US5884555A - Griddle structure - Google Patents
Griddle structure Download PDFInfo
- Publication number
- US5884555A US5884555A US09/074,729 US7472998A US5884555A US 5884555 A US5884555 A US 5884555A US 7472998 A US7472998 A US 7472998A US 5884555 A US5884555 A US 5884555A
- Authority
- US
- United States
- Prior art keywords
- griddle
- plate
- holes
- hole
- griddle plate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000004519 grease Substances 0.000 claims abstract description 17
- 239000004020 conductor Substances 0.000 claims abstract description 5
- 239000007787 solid Substances 0.000 description 3
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 239000012634 fragment Substances 0.000 description 2
- 235000019737 Animal fat Nutrition 0.000 description 1
- 208000008589 Obesity Diseases 0.000 description 1
- 235000021168 barbecue Nutrition 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 235000020824 obesity Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Images
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47J—KITCHEN EQUIPMENT; COFFEE MILLS; SPICE MILLS; APPARATUS FOR MAKING BEVERAGES
- A47J37/00—Baking; Roasting; Grilling; Frying
- A47J37/06—Roasters; Grills; Sandwich grills
- A47J37/067—Horizontally disposed broiling griddles
Definitions
- Grilles are popular for family occasions for making steak, toast, or the like and are normally an accessory part of the oven. Nevertheless, some people think such grilles are inconvenient since they prefer the fun of making steak on the table and/or furthermore, to use the grille for outdoor barbecue.
- the portable griddle structure is developed to overcome the size problem of the oven.
- the design of the conventional grille is not healthy for our diet. While making steak, or the like, grease remains with the steak and a substantial amount of the animal fat is taken in which increases the cholesterol level in our body. This could give rise to weight and heart problems, produce obesity and even cause death.
- FIG. 1 is an exploded view of an improved griddle structure according to the present invention
- FIG. 3 is a perspective view of the assembled griddle structure according to the present invention.
- FIG. 4 is the cross sectional view of a fragment of the griddle structure showing the direction of the drip flow according to the present invention.
- FIG. 6 shows the alternative opposite face of the griddle plate in the second embodiment
- FIG. 7 is a perspective view of the assembled second embodiment of the griddle structure according to the present invention.
- FIG. 8 is a cross sectional view of a fragment of the second embodiment of the griddle structure showing the direction of the drip flow according to the present invention.
- a griddle structure 1 comprising a griddle plate 2, a reflective plate 3, and a base container 4.
- the griddle plate 2 is formed with two recessed faces, one with wave-shaped strips 22 and the other face being a flat surface 25.
- a groove 24 is formed between each of the concave faces 22, 25 and the upward rim 26, next to each groove, with the groove having a slope.
- One or more through holes 21 are formed at the bottom of the slope of the groove.
- Two handles 23 are attached to two ends of the griddle plate. One is the power receiver from an external power supply.
- the reflective plate 3 is made of a reflective material, preferably metal, and has two openings formed on the rim 34 of the reflective plate 3 for placement of the handles 23.
- the plate is placed between the base container 4 and the griddle plate 2 for heat collection is and storage.
- a plurality of through holes 31 are formed in the base of the reflective plate 3 next to the rim 34 and are positioned with respect to the through holes 21 of the griddle plate 2 to allow the dripping grease to pass through.
- a screw hole 35 is at each corner of the reflective plate 3 receives an inserted screw 32 to be affixed to a block 33 to maintain a distance between the reflective plate 3 and the base container 4.
- the base container 4 has two openings for the insertion of the handles 23 of the griddle plate 2.
- Collecting means 41 are built in the base container 4 and act as a drawer which is removably inserted into a cavity 42.
- the collecting means 41 is positioned with respect to the through holes 21 of the griddle plate 2 and through holes 31 of the reflective plate 3 to receive dripping grease therein from steak or the like.
- the arrow indicates the flow of the grease drip. Firstly, the grease leaves the surface of the griddle plate 2 into the groove 24 and then passes the through hole 21. It then passes through the through hole 31 and is received by the collecting means 41. Once the drip stops and/or the collecting mean 41 is full, the collecting mean 41 may be removed for cleaning up.
- FIGS. 5 to 8 show the griddle structure 1 defining the second preferred embodiment.
- This griddle structure 1 also comprises a griddle plate 2, a reflective plate 3 and a base container 4. It further comprises the oil conducting pipe 5.
- the plurality of through holes 21 from the griddle plate 2 come together at the through hole 27 which is bent at an angle away from the griddle plate 2. It receives the oil outlet pipe which directs grease away from the griddle plate 2.
- the pipe 5 is heat resistant and is formed of two parts, the solid part 51 and the flexible part 52.
- the solid part 51 of the pipe 5 is inserted into the through hole 27 through the through holes 36 and 44 of the reflective plate 3 and base container 4, respectively.
- the flexible part 52 of the pipe 5 past the solid part and is bent toward the desired direction toward an external collecting mean (not shown).
Landscapes
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Food-Manufacturing Devices (AREA)
Abstract
Description
Claims (8)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US09/074,729 US5884555A (en) | 1998-05-07 | 1998-05-07 | Griddle structure |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US09/074,729 US5884555A (en) | 1998-05-07 | 1998-05-07 | Griddle structure |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US5884555A true US5884555A (en) | 1999-03-23 |
Family
ID=22121317
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US09/074,729 Expired - Fee Related US5884555A (en) | 1998-05-07 | 1998-05-07 | Griddle structure |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | US5884555A (en) |
Cited By (82)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5967024A (en) * | 1999-04-16 | 1999-10-19 | Demars; Robert A. | Juice removal frying pan |
| US6024014A (en) * | 1999-03-02 | 2000-02-15 | Hiraoka & Co. ( H.K. ) , Ltd. | Portable reversible grill with improved fluid drainage |
| US6064042A (en) * | 1999-02-19 | 2000-05-16 | Appliance Development Corporation | Reversible self-contained cooking appliance |
| USD429946S (en) * | 1999-03-19 | 2000-08-29 | Main Power Electrical Factory Ltd. | Electric grill |
| USD431152S (en) * | 1999-03-19 | 2000-09-26 | Main Power Electrical Factory Ltd. | Electric grill |
| USD432855S (en) * | 1999-01-19 | 2000-10-31 | Kinetic Group, L.L.C. | Partially ribbed cooking grill |
| USD436796S1 (en) | 1999-06-15 | 2001-01-30 | National Presto Industries, Inc. | Indoor grill |
| USD441250S1 (en) | 1999-08-09 | 2001-05-01 | Goodway Electrical Co. Ltd. | Grill |
| USD452630S1 (en) | 1999-08-09 | 2002-01-01 | Goodway Electrical Co. Ltd. | Grill |
| US6415710B1 (en) * | 2001-06-08 | 2002-07-09 | Gary Roger Boone | Grease collection system |
| US6433312B1 (en) * | 1999-11-23 | 2002-08-13 | Hamilton Beach/Proctor-Silex, Inc. | Electric roaster |
| USD463202S1 (en) | 2001-08-21 | 2002-09-24 | Michael A. Smith | Grilling pan for barbecue |
| US6523460B1 (en) | 2001-07-31 | 2003-02-25 | Rita T. Lange | Skillet with interchangeable perforated bottom plates |
| US20040211406A1 (en) * | 2003-04-24 | 2004-10-28 | Randall Cornfield | Multi-purpose stovetop grilling and cooking device |
| US6837152B1 (en) * | 2003-12-12 | 2005-01-04 | Fancy Food Service Equipment Co., Ltd. | Water-cooled muffler device for a grill apparatus |
| USD505044S1 (en) * | 2003-10-28 | 2005-05-17 | Poking Industrial Company, Ltd. | Reversible grill |
| US6930288B1 (en) * | 2004-03-01 | 2005-08-16 | Tsann Kuen Enterprise Co., Ltd. | Cooking device with a warming compartment |
| US20060150827A1 (en) * | 2003-06-24 | 2006-07-13 | Bruno Adrian A | Grilling apparatus |
| US20070137499A1 (en) * | 2005-11-23 | 2007-06-21 | Sunbeam Products, Inc. | Cooking appliance with removable cooking surface |
| US7381929B2 (en) * | 2005-06-27 | 2008-06-03 | Patent 2000, S.L. | Portable griddle |
| WO2008141527A1 (en) * | 2007-05-22 | 2008-11-27 | Tuming You | An oil drain easily oven |
| US20090090348A1 (en) * | 2007-10-03 | 2009-04-09 | Contarino Jr Alfred F | Cooking grill |
| USD593791S1 (en) * | 2007-10-10 | 2009-06-09 | Domo Vision Ag | Table grill device |
| WO2009109143A1 (en) * | 2008-03-06 | 2009-09-11 | You Tuming | Fry-baking oven draining oil easily |
| USD610405S1 (en) * | 2009-05-12 | 2010-02-23 | Mcconnell Evan | Grill grate |
| USD644059S1 (en) * | 2010-06-02 | 2011-08-30 | Pi-Design Ag | Electric grill |
| USD651851S1 (en) * | 2011-03-31 | 2012-01-10 | Ibc-Hearthware, Inc. | Grill |
| USD660640S1 (en) * | 2011-09-09 | 2012-05-29 | De'Longhi Appliances SRL Con Unico Socio | Electric grill |
| USD676272S1 (en) * | 2012-06-14 | 2013-02-19 | Tsann Kuen (Zhangzhou) Enterprise Co., Ltd. | Griddle |
| USD685605S1 (en) * | 2012-11-19 | 2013-07-09 | Xinhua Electric Appliance Co., Ltd. | Grill having oil tray and detachable and reversible grill plate |
| USD697752S1 (en) * | 2012-10-09 | 2014-01-21 | De' Longhi Appliances S.R.L. Con Unico Socio | Grill |
| USD697757S1 (en) | 2012-11-20 | 2014-01-21 | Xinhua Electric Appliance Co., Ltd. | Detachable and reversible grill plate |
| USD702500S1 (en) * | 2012-03-07 | 2014-04-15 | Zojirushi Corporation | Grill plate |
| USD709727S1 (en) * | 2012-10-17 | 2014-07-29 | Magellan Group, Ltd. | Modular griddle and grill frame with inserts |
| USD711186S1 (en) * | 2012-10-09 | 2014-08-19 | De Longhi Appliances S.R.L. CON UNICO SOCIO | Grill |
| USD723324S1 (en) * | 2013-08-28 | 2015-03-03 | Ferstavi Holdings Inc. | Combination baking pan and cooling rack |
| USD730679S1 (en) * | 2013-10-12 | 2015-06-02 | Tsann Kuen (Zhangzhou) Enterprise Co., Ltd. | Grill cookware |
| USD734987S1 (en) * | 2014-03-14 | 2015-07-28 | Lawrence Coats | Reversible griddle |
| US9192265B1 (en) * | 2012-10-16 | 2015-11-24 | Jeffrey A. Johnson | Grease collector receptacle and cooking utensil for use therewith |
| US20150335200A1 (en) * | 2014-05-23 | 2015-11-26 | Viking Range, Llc | Griddle |
| US9289097B2 (en) | 2013-03-11 | 2016-03-22 | Afc Business Ventures, Llc | Apparatus for converting hinged-lid cooking grills for cooking pizza |
| USD757493S1 (en) * | 2014-01-15 | 2016-05-31 | Samsung Electronics Co., Ltd. | Electronic grill for oven |
| USD758786S1 (en) * | 2015-03-05 | 2016-06-14 | Spectrum Brands, Inc. | Griddle |
| USD760019S1 (en) * | 2015-03-06 | 2016-06-28 | Spectrum Brands, Inc. | Griddle |
| USD760018S1 (en) * | 2015-03-05 | 2016-06-28 | Spectrum Brands, Inc. | Griddle |
| CN106308543A (en) * | 2015-06-19 | 2017-01-11 | 镇江江城金属制品有限公司 | Barbecue grill capable of easily discharging oil |
| US9668615B2 (en) | 2010-03-08 | 2017-06-06 | Afc Business Ventures, Llc | Apparatus for converting kettle or kamado style cooking grills for cooking pizza |
| US9681775B2 (en) | 2012-11-15 | 2017-06-20 | Afc Business Ventures, Llc | Apparatus for cooking pizza in kettle- or kamado-style cooking grills |
| USD793161S1 (en) * | 2016-02-11 | 2017-08-01 | Trinidad Benham Corporation | Grill liner |
| CN107198466A (en) * | 2017-08-01 | 2017-09-26 | 刘盛松 | Healthy and environment-friendly cooking device with oil interception plate |
| USD802991S1 (en) * | 2016-01-28 | 2017-11-21 | Tefal | Accessory for electric grill |
| USD804898S1 (en) * | 2017-06-26 | 2017-12-12 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD804899S1 (en) * | 2017-06-26 | 2017-12-12 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD806471S1 (en) * | 2016-02-11 | 2018-01-02 | Trinidad Benham Corporation | Grilling pan |
| USD812974S1 (en) * | 2016-08-01 | 2018-03-20 | Cna International Inc. | Steamer plate |
| USD814238S1 (en) | 2016-03-25 | 2018-04-03 | Afc Business Ventures, Llc | Accessory for barbecue grills |
| USD820032S1 (en) | 2015-12-01 | 2018-06-12 | Tristar Products, Inc. | Pan |
| USD823639S1 (en) * | 2016-08-08 | 2018-07-24 | Gibson Overseas Inc | Pioneer woman butterfly griddle |
| USD825255S1 (en) | 2015-11-17 | 2018-08-14 | Tristar Products, Inc. | Griddle |
| USD825980S1 (en) | 2015-11-17 | 2018-08-21 | Ke M.O. House Co., Ltd. | Pan |
| CN108497946A (en) * | 2017-12-29 | 2018-09-07 | 金华乐嘉厨具有限公司 | A kind of foldable barbecue disk |
| US10105008B2 (en) | 2013-08-06 | 2018-10-23 | Afc Business Ventures, Llc | Hinged-lid cooking grill for cooking pizza and the like |
| US10327589B1 (en) | 2016-05-04 | 2019-06-25 | North Atlantic Imports, Llc | Outdoor cooking station with griddle, system and method thereof |
| US10327588B2 (en) | 2016-05-04 | 2019-06-25 | North Atlantic Imports, Llc | Griddle device, system, and method |
| USD858175S1 (en) * | 2018-02-09 | 2019-09-03 | Lekue, Sl | Grill for microwave oven |
| USD859061S1 (en) | 2019-01-31 | 2019-09-10 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD880931S1 (en) * | 2018-08-21 | 2020-04-14 | Guangdong Midea Consumer Electric Manufacturing Co., Ltd. | Cooking plate |
| USD883018S1 (en) | 2019-01-31 | 2020-05-05 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD883019S1 (en) | 2019-01-31 | 2020-05-05 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD883020S1 (en) | 2019-01-31 | 2020-05-05 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD909115S1 (en) * | 2018-04-26 | 2021-02-02 | Kokubo & Co., Ltd. | Container for cooking |
| USD966030S1 (en) * | 2020-11-24 | 2022-10-11 | Lekue, S.L. | Barbecue grill |
| USD971668S1 (en) * | 2022-08-09 | 2022-12-06 | elago CO. LTD | Oven tray |
| USD988062S1 (en) * | 2020-09-16 | 2023-06-06 | StoreBound LLC | Electric griddle |
| USD998408S1 (en) * | 2021-07-14 | 2023-09-12 | Hyunho Kang | Electric grill |
| USD1030402S1 (en) * | 2022-08-28 | 2024-06-11 | Zhengying Qiu | Set of collapsible baking pans |
| USD1034050S1 (en) * | 2022-07-23 | 2024-07-09 | Jingxing Zhou | Air fryer basket |
| USD1036189S1 (en) * | 2022-11-01 | 2024-07-23 | Daobin Yu | Air fryer basket |
| USD1038687S1 (en) * | 2024-03-27 | 2024-08-13 | Xin Chen | Texture pattern cookie sheet |
| US12318037B1 (en) * | 2023-11-25 | 2025-06-03 | Shenzhen Terra Maestro Technology Co., Ltd. | Electric arc grill with oil receiving plate |
| USD1095130S1 (en) * | 2024-09-10 | 2025-09-30 | Ningbo Saian Intelligent Technology Co., Ltd. | Grill for microwave oven |
| USD1097680S1 (en) * | 2024-08-19 | 2025-10-14 | Hongfa Zhang | Electric grill |
Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US850058A (en) * | 1906-11-14 | 1907-04-09 | Jonas W Ross | Broiler. |
| US1732910A (en) * | 1928-08-07 | 1929-10-22 | American Stove Co | Combined broiler and roasting pan |
| US2703078A (en) * | 1953-02-02 | 1955-03-01 | Jr John Hays Hammond | Cooking stove with renewable cooking surface |
| US2774295A (en) * | 1952-12-13 | 1956-12-18 | Wm B Watkins Co | Ribbed grill |
| US3308747A (en) * | 1963-08-01 | 1967-03-14 | Spagnolo Armando | Grillers and like appliances |
| US3407723A (en) * | 1967-01-16 | 1968-10-29 | Joseph C. Varkala | Bacon cooker |
| US3418921A (en) * | 1966-04-25 | 1968-12-31 | Vulcan Hart Corp | Broiler |
| US3842726A (en) * | 1973-08-20 | 1974-10-22 | Wolf Range Co | Grooved griddle |
| US3938431A (en) * | 1974-12-06 | 1976-02-17 | Potvin Alfred M | Electric grill appliance |
| US4352324A (en) * | 1980-11-10 | 1982-10-05 | Noh Edwin C S | Frying pan with a removable grease catcher |
| US4606261A (en) * | 1983-11-30 | 1986-08-19 | Dario Bernardi | Gridiron for grilling food items by reflected heat |
| US5237914A (en) * | 1992-11-30 | 1993-08-24 | Carstensen Morris A | Cooking grill assembly |
| US5365038A (en) * | 1992-02-14 | 1994-11-15 | Kabushiki Kaisha Nissei Giken | Covered defroster with a defrosting plate over a latent heat source |
-
1998
- 1998-05-07 US US09/074,729 patent/US5884555A/en not_active Expired - Fee Related
Patent Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US850058A (en) * | 1906-11-14 | 1907-04-09 | Jonas W Ross | Broiler. |
| US1732910A (en) * | 1928-08-07 | 1929-10-22 | American Stove Co | Combined broiler and roasting pan |
| US2774295A (en) * | 1952-12-13 | 1956-12-18 | Wm B Watkins Co | Ribbed grill |
| US2703078A (en) * | 1953-02-02 | 1955-03-01 | Jr John Hays Hammond | Cooking stove with renewable cooking surface |
| US3308747A (en) * | 1963-08-01 | 1967-03-14 | Spagnolo Armando | Grillers and like appliances |
| US3418921A (en) * | 1966-04-25 | 1968-12-31 | Vulcan Hart Corp | Broiler |
| US3407723A (en) * | 1967-01-16 | 1968-10-29 | Joseph C. Varkala | Bacon cooker |
| US3842726A (en) * | 1973-08-20 | 1974-10-22 | Wolf Range Co | Grooved griddle |
| US3938431A (en) * | 1974-12-06 | 1976-02-17 | Potvin Alfred M | Electric grill appliance |
| US4352324A (en) * | 1980-11-10 | 1982-10-05 | Noh Edwin C S | Frying pan with a removable grease catcher |
| US4606261A (en) * | 1983-11-30 | 1986-08-19 | Dario Bernardi | Gridiron for grilling food items by reflected heat |
| US5365038A (en) * | 1992-02-14 | 1994-11-15 | Kabushiki Kaisha Nissei Giken | Covered defroster with a defrosting plate over a latent heat source |
| US5237914A (en) * | 1992-11-30 | 1993-08-24 | Carstensen Morris A | Cooking grill assembly |
Cited By (99)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD432855S (en) * | 1999-01-19 | 2000-10-31 | Kinetic Group, L.L.C. | Partially ribbed cooking grill |
| US6064042A (en) * | 1999-02-19 | 2000-05-16 | Appliance Development Corporation | Reversible self-contained cooking appliance |
| US6024014A (en) * | 1999-03-02 | 2000-02-15 | Hiraoka & Co. ( H.K. ) , Ltd. | Portable reversible grill with improved fluid drainage |
| USD429946S (en) * | 1999-03-19 | 2000-08-29 | Main Power Electrical Factory Ltd. | Electric grill |
| USD431152S (en) * | 1999-03-19 | 2000-09-26 | Main Power Electrical Factory Ltd. | Electric grill |
| US5967024A (en) * | 1999-04-16 | 1999-10-19 | Demars; Robert A. | Juice removal frying pan |
| USD436796S1 (en) | 1999-06-15 | 2001-01-30 | National Presto Industries, Inc. | Indoor grill |
| USD441250S1 (en) | 1999-08-09 | 2001-05-01 | Goodway Electrical Co. Ltd. | Grill |
| USD452630S1 (en) | 1999-08-09 | 2002-01-01 | Goodway Electrical Co. Ltd. | Grill |
| US6433312B1 (en) * | 1999-11-23 | 2002-08-13 | Hamilton Beach/Proctor-Silex, Inc. | Electric roaster |
| US6415710B1 (en) * | 2001-06-08 | 2002-07-09 | Gary Roger Boone | Grease collection system |
| US6523460B1 (en) | 2001-07-31 | 2003-02-25 | Rita T. Lange | Skillet with interchangeable perforated bottom plates |
| USD463202S1 (en) | 2001-08-21 | 2002-09-24 | Michael A. Smith | Grilling pan for barbecue |
| US20040211406A1 (en) * | 2003-04-24 | 2004-10-28 | Randall Cornfield | Multi-purpose stovetop grilling and cooking device |
| US7059318B2 (en) | 2003-04-24 | 2006-06-13 | Randall Cornfield | Multi-purpose stovetop grilling and cooking device |
| US7340994B2 (en) * | 2003-06-24 | 2008-03-11 | Weber-Stephen Products Co. | Grilling apparatus |
| US20060150827A1 (en) * | 2003-06-24 | 2006-07-13 | Bruno Adrian A | Grilling apparatus |
| USD505044S1 (en) * | 2003-10-28 | 2005-05-17 | Poking Industrial Company, Ltd. | Reversible grill |
| US6837152B1 (en) * | 2003-12-12 | 2005-01-04 | Fancy Food Service Equipment Co., Ltd. | Water-cooled muffler device for a grill apparatus |
| US6930288B1 (en) * | 2004-03-01 | 2005-08-16 | Tsann Kuen Enterprise Co., Ltd. | Cooking device with a warming compartment |
| US20050189341A1 (en) * | 2004-03-01 | 2005-09-01 | Fang-Chuan Lin | Cooking device with a warming compartment |
| US7381929B2 (en) * | 2005-06-27 | 2008-06-03 | Patent 2000, S.L. | Portable griddle |
| US20070137499A1 (en) * | 2005-11-23 | 2007-06-21 | Sunbeam Products, Inc. | Cooking appliance with removable cooking surface |
| US7872213B2 (en) | 2005-11-23 | 2011-01-18 | Sunbeam Products, Inc. | Cooking appliance with removable cooking surface |
| WO2008141527A1 (en) * | 2007-05-22 | 2008-11-27 | Tuming You | An oil drain easily oven |
| US20090090348A1 (en) * | 2007-10-03 | 2009-04-09 | Contarino Jr Alfred F | Cooking grill |
| US7905225B2 (en) * | 2007-10-03 | 2011-03-15 | Contarino Alfred F | Cooking grill |
| USD593791S1 (en) * | 2007-10-10 | 2009-06-09 | Domo Vision Ag | Table grill device |
| WO2009109143A1 (en) * | 2008-03-06 | 2009-09-11 | You Tuming | Fry-baking oven draining oil easily |
| USD610405S1 (en) * | 2009-05-12 | 2010-02-23 | Mcconnell Evan | Grill grate |
| US10051997B2 (en) | 2010-03-08 | 2018-08-21 | Afc Business Ventures, Llc | Apparatus for converting kettle or kamado style cooking grills for cooking pizza |
| US10405699B2 (en) | 2010-03-08 | 2019-09-10 | Afc Business Ventures, Llc | Apparatus for converting cooking grills for cooking pizza |
| US9668615B2 (en) | 2010-03-08 | 2017-06-06 | Afc Business Ventures, Llc | Apparatus for converting kettle or kamado style cooking grills for cooking pizza |
| USD644059S1 (en) * | 2010-06-02 | 2011-08-30 | Pi-Design Ag | Electric grill |
| USD651851S1 (en) * | 2011-03-31 | 2012-01-10 | Ibc-Hearthware, Inc. | Grill |
| USD660640S1 (en) * | 2011-09-09 | 2012-05-29 | De'Longhi Appliances SRL Con Unico Socio | Electric grill |
| USD702500S1 (en) * | 2012-03-07 | 2014-04-15 | Zojirushi Corporation | Grill plate |
| USD676272S1 (en) * | 2012-06-14 | 2013-02-19 | Tsann Kuen (Zhangzhou) Enterprise Co., Ltd. | Griddle |
| USD711186S1 (en) * | 2012-10-09 | 2014-08-19 | De Longhi Appliances S.R.L. CON UNICO SOCIO | Grill |
| USD697752S1 (en) * | 2012-10-09 | 2014-01-21 | De' Longhi Appliances S.R.L. Con Unico Socio | Grill |
| US9192265B1 (en) * | 2012-10-16 | 2015-11-24 | Jeffrey A. Johnson | Grease collector receptacle and cooking utensil for use therewith |
| USD709727S1 (en) * | 2012-10-17 | 2014-07-29 | Magellan Group, Ltd. | Modular griddle and grill frame with inserts |
| US10132502B2 (en) | 2012-11-15 | 2018-11-20 | Afc Business Ventures, Llc | Apparatus for cooking pizza in kettle- or kamado-style cooking grills |
| US9681775B2 (en) | 2012-11-15 | 2017-06-20 | Afc Business Ventures, Llc | Apparatus for cooking pizza in kettle- or kamado-style cooking grills |
| USD685605S1 (en) * | 2012-11-19 | 2013-07-09 | Xinhua Electric Appliance Co., Ltd. | Grill having oil tray and detachable and reversible grill plate |
| USD697757S1 (en) | 2012-11-20 | 2014-01-21 | Xinhua Electric Appliance Co., Ltd. | Detachable and reversible grill plate |
| US10687667B2 (en) | 2013-03-11 | 2020-06-23 | Afc Business Ventures, Llc | Apparatus for converting hinged-lid cooking grills for cooking pizza |
| US9289097B2 (en) | 2013-03-11 | 2016-03-22 | Afc Business Ventures, Llc | Apparatus for converting hinged-lid cooking grills for cooking pizza |
| US10524616B2 (en) | 2013-08-06 | 2020-01-07 | Afc Business Ventures, Llc | Hinged-lid cooking grill for cooking pizza and the like |
| US10105008B2 (en) | 2013-08-06 | 2018-10-23 | Afc Business Ventures, Llc | Hinged-lid cooking grill for cooking pizza and the like |
| USD723324S1 (en) * | 2013-08-28 | 2015-03-03 | Ferstavi Holdings Inc. | Combination baking pan and cooling rack |
| USD730679S1 (en) * | 2013-10-12 | 2015-06-02 | Tsann Kuen (Zhangzhou) Enterprise Co., Ltd. | Grill cookware |
| USD757493S1 (en) * | 2014-01-15 | 2016-05-31 | Samsung Electronics Co., Ltd. | Electronic grill for oven |
| USD734987S1 (en) * | 2014-03-14 | 2015-07-28 | Lawrence Coats | Reversible griddle |
| US20150335200A1 (en) * | 2014-05-23 | 2015-11-26 | Viking Range, Llc | Griddle |
| USD760018S1 (en) * | 2015-03-05 | 2016-06-28 | Spectrum Brands, Inc. | Griddle |
| USD758786S1 (en) * | 2015-03-05 | 2016-06-14 | Spectrum Brands, Inc. | Griddle |
| USD760019S1 (en) * | 2015-03-06 | 2016-06-28 | Spectrum Brands, Inc. | Griddle |
| CN106308543A (en) * | 2015-06-19 | 2017-01-11 | 镇江江城金属制品有限公司 | Barbecue grill capable of easily discharging oil |
| USD825255S1 (en) | 2015-11-17 | 2018-08-14 | Tristar Products, Inc. | Griddle |
| USD825980S1 (en) | 2015-11-17 | 2018-08-21 | Ke M.O. House Co., Ltd. | Pan |
| USD829486S1 (en) | 2015-12-01 | 2018-10-02 | Tristar Products, Inc. | Pan |
| USD820032S1 (en) | 2015-12-01 | 2018-06-12 | Tristar Products, Inc. | Pan |
| USD802991S1 (en) * | 2016-01-28 | 2017-11-21 | Tefal | Accessory for electric grill |
| USD806471S1 (en) * | 2016-02-11 | 2018-01-02 | Trinidad Benham Corporation | Grilling pan |
| USD793161S1 (en) * | 2016-02-11 | 2017-08-01 | Trinidad Benham Corporation | Grill liner |
| USD814238S1 (en) | 2016-03-25 | 2018-04-03 | Afc Business Ventures, Llc | Accessory for barbecue grills |
| US11284743B2 (en) | 2016-05-04 | 2022-03-29 | North Atlantic Imports, Llc | Outdoor cooking station with griddle, system and method thereof |
| US10952564B2 (en) | 2016-05-04 | 2021-03-23 | North Atlantic Imports, Llc | Griddle device, system, and method |
| US10959572B2 (en) | 2016-05-04 | 2021-03-30 | North Atlantic Imports, Llc | Outdoor cooking station with griddle, system and method thereof |
| US10327589B1 (en) | 2016-05-04 | 2019-06-25 | North Atlantic Imports, Llc | Outdoor cooking station with griddle, system and method thereof |
| US10327588B2 (en) | 2016-05-04 | 2019-06-25 | North Atlantic Imports, Llc | Griddle device, system, and method |
| US11800954B2 (en) | 2016-05-04 | 2023-10-31 | North Atlantic Imports, Llc | Outdoor cooking station with griddle, system and method thereof |
| US12185873B2 (en) | 2016-05-04 | 2025-01-07 | North Atlantic Imports, Llc | Outdoor cooking station with griddle, system and method thereof |
| USD812974S1 (en) * | 2016-08-01 | 2018-03-20 | Cna International Inc. | Steamer plate |
| USD823639S1 (en) * | 2016-08-08 | 2018-07-24 | Gibson Overseas Inc | Pioneer woman butterfly griddle |
| USD820042S1 (en) | 2017-06-26 | 2018-06-12 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD804898S1 (en) * | 2017-06-26 | 2017-12-12 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD804899S1 (en) * | 2017-06-26 | 2017-12-12 | E. Mishan & Sons, Inc. | Smokeless grill |
| CN107198466A (en) * | 2017-08-01 | 2017-09-26 | 刘盛松 | Healthy and environment-friendly cooking device with oil interception plate |
| CN108497946A (en) * | 2017-12-29 | 2018-09-07 | 金华乐嘉厨具有限公司 | A kind of foldable barbecue disk |
| USD858175S1 (en) * | 2018-02-09 | 2019-09-03 | Lekue, Sl | Grill for microwave oven |
| USD909115S1 (en) * | 2018-04-26 | 2021-02-02 | Kokubo & Co., Ltd. | Container for cooking |
| USD880931S1 (en) * | 2018-08-21 | 2020-04-14 | Guangdong Midea Consumer Electric Manufacturing Co., Ltd. | Cooking plate |
| USD883020S1 (en) | 2019-01-31 | 2020-05-05 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD859061S1 (en) | 2019-01-31 | 2019-09-10 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD883018S1 (en) | 2019-01-31 | 2020-05-05 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD883019S1 (en) | 2019-01-31 | 2020-05-05 | E. Mishan & Sons, Inc. | Smokeless grill |
| USD988062S1 (en) * | 2020-09-16 | 2023-06-06 | StoreBound LLC | Electric griddle |
| USD966030S1 (en) * | 2020-11-24 | 2022-10-11 | Lekue, S.L. | Barbecue grill |
| USD998408S1 (en) * | 2021-07-14 | 2023-09-12 | Hyunho Kang | Electric grill |
| USD1034050S1 (en) * | 2022-07-23 | 2024-07-09 | Jingxing Zhou | Air fryer basket |
| USD971668S1 (en) * | 2022-08-09 | 2022-12-06 | elago CO. LTD | Oven tray |
| USD1030402S1 (en) * | 2022-08-28 | 2024-06-11 | Zhengying Qiu | Set of collapsible baking pans |
| USD1036189S1 (en) * | 2022-11-01 | 2024-07-23 | Daobin Yu | Air fryer basket |
| US12318037B1 (en) * | 2023-11-25 | 2025-06-03 | Shenzhen Terra Maestro Technology Co., Ltd. | Electric arc grill with oil receiving plate |
| USD1038687S1 (en) * | 2024-03-27 | 2024-08-13 | Xin Chen | Texture pattern cookie sheet |
| USD1097680S1 (en) * | 2024-08-19 | 2025-10-14 | Hongfa Zhang | Electric grill |
| USD1095130S1 (en) * | 2024-09-10 | 2025-09-30 | Ningbo Saian Intelligent Technology Co., Ltd. | Grill for microwave oven |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5884555A (en) | Griddle structure | |
| US4930491A (en) | Portable combination cooking grill | |
| US5211105A (en) | Smokeless and scorchless grill pan | |
| CA2140839C (en) | Cooking grid | |
| US4889972A (en) | Multi-functional electrically activated stove | |
| US5176067A (en) | Indoor grill | |
| US6024014A (en) | Portable reversible grill with improved fluid drainage | |
| KR20060131915A (en) | Grill pan | |
| US7607387B2 (en) | System and method for diverting liquids from foodstuff during preparation in a frying pan | |
| US20040262287A1 (en) | Roaster | |
| US20080173186A1 (en) | Sandwich bun toasting and warming apparatus | |
| US6848440B2 (en) | Grill unit and cooking apparatus with the same | |
| US20020066373A1 (en) | Electric grill-grillpan with adjustable cooking surfaces | |
| EP1444938B1 (en) | Grill unit and cooking apparatus with the same | |
| KR19980010448U (en) | Grilled meat plate for pot lid | |
| CN2255229Y (en) | pan | |
| US5740720A (en) | Multiple-doughnut fryer system | |
| KR200330926Y1 (en) | A roaster having a pass | |
| JPS5931142Y2 (en) | Structure of table yakiniku maker | |
| CN215502554U (en) | A frying basket, fryer assembly and air fryer | |
| KR102562856B1 (en) | Compact vertical oven | |
| KR200355889Y1 (en) | A roaster to roast meat | |
| KR102286120B1 (en) | Grill Plate For Cook | |
| USD380642S (en) | Cooking grill | |
| KR20090001954U (en) | Grilled Meat Cooker |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AS | Assignment |
Owner name: LYD JAN CO., LTD., A CORPORATION OF REPUBLIC OF CH Free format text: ASSIGNMENT OF ASSIGNORS INTEREST;ASSIGNOR:LI CHEN, WU CHANG;REEL/FRAME:009166/0950 Effective date: 19980417 |
|
| FEPP | Fee payment procedure |
Free format text: PAYOR NUMBER ASSIGNED (ORIGINAL EVENT CODE: ASPN); ENTITY STATUS OF PATENT OWNER: SMALL ENTITY Free format text: PAYER NUMBER DE-ASSIGNED (ORIGINAL EVENT CODE: RMPN); ENTITY STATUS OF PATENT OWNER: SMALL ENTITY |
|
| FEPP | Fee payment procedure |
Free format text: PAYOR NUMBER ASSIGNED (ORIGINAL EVENT CODE: ASPN); ENTITY STATUS OF PATENT OWNER: SMALL ENTITY |
|
| FPAY | Fee payment |
Year of fee payment: 4 |
|
| FPAY | Fee payment |
Year of fee payment: 8 |
|
| REMI | Maintenance fee reminder mailed | ||
| LAPS | Lapse for failure to pay maintenance fees | ||
| STCH | Information on status: patent discontinuation |
Free format text: PATENT EXPIRED DUE TO NONPAYMENT OF MAINTENANCE FEES UNDER 37 CFR 1.362 |
|
| FP | Lapsed due to failure to pay maintenance fee |
Effective date: 20110323 |