US3790648A - Process for the manufacture of benzylphosphonates - Google Patents
Process for the manufacture of benzylphosphonates Download PDFInfo
- Publication number
- US3790648A US3790648A US00225615A US3790648DA US3790648A US 3790648 A US3790648 A US 3790648A US 00225615 A US00225615 A US 00225615A US 3790648D A US3790648D A US 3790648DA US 3790648 A US3790648 A US 3790648A
- Authority
- US
- United States
- Prior art keywords
- formula
- mol
- phosphite
- carbon atoms
- tert
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title abstract description 33
- 238000004519 manufacturing process Methods 0.000 title abstract description 15
- OGBVRMYSNSKIEF-UHFFFAOYSA-N Benzylphosphonic acid Chemical class OP(O)(=O)CC1=CC=CC=C1 OGBVRMYSNSKIEF-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract description 25
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 abstract description 4
- 239000003381 stabilizer Substances 0.000 abstract description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 abstract description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 23
- -1 benzyl halides Chemical class 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 125000000217 alkyl group Chemical group 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000000203 mixture Substances 0.000 description 14
- 239000002585 base Substances 0.000 description 11
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 8
- 239000003513 alkali Substances 0.000 description 8
- 125000000753 cycloalkyl group Chemical group 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 7
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- LXCYSACZTOKNNS-UHFFFAOYSA-N diethoxy(oxo)phosphanium Chemical compound CCO[P+](=O)OCC LXCYSACZTOKNNS-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 5
- 125000005037 alkyl phenyl group Chemical group 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 125000000623 heterocyclic group Chemical group 0.000 description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 150000001350 alkyl halides Chemical class 0.000 description 4
- 125000006487 butyl benzyl group Chemical group 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 3
- CDXVUROVRIFQMV-UHFFFAOYSA-N oxo(diphenoxy)phosphanium Chemical compound C=1C=CC=CC=1O[P+](=O)OC1=CC=CC=C1 CDXVUROVRIFQMV-UHFFFAOYSA-N 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 2
- LCWKIAHCEIHHJE-UHFFFAOYSA-N 4-[(dimethylamino)methyl]-2,6-dimethylphenol Chemical compound CN(C)CC1=CC(C)=C(O)C(C)=C1 LCWKIAHCEIHHJE-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 150000003938 benzyl alcohols Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000006165 cyclic alkyl group Chemical group 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- BAKDLAFAVHBXHW-UHFFFAOYSA-N dioctadecyl phosphite Chemical compound CCCCCCCCCCCCCCCCCCOP([O-])OCCCCCCCCCCCCCCCCCC BAKDLAFAVHBXHW-UHFFFAOYSA-N 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- ZHBRSHSRMYZHLS-UHFFFAOYSA-N (4-hydroxyphenyl)methylphosphonic acid Chemical class OC1=CC=C(CP(O)(O)=O)C=C1 ZHBRSHSRMYZHLS-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 239000001733 1,4-Heptonolactone Substances 0.000 description 1
- YXYYZPDGOACFLV-UHFFFAOYSA-N 1-diethoxyphosphorylpentylbenzene Chemical compound CCCCC(P(=O)(OCC)OCC)C1=CC=CC=C1 YXYYZPDGOACFLV-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- NBGHWWFWFLNKMX-UHFFFAOYSA-N 4-(diethoxyphosphorylmethyl)-2,6-di(propan-2-yl)phenol Chemical compound CCOP(=O)(OCC)CC1=CC(C(C)C)=C(O)C(C(C)C)=C1 NBGHWWFWFLNKMX-UHFFFAOYSA-N 0.000 description 1
- BWGGHVNBXBGKOF-UHFFFAOYSA-N 4-(diethoxyphosphorylmethyl)-2,6-dimethylphenol Chemical compound CCOP(=O)(OCC)CC1=CC(C)=C(O)C(C)=C1 BWGGHVNBXBGKOF-UHFFFAOYSA-N 0.000 description 1
- RQJDUEKERVZLLU-UHFFFAOYSA-N 4-Hydroxybenzylamine Chemical class NCC1=CC=C(O)C=C1 RQJDUEKERVZLLU-UHFFFAOYSA-N 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000002511 behenyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000004965 chloroalkyl group Chemical group 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- BVXOPEOQUQWRHQ-UHFFFAOYSA-N dibutyl phosphite Chemical compound CCCCOP([O-])OCCCC BVXOPEOQUQWRHQ-UHFFFAOYSA-N 0.000 description 1
- KDFMYTBUQJDSOY-UHFFFAOYSA-N didocosyl hydrogen phosphite Chemical compound CCCCCCCCCCCCCCCCCCCCCCOP(O)OCCCCCCCCCCCCCCCCCCCCCC KDFMYTBUQJDSOY-UHFFFAOYSA-N 0.000 description 1
- QBCOASQOMILNBN-UHFFFAOYSA-N didodecoxy(oxo)phosphanium Chemical compound CCCCCCCCCCCCO[P+](=O)OCCCCCCCCCCCC QBCOASQOMILNBN-UHFFFAOYSA-N 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- IEXRYDPZNWLKLE-UHFFFAOYSA-N dihexadecoxy(oxo)phosphanium Chemical compound CCCCCCCCCCCCCCCCO[P+](=O)OCCCCCCCCCCCCCCCC IEXRYDPZNWLKLE-UHFFFAOYSA-N 0.000 description 1
- XFUSKHPBJXJFRA-UHFFFAOYSA-N dihexyl hydrogen phosphite Chemical compound CCCCCCOP(O)OCCCCCC XFUSKHPBJXJFRA-UHFFFAOYSA-N 0.000 description 1
- CZHYKKAKFWLGJO-UHFFFAOYSA-N dimethyl phosphite Chemical compound COP([O-])OC CZHYKKAKFWLGJO-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- SJYNFBVQFBRSIB-UHFFFAOYSA-N norbornadiene Chemical compound C1=CC2C=CC1C2 SJYNFBVQFBRSIB-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4003—Esters thereof the acid moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4056—Esters of arylalkanephosphonic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/53—Phosphorus bound to oxygen bound to oxygen and to carbon only
- C08K5/5317—Phosphonic compounds, e.g. R—P(:O)(OR')2
- C08K5/5333—Esters of phosphonic acids
Definitions
- ABSTRACT OF THE DISCLOSURE Process for the manufacture of 4-hydroxybenzylphosphonic esters by reacting esters of phosphoric acid with 4-hydroxybenzylamines in the presence of a base.
- the compounds manufactured according to the invention are used as stabilizers.
- the present invention relates to a process for the manufacture of compounds of the Formula I I O R4 R:
- R and R denote a straight-chain or branched alkyl group, a cycloalkyl group or an aralkyl group
- R and R independently of one another denote a straightchain or branched alkyl group, a cycloalkyl group, an alkylthioalkyl group, an alkyloxalalkyl group, a halogenoalkyl group, an alkenyl group, the phenyl group or an alkylphenyl group, or together denote the groups characterized in that 1 mol of a compound of the Formula II I Ra B2 wherein R and R 'halve the abovementioned meaning and R and R independently of one another denote a straight-chain or branched alkyl group or together, and with inclusion of the nitrogen atom, denote a saturated "United States Patent ihce 3,790,648 Patented Feb.
- dialkylamines split off during the reaction can easily be removed because of their volatility and can furthermore be trapped and reemployed for the manufacture of the starting products of the Formula II, which represents a further advantage in dustrially.
- dialkyl phosphites used in the heterocyclic ring are reacted with one mol of a compound 7 of the Formula HI E O R4 (III) wherein R and B, have the aboven entioned meaning in the presence of a base.
- R and R independently of one another denote a straight-chain or branched alkyl group with 1 to 8 carbon atoms or a cycloalkyl group with *6 to 8 carbon atoms and R and R independently of one another denote a straight-chain or branched alkyl group with 1-22 carbon atoms, a cycloalkyl group with 6-8 carbon atoms, the groups wherein the alkyl groups possess 1-18 carbon atoms, the phenyl group or an alkylphenyl group with 7-14 carbon atoms.
- dialkyl In the preferred embodiment of the process according to the invention, compounds of the Formula II are used in which R and R independently of one another denote a straight-chain or branched alkyl group with 1 to 5 carbon atoms or together, with inclusion of the nitrogen atom, form a hydrogenated heterocyclic S-membered or 6-membered ring.
- R denotes methyl or branched alkyl with 3-4 carbon atoms
- R denotes branched alkyl with 3 or 4 carbon atoms
- R and R denote straight-chain or branched alkyl groups with 1-18 carbon atoms.
- Compounds ofthe Formula II in which R and R denote methyl, ethyl, propyl or isopropyl or together denote the radical of piperidine or morpholine are particularly preferentially employed for the manufacture of the compounds of the Formula I.
- the process according to the invention can be carried out in the absence or in the presence of a solvent. Preferably, no solvent is used.
- R R R R R and R represent alkyl groups, these can, within the framework of the limits which have been indicated, be methyl, ethyl, propyl, isopropyl, butyl, isobutyl, tertbutyl, amyl, tert.arnyl, hexyl, heptyl, octyl, nonyl, decyl, undecyl, dodecyl, tetradecyl, hexadecyl, octdecyl, eicosyl or docosyl.
- These groups may also be alkyl substituents if R and R denote alkylphenyl.
- R and R are halogenoalkyl groups, then these are preferably chloroalkyl groups with 1-18 carbon atoms, such as, for example, 2-chloroethyl.
- R and R can also be cyclic alkyl groups with 6 to 8 carbon atoms. These can be, for example, cyclohexyl, cycloheptyl or cyclooctyl, and the preferred cyclic alkyl group is the l-methylcyclo- Preferred'temperature ranges are 60-120 C.
- R and R are aralkyl groups, these can be groups with 7-12 carbon atoms, such as benzyl or phenylethyl. If R and R with inclusion of the nitrogen atom, form a heterocyclic S-membered or 6-membered ring, then this can be, for example, the radical of morpholine or piperidine.
- R is alkylthioalkyl, it can be hexadecylthioethyl, dodecylthioethyl, hexylthioethyl, octadecylthiopropyl, dodecylthiopropyl or hexylthiopropyl.
- R;., denotes alkyloxalalkyl this can be octadecyloxyethyl or dodecyloxyethyl.
- R as alkenyl is, for example, allyl.
- solvents are used in the process according tov the invention, then these can be aromatic hydrocarbons such as benzene or toluene, higher-boiling ethers, such as dioxane or ethylene glycol dimethyl ether, or aliphatic hydrocarbons or hydrocarbon mixtures, such as ligroin.
- Bases in the process according to the invention are, for example, alkali amides such as LlNHg or NaNI-I alkali hydrides, such as NaH or Lil-I, alkali hydroxides, such as LiII-I, NaOH or KOH, alcoholates such as NaOCI-I NaOC H or Mg(OC H Alkali amides and alkali alcoholates are preferred.
- Alkali compounds of the phosphites of the Formula 111 can also be employed as bases. Their manufacture is effected, for example, by adding an alkali metal such as sodium to a phosphite of the Formula III.
- Examples of compounds of the Formula III are dimethyl phosphite, diethyl phosphite, dibutyl phosphite, dihexyl phosphite, di-Z-ethylhexyl phosphite,- dioctyl phospite, didodecyl phosphite, dihexadecyl phosphite, dioctadecyl phosphite, didocosyl phosphite, diphenyl phosphite I or di-p-octylphenyl phosphite.
- the starting compounds of the Formula II canbe manufactured from the corresponding 2,6-dialkylphenol, formaldehyde and a secondary amine HNR R as described, for example, in Netherlands Pat. 6803498.
- the reactants of the Formulae II and III are advantageously employed in molar ratios.
- one of the two reactants can be used in an excess of up to 20%.
- The-base is employed in amounts of 1-30 mol percent, preferably 5-10 mol percent, relative to one of the reactants ofcthe Formula II or III. 4
- the temperature in the process according to the invention are not critical. They are only important with re- If, for example, the reaction is carried out at 100 C
- the reaction according to the invention is preferably carried out under nitrogen or a noble gas, at normal pressure or reduced presusre, such as, for example, 10- mm. Hg.
- the reaction according to the invention can be carried out, for example, by warming the Compounds 11 and III and the base, withoutsolvents, under reduced p ressure'until no further amine is evolved, or by adding the base 'to a solution of the Compound III and then adding the compound II, in the same solvent as the CompoundIH, at elevated temperature.
- the compounds obtained in accordance with the process of the invention are outstandingly suitable for use as stabilizers against the thermo-oxidative and/or photo-induced degradation of monomeric and polymeric substances, especially for the stabilization of polypropylene, of polyethylene, of polyamides, of polyacetals or of copolymers of ethylene, propylene and a diene such as, for example, norbornadiene or dicyclopentadiene.
- the diphenyl phosphite is replaced by an equimolecular amount of di-tert.octylphenyl phosphite and otherwise the same procedure is followed, 4- hydroxy-3,5-di-tert.butylbenzyl-phosphonic acid di-(tert. octylphenyl) ester is obtained in good yield, after distilling off the solvent, as a glass of a slight yellow color.
- Process for the manufacture of compounds of the Formula I ii OR -onionlor which comprises reacting 1 mol of a compound of the Formula II HQ-QCm-N wherein R and R have the'abovementioned meaning and R and R independently of one another denote a straight-chain or branched alkyl group or together, and with inclusion of the nitrogen atom, denote a saturated heterocyclic ring, with one mol of a compound of the Formula III wherein R and R have the abovementioned meaning, in the presence of a base selected from alkali amides, alkali hydrides, alkali hydroxides, alkali alcoholates, and alkali compounds of the phosphites of the Formula III.
- R and R denote a straight-chain or branched alkyl group or a cycloalkyl group and R and R inde: pendently of one another denote a straight-chain or branched alkyl group, a cycloalkyl group, an alkylthioalkyl group, an alkyloxalkyl group, an alkenyl group, the phenyl group or an alkylphenyl group or together denote the groups -omomor 3.
- R and R independently of one another denote a straight-chain or branched alkyl group with 1 to 8 carbon atoms or a cycloalkyl group with 6 to 8 carbon atoms and R and R independently of one another denote a straight-chain or branched alkyl group with 1-22 carbon atoms,a cycloalkyl group with 6-8 carbon atoms, the --(CH -Sall yl or (CH 0alkyl groups, wherein the alkyl groups contain 1-18 carbon atoms, the phenyl group or an alkylphenyl group with 7-14 carbon atoms.
- R and R independently of one another denote. alkylwith 1-5 carbon atoms or together and with inclusion of the nitrogen atom form a hydrogenated heterocyclic S-membered or fi-rnembered ring.
- R denotes methyl or branched alkyl with 3-4 carbon atoms
- R denotes branched alkyl with 3 or 4 carbon atoms
- R and R denote straight-chain or branched alkyl groups with 1-18 carbon atoms.
- R and R denote methyl, ethyl, propyl or isopropyl or together denote the radical of piperidine or morpholine.
- R and R denote methyl, ethyl, propyl or isopropyl or together denote the radical of piperidine.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH231571A CH542248A (de) | 1971-02-17 | 1971-02-17 | Verfahren zur Herstellung von Benzylphosphonaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3790648A true US3790648A (en) | 1974-02-05 |
Family
ID=4230916
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US00225615A Expired - Lifetime US3790648A (en) | 1971-02-17 | 1972-02-11 | Process for the manufacture of benzylphosphonates |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3790648A (enExample) |
| AT (1) | AT309466B (enExample) |
| BE (1) | BE779422A (enExample) |
| CA (1) | CA926871A (enExample) |
| CH (1) | CH542248A (enExample) |
| DE (1) | DE2203837C3 (enExample) |
| FR (1) | FR2125515B1 (enExample) |
| GB (1) | GB1365622A (enExample) |
| IT (1) | IT950550B (enExample) |
| NL (1) | NL7202041A (enExample) |
| SU (1) | SU509240A3 (enExample) |
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3962377A (en) * | 1973-09-25 | 1976-06-08 | Ciba-Geigy Corporation | 2,3,5-Trialkyl-4-hydroxybenzylphosphonates and phosphinates |
| US3962376A (en) * | 1973-09-25 | 1976-06-08 | Ciba-Geigy Corporation | 2,4,6-Trialkyl-3-hydroxyphenylalkane phosphonates and phosphinates |
| US4008199A (en) * | 1975-06-09 | 1977-02-15 | Celanese Corporation | Heat stabilized polyalkylene terephthalate resin composition |
| US4093588A (en) * | 1974-10-07 | 1978-06-06 | Ciba-Geigy Corporation | Hindered phenolic cyclic phosphonates and stabilized compositions |
| US4210577A (en) * | 1976-12-24 | 1980-07-01 | Argus Chemical Corporation | Stabilizers for synthetic polymers comprising 2,2,6,6-tetramethyl-4-piperidyl carboxylic acid ester, phosphonic acid ester and phenol |
| US4263232A (en) * | 1979-07-09 | 1981-04-21 | Ciba-Geigy Corporation | Process for the manufacture of selected phosphonates |
| US5157141A (en) * | 1989-11-29 | 1992-10-20 | Ciba-Geigy Corporation | Process for the preparation of hydroxybenzylphosphonates |
| US5171873A (en) * | 1991-04-05 | 1992-12-15 | Ciba-Geigy Corporation | Process for the preparation of sterically hindered hydroxybenzylphosphonates |
| US5258540A (en) * | 1989-11-29 | 1993-11-02 | Ciba-Geigy Corporation | Cyclohexyl substituted hydroxybenyzlphosphonates |
| EP0690064A1 (de) | 1994-06-28 | 1996-01-03 | Ciba-Geigy Ag | Verfahren zur Herstellung von sterisch gehinderten Hydroxybenzylphosphonaten |
| EP0816354A1 (de) * | 1996-06-25 | 1998-01-07 | Bayer Ag | Verfahren zur Herstellung und Stabilisierung von aliphatischen Sechsringcarbonaten |
| US5756596A (en) * | 1993-12-16 | 1998-05-26 | Ciba Specialty Chemicals Corporation | Increasing the molecular weight of polyamides |
| WO2003026632A3 (en) * | 2001-09-26 | 2003-08-21 | Theravance Inc | Substituted phenol compounds useful for anesthesia and sedation |
| CN119708054A (zh) * | 2024-12-12 | 2025-03-28 | 中国科学院兰州化学物理研究所 | 一种抗氧抗磨双功能润滑添加剂、制备方法及其应用 |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4128509A1 (de) * | 1991-08-28 | 1993-03-04 | Basf Ag | Thermooxidationsbestaendige thermoplastische formmassen |
| DE4131951A1 (de) * | 1991-09-25 | 1993-04-08 | Boehme Chem Fab Kg | Wasserloesliche bzw. dispergierbare mittel zur stabilisierung thermooxidativ labiler verbindungen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1917512A1 (de) * | 1969-04-05 | 1970-10-15 | Advance Prod Gmbh | phosphonessigsaeureester |
-
1971
- 1971-02-17 CH CH231571A patent/CH542248A/de not_active IP Right Cessation
-
1972
- 1972-01-27 DE DE2203837A patent/DE2203837C3/de not_active Expired
- 1972-02-11 US US00225615A patent/US3790648A/en not_active Expired - Lifetime
- 1972-02-11 CA CA134496A patent/CA926871A/en not_active Expired
- 1972-02-16 AT AT124872A patent/AT309466B/de not_active IP Right Cessation
- 1972-02-16 BE BE779422A patent/BE779422A/xx unknown
- 1972-02-16 SU SU1749596A patent/SU509240A3/ru active
- 1972-02-16 FR FR7205189A patent/FR2125515B1/fr not_active Expired
- 1972-02-16 IT IT20636/72A patent/IT950550B/it active
- 1972-02-16 NL NL7202041A patent/NL7202041A/xx unknown
- 1972-02-17 GB GB736672A patent/GB1365622A/en not_active Expired
Cited By (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3962377A (en) * | 1973-09-25 | 1976-06-08 | Ciba-Geigy Corporation | 2,3,5-Trialkyl-4-hydroxybenzylphosphonates and phosphinates |
| US3962376A (en) * | 1973-09-25 | 1976-06-08 | Ciba-Geigy Corporation | 2,4,6-Trialkyl-3-hydroxyphenylalkane phosphonates and phosphinates |
| US4093588A (en) * | 1974-10-07 | 1978-06-06 | Ciba-Geigy Corporation | Hindered phenolic cyclic phosphonates and stabilized compositions |
| US4008199A (en) * | 1975-06-09 | 1977-02-15 | Celanese Corporation | Heat stabilized polyalkylene terephthalate resin composition |
| US4210577A (en) * | 1976-12-24 | 1980-07-01 | Argus Chemical Corporation | Stabilizers for synthetic polymers comprising 2,2,6,6-tetramethyl-4-piperidyl carboxylic acid ester, phosphonic acid ester and phenol |
| US4222931A (en) * | 1976-12-24 | 1980-09-16 | Argus Chemical Corporation | Stabilizers for synthetic polymers comprising 2,2,6,6-tetramethyl-4-piperidyl ether alcohol or ether, phosphonic acid ester and phenolic antioxidant |
| US4263232A (en) * | 1979-07-09 | 1981-04-21 | Ciba-Geigy Corporation | Process for the manufacture of selected phosphonates |
| EP0434606B1 (de) * | 1989-11-29 | 1995-08-16 | Ciba-Geigy Ag | Hydroxybenzylphosphonate und Verfahren zu ihrer Herstellung |
| US5258540A (en) * | 1989-11-29 | 1993-11-02 | Ciba-Geigy Corporation | Cyclohexyl substituted hydroxybenyzlphosphonates |
| US5157141A (en) * | 1989-11-29 | 1992-10-20 | Ciba-Geigy Corporation | Process for the preparation of hydroxybenzylphosphonates |
| US5171873A (en) * | 1991-04-05 | 1992-12-15 | Ciba-Geigy Corporation | Process for the preparation of sterically hindered hydroxybenzylphosphonates |
| US5756596A (en) * | 1993-12-16 | 1998-05-26 | Ciba Specialty Chemicals Corporation | Increasing the molecular weight of polyamides |
| EP0690064A1 (de) | 1994-06-28 | 1996-01-03 | Ciba-Geigy Ag | Verfahren zur Herstellung von sterisch gehinderten Hydroxybenzylphosphonaten |
| US5618963A (en) * | 1994-06-28 | 1997-04-08 | Ciba-Geigy Corporation | Process for the preparation of sterically hindered hydroxybenzylphosphonates |
| EP0816354A1 (de) * | 1996-06-25 | 1998-01-07 | Bayer Ag | Verfahren zur Herstellung und Stabilisierung von aliphatischen Sechsringcarbonaten |
| US5861107A (en) * | 1996-06-25 | 1999-01-19 | Bayer Aktiengesellschaft | Process for the preparation of aliphatic carbonates having a six-membered ring |
| WO2003026632A3 (en) * | 2001-09-26 | 2003-08-21 | Theravance Inc | Substituted phenol compounds useful for anesthesia and sedation |
| US6815555B2 (en) | 2001-09-26 | 2004-11-09 | Theravance, Inc. | Substituted phenol compounds useful for anesthesia and sedation |
| US20050032753A1 (en) * | 2001-09-26 | 2005-02-10 | Jenkins Thomas E. | Substituted phenol compounds useful for anesthesia and sedation |
| US7226946B2 (en) | 2001-09-26 | 2007-06-05 | Theravance, Inc. | Substituted phenol compounds useful for anesthesia and sedation |
| CN119708054A (zh) * | 2024-12-12 | 2025-03-28 | 中国科学院兰州化学物理研究所 | 一种抗氧抗磨双功能润滑添加剂、制备方法及其应用 |
Also Published As
| Publication number | Publication date |
|---|---|
| BE779422A (fr) | 1972-08-16 |
| FR2125515A1 (enExample) | 1972-09-29 |
| NL7202041A (enExample) | 1972-08-21 |
| FR2125515B1 (enExample) | 1974-09-13 |
| IT950550B (it) | 1973-06-20 |
| AT309466B (de) | 1973-08-27 |
| GB1365622A (en) | 1974-09-04 |
| DE2203837A1 (de) | 1972-08-31 |
| CA926871A (en) | 1973-05-22 |
| CH542248A (de) | 1973-09-30 |
| SU509240A3 (ru) | 1976-03-30 |
| DE2203837B2 (de) | 1980-06-26 |
| DE2203837C3 (de) | 1981-07-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3790648A (en) | Process for the manufacture of benzylphosphonates | |
| US2578652A (en) | Addition product of diester of dithiophosphoric acid and maleic acid and its esters, and method of preparation | |
| US3270091A (en) | Hydroxyphenylalkane phosphonic acids and esters thereof | |
| US2952701A (en) | Organophosphorus derivatives of 2, 2-dimethyl-1, 3-propanediol | |
| US2220845A (en) | Aromatic phosphites | |
| US4382042A (en) | Method of preparing oligomeric phosphate esters | |
| US2685581A (en) | Organic phosphorus compounds | |
| US4290976A (en) | Process for the preparation of phenol-free phosphites | |
| US3280070A (en) | Stabilization of unstable organic material with phosphonates, phosphates and/or thiodipropionates | |
| US2754320A (en) | Production of diesterified phosphono derivatives of monofunctional compounds | |
| JP2924357B2 (ja) | 亜リン酸エステル化合物、その製法および用途 | |
| US3787540A (en) | Benzylation of dialkyl phosphites with dithiourethanes | |
| US3629189A (en) | Enhancement of resistance of olefin polymers to copper-catalyzed oxidative degradation | |
| US3821334A (en) | Process for the manufacture of p-hydroxybenzyl compounds | |
| US4046774A (en) | Process for N-phosphorylation of heterocyclic amines | |
| US3907517A (en) | Normally liquid hydrocarbon compositions containing amidatriazales | |
| US2535173A (en) | 3-phosphonopropane-1, 1-dicarboxylic acid esters and method of preparation | |
| US3784650A (en) | 3,5-dialkyl-4-hydroxybenzyl mercapto (acetic acid ester)containing phosphites | |
| US2305529A (en) | Cyanoethylated aryl acetonitreles | |
| US4056571A (en) | Process for the preparation of tertiary phosphine oxides | |
| US2944074A (en) | Esters of 2-carbamylphenyl phosphate | |
| EP0098109B1 (en) | Phosphorus-containing compounds, their production and their use as anti-oxidants | |
| US5169885A (en) | Bis[2-tert-butyl-4-(2-octadecyloxycarbonylethyl)-6-methylphenyl]phosphite useful as a stabilizing agent | |
| DE3928291A1 (de) | Phosphorigsaeure-arylester-amid-halogenide, phosphonigsaeurearylester-amide, verfahren zu ihrer herstellung und deren verwendung zur stabilisierung von kunststoffen | |
| US3849370A (en) | Enhancement of resistance of olefin polymers to heavy metal catalyzed oxidative degradation |