455/00
Definitions
- the present invention relates to substituted imidazopyridazine derivatives useful as ⁇ inhibitors.
- the invention further relates to processes for preparing such compounds, pharmaceutical compositions comprising said compounds as an active ingredient as well as the use of said compounds as a medicament.
- PI3Ks phosphoinositide-3-kinases
- class I phosphoinositide-3-kinases are divided into 2 subclasses: class I A , composed of a pi 10 catalytic subunit (pi 10a, pi 10b or pi lOd) and a p85 regulatory subunit (p85a, p55a and p50a, p85b or p55g) and class 1 B PI3K represented by the pi lOg catalytic subunit and the plOl and p84 regulatory subunits [B. Vanhaesebroeck and M.D. Waterfield (1999) Experimental Cell Research., 253, 239-254].
- the class I A PI3Ks are activated in a variety of solid and non-solid tumors via mutation or deletion of the tumor suppressor PTEN (phosphatase and tensin homolog) or in the case of pi 10a by activating mutations [K.D Courtney, R.B. Corcoran and J.A. Engelman (2010), Journal of Clinical Oncology., 28; 1075].
- PI3Ks can also be activated by receptor tyrosine kinases (RTKs); pi 10b can be activated by G-protein coupled receptors [K.D Courtney, R.B. Corcoran and J.A. Engelman (2010), Journal of Clinical Oncology., 28; 1075].
- PTEN antagonizes the activity of the PI3Ks through the
- PIP3 generated by activation of PI3K or sustained by the inactivation of PTEN binds to a subset of lipid-binding domains in downstream targets such as the pleckstrin homology domain of the oncogene Akt thereby recruiting it to the plasma membrane [Stokoe D., Stephens L. R., Copeland T., Gaffney P. R., Reese C. B., Painter G. F, Holmes A. B., McCormick F., Hawkins P. T. (1997) Science 277, 567—570].
- Akt Akt phosphorylates several effector molecules that are involved in numerous biologically relevant processes such as metabolism, differentiation, proliferation, longevity and apoptosis [D. R. Calnan and A. Brunet (2008) Oncogene 27; 2276)].
- the genetic knockout of pi 10b, but not pi 10a is able to block tumor formation and Akt activation driven by Pten loss in the anterior prostate in a mouse model [Jia S, Liu Z, Zhang S, Liu P, Zhang L, Lee SH, Zhang J, Signoretti S, Loda M, Roberts TM, Zhao JJ. Nature 2008; 454:776-9].
- pi 10b may be a target for antithrombotic therapy. It has been reported in mouse models that PBKb inhibition can prevent stable integrin an b 3 adhesion contacts that eliminates occulusive thrombus formation without prolongation of bleed time [S. P. Jackson et al. (2005) Nature Medicine., 11, 507-514].
- PI3K phosphatidylinositol-4,5-bisphosphate 3-kinase
- PCa prostate cancer
- PTEN phosphatase and tensin homolog
- AR androgen receptor
- ⁇ 3 ⁇ inhibitors can be advantageously combined with anti-androgen therapies including androgen receptor antagonists and inhibitors of androgen biosynthesis in PTEN-negative prostate cancers.
- WO 2009/060197 discloses imidazopyridazines for use as protein kinase inhibitors.
- WO 2012/1 16237 discloses heterocyclic entitites that modulate PI3 kinase activity.
- WO 201 1/123751 describes heterocyclic compounds as selective inhibitors of PI3K activity.
- WO 201 1/ 058109 relates to a series of fused bicyclic pyrrole and imidazole derivatives as kinase inhibitors.
- WO 201 1/022439 discloses heterocyclic entities that modulate PI3 kinase activity.
- WO 2008/014219 describes thiozolidinedione derivatives as P13 kinase inhibitors.
- WO 2013/028263 relates to pyrazol opyri m idi ne derivatives as PI3 kinase inhibitors.
- WO 2012/047538 relates to benzimidazole derivatives as PI3 kinase inhibitors.
- WO 2013/095761 relates to imidazopyridine derivatives as PI3 kinase inhibitors.
- US 201 01 57977 relates to benzimidazole b ronic acid derivatives as PI kinase inhibitors.
- WO 2007/038314 discloses heterocyclic compounds useful as kinase modulators.
- WO 2008/030579 describes modulators of IRAK kinase.
- WO 2009/091374 and WO 2008/008539 relate to fused heterocyclic derivatives for prophylaxis and treatment of diseases, such as HGF mediated diseases.
- WO 2014 07821 1 discloses heteroaromatic compounds as PI3 kinase modulators.
- WO 2008/138834 relates to substituted imidazopyridazines as P13K lipid kinase inhibitors.
- WO 2010/007099 describes 2-aminoimidazo[l,2-b]pyridazine derivatives as PI3K inhibitors.
- WO 201 1/047770 discloses py ray ol opyri m i di ne derivatives as PI3K inhibitors.
- the compounds of the present invention are useful as ⁇ 3 ⁇ inhibitors.
- the compounds according to the invention and compositions thereof may be useful for the treatment or prevention, in particular for the treatment, of diseases such as cancer, autoimmune disorders, cardiovascular diseases, inflammatory diseases, neurodegenerative diseases, allergy, pancreatitis, asthma, multiorgan failure, kidney diseases, platelet aggregation, sperm motility, transplantation rejection, graft rejection, lung injuries and the like.
- This invention concerns compounds of Formula (1)
- NIHSO ⁇ -C ⁇ alkyl -N(CH 3 )-C 1 _ 4 alkyl-S0 2 -CH 3 , -NH-Ci_ 4 alkyl-S0 2 -CH 3 , -N(CH 3 )-Ci_ 4 alkyl-OH,
- Y represents -CH 2 - or -NH-
- R 4a represents hydrogen, Ci_ 4 alkyl, Het a , or C 1-4 alkyl substituted with one or more substituents each independently selected from the group consisting of -OH, -NR 5 R 6 and He ;
- R 4 represents hydrogen, halo, Ci -4 alkyl, or C 1-4 alkyl substituted with one or more halo substituents;
- R 4a and R 4b are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a-1 ), (a-2), (a-3), (a-4) or (a-5):
- X represents -NH-, -O- or -N(C ! _ 3 alkyl)-; both R substituents are the same and are selected from the group consisting of hydrogen, fluoro and methyl; or both R 7 substituents are taken together to form together with the common carbon atom to which they are attached a
- R 8 substituents are the same and are selected from the group consisting of
- R 5 represents hydrogen, Ci.galkyl, or C ⁇ ealkyl substituted with one -OH;
- R 6 represents hydrogen, C ⁇ alkyl, or Ci-ealkyl substituted with one -OH;
- Ar represents phenyl optionally substituted with hydroxy
- p 1 or 2;
- the present invention also concerns methods for the preparation of compounds of the present invention and pharmaceutical compositions comprising them.
- the compounds of the present invention were found to inhibit ⁇ 3 ⁇ , and therefore may be useful in the treatment or prevention, in particular in the treatment, of diseases such as cancer, autoimmune disorders, cardiovascular diseases, inflammatory diseases, neurodegenerative diseases, allergy, pancreatitis, asthma, multiorgan failure, kidney diseases, platelet aggregation, sperm motility, transplantation rejection, graft rejection, lung injuries and the like.
- diseases such as cancer, autoimmune disorders, cardiovascular diseases, inflammatory diseases, neurodegenerative diseases, allergy, pancreatitis, asthma, multiorgan failure, kidney diseases, platelet aggregation, sperm motility, transplantation rejection, graft rejection, lung injuries and the like.
- Some of the compounds of the present invention may undergo metabolism to a more active form in vivo (prodrugs).
- the compounds of formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof may be suitable in the treatment or prevention, in particular in the treatment, of cancer.
- the present invention also concerns the use of compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, for the manufacture of a medicament for the inhibition of ⁇ , for the treatment or prevention of cancer.
- di ferent aspects of the invention are defined in more detail. Each aspect so defined may be combined with any other aspect or aspects unless clearly indicated to the contrary. In particular, any feature indicated as being preferred or advantageous may be combined with any other feature or features indicated as being preferred or
- substituted is used in the present invention, it is meant, unless otherwise is indicated or is clear from the context, to indicate that one or more hydrogens, in particular from 1 to 3 hydrogens, preferably 1 or 2 hydrogens, more preferably 1 hydrogen, on the atom or radical indicated in the expression using
- substituted are replaced with a selection from the indicated group, provided that the nonnal valency is not exceeded, and that the substitution results in a chemically stable compound, i.e. a compound that is sufficiently robust to survive isolation to a useful degree of purity from a reaction mixture, and formulation into a therapeutic agent.
- a substituent on a heterocvclyl group may replace any hydrogen atom on a ring carbon atom or on a ring heteroatom.
- Ci- 6 alkyl group contains from 1 to 6 carbon atoms
- C h alky! group contains from 1 to 4 carbon atoms
- Ci--,alkyl group contains from 1 to 3 carbon atom and so on.
- S( / 0 ⁇ . (SCV) or S0 2 represents a sulfonyl moiety.
- halo as a group or part of a group is generic for fluoro. chloro, bromo, iodo unless otherwise is indicated or is clear from the context.
- C h alky! groups comprise from 1 to 6 carbon atoms, preferably from 1 to 4 carbon atoms, more preferably from 1 to 3 carbon atoms, still more preferably 1 to 2 carbon atoms.
- Alky 1 groups may be linear or branched and may be substituted as indicated herein.
- the subscript refers to the number of carbon atoms that the named group may contain.
- alkyl includes all linear, or branched alkyl groups with between I and 6 carbon atoms, and thus includes such as for example methyl, ethyl, ⁇ -propyl, /-propyl, 2-methyl-ethyl, butyl and its isomers (e.g. //-butyl, As'obutyl and /er/ ' -butyl ), pentyl and its isomers, hexyl and its isomers, and the like.
- C h alky! refers to a hydrocarbyl radical of Formula C n H 2n+ i wherein n is a number ranging from 1 to 4.
- C h alky! groups comprise from 1 to 4 carbon atoms, preferably from 1 to 3 carbon atoms, more preferably I to 2 carbon atoms.
- C i -4 alky 1 groups may be linear or branched and may be substituted as indicated herein. When a subscript is used herein following a carbon atom, the subscript refers to the number of carbon atoms that the named group may contain.
- C i- t alkyl includes all linear, or branched alkyl groups with between 1 and 4 carbon atoms, and thus includes methyl, ethyl, //-propyl, /-propyl, 2-methyl-ethyl, butyl and its isomers (e.g. //-butyl, s'obutyl and ter/-butyl), and the like.
- the terra "C h alky! as a group or part of a group refers to a hydrocarbyl radical of Formula C ,,3 ⁇ 4,,+ 1 wherein n is a number ranging from 1 to 3.
- Ci -3 alkyl groups comprise from 1 to 3 carbon atoms, preferably 1 to 2 carbon atoms.
- Ci_ 3 alkyl includes all linear, or branched alkyl groups with between 1 and 3 carbon atoms, and thus includes methyl, ethyl, //-propyl, /-propyl, 2-methyl-ethyl, and the like.
- Examples of a 4-, 5- or 6-membered saturated heterocyclyl containing at least one heteroatom each independently selected from O, S, S( )) and include, but are not limited to azetidinyl, morpholinyl, piperidinyl, pyrrol idinyl, 1 .1 -dioxido-thietanyl, 1, 1 - dioxido-thiomorpholinyl, piperazinyl, dioxolany], oxazolidinyl, oxetanyl,
- Hef may be attached to the remainder of the molecule of Formula (I) through any available ring carbon atom or ring heteroatom as appropriate, if not otherwise specified.
- spiro moieties include, but are not limited to
- subject refers to an animal, preferably a mammal (e.g. cat, dog, primate or human), more preferably a human, who is or has been the object of treatment, observation or experiment.
- a mammal e.g. cat, dog, primate or human
- terapéuticaally effective amount means that amount of active compound or pharmaceutical agent that elicits the biological or medicinal response in a tissue system, animal or human that is being sought by a researcher, veterinarian, medicinal doctor or other clinician, which includes alleviation or reversal of the symptoms of the disease or disorder being treated.
- composition is intended to encompass a product comprising the specified ingredients in the specified amounts, as well as any product which results, directly or indirectly, from combinations of the specified ingredients in the specified amounts.
- treatment is intended to refer to all processes wherein there may be a slowing, interrupting, arresting or stopping of the progression of a disease, but does not necessarily indicate a total elimination of all symptoms.
- compounds of the invention as used herein, is meant to include the compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof.
- substituents may replace, unless otherwise is indicated or is clear from the context, any hydrogen atom bound to a carbon or nitrogen atom of the ring system.
- compound of Formula (1) is meant to include the stereoisomers thereof and the tautomeric forms thereof.
- stereoisomers stereoi som eric forms
- stereochemically isomeric forms hereinbefore or hereinafter are used interchangeably.
- the invention includes all stereoisomers of the compounds of the invention either as a pure stereoisomer or as a mixture of two or more stereoisomers.
- Enantiomers are stereoisomers that are non-superimpo sable mirror images of each other.
- a 1 : 1 mixture of a pair of enantiomers is a racemate or racemic mixture.
- Atropisomers are stereoisomers which have a particular spatial configuration, resulting from a restricted rotation about a single bond, due to large stcric hindrance. All atropisomeric forms of the compounds of Formula (I) are intended to be included within the scope of the present invention.
- Diastereomers are stereoisomers that are not enantiomers, i.e. they are not related as mirror images. If a compound contains a double bond, the substituents may be in the E or the Z configuration. Substituents on bivalent cyclic (partially) saturated radicals may have either the cis- or trans-configuration; for example if a compound contains a di substituted cycle alky 1 group, the substituents may be in the cis or trans configuration. Therefore, the invention includes enantiomers, atropisomers, diastereomers, racemates, E isomers, Z isomers, cis isomers, trans isomers and mixtures thereof, whenever chemically possible.
- the meaning of all those terms, i.e. enantiomers, atropisomers, diastereomers, racemates, E isomers, Z isomers, cis isomers, trans isomers and mixtures thereof are known to the skilled person.
- the absolute configuration is specified according to the Cahn-Ingold-Prelog system.
- the configuration at an asymmetric atom is specified by either R or S.
- Resolved stereoisomers whose absolute configuration is not known can be designated by (+) or (-) depending on the direction in which they rotate plane polarized light.
- resolved enantiomers whose absolute configuration is not known can be designated by (+) or (-) depending on the direction in which they rotate plane polarized light.
- stereoisomer is substantially free, i.e. associated with less than 50%, preferably less than 20%, more preferably less than 10%, even more preferably less than 5%, in particular less than 2% and most preferably less than 1%, of the other stereoisomers.
- thi s means that the compound is substantially free of the (S) isomer
- E when a compound of Formula (I) is for instance specified as E, this means that the compound is substantially free of the Z isomer; when a compound of Formula (I) is for instance specified as cis, this means that the compound is substantially free of the trans isomer.
- Some of the compounds of Formula (1) may also exist in their tautomeric form. Such forms in so far as they may exist, are intended to be included within the scope of the present invention. It follows that a single compound may exist in both stereoisomer ⁇ and tautomeric form.
- salts of the compounds of Formula (I), N-oxides and solvates thereof are those wherein the counterion is pharmaceutically acceptable.
- salts of acids and bases which are non-pharmaceutical ly acceptable may also find use, for example, in the preparation or purification of a pharmaceutically acceptable compound. All salts, whether pharmaceutically acceptable or not are included within the ambit of the present invention.
- the pharmaceutically acceptable addition salts as mentioned hereinabove or hereinafter are meant to comprise the therapeutically active non-toxic acid and base addition salt forms which the compounds of Formula (1), N-oxides and solvates thereof, are able to form.
- the pharmaceutically acceptable acid addition salts can conveniently be obtained by treating the base form with such appropriate acid.
- Appropriate acids comprise, for example, inorganic acids such as hydrohalic acids, e.g. hydrochloric or hydrobroraic acid, sulfuric, nitric, phosphoric and the like acids; or organic acids such as, for example, acetic, propanoic, hydroxyacetic, lactic, pyruvic, oxalic (i.e.
- efhanedioic malonic
- succinic i.e. biitanedioic acid
- maleic funiaric, malic, tartaric, citric, methanesulfonic, ethane sulfonic, benzenesulfonic, p-toluenesulfonic, cyclamic, salicylic, p-aminosalicylic, pamoic and the like acids.
- said salt form can be converted by treatment with an appropriate base into the free base form .
- the compounds of Formula (I), N-oxides and solvates thereof containing an acidic proton may also be converted into their non-toxic metal or amine addition salt forms by treatment with appropriate organic and inorganic bases.
- Appropriate base salt forms comprise, for example, the ammonium salts, the alkali and earth alkaline metal salts, e.g. the lithium, sodium, potassium, magnesium, calcium salts and the like, salts with organic bases, e.g. primary, secondary and tertiary aliphatic and aromatic amines such as methylamine, ethylamine, propylamine, isopropylamine, the four butylamine isomers, dimethy amine, diethylamine, diethanolamine, dipropylamine,
- solvate comprises the hydrates and solvent addition forms which the compounds of Formula (I) arc able to form, as well as N-oxides and pharmaceutically acceptable addition salts thereof. Examples of such forms are e.g. hydrates, alcoholates and the like.
- the compounds of the invention as prepared in the processes described below may be synthesized in the form of mixtures of enantiomers, in particular racemic mixtures of enantiomers, that can be separated from one another following art-known resolution procedures.
- a manner of separating the enantiomeric forms of the compounds of Formula (I), and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof involves liquid chromatography using a chiral stationary phase.
- Said pure stereocliemically isomeric forms may also be derived from the corresponding pure stereocliemically isomeric forms of the appropriate starting materials, provided that the reaction occurs stereospecifically.
- an element in particular when mentioned in relation to a compound of Formula (I), comprises all isotopes and i so topic mixtures of this element, either naturally occurring or synthetically produced, either with natural abundance or in an isotopically enriched form.
- Radiolabelled compounds of Formula (I) comprises all isotopes and i so topic mixtures of this element, either naturally occurring or synthetically produced, either with natural abundance or in an isotopically enriched form.
- (I) may comprise a radioactive isotope selected from the group of ⁇ , H, C, F, 1, m I, l2: 13I I, 3 ⁇ 4r, ,6 Br, "Br and 82 Br.
- the radioactive isotope is selected from the group of 2 H, 3 H, 1 'C and 18 F. More preferably, the radioactive isotope is 2 II.
- deuterated compounds are intended to be included within the scope of the present invention
- the present invention concerns novel compounds of Formula (I), tautomers and stereoisomeric forms thereof, wherein
- Y represents -CH 2 - or -NH-;
- R a represents hydrogen, C 1-4 alkyl, Het a , or C 1-4 alkyl substituted with one or more substituents each independently selected from the group consisting of -OH, -NR 5 R 6 and Kef;
- R 4b represents hydrogen, halo, Ci -4 alkyl, or Ci -4 alkyl substituted with one or more halo substituents;
- R 4a and R C are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a-1 ), (a-2), (a-3), (a-4) or (a-5):
- X represents -NH-, -O- or -N(Ci- 3 alkyl)-;
- R 7 substituents are the same and are selected from the group consisting of
- R 7 substituents are taken together to form together with the common carbon atom to which they are attached a cyclopropyl, cyclobutyl or oxetanyl;
- R s substituents are the same and are selected from the group consisting of
- R 8 substituents are taken together to form together with the common carbon atom to which they are attached a cyclopropyl, cyclobutyl or oxetanyl;
- R 5 represents hydrogen, C 1-6 alkyl, or C ⁇ alkyl substituted with one -OH;
- R 6 represents hydrogen, C 1-6 alkyl, or C ⁇ alkyl substituted with one -OH;
- Ar represents phenyl optionally substituted with hydroxy
- p 1 or 2;
- the present invention concerns novel compounds of Formula (I), tautomers and stereoisomeric forms thereof, wherein
- R represents
- Y represents -CH 2 - or -NH-
- R 4a represents C 1-4 alkyl, Het a , or Ci_ 4 alkyl substituted with one or more substituents each independently selected from the group consisting of -OH, -NR 5 R 6 and He ;
- R 4 represents hydrogen, halo, Ci -4 alkyl, or C 1-4 alkyl substituted with one or more halo substituents;
- R 4a and R 4b are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a-1 ), (a-2), (a-3), (a-4) or (a-5);
- X represents -NH- or -0-
- R 7 substituents are the same and are selected from the group consisting of
- R s substituents are the same and are selected from the group consisting of
- R 5 represents hydrogen, Ci -6 alkyl, or Ci -6 alkyl substituted with one -OH;
- R 6 represents hydrogen, Ci-ealkyl, or C ⁇ alkyl substituted with one -OH;
- Ar represents phenyl optionally substituted with hydroxy
- p 1 or 2;
- the present invention concerns novel compounds of Formula (I), tautomers and stereoisomer ⁇ forms thereof, wherein
- R represents
- Y represents -CH 2 - or -NH-
- R a represents C 1-4 alkyl, Het a , or Ci -4 alkyl substituted with one or more substituents each independently selected from the group consisting of -OH, -NR 5 R 6 and He ;
- R represents hydrogen, halo, Ci ⁇ alkyl, or C ⁇ alkyl substituted with one or more halo substituents;
- R 4a and R 4b are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a-1 ), (a-2), (a-3), (a-4) or (a-5);
- X represents -NH- or -0-
- R substituents are the same and are selected from the group consisting of
- R 8 substituents are the same and are selected from the group consisting of
- R 5 represents hydrogen, C 1-6 alkyl, or C ⁇ alkyl substituted with one -OH;
- R 6 represents hydrogen, Ci-ealkyl, or Ci-ealkyl substituted with one -OH;
- Ar represents phenyl optionally substituted with hydroxy
- p 1 or 2;
- the present invention concerns novel compounds of Formula (I), tautomers and stereoisomer ⁇ forms thereof, wherein
- R q represents -NH 2 ;
- Y represents -CH 2 - or -NH-
- R 4a represents C 1-4 alkyl, Het a , or Ci ⁇ alkyl substituted with one or more substituents each independently selected from the group consisting of -OH, -NR 5 R 6 and
- R represents hydrogen, halo, Ci -4 alkyl, or C 1-4 alkyl substituted with one or more halo substituents
- R 4a and R 4b are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a-2) or (a-4);
- X represents -NH- or -N(C 1-3 alkyl)-
- R 5 represents hydrogen
- R 6 represents Ci-ealkyl substituted with one -OH
- Ar represents phenyl
- p 2;
- the present invention concerns novel compounds of Formula (I), tautomers and stereoisomeric forms thereof, wherein
- R q represents -NH 2 ;
- Y represents -CH 2 - or -NH-
- R 4a represents C 1-4 alkyl, Het a , or Ci -4 alkyl substituted with one or more substituents each independently selected from the group consisting of -OH, -NR 5 R 6 and He ;
- R represents hydrogen, halo, Ci ⁇ alkyl, or C ⁇ alkyl substituted with one or more halo substituents;
- R 4a and R 4b are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a-2) or (a-4);
- X represents -NH-
- R 5 represents hydrogen
- R 6 represents Ci_ 6 alkyl substituted with one -OH
- Ar represents phenyl
- p 2;
- the present invention concerns novel compounds of Formula (I), tautomers and stereoisomeric forms thereof, wherein
- R 1 represents -NH
- R 2 represents ;
- R 3 represents Ci -4 alkyl; -CH(OH)-CH 2 -R q ; or C 1-4 alkyl substituted with one -OH or halo substituent; in particular R 3 represents C ⁇ alkyl; -CH(OH)-CH 2 -R q ; or C 1-4 alkyl substituted with one -OH substituent;
- R q represents -NH 2 ;
- Y represents -CH 2 -;
- R a represents C ⁇ alkyl, or C 1-4 alkyl substituted with one Het substituent;
- R 4 represents halo, or Ci. 4 alkyl substituted with one or more halo substituents
- p 1 or 2;
- the present invention concerns novel compounds of Formula (I), tautomers and stereoisomeric forms thereof wherein
- R represents
- Y represents -CH 2 - or -NH-
- R 4a represents C ⁇ alkyl, or C ⁇ alkyl substituted with one or more Het a substituents
- R 4 represents halo, substituted with one or more halo
- R a and R are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a-2);
- X represents -NH-
- p 2;
- Another embodiment of the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments wherein one or more of the following restrictions apply:
- R q represents -NH 2 ;
- R 4a represents C ⁇ alkyl, Het a , or C 1-4 alkyl substituted with one or more
- R 4 represents hydrogen, halo, Ci_ 4 alkyl, or C 1 _ 4 alkyl substituted with one or more halo substituents;
- R 4a and R 4b are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a-2) or (a-4);
- R 5 represents hydrogen
- R 6 represents Ci_ 6 alkyl substituted with one -OH
- Another embodiment of the present invention relates to those com pounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments wherein one or more of the following restrictions apply:
- R 4a represents Ci -4 alkyl, or C 1-4 alkyl substituted with one or more Het
- R 4 represents halo, substituted with one or more halo
- R 4a and R 4b are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a-2);
- Another embodiment of the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments wherein one or more of the following restrictions apply:
- R 3 represents C ⁇ alkyl; or C h alky! substituted with one -OH substituent; in particular R 3 represents CH 3 or -CH 2 -OH;
- R 4a represents C 1-4 alkyl; in particular R 4a represents methyl;
- R 4 represents Ci- 4 alkyl substituted with one or more halo substituents
- R 4b represents CF 3 .
- Another embodiment of the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments wherein one or more of the following restricti ons apply:
- R 1 represents -NH 2 ;
- R 3 represents C ⁇ alkyl substituted with one -OH substituent; in particular R 3 represents -CH 2 -OH;
- R 4a represents C 1-4 alkyl; in particular R 4a represents methyl;
- R 4b represents substituted with one or more halo substituents
- R 4 represents CF 3 .
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof or any subgroup thereof as mentioned in any of the other embodiments, wherein R 1 represents -NH 2 ;
- R represents
- Y represents -CH 2 -.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R 4a represents hydrogen, Ci- 4 alkyl, or C ⁇ alkyl substituted with one or more
- R 4b represents hydrogen, halo, Ci- 4 alkyl, or Ci ⁇ alkyl substituted with one or more halo substituents.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof or an subgroup thereof as mentioned in any of the other embodiments, wherein R 4a represents C ⁇ alkyl; in particular R 4a represents methyl;
- R 4b represents substituted with one or more halo substituents
- R 4 represents CF 3 .
- the present invention relates to those compounds of Formula (1) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R 4a represents C 1-4 alkyl; in particular R 4a represents methyl.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R 4 represents hydrogen, C ⁇ alkyl, Het a , or Ci ⁇ alkyl substituted with one substituent selected from the group consisting of -OH, -NR 5 R 6 and Het a .
- the present invention relates to those compounds of Formula (1) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R represents Ci ⁇ alkyl substituted with one or more halo substituents;
- R 4 represents CF 3 .
- the present invention relates to those compounds of Formula (1) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R 4a and R 4b are other than hydrogen.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof or any subgroup thereof as mentioned in any of the other embodiments, wherein R 4 and R 4b are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a- 1 ), (a-2), (a-3), (a-4) or (a-5); in particular a structure of Formula (a-2) or (a-4); more in particular a structure of Formula (a-2).
- the present invention relates to those compounds of Formula (1) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereo or any subgroup thereof as mentioned in any of the other embodiments, wherein R 4a represents C ⁇ alkyl, Het a , or Ci -4 alkyl substituted with one or more substituents each independently selected from the group consisting of -OH, -NR 5 R 6 and Het a ; R 4 represents hydrogen, halo, Ci ⁇ alkyl, or C ⁇ alkyl substituted with one or more halo substituents;
- R 4a and R 4b are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a-2) or (a-4).
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned i any of the other embodiments, wherein
- R 4a represents C ⁇ alkyl, Het a , or Ci -4 alkyl substituted with one or more substituents each independently selected from the group consisting of -OH, -NR 5 R 6 and Het a ; R 4 represents C 1-4 alkyl, or substituted with one or more halo substituents.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R 4 represents Ci -4 alkyl, Het a , or Ci -4 alkyl substituted with one or more substituents each independently selected from the group consisting of -OH, -NR 5 R 6 and Het a ; R 4b represents C 1-4 alkyl.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof. or any subgroup thereof as mentioned in any of the other embodiments, wherein R 4a represents C 1-4 alkyl, Het a , or Ci -4 alkyl substituted with one or more substituents each independently selected from the group consisting of -OH, -NR 5 R 6 and Het a ; R 4 represents Ci -4 alkyl, or Ci -4 alkyl substituted with one or more halo substituents; or R 4a and R 4b are taken together to form together with the phenyl ring to which they are attached a structure of Formula (a-2) or (a-4).
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein
- R q represents -OH, or -NH 2 .
- the present invention relates to those compounds of Formula (1) and the N-oxides, the phannaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the ther embodiments, wherein R 3 represents Ci -4 alkyl substituted with one substituent selected from the group consisting of halo, -OH, -NH 3 ⁇ 4 -NH- (S0 2 )-Ci -4 alkyl, -N(CH 3 )-Ci -4 alkyl-S0 2 -CH 3 , -NH-Ci -4 alkyl-S0 2 -CH 3 ,
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodi ments, wherein R 3 represents Ci -4 alkyl substituted with one substituent as defined in any of the other embodiments.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein Y represents - CH 2 -.
- the present invention relates to those compounds of Formula (1) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein Y represents -NI I-.
- the present invention relates to those compounds of Fonnula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof or any subgroup thereof as mentioned in any of the other embodiments, wherein 1 represents
- Y represents Ni l-.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as menti oned in any of the other embodiments, wherein R represents
- the present invention relates to those compounds of Form la (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof or any subgroup thereof as mentioned in any of the other embodiments, wherein R
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or an subgroup thereof as mentioned in any of the other embodiments, wherein R 3 represents C ⁇ alkyl substituted with one -OH substituent; in particular R 3 represents CH 2 -OH.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R 1 represents
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R 1 represents -NH 2 .
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R q represents -OH or -NH 2 ; in particular wherein R represents -NH 2 .
- the present invention relates to those compounds of Formula (1) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as menti oned in any of the other embodiments, wherein
- R 3 represents Ci_ 4 alkyl; or Ci_ 4 alkyl substituted with one substituent selected from the group consisting of halo, -OH, -NH-(S0 2 )-Ci_ 4 alkyl,
- R 3 represents Ci -4 alkyl; or C 1-4 alkyl substituted with one substituent selected from the group consisting of halo, -OH, -N(CI I ;)- €].4alkyl-S0 2 - CH 3 , -NH-Ci -4 alkyl-S0 2 -CH 3 , -N(CH 3 )-C 1-4 alkyl-OH, and -NH-Ci -4 alkyl-OH;
- R 3 represents Ci- alkyl; or Ci- alkyl substituted with one substituent selected from the group consisting of halo and -OH;
- R 3 represents Ci -4 alkyl; or C 1-4 alkyl substituted with one -OH substituent;
- R 3 represents C 1-4 alkyl.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein the following proviso is applicable: when Y represents -Ni l-, then R J represents Ci -4 alkyl, or Ci -4 alkyl substituted with one -OH substituent.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein each Het a independently represents
- p 1 or 2.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein both R 7 substituents are hydrogen; and wherein both R 8 substituents are hydrogen.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein both R 7 substituents are the same and are selected from the group consisting of hydrogen, fluoro and methyl; and wherein
- R 8 substituents are the same and are selected from the group consisting of hydrogen and methyl.
- the present invention relates to a subgroup o Formula (I) and the N- oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, as defined in the general reaction schemes.
- the present invention relates to those compounds of Formula (1) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein I let 1 represents
- Z represents -NH-, -S-, -O- or -S(0) 2 -; in particular Z represents -S(0) 2 -;
- n 0, 1 or 2;
- n 1 or 2; provided however that m does not have value 1 when n is 0.
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as menti oned in any of the other embodiments, wherein Het a represents
- the present invention relates to those compounds of Formula (1) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R 2 represents
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R 2 represents
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R 2 representing
- the present invention relates to those compounds of Formula (I) and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof, or any subgroup thereof as mentioned in any of the other embodiments, wherein R 2 representing imited respectively to
- the compound of Formula (I) is selected from the group consisting of compounds 14, 15, 18, 19, 33, and 35, tautomers and stereoisomenc forms thereof, and the N-oxides, the pharmaceutically acceptable addition salts, and the solvates thereof.
- the compound of Formula (I) is selected from the group consisting of compound 14,
- the compound of Formula (I) is compound 14.
- the compound of Formula (I) is selected from the group consisting of compound 19,
- the compound of Formula (I) is compound 19.
- the compound of Formula (I) is selected from the group consisting of compound 33,
- the compound of Formula (I) is compound 33.
- the compound of Formula (I) is selected from the group consisting of compound 15,
- the compound of Formula (I) is compound 15.
- the compound of Formula (I) is selected from the group consisting of compound 18,
- the compound of Formula (I) is compound 1 8.
- the compound of Formula (I) is selected from the group consisting of compound 35,
- the compound of Formula (I) is compound 35.
- references to Formula (I) also include all other sub-groups and examples thereof as defined herein.
- the protecting groups may be removed at a convenient subsequent stage using methods known from the art.
- reaction work-up refers to the series of manipulations required to isolate and purify the product(s) of a chemical reaction such as for example quenching, column chromatography, extraction).
- microwave heating may be used instead of conventional heating to shorten the overall reaction time.
- C s . y (where x and y are integers) as used herein refers to the number of carbon atoms in a given group.
- Co corresponds to a covalent bond.
- Co-xalkyP as a group or part of a group refers to a covalent bond (Co) and a hydrocarbyl radical of Formula C PainI I-2 n 1 wherein n is a number ranging from 1 to 3.
- a suitable temperature such as for example 90°C, optionally in the presence of a suitable solvent such as for example ⁇ , ⁇ -dimethylformamide or dimethoxy ethane
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 C0 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel;
- a suitable ligand such as 2- dicyclohexylphosphitio-2'.6'-diisopropo ⁇ biphenyl (Ruphos)
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium (Pd 2 dba 3 )
- a suitable base such as for example Cs 2 C0 3
- a suitable solvent such as for example 2- methyl-2-butanol
- R 2 B(OH) 2 or R 2 (4,4,5,5-tetramethyl-l,3,2-dioxaborolane) in the presence of a suitable catalyst such as for example 1.
- a suitable catalyst such as for example 1.
- a suitable ligand such as Ruphos
- a suitable catalyst such as for example Pd 2 dba 3
- a suitable base such as for example Cs 2 C0
- a suitable solvent such as for example 2-methyl-2-butanol
- R 2 B(OH) 2 or R 2 (4,4,5,5-tetramethyl-l ,3,2-dioxaborolane), in the presence of a suitable catalyst such as for example l, l'-bis(diphenylphosphino)ferrocene palladium(II)dichloride dichloromethane adduct, a suitable base such as for example potassium phosphate, and a suitable solvent such as for example dioxane, at a suitable temperature such as for example at 80°C;
- a suitable catalyst such as for example l, l'-bis(diphenylphosphino)ferrocene palladium(II)dichloride dichloromethane adduct, a suitable base such as for example potassium phosphate, and a suitable solvent such as for example dioxane, at a suitable temperature such as for example at 80°C;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as for example triphenylphosphine, a suitable base such as for example K 2 C0 3 , and a suitable solvent such as for example dioxane, at a suitable temperature such as for example at 100°C, optionally in a sealed vessel;
- a suitable base such as for example lithium diisopropyl amide, and a suitable solvent such as for example tetrahydrofuran (THF), at a suitable temperature such as for example at -70°C
- a suitable base such as for example lithium diisopropylamide, a suitable source of carbon dioxide such as for example dry ice, and a suitable solvent such as for example THF, at a suitable temperature such as for example at -70°C
- THF tetrahydrofuran
- a suitable catalyst such as for example hydrido(dimethylphosphinous acid-kP)[hydrogen bis(dimethylphosphinito- kP)]platinum(II), and a suitable solvent or a mixture of solvents such as for example a mixture of THF/water, at a suitable temperature such as for example at 95°C;
- a suitable catalyst such as for example Pd(PPh 3 )4, a suitable base such as for example triethylamine (Et 3 N), and a suitable solvent such as for example methanol or ethanol, at a suitable temperature such as for example at 100°C or 120°C
- a suitable solvent such as for example methanol or ethanol, at a suitable temperature such as for example at 100°C or 120°C
- 1 1 in a suitable solvent such as for example methanol, at a suitable temperature such as for example at 65°C, in a sealed vessel;
- a suitable base such as lithium hydroxide monohydrate, and a suitable solvent or a mixture of solvents such as for example a mixture of THF/water or methanol/water;
- a suitable acid such as for example hydrochloric acid
- a suitable solvent such as for example THF
- a suitable peptidic coupling reagent such as 1- [bis(dimethylamino)methylene]-lH-[l,2,3]triazolo[4,5-b]pyridin-l-ium 3-oxide hexafluoro phosphate (HATU), in the presence of a suitable base such as for example diisopropylamine, and a suitable solvent such as for example DMF;
- a suitable catalyst such as for example Pd(PPh 3 )4, a suitable base such as for example an aqueous solution of Na 2 C0 3 , and a suitable solvent such as for example DMF, at a suitable temperature such as for example at 120°C.
- R la In case of R la (PG), first, in the presence of zinc chloride, a suitable deprotonating agent such as for example butyl lithium, a suitable solvent such as for example THF, at a suitable temperature such as for example -78°C, followed by addition (of/to) this solution (to) a mixture of intermediate (VII), optionally in solution in THF, and a suitable catalyst such as for example Pd(PPh 3 ) 4 , heating at a suitable temperature ranging from 60 to 100°C; 3: in the presence of a suitable acid such as for example />-toluenesulfonic acid hydrochloric acid or trifluoroacetic acid, in a suitable solvent such as for example dioxane or methanol, at a suitable temperature such as for example 50 or 100°C;
- a suitable deprotonating agent such as for example butyl lithium
- a suitable solvent such as for example THF
- a suitable temperature such as for example -78°C
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C in a sealed vessel.
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C in a sealed vessel.
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium (Pd 2 dba 3 ), a suitable base such as for example Cs 2 C0 3 , and a suitable solvent such as for example 2-methyl-2-butanol, at a suitable temperature such as for example between 100 and 120°C;
- R 2 B(OH) 2 or R 2 (4,4,5,5-tetramethyl-l ,3,2-dioxaborolane), in the presence of a suitable catalyst such as for example l, l'-bis(diphenylphosphino)ferrocene palladium(II)dichloride dichloromethane adduct, a suitable base such as for example potassium phosphate, and a suitable solvent such as for example a mixture dioxane and water, at a suitable temperature such as for example at 80°C;
- a suitable catalyst such as for example l, l'-bis(diphenylphosphino)ferrocene palladium(II)dichloride dichloromethane adduct
- a suitable base such as for example potassium phosphate
- a suitable solvent such as for example a mixture dioxane and water
- a suitable acid such as for example hydrochloric acid
- a suitable solvent such as for example dioxane
- a suitable temperature such as for example 70°C
- a suitable temperature such as for example 90°C, optionally in the presence of a suitable solvent such as for example ⁇ , ⁇ -dimethylformamide or dimethoxy ethane;
- a suitable catalyst such as for example Pd(PPh 3 )4, a suitable base such as for example triethylamine (Et 3 N), and a suitable solvent such as for example methanol or ethanol, at a suitable temperature such as for example at 100°C or 120°C
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 C0 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 C0 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel.
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 C0 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel.
- a suitable temperature such as for example 90°C, optionally in the presence of a suitable solvent such as for example N,N-dimethylformamide or dimethoxy ethane;
- R 2 B(OH) 2 or R 2 (4,4,5,5-tetramethyl-l,3,2-dioxaborolane) in the presence of a suitable catalyst such as for example 1.
- a suitable catalyst such as for example 1.
- a suitable temperature such as for example 90°C, in the presence of a suitable solvent such as for example N,N-dimethylformamide or dimethoxye thane;
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium (Pd 2 dba 3 ), a suitable base such as for example Cs 2 C0 3 , and a suitable solvent such as for example 2-methyl-2-butanol, at a suitable temperature such as for example between 100 and 120°C;
- R 2 B(OH) 2 or R 2 (4,4,5,5-tetramethyl-l,3,2-dioxaborolane) in the presence of a suitable catalyst such as for example lJ '-bis(diphenylphosphino)ferrocene palladium(II)dichloride dichloromethane adduct, a suitable base such as for example potassium phosphate, and a suitable solvent such as for example a mixture dioxane and water, at a suitable temperature such as for example at 80°C;
- a suitable catalyst such as for example lJ '-bis(diphenylphosphino)ferrocene palladium(II)dichloride dichloromethane adduct
- a suitable base such as for example potassium phosphate
- a suitable solvent such as for example a mixture dioxane and water
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 C0 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 C0 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel;
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium (Pd 2 dba 3 ), a suitable base such as for example Cs 2 C0 3 , and a suitable solvent such as for example 2-methyl-2-butanol, at a suitable temperature such as for example between 100 and 120°C;
- R 2 B(OH) 2 or R 2 (4,4,5,5-tetramethyl-l,3,2-dioxaboiOlane) in the presence of a suitable catalyst such as for example 1.
- a suitable catalyst such as for example 1.
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 C0 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel; 7: in the presence of a suitable base such as for example lithium hydroxide mono hydrate, a suitable solvent such as for example a mixture of methanol and water.
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 C0 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel
- a suitable base such as for example lithium hydroxide mono hydrate, a suitable solvent such as for example a mixture of methanol and water.
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium (Pd 2 dba 3 ), a suitable base such as for example Cs 2 C0 3 , and a suitable solvent such as for example 2-methyl-2-butanol, at a suitable temperature such as for example between 100 and 120°C;
- R 2 B(OH) 2 or R 2 (4,4,5,5-tetramethyl-l,3,2-dioxaborolane) in the presence of a suitable catalyst such as for example 1.
- a suitable catalyst such as for example 1.
- a suitable acid such as for example hydrochloric acid
- a suitable solvent such as for example dioxane
- a suitable temperature such as for example 70°C
- a suitable temperature such as for example 70°C or 90°C, in the presence of a suitable solvent such as for example ethanol, N,N-dimethylformamide or dimethoxyethane;
- a suitable temperature such as for example 70°C or 90°C, in the presence of a suitable solvent such as for example ethanol, N,N-dimethylformamide or dimethoxyethane;
- R 2 B(OH)2 or R 2 (4,4,5,5-tetramethyl-l,3,2-dioxaborolane) in the presence of a suitable catalyst such as for example l, l'-bis(diphenylphosphino)ferrocene palladium(II)dichloride dichloromethane adduct, a suitable base such as for example potassium phosphate, and a suitable solvent such as for example a mixture dioxane and water, at a suitable temperature such as for example at 80°C;
- a suitable catalyst such as for example l, l'-bis(diphenylphosphino)ferrocene palladium(II)dichloride dichloromethane adduct
- a suitable base such as for example potassium phosphate
- a suitable solvent such as for example a mixture dioxane and water
- a suitable reducing reagent such as for example potassium borohydride or lithium aluminium hydride, optionally a suitable additive such as for example lithium chloride, a suitable solvent such as for example THF or and a suitable temperature such as 0°C or solvent reflux based on the reducing reagent;
- a suitable reducing reagent such as for example potassium borohydride or lithium aluminium hydride
- a suitable additive such as for example lithium chloride
- a suitable solvent such as for example THF or and a suitable temperature such as 0°C or solvent reflux based on the reducing reagent
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 C0 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 C0 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel;
- R x and R y represent C ⁇ alkyl
- R z represents Ci ⁇ alkyl or phenyl
- R x and R y represent CH 3
- R z represents C(CH 3 ) 3 or phenyl. All other variables are as defined as above or according to the scope of the present invention.
- a suitable base such as for example lithium diisopropyl amide
- a suitable solvent such as for example tetrahydrofuran (THF)
- THF tetrahydrofuran
- a suitable catalyst such as for example Pd(PPh 3 )4
- a suitable solvent such as a for example N,N-dimethylformamide (DMF)
- a suitable temperature such as for example at 95°C
- 4 in the presence of a suitable catalyst such as for example Pd(PPh 3 )4, a suitable base such as for example triethylamine (Et 3 N), and a suitable solvent such as for example methanol or ethanol, at a suitable temperature such as for example at 100°C or 120°C
- 5 in the presence of a suitable base such as lithium hydroxide monohydrate, and a suitable solvent or a mixture of solvents such as for example a mixture of THF/water or MeOH/water optionally followed by the use of a suitable deprotecting agent such as for example tetrabutylammonium fluoride, in the presence of a suitable solvent such as for example THF;
- a suitable acid such as for example hydrochloric acid
- a suitable solvent such as for example THF
- a suitable base such as lithium hydroxide monohydrate, and a suitable solvent or a mixture of solvents such as for example a mixture of THF/water or MeOH/water;
- a suitable acid such as for example hydrochloric acid
- a suitable solvent such as for example THF
- a suitable catalyst such as for example hydrido(dimethylphosphinous acid-kP)[hydrogen bis(dimethylphosphinito- kP)]platinum(II), and a suitable solvent or a mixture of solvents such as for example a mixture of THF/water, at a suitable temperature such as for example at 95°C;
- peptidic coupling reagent such as 1- [bis(dimethylamino)methylene]-lH-[l,2,3]triazolo[4,5-b]pyridin-l-ium 3-oxide hexafluoro phosphate (HATU)
- HATU a suitable peptidic coupling reagent
- a suitable base such as for example diisopropylamine
- a suitable solvent such as for example DMF
- a suitable catalyst such as for example palladium acetate, in a microwave, at a suitable temperature such as for example 185°C followed by deprotection of the tert-Butyldimethylsilyl group with a suitable reagent such as tetrabutylammonium fluoride, hydrochloric acid or trifluoroacetic acid in a suitable solvent such as THF, dioxane or ;dichloromethane;;
- R la In case of R la (PG), first ,in the presence of zinc chloride, a suitable deprotonating agent such as for example butyl lithium, a suitable solvent such as for example THF, at a suitable temperature such as for example -78°C, followed by addition (of to) this solution (to) a mixture of intermediate (XXXVI), optionally in solution in THF, and a suitable catalyst such as for example Pd(PPh 3 )4, heating at a suitable temperature ranging from 60 to 100°C;
- a suitable deprotonating agent such as for example butyl lithium
- a suitable solvent such as for example THF
- a suitable temperature such as for example -78°C
- a suitable acid such as for example j-toluenesulfonic acid, hydrochloric acid or trifluoroacetic acid
- a suitable solvent such as for example dioxane, methanol or dichloromethane, at a suitable temperature such as for example 50 or 100°C;
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 1 10°C in a sealed vessel followed by deprotection of the tert- Butyldimethylsilyl group with a suitable reagent such as tetrabutylammonium fluoride, hydrochloric acid or trifluoroacetic acid in a suitable solvent such as THF, dioxane or dichloromethane.
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 1 10°C in a sealed vessel followed by deprotection of the tert- Butyldimethyl
- a suitable temperature such as for example 70°C or 90°C, in the presence of a suitable solvent such as for example ethanol, N,N-dimethylformamide or dimethoxyethane;
- a suitable catalyst such as for example Pd(PPh 3 )4 or Pd 2 (OAc)2, optionally a suitable ligand such as for example 4,5-Bis(diphenylphosphino)-9,9- dimethylxanthene, a suitable base such as for example triethylamine (Et 3 N), and a suitable solvent such as for example methanol or ethanol, at a suitable temperature such as for example at 100°C or 120°C;
- a suitable catalyst such as for example Pd(PPh 3 )4 or Pd 2 (OAc)2
- a suitable ligand such as for example 4,5-Bis(diphenylphosphino)-9,9- dimethylxanthene
- a suitable base such as for example triethylamine (Et 3 N)
- a suitable solvent such as for example methanol or ethanol
- Formula (Ij) can be prepared according to the following reaction Scheme 10.
- R 9 is defined as H or C3 ⁇ 4
- R 10 is defined as -Ci -4 alkyl-S0 2 -CH 3 or All other variables in Scheme 10 are defined as above or according to the scope of the present invention.
- a suitable reagent such as for example tetrabutylammonium fluoride, hydrochloric acid or trifluoroacetic acid in a suitable solvent such as THF, dioxane or dichloromethane;
- a suitable temperature such as for example 80°C, in the presence of a suitable oxidative reagent such as for example manganese dioxide, in a suitable solvent such as for example dioxane; 3: in the presence of a suitable reducing agent such as for example sodium triacetoxyborohydnde, a suitable additive such as for example sodium acetate, and in a suitable solvent such as for example dichloromethane;
- a suitable oxidative reagent such as for example manganese dioxide
- a suitable solvent such as for example dioxane
- a suitable reducing agent such as for example sodium triacetoxyborohydnde
- a suitable additive such as for example sodium acetate
- a suitable solvent such as for example dichloromethane
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 1 10°C, in a sealed vessel optionally followed by protecting groups cleavage with a suitable reagent such as tetrabutylammonium fluoride, hydrochloric acid or trifluoroacetic acid in a suitable solvent such as for example THF, dioxane or dichloromethane;
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 1 10°C, in a sealed vessel optionally followed by protecting groups cleavage with a suitable reagent such as tetrabutyl
- R la (PG)
- a suitable deprotonating agent such as for example butyl lithium
- a suitable solvent such as for example THF
- a suitable temperature such as for example -78°C
- this solution to) a mixture of intermediate (XXXXVI), optionally in solution in THF
- a suitable catalyst such as for example Pd(PPh 3 ) 4 , heating at a suitable temperature ranging from 60 to 100°C;
- a suitable acid such as for example 7-toluenesulfonic acid, hydrochloric acid or trifluoroacetic acid
- a suitable solvent such as for example dioxane, methanol or dichloromethane, at a suitable temperature such as for example 50 or 100°C.
- a suitable reagent such as for example di-ter/-butyl azodicarboxylate, a suitable phosphine such as for example triphenylphosphine, and in a suitable solvent such as for example THF;
- a suitable temperature such as for example 80°C, in a suitable solvent such as for example ethanol;
- acyl chloride in the presence of a suitable base such as for example diisopropylethylamine, and in a suitable solvent such as for example dichloromethane in case of a carboxylic acid, in the presence of a suitable coupling reagent such as for example l-(3-dimethyaminopropyl)-3-ethylcarbodiimide hydrochloride, a suitable additive such as for example 1-hydroxybenzotriazole, a suitable base such as for example triethylamine, and in a suitable solvent such as for example a mixture of THF and dichloromethane;
- a suitable base such as for example diisopropylethylamine
- a suitable solvent such as for example dichloromethane
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as for example 2,2'-bis(diphenylphosphino)-l, l'-binaphthyl, a suitable base such as for example cesium carbonate, a suitable solvent such as for example dioxane, at a suitable temperature such as 100°C, optionally in a sealed vessel; 5: in case of (PG)R la B(OH) 2 or (PG)R la (4.4.5.5-tetramethyl- 1.3.2-dioxaborolane ). in the presence of a suitable catalyst such as for example 1.
- a suitable catalyst such as for example 1.
- ⁇ - bis(diphenylphosphino)ferrocene palladium(II)dichloride dichloromethane adduct a suitable base such as for example potassium carbonate, and a suitable solvent such as for example a mixture of dioxane and water , at a suitable temperature such as for example at 100°C;
- R la In case of R la (PG), first , in the presence of zinc chloride, a suitable deprotonating agent such as for example butyl lithium, a suitable solvent such as for example THF, at a suitable temperature such as for example -78°C, followed by addition (of/to) this solution (to) a mixture of intermediate (L), optionally in solution in THF, and a suitable catalyst such as for example Pd(PPh 3 )4, heating at a suitable temperature ranging from 60 to 100°C;
- a suitable deprotonating agent such as for example butyl lithium
- a suitable solvent such as for example THF
- a suitable base such as for example triethylamine
- a suitable solvent such as for example dichloromethane
- 2 in the presence of a suitable catalyst such as for example palladium acetate, a suitable ligand such as for example 2,2'-bis(diphenylphosphino)-l, -binaphthyl, a suitable base such as for example cesium carbonate, a suitable solvent such as for example dioxane, at a suitable temperature such as 100°C, optionally in a sealed vessel
- 3 in case of (PG)R la B(OH) 2 or (PG)R la (4,4,5,5-tetramethyl-l,3,2-dioxaborolane), in the presence of a suitable catalyst such as for example ⁇ .
- ⁇ - bis(diphenylphosphino)ferrocene palladium(II)dichloride dichloromethane adduct a suitable base such as for example potassium carbonate, and a suitable solvent such as for example a mixture of dioxane and water , at a suitable temperature such as for example at 100°C;
- R la In case of R la (PG), first , in the presence of zinc chloride, a suitable deprotonating agent such as for example butyl lithium, a suitable solvent such as for example THF, at a suitable temperature such as for example -78°C, followed by addition (of/to) this solution (to) a mixture of intermediate (LII), optionally in solution in THF, and a suitable catalyst such as for example Pd(PPh 3 )4, heating at a suitable temperature ranging from 60 to 100°C;
- a suitable deprotonating agent such as for example butyl lithium
- a suitable solvent such as for example THF
- a suitable acid such as for example hydrochloric acid or trifluoroacetic acid
- a suitable solvent such as for example tetrahydrofurane or dichloromethane
- a suitable temperature such as for example room temperature, 50°C or 70°C.
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C, in a sealed vessel;
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C, in a sealed vessel;
- a suitable brominating reagent such as for example N- bromosuccinimide
- a suitable solvent such as for example acetonitnle
- 3 at a temperature such as 100°C or in a microwave at a temperature of 140°C, in the presence of a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium(0), a suitable ligand such as for example 2-(di-t- butylphosphino)biphenyl, a suitable base such as for example sodium fer -butoxide, and in a suitable solvent such as for example dioxane;
- a suitable brominating reagent such as for example N- bromosuccinimide
- a suitable solvent such as for example acetonitnle
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium(0)
- a suitable ligand such as for example 2-(di-t- butylphosphino)
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium(0), a suitable ligand such as for example 2-(di-t- butylphosphino)biphenyl, a suitable base such as for example sodium fer -butoxide, and in a suitable solvent such as for example dioxane, in a sealed vessel;
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium(0)
- a suitable ligand such as for example 2-(di-t- butylphosphino)biphenyl
- a suitable base such as for example sodium fer -butoxide
- a suitable solvent such as for example dioxane
- R la (PG)
- a suitable deprotonating agent such as for example butyl lithium
- a suitable solvent such as for example THF
- THF a suitable temperature
- a suitable catalyst such as for example Pd(PPh 3 )4, heating at a suitable temperature ranging from 60 to 100°C;
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium(0), a suitable ligand such as for example 2-(di-t- butylphosphino)biphenyl, a suitable base such as for example sodium fer/-butoxide, and in a suitable solvent such as for example dioxane;
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium(0)
- a suitable ligand such as for example 2-(di-t- butylphosphino)biphenyl
- a suitable base such as for example sodium fer/-butoxide
- a suitable solvent such as for example dioxane
- a suitable acid such as for example hydrochloric acid or trifluoroacetic acid
- a suitable solvent such as for example tetrahydrofurane or dichloromethane
- a suitable temperature such as for example room temperature, 50°C or 70°C.
- a suitable solvent such as for example EtOH
- a suitable temperature such as for example 90°C.
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium(0), a suitable ligand such as for example 2-(di-t- butylphosphino)biphenyl, a suitable base such as for example sodium fer -butoxide, and in a suitable solvent such as for example dioxane
- a suitable base such as for example lithium diisopropyl amide, and a suitable solvent such as for example tetrahydrofuran (THF), at a suitable temperature such as for example at -78°C
- THF tetrahydrofuran
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C, in a sealed vessel;
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C, in a sealed vessel;
- R la (PG)
- a suitable deprotonating agent such as for example butyl lithium
- a suitable solvent such as for example THF
- THF a suitable temperature
- a suitable catalyst such as for example Pd(PPh 3 )4, heating at a suitable temperature ranging from 60 to 100°C;
- a suitable catalyst such as for example Pd(PPh 3 ) 4 , a suitable base such as for example triethylamine (Et 3 N), and a suitable solvent such as for example methanol or ethanol, at a suitable temperature such as for example at 100°C or 120°C; 8: in the presence of a suitable base such as lithium hydroxide monohydrate, and a suitable solvent or a mixture of solvents such as for example a mixture of THF/water or MeOH/water;
- a suitable catalyst such as for example Pd(PPh 3 ) 4
- a suitable base such as for example triethylamine (Et 3 N)
- a suitable solvent such as for example methanol or ethanol
- R la In case of R la (PG), first ,in the presence of zinc chloride, a suitable deprotonating agent such as for example butyl lithium, a suitable solvent such as for example THF, at a suitable temperature such as for example -78°C, followed by addition (of/to) this solution (to) a mixture of intermediate (LXIV), optionally in solution in THF, and a suitable catalyst such as for example Pd(PPh 3 ) 4 , heating at a suitable temperature ranging from 60 to 100°C;
- a suitable deprotonating agent such as for example butyl lithium
- a suitable solvent such as for example THF
- a suitable temperature such as for example -78°C
- a suitable catalyst such as for example Pd(PPh 3 )4, a suitable base such as for example triethylamine (Et 3 N), and a suitable solvent such as for example methanol or ethanol, at a suitable temperature such as for example at 100°C or 120°C
- a suitable acid such as for example 7-toluenesulfonic acid, hydrochloric acid or trifluoroacetic acid, in a suitable solvent such as for example dioxane, methanol or dichloromethane, at a suitable temperature such as for example 50 or 100°C
- a suitable acid such as for example 7-toluenesulfonic acid, hydrochloric acid or trifluoroacetic acid
- a suitable solvent such as for example dioxane, methanol or dichloromethane
- peptidic coupling reagent such as 1- [bis(dimethylamino)methylene]-lH-[l,2,3]triazolo[4,5-b]pyridin-l-ium 3-oxide hexafluoro phosphate (HATU), in the presence of a suitable base such as for example diisopropylamine, and a suitable solvent such as for example DMF;
- a suitable base such as lithium hydroxide monohydrate
- a suitable solvent or a mixture of solvents such as for example a mixture of THF/water or MeOH/water.
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium(0)
- a suitable ligand such as for example 2- (Dicyclohexylphosphino)-3,6-dimethoxy-2',4',6'-triisopropyl-l, 1 '-biphenyl
- a suitable base such as for example cesium carbonate
- a suitable solvent such as for example toluene
- a suitable temperature such as for example 80°C, in the presence of a suitable oxidative reagent such as for example manganese dioxide, in a suitable solvent such as for example dioxane;
- a suitable temperature such as for example 0°C or -78°C, in a suitable solvent such as for example THF
- 3 in the presence of a suitable activating agent such as for example imidazole and a suitable solvent such as for example N,N-dimethylformamide;
- a suitable base such as for example lithium diisopropyl amide
- a suitable solvent such as for example tetrahydrofuran (THF)
- THF tetrahydrofuran
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C, in a sealed vessel;
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C, in a sealed vessel;
- a suitable deprotecting reagent such as for example tetrabutylammonium fluoride, in a suitable solvent such as for example THF;
- R la In case of R la (PG), first , in the presence of zinc chloride, a suitable deprotonating agent such as for example butyl lithium, a suitable solvent such as for example THF, at a suitable temperature such as for example -78°C, followed by addition (of to) this solution (to) a mixture of intermediate (LXXV), optionally in solution in THF, and a suitable catalyst such as for example Pd(PPh 3 )4, heating at a suitable temperature ranging from 60 to 100°C;
- a suitable deprotonating agent such as for example butyl lithium
- a suitable solvent such as for example THF
- a suitable temperature such as for example -78°C
- a suitable acid such as for example p-toluenesulfonic acid, hydrochloric acid or trifluoroacetic acid
- a suitable solvent such as for example dioxane, methanol or dichloromethane, at a suitable temperature such as for example 50 or 100°C.
- a suitable solvent such as for example dichloromethane; 'DAST' means die thylamino sulfur trifluoride;
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C, in a sealed vessel.
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C, in a sealed vessel.
- reaction conditions apply: 1 : in the presence of a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C, in a sealed vessel;
- a suitable catalyst such as for example copper iodide, a suitable ligand such as for example L-proline, a suitable base such as for example cesium carbonate, a suitable solvent such as for example N,N-dimethylformamide, at a suitable temperature such as 110°C, in a sealed vessel;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as for example 2,2'-bis(diphenylphosphino)-l, -binaphthyl, a suitable base such as for example cesium carbonate, a suitable solvent such as for example dioxane, at a suitable temperature such as 100°C;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as for example 2,2'-bis(diphenylphosphino)-l, -binaphthyl, a suitable base such as for example cesium carbonate, a suitable solvent such as for example dioxane, at a suitable temperature such as 100°C;
- a suitable temperature such as for example 80°C, in a suitable solvent such as for example ethanol;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as for example 2,2'-bis(diphenylphosphino)-l, -binaphthyl, a suitable base such as for example cesium carbonate, a suitable solvent such as for example dioxane, at a suitable temperature such as 100°C;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as for example 2,2'-bis(diphenylphosphino)-l, -binaphthyl, a suitable base such as for example cesium carbonate, a suitable solvent such as for example dioxane, at a suitable temperature such as 100°C;
- a suitable reagent such as for example tetrabutylammonium fluoride (TBAF), hydrochloric acid or trifluoroacetic acid in a suitable solvent such as THF, dioxane or dichloromethane;
- a suitable reagent such as for example di-ter/-butyl azodicarboxylate, a suitable phosphine such as for example tri phenyl phosphine, and in a suitable solvent such as for example THF
- 4 in case of an acyl chloride, in the presence of a suitable base such as for example diisopropylethylamine, and in a suitable solvent such as for example dichloromethane in case of a carboxylic acid, in the presence of a suitable coupling reagent such as for example l-(3-dimethyaminopropyl)-3-ethylcarbodiimide hydrochloride, a suitable additive such as for example 1-hydroxybenzotriazole, a suitable base such as for example triethylamine, and in a suitable solvent such as for example a mixture of THF and dichloromethane.
- a suitable reagent such as for example di-ter/-butyl azodicarboxylate,
- Formula (Iga); and compounds of Formula (I) wherein R is -NH 2 , and wherein the other variables are as shown in Formula (Iha) can be prepared according to the following reaction Scheme 22 wherein all other variables are defined as above or according to the scope of the present invention.
- R 1 is restricted to R la being
- PG represent a protective group such as for example te rt- butoxycarbo n yl or be nzyl ox yc arbo n yl .
- a suitable coupling reagent such as for example 1- [bis(dimethylamino)methylene]-lH-l,2,3-triazolo[4,5- ⁇ ]pyridinium 3-oxide, a suitable additive such as for example dimethylaminopyridine, a suitable base such as for example diisopropylethylamine, and in a suitable solvent such as for example of DMF;
- a suitable solvent such as for example of DMF
- an acide such as for example trifluoroacetic acid or hydrogen chloride in a suitable solvent such as for example dichloromethane or methanol.
- a suitable solvent such as methanol under an atmosphere of hydrogen.
- a suitable base such as for example sodium hydroxide monohydrate
- a suitable solvent such as for example a mixture of tetrahydrofuran and ethanol.
- a suitable catalyst such as for example tris(dibenzylideneacetone)dipalladium (Pd 2 dba 3 ), a suitable base such as for example Cs 2 C0 3 , and a suitable solvent such as for example 2-methyl-2-butanol, at a suitable temperature such as for example 80
- R 2 B(OH) 2 or R 2 (4,4,5,5-tetramethyl-l,3,2-dioxaborolane) in the presence of a suitable catalyst such as for example 1.1 '-bis(diphenylphosphino)ierrocene palladium(II)dichloride dichloromethane adduct, a suitable base such as for example potassium phosphate, and a suitable solvent such as for example a mixture dioxane and water, at a suitable temperature such as for example at 80°C.
- a suitable catalyst such as for example 1.1 '-bis(diphenylphosphino)ierrocene palladium(II)dichloride dichloromethane adduct
- a suitable base such as for example potassium phosphate
- a suitable solvent such as for example a mixture dioxane and water
- a suitable temperature such as for example 80°C, in the presence of a suitable oxidative reagent such as for example manganese dioxide, in a suitable solvent such as for example toluene;
- a suitable temperature such as for example room temperature, in the presence of a suitable base such as for example sodium hydroxide, in a suitable solvent such as for example tetrahydrofuran;
- a suitable temperature such as for example room temperature, in the presence of a suitable acid such as for example hydrochloric acid, in a suitable solvent such as for example tetrahydrofuran;
- a suitable temperature such as for example room temperature
- a suitable acid such as for example aqueous hydrochloric acid
- a suitable solvent such as for example tetrahydrofuran.
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as for example 2,2'-bis(diphenylphosphino)-l, -binaphthyl, a suitable base such as for example cesium carbonate, a suitable solvent such as for example dioxane, at a suitable temperature such as 100°C, optionally in a sealed vessel
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as for example 2,2'-bis(diphenylphosphino)-l, l'-binaphthyl, a suitable base such as for example cesium carbonate, a suitable solvent such as for example dioxane, at a suitable temperature such as 115°C, in a sealed vessel
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as for example 2,2'-bis(diphenylphosphino)-l, -binaphthyl,
- a suitable temperature such as for example 60°C, in the presence of a suitable acid such as for example aqueous hydrochloric acid, in a suitable solvent such as for example tetrahydrofuran;
- a suitable acid such as for example aqueous hydrochloric acid
- a suitable solvent such as for example tetrahydrofuran
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as for example 2,2'-bis(diphenylphosphino)-l,r-binaphthyl, a suitable base such as for example cesium carbonate, a suitable solvent such as for example dioxane, at a suitable temperature such as 100°C, optionally in a sealed vessel;
- a suitable temperature such as for example room temperature, in the presence of a suitable acid such as for example aqueous hydrochloric acid, in a suitable solvent such as for example tetrahydrofuran; eneral, compounds of Formula (I) wherein R 1 is -NH 2 , wherein R 2 is restricted to
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 CO 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 120°C, optionally in a sealed vessel;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 CO 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 120°C, optionally in a sealed vessel;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 CO 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 CO 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel;
- a suitable catalyst such as for example palladium acetate (Pd(Oac) 2 ), a suitable ligand such as for example 4,5-Bis(diphenylphosphino)-9,9- dimethylxanthene (Xantphos), a suitable base such as for example sodium phenoxide trihydrate or aqueous sodium hydroxide, in a suitable solvant such as for example dioxane, at a suitable temperature ranged between 100 to 120°C;
- a suitable catalyst such as for example palladium acetate (Pd(Oac) 2 )
- a suitable ligand such as for example 4,5-Bis(diphenylphosphino)-9,9- dimethylxanthene (Xantphos)
- a suitable base such as for example sodium phenoxide trihydrate or aqueous sodium hydroxide, in a suitable solvant such as for example dioxane, at a suitable temperature ranged between 100 to 120°C;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 CO 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 120°C, optionally in a sealed vessel;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 CO 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 120°C, optionally in a sealed vessel;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 CO 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel;
- a suitable catalyst such as for example palladium acetate, a suitable ligand such as triphenylphosphine, a suitable base such as for example K 2 CO 3 , a suitable solvent such as for example dioxane, and a suitable temperature such as for example 100°C, optionally in a sealed vessel;
- reaction products may be isolated from the reaction medium and, if necessary, further purified according to methodologies generally known in the art such as, for example, extraction, crystallization, trituration and
- the ehirally pure forms of the compounds of Formula (I ) form a preferred group of compounds. It is therefore that the ehirally pure forms of the intermediates and their salt forms are particularly useful in the preparation of ehirally pure compounds of Formula (I). Also enantiomeric mixtures of the intermediates are useful in the preparation of compounds of Formula (I) with the corresponding configuration.
- the compounds of the present invention inhibit ⁇ 3 ⁇ kinase activity, and optionally also have ⁇ inhibitory activity. Some of the compounds of the present invention may undergo metabolism to a more active form in vivo
- the compounds according to the present invention or pharmaceutical compositions thereof may be useful for treating or preventing, in partic ular treating, of diseases such as cancer, autoimmune disorders, cardiovascular diseases, inflammatory diseases, neurodegenerative diseases, allergy, pancreatitis, asthma, multiorgan failure, kidney diseases, platelet aggregation, sperm motility, transplantation rejection, graft rejection, lung injuries and the like; in particular cancer.
- diseases such as cancer, autoimmune disorders, cardiovascular diseases, inflammatory diseases, neurodegenerative diseases, allergy, pancreatitis, asthma, multiorgan failure, kidney diseases, platelet aggregation, sperm motility, transplantation rejection, graft rejection, lung injuries and the like
- the pharmaceutically active compounds of the present invention are active as ⁇ 13 ⁇ inhibitors, they exhibit therapeutic utility in treatment or prevention, in particular treatment, f susceptible neoplasms, particularly those neoplasms that exhibit a PTEN deficiency.
- PTEN deficient or “PTEN deficiency” shall describe tumors with deficiencies of the tumor suppressor function of PTEN (Phosphatase and Tensin Homolog). Such deficiency includes mutation in the PTEN gene, reduction or absence of PTEN proteins when compared to PTEN wild-type, or mutation or absence of other genes that cause suppression of PTEN function.
- “Susceptible neoplasm” as used herein refers to neoplasms which are susceptible to treatment by a kinase inhibitor and particularly neoplasms that are susceptible to treatment by a ⁇ 3 ⁇ inhibitor.
- Neoplasms which have been associated with inappropriate activity of the PTEN phosphatase and particularly neoplasms which exhibit mutation of PTEN, or mutation of an upstream activator of ⁇ 3 ⁇ kinase or o verexpression of an upstream activator of ⁇ 13 ⁇ kinase, and are therefore susceptible to treatment with an ⁇ 3 ⁇ inhibitor are known in the art, and include both primary and metastatic tumors and cancers. According to an embodiment, description of the treatment of a susceptible neoplasm may be used interchangeably with description of the treatment of a cancer.
- susceptible neoplasms include but are not limited to PTEN-deficient neoplasms listed as follows: brain (gliomas), glioblastomas, leukemias, Bannayan-Zonana syndrome, Cowden disease, Lhermitte-Ducios disease, breast cancer, inflammatory breast cancer, colorectal cancer Wilm ' s tumor, Ewing's sarcoma.
- Rhabdomyosarcoma ependymoma, medulloblastoma, colon cancer, head and neck cancer, liver cancer, kidney cancer, Sung cancer, melanoma, squamous cell carcinoma, ovarian cancer, pancreatic cancer, prostate cancer, sarcoma cancer, osteosarcoma, giant cell tumor of bone, thyroid cancer, lymphoblastic T cell leukemia, chronic
- myelogenous leukemia chronic lymphocytic leukemia, hairy-cell leukemia, acute lymphoblastic leukemia, acute myelogenous leukemia, chronic neutrophilic leukemia, acute lymphoblastic T cell leukemia.
- Plasmacytoma Immunoblastic large cell leukemia. Mantle cell leukemia. Multiple myeloma, Megakan oblastic leukemia.
- Acute megakaryocyte leukemia promyelocytic leukemia, Erythroleukemia, malignant lymphoma, h dg kin lymphoma, non-hodgkins lymphoma, lymphoblastic T cell lymphoma.
- Burkitt's lymphoma Burkitt's lymphoma, follicular lymphoma, neuroblastoma, bladder cancer, urothelial cancer, cervical cancer, vulval cancer, endometrial cancer, renal cancer.
- gastrointestinal stromal tumor gastrointestinal stromal tumor
- testicular cancer gastrointestinal stromal tumor
- susceptible neoplasm includes and is limited to hormone refractory prostate cancer, non-small-cell lung cancer, endometrial cancer, gastric cancer, melanoma, head and neck cancer, breast cancer, including tripnegative breast cancer, and glioma.
- the term "susceptible neoplasm” includes and is limited to prostate cancer, in particular hormone refractory prostate cancer.
- the compounds of the present invention may also have therapeutic applications in sensitising tumour cells for radiotherapy and chemotherapy.
- the compounds of the present invention may be used as "radio sensitizer” and or “chemosensitizer” or can be given in combination with another "radiosensitizer” and or
- radiosensitizer is defined as a molecule, preferably a low molecular weight molecule, administered to animals in therapeutically effective amounts to increase the sensitivity of the cells to ionizing radiation and/or to promote the treatment of diseases which are treatable with ionizing radiation.
- chemosensitizer is defined as a molecule, preferably a low molecular weight molecule, administered to animals in therapeutically effective amounts to increase the sensitivity of cells to chemotherapy and/or promote the treatment of diseases which are treatable with chemotherapeutics.
- hypoxic cell radiosensitizers e.g., 2- nitioimidazole compounds, and benzotriazine dioxide compounds
- non-hypoxic cell radiosensitizers e.g., halogenated pyrimidines
- various other potential mechanisms of action have been hypothesized for
- radiosensitizers in the treatment of disease.
- radiosensitizers include, but are not limited to, the following: metronidazole, mi sonidazole, de sm eth y 1 m i on i dazo 1 e , pimonidazole, etanidazole, nimorazole, m itomycin C, SU 1069, SR 4233, F.09, RB 6145, nicotinamide, 5-bromodeoxyuridine (BUdR), 5- iododeoxyuridine ( HJdR). bromodeoxycytidine, fl uorodeoxyuri di ne (T ' udR), hydroxyurea, cisplatin, and therapeutically effective analogs and derivatives of the same.
- Photodynamic therapy (PDT) of cancers employs visible light as the radiation activator of the sensitizing agent.
- photodynamic radiosensitizers include the following, but are not limited to: hematoporphyrin derivatives, Photofrin,
- benz porphyrin derivatives tin etioporphyrin, pheoborbide-a, bacteriochlorophyll-a, naphthalocyanines, phthalocyanines, zinc phthalocyanine, and therapeutically effective analogs and derivatives of the same.
- Radiosensitizers may be admini stered i conjunction with a therapeutically effective amount of one or more other compounds, including but not limited to: compounds which promote the incorporation of radiosensitizers to the target cells; compounds which control the flow of therapeutics, nutrients, and/or oxygen to the target cells; chemotherapeutic agents which act on the tumour with or without additional radiation; or other therapeutically effective compounds for treating cancer or other diseases.
- Chemosensitizers may be administered in conjunction with a therapeutically effective amount of one or more other compounds, including but not limited to: compounds which promote the incorporation of chemosensitizers to the target cells; compounds which control the flow of therapeutics, nutrients, and/or oxygen to the target cells; chemotherapeutic agents which act on the tumour or other therapeutically effective compounds for treating cancer or other disease.
- Calcium antagonists for example verapamil, are found useful in combination with antineoplastic agents to establish chemosensitivity in tumor cells resistant to accepted chemotherapeutic agents and to potentiate the efficacy of such compounds in drug-sensitive malignancies.
- the invention relates to compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof for use as a medicament.
- the invention also relates to compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, for use in the inhibition of ⁇ ⁇ kinase activity and optionally also for use in the inhibition of ⁇ 3 ⁇ .
- the compounds of the present invention can be "anti-cancer agents", which term also encompasses “anti-tumor cell growth agents” and “anti-neoplastic agents”.
- the invention al so relates to compounds of Formula (1) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, for use in the treatment of diseases mentioned above.
- the invention also relates to compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, for the treatment or prevention, in particular for the treatment, of said diseases.
- the invention also relates to compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, for the treatment or prevention, in particular in the treatment, of ⁇ 3 ⁇ mediated diseases or conditions.
- the invention also relates to compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, for the treatment or prevention, in particular in the treatment, of ⁇ 3 ⁇ and optionally PI3K5 mediated diseases or conditions.
- the invention also relates to the use of compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, for the manufacture of a medicament.
- the invention also relates to the use of compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, for the manufacture of a medicament for the inhibition of ⁇ 3 ⁇ .
- the invention also relates to the use of compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, for the manufacture of a medicament for the inhibition of ⁇ 3 ⁇ and optionally also for the inhibition of ⁇ 3 ⁇ .
- the invention also relates to the use of com pounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, for the manufacture of a medicament for the treatment or prevention, in particular for the treatment, of any one of the disease conditions mentioned hereinbefore.
- the invention also relates to the use of compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, for the manufacture of a medi cament for the treatment of any one of the disease conditions menti oned hereinbefore.
- the compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof can be administered to mammals, preferably humans for the treatment or prevention of any one of the diseases mentioned hereinbefore.
- Said methods comprise the administration, i.e. the systemic or topical administration, preferably oral administration, of an effective amount of a compound of Formula (1) or a N-oxide, a pharmaceutically acceptable addition salt, or a solvate thereof, to warm- blooded animals, including humans.
- An effective therapeutic daily amount would be from about 0.005 mg/kg to 50 mg kg, in particular 0.01 mg/kg to 50 mg/kg body weight more in particular from 0.01 mg/kg to 25 mg/kg body weight, preferably from about 0.01 mg/kg to about 1 5 mg/kg, more preferably from about 0.01 mg kg to about 10 nig kg, even more preferably from about 0.01 mg kg to about 1 mg kg, most preferably from about 0.05 mg kg to about 1 mg kg body weight.
- the amount of a compound according to the present invention, also referred to here as the active ingredient, which is required to achieve a therapeutically effect will of course, vary on case-by-case basis, for example with the particular compound, the route of administration, the age and condition of the recipient, and the particular disorder or disease being treated.
- a method of treatment may also include admini stering the active ingredient on a regimen of between one and four intakes per day.
- the compounds according to the invention are preferably formulated prior to
- suitable pharmaceutical formulations are prepared by known procedures using well known and readily available ingredients.
- Combination therapy includes administration of a single pharmaceutical dosage formulation which contains a compound of Formula (I), a N-oxide, a pharmaceutically acceptable addition salt, or a solvate thereof, and one or more additional therapeutic agents, as well as administration of the compound of Formula (I), a N-oxide, a pharmaceutically acceptable addition salt, or a solvate thereof, and each additional therapeutic agents in its own separate pharmaceutical dosage formulation.
- pharmaceutically acceptable addition salt or a solvate thereof and a therapeutic agent may be administered to the patient together in a single oral dosage composition such as a tablet or capsule, or each agent may be admini stered in separate oral dosage formulations.
- the active ingredient While it is possible for the active ingredient to be administered alone, it is preferable to present it as a pharmaceutical composition.
- the present invention further provides a pharmaceutical composition
- a pharmaceutical composition comprising a pharmaceutically acceptable carrier and, as active ingredient, a therapeutically effective amount of a compound of Formula (I), a N-oxide, a pharmaceutically acceptable addition salt, or a solvate thereof.
- the carrier or diluent must be "acceptable” in the sense of being compatible with the other ingredients of the composition and not deleterious to the recipients thereof.
- the subject compounds may be formulated into various pharmaceutical forms for administration purposes.
- the compounds according to the invention in particular the compounds of Formula (I) and N-oxides, pharmaceutically acceptable addition salts, and solvates thereof, or any subgroup or combination thereof may be formulated into various pharmaceutical forms for administration purposes.
- compositions there may be cited all compositions usually employed for systemically administering drugs.
- compositions of this invention an effective amount of the particular compound as the active ingredient is combined in intimate admixture with a pharmaceutically acceptable carrier, which carrier may take a ide variety of forms depending on the form of preparation desired for administration.
- a pharmaceutically acceptable carrier which carrier may take a ide variety of forms depending on the form of preparation desired for administration.
- These pharmaceutical compositions are desirable in unitary dosage form suitable, in particular, for administration orally, rectally, percutaneously, by parenteral injection or by inhalation.
- any of the usual pharmaceutical media may be employed such as, for example, water, glycols, oils, alcohols and the like in the case of oral liquid preparations such as suspensions, syrups, elixirs, emulsions and solutions; or solid earners such as starches, sugars, kaolin, diluents, lubricants, binders, disintegrating agents and the like in the case of powders, pills, capsules and tablets. Because of their ease in administration, tablets and capsules represent the most advantageous oral dosage unit forms in which case solid pharmaceutical carriers are obviously employed.
- the carrier will usually comprise sterile water, at least in large part, though other ingredients, for example, to aid solubility, may be included.
- injectable solutions for example, may be prepared in which the carrier comprises saline solution, glucose solution or a mixture of saline and glucose solution, injectable solutions containing a compound of Formula (I), a -oxide, a pharmaceutically acceptable addition salt, or a solvate thereof, may be formulated in an oil for prolonged action.
- Appropriate oils for this purpose are, for example, peanut oil, sesame oil, cottonseed oil, corn oil, soybean oil, synthetic glycerol esters of long chain fatty acids and mixtures of these and other oils.
- Injectable suspensions may also be prepared in which case appropriate liquid carriers, suspending agents and the like may be employed. Also included are solid form preparations that are intended to be converted, shortly before use, to liquid form preparations, in the compositions suitable for percutaneous administration, the carrier optionally comprises a penetration enhancing agent and or a suitable wetting agent, optionally combined with suitable additives of any nature in minor proportions, which additives do not introduce a significant deleterious effect on the skin. Said additives may facilitate the administration to the skin and or may be helpful for preparing the desired compositions. These compositions may be administered in various ways, e.g., as a transdermal patch, as a spot-on, as an ointment. Acid or base addition salts of compounds of Formula (I) due to their increased water solubility over the
- Unit dosage form refers to physically discrete units suitable as unitary dosages, each unit containing a predetermined quantity of active ingredient calculated to produce the desired therapeutic effect in association with the required
- unit dosage forms are tablets (including scored or coated tablets), capsules, pills, powder packets, wafers, suppositories, injectable solutions or suspensions and the like, and segregated multiples thereof.
- the pharmaceutical composition w i 11 preferably comprise from 0.05 to 99 % by weight, more preferably from 0.1 to 70 % by weight, even more preferably from 0.1 to 50 % by weight of the compound of Formula (I), a N-oxide, a pharmaceutically acceptable addition salt, or a solvate thereof, and from 1 to 99.95 % by weight, more preferably from 30 to 99.9 % by weight even more preferably from 50 to 99.9 % by weight of a pharmaceutically acceptable carrier, all percentages being based on the total weight of the composition.
- a combination of a compound of the present invention with another anticancer agent is envisaged, especially for use cis ci medicine, more specifically for use in the treatment of cancer or related diseases.
- the compounds of the invention may be advantageously employed in combination with one or more other medicinal agents, more particularly, with other anti-cancer agents or adjuvants in cancer therapy.
- anti-cancer agents or adjuvants include but are not limited to:
- platinum coordination compounds for example ci splat in optionally combined i h amifostine, carbopiatin or oxaliplatin;
- taxane compounds for example paclitaxel, paclitaxel protein hound particles (AbraxaneTM) or docetaxel;
- topoisomerase I inhibitors such as camptothecin compounds for example irinotecan, SN-38, topotecan, topotecan hcl;
- topoisomerase II inhibitors such as anti-tumour epipodophyllotoxins or podophyllotoxin derivatives for example etoposide, etoposide phosphate or teniposide;
- anti -turn our vinca alkaloids for example vinblastine, vincristine or vinorelbine
- anti-tumour nucleoside derivatives for example 5-fluorouracil, leucovorin, gemcitabine, gemcitabine hcl, capecitabine, cladribine.
- alkylating agents such as nitrogen mustard or nitrosourea for example cyclophosphamide, chlorambucil, carmustine, thiotepa, mephalan (melphalan), lomustine, altretamine, busulfan, daearbazine, estramustine, ifosfamide optionally in combination with mesna, pipobroman, procarbazine, streptozocin, temozolomide, uracil;
- alkylating agents such as nitrogen mustard or nitrosourea for example cyclophosphamide, chlorambucil, carmustine, thiotepa, mephalan (melphalan), lomustine, altretamine, busulfan, daearbazine, estramustine, ifosfamide optionally in combination with mesna, pipobroman, procarbazine, streptozocin, temozolomide, uracil;
- anti-tumour anthracycline derivatives for example daunorubicin.
- doxorubicin optionally in combination with dexrazoxane, doxil, idarubicin, mitoxantrone, epirubicin, epirubicin hcl, valrubicin;
- IGF-1 receptor molecules that target the IGF-1 receptor for example picropodophilin
- tetracarcin derivatives for example tetrocarcin A
- glucocorticoi ' den for example prednisone
- estrogen receptor antagonists or selective estrogen receptor modulators or inhibitors of estrogen synthesis for example tamoxifen, fulvestrant, toremifene, droloxifene, faslodex, raloxifene or letrozole;
- aromatase inhibitors such as exemestane, anastrozole, letrazole, testolactone and vorozole;
- differentiating agents such as retinoids, vitamin D or retinoic acid and retinoic acid metabolism blocking agents ( AMBA) for example accutane;
- AMBA retinoic acid metabolism blocking agents
- DNA methyl transferase inhibitors for example azacytidine or decitabine anti folates for example premetrexed di sodium;
- antibiotics for example anti nom vein D, bleomycin, mitomycin C, dactinomycin, carminomycin, daunomycin, levamisole, plicamycin, mithramycin; antimetabolites for example clofarabine, aminopterin, cytosine arabinoside or methotrexate, azacitidine, floxuridine, pentostatin, thioguanine; apoptosis inducing agents and antiangiogenic agents such as Bcl-2 inhibitors for example YC 137, BH 12, ABT 737, gossypol, HA 14-1, TW 37 or decanoic acid;
- Bcl-2 inhibitors for example YC 137, BH 12, ABT 737, gossypol, HA 14-1, TW 37 or decanoic acid
- tubuline-binding agents for example combrcstatin, colchicines or nocodazolc; kinase inhibitors (e.g. EGF (epithelial growth factor receptor) inhibitors, MTK1 (multi target kinase inhibitors), m ' fOR inhibitors) for example flavoperidol, imatinib mesylate, erlotinib, gefitinib, dasatinib, lapatinib, lapatinib ditosylate, sorafenib. sunitinib, sunitinib maleate. temsirolimus;
- kinase inhibitors e.g. EGF (epithelial growth factor receptor) inhibitors, MTK1 (multi target kinase inhibitors), m ' fOR inhibitors
- flavoperidol imatinib mesylate, erlotinib, gefitinib, dasatinib, lapatin
- farnesyltransferase inhibitors for example tipifarnib
- I IMC hi stone deacetylase inhibitors for example sodium butyrate, suberoylanilide hydroxamic acid (SAHA), depsipeptide (FR 901228), NVP- LAQ824, R306465, JNJ-26481585, trichostatin A, vorinostat;
- telomestatin a trimer of a pregnene inhibitor
- telomestatin a trimer of a pregnene inhibitor
- Matrix metalloproteinase inhibitors for example batimastat, marimastat, prinostat or metastat;
- interleukins for example aldesleukin, de ileukin diftitox, interferon al fa 2a, interferon alia 2b, peginterferon alfa 2b;
- Retinoids for example alitretinoin, bexarotene, tretinoin;
- Steroids for example dromostanolone propionate, megestrol acetate, nandrolone (dec a no ate, phenpropionate), dexamethasone;
- Gonadotropin releasing hormone agonists or antagonists for example abarelix, goserelin acetate, histrelin acetate, leuprolide acetate;
- Thalidomide lenalidomide
- - MEK inhibitors for example PD98059, AZD6244, CI- 1040;
- colony-stimulating factor analogs for example filgrastim, pegfilgrastim, sargramostim; erythropoietin or analogues thereof (e.g. darbepoetin alfa); interleukin 1 1 ; oprelvekin; zoledronate, zoledronic acid; fen tan yl;
- CYP17 e.g. abiraterone, abiraterone acetate
- mTOR inhibitors such as rapamycins and rapalogs, and mTOR kinase inhibitors:
- autophagy inhibitors such as chloroquine and hydroxy-chloroquine
- - androgen receptor antagonist drugs e.g. enzalutamide or ARN-509;
- the present invention further relates to a product containing as first active ingredient a compound according to the invention and as further active ingredient one or more anticancer agents, as a combined preparation for simultaneous, separate or sequential use i n the treatment of patients suffering from cancer.
- the one or more other medicinal agents and the compound according to the present i nvention may be administered simultaneousl (e.g. in separate or unitary
- compositions or sequentially in either order.
- the two or more compounds will be administered within a period and in an amount and manner that is sufficient to ensure that an advantageous or synergistic effect i s achieved
- the preferred method and order of admini stration and the respective dosage amounts and regimes for each component of the combination will depend on the particular other medicinal agent and compound of the present invention being administered, their route of administration, the particular tumour being treated and the particular host being treated.
- the optimum method and order of administration and the dosage amounts and regime can be readily determined by those skilled in the art using conventional methods and in view of the information set out herein.
- the weight ratio of the compound according to the present invention and the one or more other anticancer agent(s) when given as a combination may be determined by the person skilled in the art. Said ratio and the exact dosage and frequency of
- a particular weight ratio for the present compound of Formula (I) and another anticancer agent may range from 1/ 10 to 10/1, more in particular from 1/5 to 5/1, even more in particular from 1/3 to 3/1.
- the platinum coordination compound is advantageously administered in a dosage of 1
- camptothecin compound is advantageously administered in a dosage of 0.1 to
- the anti-tumour podophyllotoxin derivative is advantageously administered in a dosage of 30 to 300 mg per square meter (mg/m 2 ) of body surface area, for example 50 to 250mg/m 2 , particularly for etoposide in a dosage of about 35 to 100 mg/m' and for teniposide in about 50 to 250 mg/m 2 per course of treatment.
- the anti-tumour vinca alkaloid is advantageously administered in a dosage of 2 to
- the an ti -tumour nucleoside derivative is advantageously administered in a dosage of 200 to 2500 mg per square meter (mg/m 2 ) of body surface area, for example 700 to
- the alkylating agents such as nitrogen mustard or nitrosourea is advantageously administered in a dosage of 100 to 500 mg per square meter (mg/m 2 ) of body surface area, for example 120 to 200 mg/m 2 .
- a dosage of 100 to 500 mg per square meter (mg/m 2 ) of body surface area for example 120 to 200 mg/m 2 .
- eye 1 opho spham i dc in a dosage of about 100 to 500 mg/m
- chlorambucil in a dosage of about 0.1 to 0.2 mg kg
- carmustine in a dosage of about 150 to 200 mg/m "
- lomustine in a dosage of about 100 to 150 mg/m 2 per course of treatment.
- the anti-tumour anthracycline derivative is advantageously administered in a dosage of 10 to 75 mg per square meter (mg/m 2 ) of body surface area, for example 15 to
- the antiestrogen agent is advantageously administered in a dosage of about 1 to 100 mg daily depending on the particular agent and the condition being treated.
- Tamoxifen is advantageously administered orally in a dosage of 5 to 50 mg, preferably 10 to 20 mg twice a day, continuing the therapy for sufficient time to achieve and maintain a therapeutic effect.
- Toremifene is advantageously administered orally in a dosage of about 60mg once a day, continuing the therapy for sufficient time to achieve and maintain a therapeutic effect.
- Anastrozole is advantageously administered orally in a dosage of about 1 mg once a day.
- Droloxifene is advantageously administered orally in a dosage of about 20- 1 0m g once a day.
- Raloxifene is advantageously admini tered orally in a dosage of about 6 mg once a day.
- Exemestane is advantageously
- Antibodies are advantageously administered in a dosage of about 1 to 5 mg per square meter (mg/m 2 ) of body surface area, or as known in the art, if different.
- Trastuzumab is advantageously administered in a dosage of 1 to 5 mg per square meter (mg n ) of body surface area, particularly 2 to 4m g m per course of treatment.
- dosages may be admini tered for example once, twice or more per course of treatment, which may be repeated for example every 7, 14, 21 or 28 days.
- the following examples illustrate the present invention. In case no specific
- stereochemistry is indicated for a stereocenter of a compound, this means that the compound was obtained as a mixture of the R and the S enantiomers.
- 'DCM' means dichloromethane
- 'Me' means methyl
- 'Et' means ethyl
- 'MeOH' means methanol
- 'DMF' means dimethylformamide
- 'Et 2 0' means diethyl ether
- 'EtOAc' means ethyl acetate
- 'THF' means tetrahydrofuran
- 'ACN' means acetonitrile
- 'EtOH' means ethanol
- 'DME' means 1,2-dimethoxyethane
- 'SFC means supercritical fluid chromatography
- 'MgSCV means magnesium sulfate
- 'q.s.' means quantum sufficit
- 'M.P.' means melting point
- 'iPrNH 2 ' means isopropyl amine
- 'DIPE' means diisopropylether
- 'K 2 C0 3 ' means potassium carbon
- 'TEA means trill uoroace ic acid
- 'rt' means room temperature
- 'PPI1 3 ' means triphenylphosphine
- 'DMAP' means dimethylaminopyridine
- 'Pd/C means palladium on carbon
- ' ⁇ ' ⁇ '" means te trabu tylam moni um fluoride
- ' ⁇ ' ⁇ ' ⁇ means methyl tcrt-butyl ether.
- 'Me-THF means 2-methyltetrahydrofuran.
- 'Boc' means t-butoxycarbonyl.
- 'Ms means methancsulfonyl ( mesyl).
- 'MsO' means mesylate.
- 'DIPEA' means diisopropylethylamine
- 'Xantphos' means (9,9-dimethyl-9H-xanthene- 4,5-diyl)bis[diphenylphosphine]
- 'XPhos' means dicyclohexyl[2',4',6'-tris(l- methylethyl)[l, l'-biphenyl]-2-yl]-phosphine
- 'NMP' means ⁇ '-methyl-2-pyrrolidone
- 'IIPLC means igh performance liquid chromatography.
- the filtrate was purified by chromatography over silica gel (irregular SiOH, 550g; gradient from 100% DCM to 90% DCM 10% CH 3 OH 0.1% NH 4 OH). The fractions containing the product were collected and evaporated to dryness yielding 17.3 g (54%) of intermediate 2.
- Acetyl chloride (6.8 mL; 96.2 mmol) was added dropwise to a solution of intermediate 2 ( (18.8 g; 80.2 mmol), triethylamine (16.8 mL; 0.12 mmol) in DCM (350 mL) at 5°C. The reaction mixture was stirred for 2 hours at room temperature. The solution was poured into water and the organic layer was separated then dried over MgSC ⁇ , filtered and evaporated until dryness.
- Imidazole (5.34 g; 35.4 mmol) was added to a mixture of intermediate 5 (7.2 g; 17.7 mmol), tert-butyldimethylchlorosilane (5 g; 74.3 mmol) in DMF (25 mL) and the reaction was stirred at room temperature for 15 hours. The mixture was poured into water and extracted with DCM. The organic layer was dried over MgSC ⁇ , filtered and evaporated to dryness.
- Methyl magnesium chloride (4.1 mL, 12 mmol) was added dropwise to a solution of intermediate 8 (2.0 g, 4.9 mmol) in dry THF (40 mL) at 0°C. The reaction mixture was stirred at 0°C for lhour then room temperature overnight.
- reaction mixture was poured onto a saturated solution of NH 4 CI and extracted with DCM.
- the organic layer was separated, dried over MgSO ⁇ filtered and evaporated to afford 2.1 g (98%) of intermediate 9 which was directly used in the next reaction step without any further treatment.
- Intermediate 10 was prepared according to an analogous procedure as described for the synthesis of intermediate 6, using intermediate 9 as starting material (99% ).
- the residue was purified by chromatography over silica gel (irregular SiOH, 300g; gradient from 100% DCM to 98% DCM 2% CH 3 OH 0.1% NH 4 OH). The fractions containing the product were collected and evaporated. The residue (7.2 g) was purified by chromatography over silica gel (irregular SiOH, 200g; gradient from 60% Heptane 5% MeOH 35% EtOAc). The fractions containing the product were collected and evaporated to afford 1.6 g (18%) of intermediate 14 and 1.8 g of intermediate 105.
- reaction mixture was quenched with a 10% aqueous solution of NH 4 CI and EtOAc was added.
- the organic layer was decanted, separated, washed with brine, dried over MgS0 4 , filtered and evaporated to dryness.
- Intermediate 42 was prepared according to an analogous procedure as described for the synthesis of intermediate 41, using intermediate 15 as starting material, and intermediate 42 was directly used in the next step without any further treatment.
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Immunology (AREA)
- Pulmonology (AREA)
- Neurosurgery (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Epidemiology (AREA)
- Reproductive Health (AREA)
- Urology & Nephrology (AREA)
- Psychiatry (AREA)
- Gynecology & Obstetrics (AREA)
- Hospice & Palliative Care (AREA)
- Pain & Pain Management (AREA)
- Transplantation (AREA)
- Cardiology (AREA)
- Hematology (AREA)
- Rheumatology (AREA)
- Pregnancy & Childbirth (AREA)
- Diabetes (AREA)
- Endocrinology (AREA)
- Heart & Thoracic Surgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Taps Or Cocks (AREA)
Priority Applications (23)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EA201791396A EA029789B1 (ru) | 2014-12-19 | 2015-12-18 | ПРОИЗВОДНЫЕ ИМИДАЗОПИРИДАЗИНА В КАЧЕСТВЕ ИНГИБИТОРОВ PI3Kβ |
| SM20190509T SMT201900509T1 (it) | 2014-12-19 | 2015-12-18 | Derivati di imidazopiridazina come inibitori di pi3kbeta |
| AU2015366190A AU2015366190B2 (en) | 2014-12-19 | 2015-12-18 | Imidazopyridazine derivatives as P13Kbeta inhibitors |
| LTEP15810784.7T LT3233862T (lt) | 2014-12-19 | 2015-12-18 | Imidazopiridazino dariniai, kaip pi3kbeta slopikliai |
| CN201580069133.7A CN107108634B (zh) | 2014-12-19 | 2015-12-18 | 作为PI3Kβ抑制剂的咪唑并哒嗪衍生物 |
| ES15810784T ES2761051T3 (es) | 2014-12-19 | 2015-12-18 | Derivados de imidazopiridazina como inhibidores de PI3Kbeta |
| BR112017012930A BR112017012930A2 (pt) | 2014-12-19 | 2015-12-18 | derivados de imidazopiridazina como inibidores de pi3kbeta. |
| CA2967551A CA2967551A1 (en) | 2014-12-19 | 2015-12-18 | Imidazopyridazine derivatives as pi3k.beta. inhibitors |
| JP2017532819A JP6568588B2 (ja) | 2014-12-19 | 2015-12-18 | PI3Kβ阻害剤としてのイミダゾピリダジン誘導体 |
| DK15810784.7T DK3233862T3 (da) | 2014-12-19 | 2015-12-18 | Imidazopyridazinderivater som pi3k-beta-inhibitorer |
| PL15810784T PL3233862T3 (pl) | 2014-12-19 | 2015-12-18 | Pochodne imidazopirydazyny jako inhibitory PI3Kbeta |
| MDE20170191 MD3233862T2 (ro) | 2014-12-19 | 2015-12-18 | Derivați ai imidazopiridazinei în calitate de inhibitori ai pΙ3Κbeta |
| MX2017008074A MX2017008074A (es) | 2014-12-19 | 2015-12-18 | DERIVADOS DE IMIDAZOPIRIDAZINA COMO INHIBIDORES DE FOSFOINOSITIDA-3-QUINASAS BETA (PI3Kß). |
| MA41174A MA41174B1 (fr) | 2014-12-19 | 2015-12-18 | Dérivés d'imidazopyridazine utilisés en tant qu'inhibiteurs de pi3kbeta |
| RSP20191225 RS59301B1 (sr) | 2014-12-19 | 2015-12-18 | Derivati imidazopiridazina kao pi3kbeta inhibitori |
| MEP-2019-263A ME03517B (me) | 2014-12-19 | 2015-12-18 | Derivati imidazopiridazina kao pi3kbeta inhibitori |
| SI201530855T SI3233862T1 (sl) | 2014-12-19 | 2015-12-18 | Derivati imidazopiridazina kot inhibitorji PI3Kbeta |
| US15/537,551 US10087187B2 (en) | 2014-12-19 | 2015-12-18 | Imidazopyridazine derivatives as PI3KB inhibitors |
| KR1020177016722A KR20170095239A (ko) | 2014-12-19 | 2015-12-18 | PI3Kβ 저해제로서의 이미다조피리다진 유도체 |
| EP15810784.7A EP3233862B1 (en) | 2014-12-19 | 2015-12-18 | Imidazopyridazine derivatives as pi3kbeta inhibitors |
| HRP20191550 HRP20191550T1 (hr) | 2014-12-19 | 2015-12-18 | Derivati imidazopiridazina kao inhibitori pi3kbeta |
| IL252866A IL252866B (en) | 2014-12-19 | 2017-06-13 | History of imidazopyridazine as pi3k beta inhibitors |
| CY20191101031T CY1122381T1 (el) | 2014-12-19 | 2019-10-03 | Παραγωγα ιμιδαζοπυριδαζινης ως αναστολεις pi3kbhta |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EPEP14199322.0 | 2014-12-19 | ||
| EP14199322 | 2014-12-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| WO2016097347A1 true WO2016097347A1 (en) | 2016-06-23 |
Family
ID=52134002
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PCT/EP2015/080604 Ceased WO2016097347A1 (en) | 2014-12-19 | 2015-12-18 | IMIDAZOPYRIDAZINE DERIVATIVES AS ΡΙ3Κβ INHIBITORS |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US10087187B2 (https=) |
| EP (1) | EP3233862B1 (https=) |
| JP (1) | JP6568588B2 (https=) |
| KR (1) | KR20170095239A (https=) |
| CN (1) | CN107108634B (https=) |
| AU (1) | AU2015366190B2 (https=) |
| BR (1) | BR112017012930A2 (https=) |
| CA (1) | CA2967551A1 (https=) |
| CY (1) | CY1122381T1 (https=) |
| DK (1) | DK3233862T3 (https=) |
| EA (1) | EA029789B1 (https=) |
| ES (1) | ES2761051T3 (https=) |
| HR (1) | HRP20191550T1 (https=) |
| HU (1) | HUE045220T2 (https=) |
| IL (1) | IL252866B (https=) |
| LT (1) | LT3233862T (https=) |
| MA (1) | MA41174B1 (https=) |
| MD (1) | MD3233862T2 (https=) |
| ME (1) | ME03517B (https=) |
| MX (1) | MX2017008074A (https=) |
| PL (1) | PL3233862T3 (https=) |
| PT (1) | PT3233862T (https=) |
| RS (1) | RS59301B1 (https=) |
| SI (1) | SI3233862T1 (https=) |
| SM (1) | SMT201900509T1 (https=) |
| WO (1) | WO2016097347A1 (https=) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2017060406A1 (en) | 2015-10-09 | 2017-04-13 | Janssen Pharmaceutica Nv | Quinoxaline and pyridopyrazine derivatives as pi3kbeta inhibitors |
| WO2018178280A1 (en) | 2017-03-29 | 2018-10-04 | Janssen Pharmaceutica Nv | Quinoxaline and pyridopyrazine derivatives as pi3k-beta inhibitors |
| CN110128505A (zh) * | 2019-05-21 | 2019-08-16 | 梯尔希(南京)药物研发有限公司 | 一种戈舍瑞林杂质的合成方法 |
| US10894793B2 (en) | 2016-06-16 | 2021-01-19 | Janssen Pharmaceutica Nv | Bicyclic pyridine, pyrazine, and pyrimidine derivatives as PI3K beta inhibitors |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP7637328B2 (ja) | 2019-02-07 | 2025-02-28 | ベイジーン リミテッド | Tlr7アゴニストとしてのイミダゾ[2,1-f][1,2,4]トリアジン-4-アミン誘導体 |
Citations (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2007038314A2 (en) | 2005-09-22 | 2007-04-05 | Bristol-Myers Squibb Company | Fused heterocyclic compounds useful as kinase modulators |
| WO2008008539A2 (en) | 2006-07-14 | 2008-01-17 | Amgen Inc. | Fused heterocyclic derivatives useful as inhibitors of the hepatocyte growth factor receptor |
| WO2008014219A2 (en) | 2006-07-24 | 2008-01-31 | Smithkline Beecham Corporation | Thiozolidinedione derivatives as p13 kinase inhibitors |
| WO2008030579A2 (en) | 2006-09-07 | 2008-03-13 | Biogen Idec Ma Inc. | Irak modulators for treating an inflammatory condition, cell proliferative disorder, immune disorder |
| WO2008138834A1 (en) | 2007-05-09 | 2008-11-20 | Novartis Ag | Substituted imidazopyridazines as pi3k lipid kinase inhibitors |
| WO2009060197A1 (en) | 2007-11-08 | 2009-05-14 | Centro Nacional De Investigaciones Oncologicas (Cnio) | Imidazopyridazines for use as protein kinase inhibitors |
| WO2009091374A2 (en) | 2008-01-15 | 2009-07-23 | Amgen Inc. | Fused heterocyclic derivatives and methods of use |
| WO2010007099A1 (en) | 2008-07-15 | 2010-01-21 | Cellzome Limited | 2-aminoimidazo[1,2-b]pyridazine derivatives as pi3k inhibitors |
| WO2011022439A1 (en) | 2009-08-17 | 2011-02-24 | Intellikine, Inc. | Heterocyclic compounds and uses thereof |
| WO2011047770A2 (de) | 2009-10-19 | 2011-04-28 | Merck Patent Gmbh | Pyrazolopyrimidinderivate |
| WO2011058109A1 (en) | 2009-11-12 | 2011-05-19 | Ucb Pharma S.A. | Fused bicyclic pyrrole and imidazole derivatives as kinase inhibitors |
| WO2011123751A2 (en) | 2010-04-02 | 2011-10-06 | Amgen Inc. | Heterocyclic compounds and their uses |
| WO2012047538A1 (en) | 2010-10-06 | 2012-04-12 | Glaxosmithkline Llc | Benzimidazole derivatives as pi3 kinase inhibitors |
| WO2012116237A2 (en) | 2011-02-23 | 2012-08-30 | Intellikine, Llc | Heterocyclic compounds and uses thereof |
| WO2013028263A1 (en) | 2011-08-24 | 2013-02-28 | Glaxosmithkline Llc | Pyrazolopyrimidine derivatives as pi3 kinase inhibitors |
| US20130157977A1 (en) | 2011-12-20 | 2013-06-20 | Glaxosmithkline Llc | Benzimidazole Boronic Acid Derivatives As PI3 Kinase Inhibitors |
| WO2013095761A1 (en) | 2011-12-20 | 2013-06-27 | Glaxosmithkline Llc | Imidazopyridine derivatives as pi3 kinase inhibitors |
| WO2014078211A1 (en) | 2012-11-14 | 2014-05-22 | Calitor Sciences, Llc | Heteroaromatic compounds as pi3 kinase modulators and methods of use |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PE20091468A1 (es) * | 2008-02-28 | 2009-10-22 | Novartis Ag | DERIVADOS DE 3-METIL-IMIDAZO-[1,2-b]-PIRIDAZINA |
| GB201321734D0 (en) * | 2013-12-09 | 2014-01-22 | Ucb Pharma Sa | Therapeutic Agents |
-
2015
- 2015-12-18 MA MA41174A patent/MA41174B1/fr unknown
- 2015-12-18 ES ES15810784T patent/ES2761051T3/es active Active
- 2015-12-18 JP JP2017532819A patent/JP6568588B2/ja not_active Expired - Fee Related
- 2015-12-18 EP EP15810784.7A patent/EP3233862B1/en active Active
- 2015-12-18 RS RSP20191225 patent/RS59301B1/sr unknown
- 2015-12-18 BR BR112017012930A patent/BR112017012930A2/pt active Search and Examination
- 2015-12-18 AU AU2015366190A patent/AU2015366190B2/en not_active Ceased
- 2015-12-18 HR HRP20191550 patent/HRP20191550T1/hr unknown
- 2015-12-18 DK DK15810784.7T patent/DK3233862T3/da active
- 2015-12-18 PT PT158107847T patent/PT3233862T/pt unknown
- 2015-12-18 HU HUE15810784A patent/HUE045220T2/hu unknown
- 2015-12-18 WO PCT/EP2015/080604 patent/WO2016097347A1/en not_active Ceased
- 2015-12-18 MX MX2017008074A patent/MX2017008074A/es active IP Right Grant
- 2015-12-18 CA CA2967551A patent/CA2967551A1/en active Pending
- 2015-12-18 SM SM20190509T patent/SMT201900509T1/it unknown
- 2015-12-18 US US15/537,551 patent/US10087187B2/en active Active
- 2015-12-18 CN CN201580069133.7A patent/CN107108634B/zh not_active Expired - Fee Related
- 2015-12-18 LT LTEP15810784.7T patent/LT3233862T/lt unknown
- 2015-12-18 SI SI201530855T patent/SI3233862T1/sl unknown
- 2015-12-18 MD MDE20170191 patent/MD3233862T2/ro not_active IP Right Cessation
- 2015-12-18 ME MEP-2019-263A patent/ME03517B/me unknown
- 2015-12-18 KR KR1020177016722A patent/KR20170095239A/ko not_active Ceased
- 2015-12-18 EA EA201791396A patent/EA029789B1/ru not_active IP Right Cessation
- 2015-12-18 PL PL15810784T patent/PL3233862T3/pl unknown
-
2017
- 2017-06-13 IL IL252866A patent/IL252866B/en active IP Right Grant
-
2019
- 2019-10-03 CY CY20191101031T patent/CY1122381T1/el unknown
Patent Citations (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2007038314A2 (en) | 2005-09-22 | 2007-04-05 | Bristol-Myers Squibb Company | Fused heterocyclic compounds useful as kinase modulators |
| WO2008008539A2 (en) | 2006-07-14 | 2008-01-17 | Amgen Inc. | Fused heterocyclic derivatives useful as inhibitors of the hepatocyte growth factor receptor |
| WO2008014219A2 (en) | 2006-07-24 | 2008-01-31 | Smithkline Beecham Corporation | Thiozolidinedione derivatives as p13 kinase inhibitors |
| WO2008030579A2 (en) | 2006-09-07 | 2008-03-13 | Biogen Idec Ma Inc. | Irak modulators for treating an inflammatory condition, cell proliferative disorder, immune disorder |
| WO2008138834A1 (en) | 2007-05-09 | 2008-11-20 | Novartis Ag | Substituted imidazopyridazines as pi3k lipid kinase inhibitors |
| WO2009060197A1 (en) | 2007-11-08 | 2009-05-14 | Centro Nacional De Investigaciones Oncologicas (Cnio) | Imidazopyridazines for use as protein kinase inhibitors |
| WO2009091374A2 (en) | 2008-01-15 | 2009-07-23 | Amgen Inc. | Fused heterocyclic derivatives and methods of use |
| WO2010007099A1 (en) | 2008-07-15 | 2010-01-21 | Cellzome Limited | 2-aminoimidazo[1,2-b]pyridazine derivatives as pi3k inhibitors |
| WO2011022439A1 (en) | 2009-08-17 | 2011-02-24 | Intellikine, Inc. | Heterocyclic compounds and uses thereof |
| WO2011047770A2 (de) | 2009-10-19 | 2011-04-28 | Merck Patent Gmbh | Pyrazolopyrimidinderivate |
| WO2011058109A1 (en) | 2009-11-12 | 2011-05-19 | Ucb Pharma S.A. | Fused bicyclic pyrrole and imidazole derivatives as kinase inhibitors |
| WO2011123751A2 (en) | 2010-04-02 | 2011-10-06 | Amgen Inc. | Heterocyclic compounds and their uses |
| WO2012047538A1 (en) | 2010-10-06 | 2012-04-12 | Glaxosmithkline Llc | Benzimidazole derivatives as pi3 kinase inhibitors |
| WO2012116237A2 (en) | 2011-02-23 | 2012-08-30 | Intellikine, Llc | Heterocyclic compounds and uses thereof |
| WO2013028263A1 (en) | 2011-08-24 | 2013-02-28 | Glaxosmithkline Llc | Pyrazolopyrimidine derivatives as pi3 kinase inhibitors |
| US20130157977A1 (en) | 2011-12-20 | 2013-06-20 | Glaxosmithkline Llc | Benzimidazole Boronic Acid Derivatives As PI3 Kinase Inhibitors |
| WO2013095761A1 (en) | 2011-12-20 | 2013-06-27 | Glaxosmithkline Llc | Imidazopyridine derivatives as pi3 kinase inhibitors |
| WO2014078211A1 (en) | 2012-11-14 | 2014-05-22 | Calitor Sciences, Llc | Heteroaromatic compounds as pi3 kinase modulators and methods of use |
Non-Patent Citations (12)
| Title |
|---|
| B. VANHAESEBROECK; M.D. WATERFIELD, EXPERIMENTAL CELL RESEARCH.,, vol. 253, 1999, pages 239 - 254 |
| D. R. CALNAN; A. BRUNET, ONCOGENE, vol. 27, 2008, pages 2276 |
| JIA S; LIU Z; ZHANG S; LIU P; ZHANG L; LEE SH; ZHANG J; SIGNORETTI S; LODA M; ROBERTS TM, NATURE, vol. 454, 2008, pages 776 - 9 |
| K.D COURTNEY, R.B. CORCORAN AND J.A. ENGELMAN, JOURNAL OF CLINICAL ONCOLOGY, vol. 28, 2010, pages 1075 |
| K.D COURTNEY; R.B. CORCORAN; J.A. ENGELMAN, JOURNAL OF CLINICAL ONCOLOGY, vol. 28, 2010, pages 1075 |
| K.D COURTNEY; R.B. CORCORAN; J.A. ENGELMAN, JOURNAL OF CLINICAL ONCOLOGY., vol. 28, 2010, pages 1075 |
| MARQUES RB ET AL.: "High Efficacy of Combination Therapy Using PI3K/AKT Inhibitors with Androgen Deprivation in Prostate Cancer Preclinical Models", EUR UROL, 2014, Retrieved from the Internet <URL:http://dx.doi.org/10.1016/j.eururo.2014.08.053> |
| MYERS M. P; PASS I; BATTY I. H; VAN DER KAAY J; STOLAROV J. P; HEMMINGS B. A; WIGLER M. H; DOWNES C. P; TONKS N. K, PROC. NATL.ACAD. SCI, vol. 95, 1998, pages 13513 - 13518 |
| S. P. JACKSO ET AL., NATURE MEDICINE, vol. 11, 2005, pages 507 - 514 |
| SCIENCE, vol. 277, 1997, pages 567 - 570 |
| WEE S; WIEDERSCHAIN D; MAIRA SM; LOO A; MILLER C; DEBEAUMONT R; STEGMEIER F; YAO YM; LENGAUER C, PROC. NATL. ACAD. SCI (USA), vol. 105, 2008, pages 13057 |
| ZHAO L.; VOGT P. K., ONCOGENE, vol. 27, 2008, pages 5486 - 5496 |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2017060406A1 (en) | 2015-10-09 | 2017-04-13 | Janssen Pharmaceutica Nv | Quinoxaline and pyridopyrazine derivatives as pi3kbeta inhibitors |
| US10526316B2 (en) | 2015-10-09 | 2020-01-07 | Janssen Pharmaceutica Nv | Quinoxaline and pyridopyrazine derivatives as PI3Kβ inhibitors |
| US10894793B2 (en) | 2016-06-16 | 2021-01-19 | Janssen Pharmaceutica Nv | Bicyclic pyridine, pyrazine, and pyrimidine derivatives as PI3K beta inhibitors |
| WO2018178280A1 (en) | 2017-03-29 | 2018-10-04 | Janssen Pharmaceutica Nv | Quinoxaline and pyridopyrazine derivatives as pi3k-beta inhibitors |
| US11130751B2 (en) | 2017-03-29 | 2021-09-28 | Janssen Pharmaceutica Nv | Quinoxaline and pyridopyrazine derivatives as PI3K-beta inhibitors |
| CN110128505A (zh) * | 2019-05-21 | 2019-08-16 | 梯尔希(南京)药物研发有限公司 | 一种戈舍瑞林杂质的合成方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| CN107108634B (zh) | 2020-09-15 |
| MA41174B1 (fr) | 2019-09-30 |
| SI3233862T1 (sl) | 2019-09-30 |
| AU2015366190B2 (en) | 2020-01-23 |
| EA201791396A1 (ru) | 2017-10-31 |
| PT3233862T (pt) | 2019-10-09 |
| US10087187B2 (en) | 2018-10-02 |
| EA029789B1 (ru) | 2018-05-31 |
| HUE045220T2 (hu) | 2019-12-30 |
| US20180002336A1 (en) | 2018-01-04 |
| CN107108634A (zh) | 2017-08-29 |
| MX2017008074A (es) | 2018-01-09 |
| EP3233862A1 (en) | 2017-10-25 |
| IL252866A0 (en) | 2017-08-31 |
| SMT201900509T1 (it) | 2019-11-13 |
| JP2017538734A (ja) | 2017-12-28 |
| HRP20191550T1 (hr) | 2019-11-29 |
| RS59301B1 (sr) | 2019-10-31 |
| BR112017012930A2 (pt) | 2018-01-09 |
| CY1122381T1 (el) | 2021-01-27 |
| MA41174A (fr) | 2017-10-25 |
| ES2761051T3 (es) | 2020-05-18 |
| DK3233862T3 (da) | 2019-10-07 |
| MD3233862T2 (ro) | 2019-11-30 |
| IL252866B (en) | 2020-09-30 |
| CA2967551A1 (en) | 2016-06-23 |
| KR20170095239A (ko) | 2017-08-22 |
| ME03517B (me) | 2020-04-20 |
| JP6568588B2 (ja) | 2019-08-28 |
| AU2015366190A1 (en) | 2017-05-25 |
| LT3233862T (lt) | 2019-09-10 |
| EP3233862B1 (en) | 2019-07-03 |
| PL3233862T3 (pl) | 2020-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR102472198B1 (ko) | Pi3k 베타 저해제로서의 아자벤즈이미다졸 유도체 | |
| ES2731216T3 (es) | Nuevos compuestos | |
| AU2015366190B2 (en) | Imidazopyridazine derivatives as P13Kbeta inhibitors | |
| EP3233839B1 (en) | Heterocyclyl linked imidazopyridazine derivatives as pi3kbeta inhibitors | |
| KR102472453B1 (ko) | Pi3k 베타 저해제로서의 이환식 피리딘, 피라진, 및 피리미딘 유도체 | |
| WO2018178280A1 (en) | Quinoxaline and pyridopyrazine derivatives as pi3k-beta inhibitors | |
| BR112018075999B1 (pt) | Derivados de piridina, pirazina e pirimidina bicíclicos como inibidores de pi3k beta |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 121 | Ep: the epo has been informed by wipo that ep was designated in this application |
Ref document number: 15810784 Country of ref document: EP Kind code of ref document: A1 |
|
| ENP | Entry into the national phase |
Ref document number: 2967551 Country of ref document: CA |
|
| ENP | Entry into the national phase |
Ref document number: 2015366190 Country of ref document: AU Date of ref document: 20151218 Kind code of ref document: A |
|
| REEP | Request for entry into the european phase |
Ref document number: 2015810784 Country of ref document: EP |
|
| WWE | Wipo information: entry into national phase |
Ref document number: 252866 Country of ref document: IL |
|
| ENP | Entry into the national phase |
Ref document number: 20177016722 Country of ref document: KR Kind code of ref document: A Ref document number: 2017532819 Country of ref document: JP Kind code of ref document: A |
|
| WWE | Wipo information: entry into national phase |
Ref document number: MX/A/2017/008074 Country of ref document: MX |
|
| NENP | Non-entry into the national phase |
Ref country code: DE |
|
| WWE | Wipo information: entry into national phase |
Ref document number: 15537551 Country of ref document: US |
|
| REG | Reference to national code |
Ref country code: BR Ref legal event code: B01A Ref document number: 112017012930 Country of ref document: BR |
|
| WWE | Wipo information: entry into national phase |
Ref document number: 201791396 Country of ref document: EA |
|
| ENP | Entry into the national phase |
Ref document number: 112017012930 Country of ref document: BR Kind code of ref document: A2 Effective date: 20170616 |