US3879402A - Process for preparing 2-chloro-5-sulfamoylbenzoic acids - Google Patents
Process for preparing 2-chloro-5-sulfamoylbenzoic acids Download PDFInfo
- Publication number
- US3879402A US3879402A US400704A US40070473A US3879402A US 3879402 A US3879402 A US 3879402A US 400704 A US400704 A US 400704A US 40070473 A US40070473 A US 40070473A US 3879402 A US3879402 A US 3879402A
- Authority
- US
- United States
- Prior art keywords
- chloro
- benzoic acid
- acid
- reaction
- acids
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- LWDSANAOYPHQAW-UHFFFAOYSA-N 2-chloro-5-sulfamoylbenzoic acid Chemical class NS(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1 LWDSANAOYPHQAW-UHFFFAOYSA-N 0.000 title abstract description 5
- 238000004519 manufacturing process Methods 0.000 title description 3
- 238000000034 method Methods 0.000 claims abstract description 25
- 229910001510 metal chloride Inorganic materials 0.000 claims abstract description 7
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- 239000012442 inert solvent Substances 0.000 claims description 5
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical group Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910021592 Copper(II) chloride Inorganic materials 0.000 claims 1
- 239000012954 diazonium Substances 0.000 abstract description 11
- 230000015572 biosynthetic process Effects 0.000 abstract description 7
- JRGAUAWPCLQHTF-UHFFFAOYSA-N 2-amino-5-sulfamoylbenzoic acid Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1C(O)=O JRGAUAWPCLQHTF-UHFFFAOYSA-N 0.000 abstract description 6
- 150000001989 diazonium salts Chemical class 0.000 abstract description 6
- 238000003786 synthesis reaction Methods 0.000 abstract description 5
- 238000006193 diazotization reaction Methods 0.000 abstract description 3
- 239000003524 antilipemic agent Substances 0.000 abstract description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 22
- -1 morpholino, hexamethyleneimino, piperidino Chemical group 0.000 description 19
- 239000005711 Benzoic acid Substances 0.000 description 12
- 235000010233 benzoic acid Nutrition 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- IFXSWTIWFGIXQO-AOOOYVTPSA-N 2-chloro-5-[(3s,5r)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoic acid Chemical compound C1[C@@H](C)C[C@@H](C)CN1S(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1 IFXSWTIWFGIXQO-AOOOYVTPSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- GHZFXVLKFOAKRO-UHFFFAOYSA-N 2-chloro-5-(dimethylsulfamoyl)benzoic acid Chemical compound CN(C)S(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1 GHZFXVLKFOAKRO-UHFFFAOYSA-N 0.000 description 2
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- YOHQHOGFNVNADO-UHFFFAOYSA-N 2-chloro-5-(dipropylsulfamoyl)benzoic acid Chemical compound CCCN(CCC)S(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1 YOHQHOGFNVNADO-UHFFFAOYSA-N 0.000 description 1
- NAZKDUFIGADRGV-UHFFFAOYSA-N 2-chloro-5-[methyl(phenyl)sulfamoyl]benzoic acid Chemical compound C=1C=C(Cl)C(C(O)=O)=CC=1S(=O)(=O)N(C)C1=CC=CC=C1 NAZKDUFIGADRGV-UHFFFAOYSA-N 0.000 description 1
- CLHNTBSDCJLCKV-UHFFFAOYSA-N 2-chloro-5-chlorosulfonylbenzoic acid Chemical compound OC(=O)C1=CC(S(Cl)(=O)=O)=CC=C1Cl CLHNTBSDCJLCKV-UHFFFAOYSA-N 0.000 description 1
- GOWHUHLKBKFDKK-UHFFFAOYSA-N 2-chloro-5-morpholin-4-ylsulfonylbenzoic acid Chemical compound C1=C(Cl)C(C(=O)O)=CC(S(=O)(=O)N2CCOCC2)=C1 GOWHUHLKBKFDKK-UHFFFAOYSA-N 0.000 description 1
- RYCLZKQOCUAPMF-UHFFFAOYSA-N 2-chloro-5-piperidin-1-ylsulfonylbenzoic acid Chemical compound C1=C(Cl)C(C(=O)O)=CC(S(=O)(=O)N2CCCCC2)=C1 RYCLZKQOCUAPMF-UHFFFAOYSA-N 0.000 description 1
- KLYCPFXDDDMZNQ-UHFFFAOYSA-N Benzyne Chemical compound C1=CC#CC=C1 KLYCPFXDDDMZNQ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000000039 congener Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 229960003280 cupric chloride Drugs 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000009795 derivation Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000000055 hyoplipidemic effect Effects 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005648 named reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/92—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with a hetero atom directly attached to the ring nitrogen atom
- C07D211/96—Sulfur atom
Definitions
- This invention relates to a process for the synthesis of 2-chlorobenzoic acid derivation, and in particular to the preparation of 2-chloro-5sulfamoylbenzoic acids, a class of compounds useful as agents for lowering blood lipid levels.
- n is an integer ofO to 3 and R and R are each selected from the group consisting of hydrogen, methyl, chloro and bromo; and R and R when consid- LII cred together with the nitrogen to which they are attached form a heterocyclic ring selected from the group consisting of morpholino, hexamethyleneimino, piperidino and monoand dimethylpiperidino, which comprises contacting in a reaction-inert solvent a diazonium salt of the formula DETAILED DESCRIPTION OF THE lNVENTlON
- the aforementioned reaction is depicted in the following scheme mtal chloride 1 ⁇ v R /NS02 00 1-1 R NS0 c0 11 wherein R R and the metal chlorides are as previously described.
- the ratio of reactants is appoximately equimolar. In practice, a slight excess of from 10-20% excess of the metal chloride can be employed without markedly affecting the quality of the product formed.
- lt is also desirable to conduct said reaction in a reaction-inert solvent as opposed to conducting it neat.
- a solvent or mixtures thereof, is contemplated those, which under the conditions of the instant pro.- cess, do not enter into appreciable reaction with either the starting reagents or products.
- the solvent be water. Because of decreased water solubility due to the lipophylic nature of some of the diazonium salts, it is sometimes desirable, though not critical to the success of said process, that a water-miscible reaction-inert solvent be added to the water.
- solvents which may accound for as much as 25% of the solvent volume, include tetrahydrofuran, dimethoxyethane, dioxane, dimethylformamide, acetone, dimethylsulfoxide and the like.
- Reaction time is not critical and is inherently dependent on concentration, reaction temperature and reac tivity of the starting reagents. In general, when reaction temperatures of 70-80 C. are employed, the reaction time will vary from 5-20 minutes.
- reaction mixture heating of the reaction mixture to facilitate the present process is of a practical necessity, since lower reaction temperatures lead to slower formation of product. Too rigorous a heating could lead to the formation of unwanted by-products, thus lessening the quality of the product formed.
- a temperature range of 60-l00 C. is operative, while a range of 70-80 C. is preferred.
- the mixture is cooled and the precipitated product is filtered.
- a water-miscible organic solvent has been added to aid in solubilizing the reagents, it is preferred that said solvents be removed in vacuo prior to cooling of the reaction.
- the product is purified by methods familiar to those skilled in the art, and comprise recrystallization from a suitable solvent, reprecipitation from an aqueous basic solution or chromatographing on a suitably packed column.
- the starting diazonium chloride salts are sensitive reagents which are not isolated, but prepared in NY. using the corresponding 2-amino-5-sulfamy]benzoic acid, sodium nitrite and an excess of hydrochloric acid.
- the use of this procedure in the synthesis of the starting diazonium chloride salts is one which is employed repeatedly in the chemical literature wherein aromatic amines are converted to diazonium chloride salts.
- other salts, such as the sulfate salt may be employed with comparable results in the present process.
- the aforementioned methods for preparing diazonium salts are reviewed by Wagner and Zook, Synthetic Organic Chemistry," John Wiley and Sons, Inc., New York, N. 1953, Chapt. 30, p. 772.
- the 2-amino-5-sulfamylbenzoic acids are, in turn, prepared by treatment of the requisite sulfonyl chlorides with the appropriate amine.
- the sulfonyl chlorides are prepared by chlorosulfonation of anthranilic acid, isotoic anhydride or (lower)alkyl anthranilates.
- the amines used in preparing the intermediates are either known in the chemical literature or are preparable by well-known procedures.
- the compounds of the present process are useful as hypolipemic agents and lower blood cholesterol levels.
- the aforementioned Belgium Patent teaches how to use these compounds for the indicated utility.
- chloro-5-(3,4-dimethylpiperidinosulfonyl)benzoic acid 2-chloro-5-(di-n-butylaminosulfonyl)benzoic acid; and 2-chloro-5-(hexamethyleneiminosulfonyl)- benzoic acid.
- 2-chloro-5sulfamoylbenzoic acids are synthesized: 2-chloro-5-(cis-3,5-dimethylpiperidinosulfonyl)benzoic acid (FeCla); Z-chloro-S- (piperidinosulfonyl)benzoic acid (CuCl); 2-chloro-5- (3,3-dimethylpiperidinosulfonyl)benzoic acid (SnCl 2-chloro-5-(di-n-propylaminosulfonyl)benzoic acid (FeCl3); 2-chloro-5-(hexamethyleneiminosulfonyl)- bcnzoic acid (AlCl 2-chloro-5-(morpholinosulfonyl)benzoic acid (ZnCl 2-chloro-5-(3,4-dimethylpiperidinosulf
- R is selected from the group consisting of hydrogen and alkyl containing from 1 to 4 carbon atoms; R is selected from the group consisting of alkyl containing from I to 4 carbon atoms and phenylalkylene of the formula wherein n is an integer ofO to 3 and R and R are each selected from the group consisting of hydrogen,.
- R, and R when considered together with the nitrogen to which they are attached form a heterocyclic ring selected from the group consisting of morpholino, hexamethyleneimino, pipcridino and monoand dimethylpiperidino, which comprises contacting in a reaction-inert solvent a diazonium salt of the formula CH R 2 11 wherein R is p-chloro, R is hydrogen and n is 2.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US400704A US3879402A (en) | 1973-09-26 | 1973-09-26 | Process for preparing 2-chloro-5-sulfamoylbenzoic acids |
| GB1875674A GB1415996A (en) | 1973-09-26 | 1974-04-29 | Process for the preparation of 2-chloro-5-sulphamoyl- benzoic acids |
| CA205,023A CA1022552A (en) | 1973-09-26 | 1974-07-18 | Process for preparing 2-chloro-5-sulfamoylbenzoic acids |
| SE7409629A SE7409629L (ref) | 1973-09-26 | 1974-07-24 | |
| DD180362A DD114596A5 (ref) | 1973-09-26 | 1974-08-06 | |
| FI2342/74A FI234274A7 (ref) | 1973-09-26 | 1974-08-06 | |
| RO7479676A RO70372A (ro) | 1973-09-26 | 1974-08-06 | Procedeu de preparare a acizilor 2-clor-5-sulfamoilbenzoici |
| DK418074AA DK133977B (da) | 1973-09-26 | 1974-08-06 | Fremgangsmåde til fremstilling af 2-chlor-5-sulfamoylbenzoesyrer. |
| ES429000A ES429000A1 (es) | 1973-09-26 | 1974-08-06 | Un procedimiento para preparar acidos 2-cloro-5-sulfamoil- benzoicos. |
| NL7410541A NL7410541A (nl) | 1973-09-26 | 1974-08-06 | Werkwijze voor de bereiding van 2-chloorben- urderivaten. |
| JP9068274A JPS5726510B2 (ref) | 1973-09-26 | 1974-08-07 | |
| AR255081A AR202421A1 (es) | 1973-09-26 | 1974-08-07 | Procedimiento para preparar acidos 2-cloro-5-sulfamoil-benzoicos |
| AT647774A AT332861B (de) | 1973-09-26 | 1974-08-07 | Verfahren zur herstellung von 2-chlor-5-aminosulfonylbenzoesauren |
| LU70683A LU70683A1 (ref) | 1973-09-26 | 1974-08-07 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US400704A US3879402A (en) | 1973-09-26 | 1973-09-26 | Process for preparing 2-chloro-5-sulfamoylbenzoic acids |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3879402A true US3879402A (en) | 1975-04-22 |
Family
ID=23584675
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US400704A Expired - Lifetime US3879402A (en) | 1973-09-26 | 1973-09-26 | Process for preparing 2-chloro-5-sulfamoylbenzoic acids |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3879402A (ref) |
| JP (1) | JPS5726510B2 (ref) |
| AR (1) | AR202421A1 (ref) |
| AT (1) | AT332861B (ref) |
| CA (1) | CA1022552A (ref) |
| DD (1) | DD114596A5 (ref) |
| DK (1) | DK133977B (ref) |
| ES (1) | ES429000A1 (ref) |
| FI (1) | FI234274A7 (ref) |
| GB (1) | GB1415996A (ref) |
| LU (1) | LU70683A1 (ref) |
| NL (1) | NL7410541A (ref) |
| RO (1) | RO70372A (ref) |
| SE (1) | SE7409629L (ref) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4006007A (en) * | 1975-01-02 | 1977-02-01 | Monsanto Company | N-(Substituted phenyl) derivatives of saccharin |
| US4138399A (en) * | 1970-09-14 | 1979-02-06 | Pfizer Inc. | Sulfamylbenzoic acid |
| US20050228015A1 (en) * | 2004-03-10 | 2005-10-13 | Pfizer Inc | Substituted heteroaryl- and phenylsulfamoyl compounds |
| US20050288340A1 (en) * | 2004-06-29 | 2005-12-29 | Pfizer Inc | Substituted heteroaryl- and phenylsulfamoyl compounds |
| US20110129542A1 (en) * | 2007-08-15 | 2011-06-02 | Schering Corporation | Substituted azepine- and diazepine-sulfonamides useful to inhibit 11beta-hydroxysteroid dehydrogenase type-1 |
| CN109293539A (zh) * | 2018-10-26 | 2019-02-01 | 天津德凯化工股份有限公司 | 一种提高染料固色率和溶解度的中间体及其制备方法 |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL8220204A (nl) * | 1981-06-22 | 1983-05-02 | Mochida Pharm Co Ltd | Nieuwe aminosulfonylbenzoezuur derivaten en werkwijze voor het bereiden daarvan. |
| DE3732374A1 (de) * | 1987-09-25 | 1989-04-06 | Basf Lacke & Farben | Zink-, blei- und/oder calciumsalze von carbonsaeuren und deren verwendung als korrosionsschutzmittel |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE729430A (ref) * | 1968-04-22 | 1969-09-08 |
-
1973
- 1973-09-26 US US400704A patent/US3879402A/en not_active Expired - Lifetime
-
1974
- 1974-04-29 GB GB1875674A patent/GB1415996A/en not_active Expired
- 1974-07-18 CA CA205,023A patent/CA1022552A/en not_active Expired
- 1974-07-24 SE SE7409629A patent/SE7409629L/xx not_active Application Discontinuation
- 1974-08-06 ES ES429000A patent/ES429000A1/es not_active Expired
- 1974-08-06 RO RO7479676A patent/RO70372A/ro unknown
- 1974-08-06 FI FI2342/74A patent/FI234274A7/fi unknown
- 1974-08-06 NL NL7410541A patent/NL7410541A/xx not_active Application Discontinuation
- 1974-08-06 DD DD180362A patent/DD114596A5/xx unknown
- 1974-08-06 DK DK418074AA patent/DK133977B/da unknown
- 1974-08-07 JP JP9068274A patent/JPS5726510B2/ja not_active Expired
- 1974-08-07 AR AR255081A patent/AR202421A1/es active
- 1974-08-07 AT AT647774A patent/AT332861B/de not_active IP Right Cessation
- 1974-08-07 LU LU70683A patent/LU70683A1/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE729430A (ref) * | 1968-04-22 | 1969-09-08 |
Non-Patent Citations (2)
| Title |
|---|
| Hodgson et al., J. Chem. Soc., (1945), pages 545-546. * |
| Name Reactions in Organic Chemistry, Surrey, (1954), Academic Press, Inc. pages 149-150. * |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4138399A (en) * | 1970-09-14 | 1979-02-06 | Pfizer Inc. | Sulfamylbenzoic acid |
| US4006007A (en) * | 1975-01-02 | 1977-02-01 | Monsanto Company | N-(Substituted phenyl) derivatives of saccharin |
| US20050228015A1 (en) * | 2004-03-10 | 2005-10-13 | Pfizer Inc | Substituted heteroaryl- and phenylsulfamoyl compounds |
| US20060258723A1 (en) * | 2004-03-10 | 2006-11-16 | Pfizer Inc | Substituted Heteroaryl- and Phenylsulfamoyl Compounds |
| US7262318B2 (en) | 2004-03-10 | 2007-08-28 | Pfizer, Inc. | Substituted heteroaryl- and phenylsulfamoyl compounds |
| US20050288340A1 (en) * | 2004-06-29 | 2005-12-29 | Pfizer Inc | Substituted heteroaryl- and phenylsulfamoyl compounds |
| US20060229363A1 (en) * | 2004-06-29 | 2006-10-12 | Hamanaka Ernest S | Substituted Heteroaryl- and Phenylsulfamoyl Compounds |
| US20110129542A1 (en) * | 2007-08-15 | 2011-06-02 | Schering Corporation | Substituted azepine- and diazepine-sulfonamides useful to inhibit 11beta-hydroxysteroid dehydrogenase type-1 |
| CN109293539A (zh) * | 2018-10-26 | 2019-02-01 | 天津德凯化工股份有限公司 | 一种提高染料固色率和溶解度的中间体及其制备方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| SE7409629L (ref) | 1975-03-27 |
| ATA647774A (de) | 1976-02-15 |
| GB1415996A (en) | 1975-12-03 |
| DK418074A (ref) | 1975-05-20 |
| NL7410541A (nl) | 1975-04-01 |
| JPS5726510B2 (ref) | 1982-06-04 |
| DK133977B (da) | 1976-08-23 |
| CA1022552A (en) | 1977-12-13 |
| DD114596A5 (ref) | 1975-08-12 |
| FI234274A7 (ref) | 1975-03-27 |
| LU70683A1 (ref) | 1975-05-21 |
| ES429000A1 (es) | 1977-01-16 |
| AR202421A1 (es) | 1975-06-06 |
| AT332861B (de) | 1976-10-25 |
| JPS5058029A (ref) | 1975-05-20 |
| RO70372A (ro) | 1980-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2937204A (en) | Nu-alkanoyl dinitrobenzamides | |
| US3159628A (en) | Pteridine-5-oxide derivatives | |
| US3879402A (en) | Process for preparing 2-chloro-5-sulfamoylbenzoic acids | |
| JPH0548221B2 (ref) | ||
| US4129656A (en) | Thiazolidine derivatives, salidiuretic compositions and methods of effecting salidiuresis employing them | |
| US3905997A (en) | 3-Aryl-5-oxo-2-pyrazoline-4-carboxanilides and process therefor | |
| US3862955A (en) | Process for the preparation of 1,2-benzisothiazolin 3-ones | |
| US4107434A (en) | Process for making pleuromutilins | |
| US3985785A (en) | Cyanoethyl acetamidine compounds | |
| SU584774A3 (ru) | Способ получени производных изоксазола | |
| US3442901A (en) | Dimethyl-oxo-surfurylene derivatives | |
| US3919277A (en) | Mercaptoethylation of amines | |
| US4808723A (en) | Process for the preparation of benzothiazoles | |
| US3519678A (en) | Halo-substituted 2-acetoxy benzanilides | |
| SU1147251A3 (ru) | Способ получени производных бензоилфенилпиперидина | |
| SU764609A3 (ru) | Способ получени производных бензимидазолкарбамата | |
| US3223703A (en) | 3-carbalkoxy- and 3-carbamoyl-5-subtituted - (2h) - 1,2,6 - thiadiazine - 1,1-dioxides and process | |
| US4028409A (en) | Process for the preparation of α-oxothiodimethylamide compounds | |
| US3538109A (en) | 2-benzothiazolinethiones | |
| US4322356A (en) | Method of preparing substituted phthalides | |
| US3818023A (en) | 2-phenyl benzothiazolyl acetic acid derivatives | |
| US2919277A (en) | Process for the production of cyanocarbonic acid amides | |
| US4269985A (en) | Process for the preparation of 2-amino-5-nitrothiazole | |
| US3896172A (en) | Preparation of amino-diphenylsulfides | |
| Tsuzuki et al. | Novel conversion of diphenylcarbodiimide by sodium naphthalene |