US3699125A - 1,2,3-trisubstituted pyrrolidine derivatives - Google Patents
1,2,3-trisubstituted pyrrolidine derivatives Download PDFInfo
- Publication number
- US3699125A US3699125A US886328A US3699125DA US3699125A US 3699125 A US3699125 A US 3699125A US 886328 A US886328 A US 886328A US 3699125D A US3699125D A US 3699125DA US 3699125 A US3699125 A US 3699125A
- Authority
- US
- United States
- Prior art keywords
- methyl
- pyrrolidine
- ylidene
- dibenzo
- dihydro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- -1 1,2,3-trisubstituted pyrrolidine Chemical class 0.000 title description 28
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 abstract description 76
- 150000001875 compounds Chemical class 0.000 abstract description 44
- 239000003795 chemical substances by application Substances 0.000 abstract description 24
- 229910052736 halogen Inorganic materials 0.000 abstract description 17
- 150000002367 halogens Chemical class 0.000 abstract description 16
- 150000003839 salts Chemical class 0.000 abstract description 15
- 230000002401 inhibitory effect Effects 0.000 abstract description 11
- 230000028327 secretion Effects 0.000 abstract description 10
- 230000001410 anti-tremor Effects 0.000 abstract description 8
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 8
- 239000001257 hydrogen Substances 0.000 abstract description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 5
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 abstract description 4
- 239000005977 Ethylene Substances 0.000 abstract description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 3
- 229910052760 oxygen Inorganic materials 0.000 abstract description 3
- 239000001301 oxygen Substances 0.000 abstract description 3
- 239000011593 sulfur Substances 0.000 abstract description 3
- 229910052717 sulfur Inorganic materials 0.000 abstract description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical group [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 abstract description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 76
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 42
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 29
- 239000013078 crystal Substances 0.000 description 24
- 238000000034 method Methods 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 17
- 239000002904 solvent Substances 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 239000000243 solution Substances 0.000 description 14
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 14
- 239000002253 acid Substances 0.000 description 13
- 238000010438 heat treatment Methods 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical group C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 9
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 8
- FCLZCOCSZQNREK-UHFFFAOYSA-N Pyrrolidine, hydrochloride Chemical compound Cl.C1CCNC1 FCLZCOCSZQNREK-UHFFFAOYSA-N 0.000 description 8
- 239000003814 drug Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 230000009467 reduction Effects 0.000 description 8
- 238000006722 reduction reaction Methods 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 7
- 230000009471 action Effects 0.000 description 7
- 230000002140 halogenating effect Effects 0.000 description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 230000002496 gastric effect Effects 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 5
- 229960004373 acetylcholine Drugs 0.000 description 5
- 125000002947 alkylene group Chemical group 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 230000001225 therapeutic effect Effects 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- WXHBTZOMJJEWPN-UHFFFAOYSA-N 2-(3-benzhydrylidene-2-methylpyrrolidin-1-yl)ethanol Chemical compound CC1N(CCO)CCC1=C(C=1C=CC=CC=1)C1=CC=CC=C1 WXHBTZOMJJEWPN-UHFFFAOYSA-N 0.000 description 4
- CPHUUWJMAOTJLB-UHFFFAOYSA-N 2-methylidenepyrrolidine Chemical compound C=C1CCCN1 CPHUUWJMAOTJLB-UHFFFAOYSA-N 0.000 description 4
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 4
- 230000001004 anti-acetylcholinic effect Effects 0.000 description 4
- 230000001387 anti-histamine Effects 0.000 description 4
- 239000000739 antihistaminic agent Substances 0.000 description 4
- MOOAHMCRPCTRLV-UHFFFAOYSA-N boron sodium Chemical compound [B].[Na] MOOAHMCRPCTRLV-UHFFFAOYSA-N 0.000 description 4
- 230000008602 contraction Effects 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 4
- 229940032330 sulfuric acid Drugs 0.000 description 4
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 3
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- QPJORFLSOJAUNL-UHFFFAOYSA-N dibenzo[a,d][7]annulene Chemical compound C1=CC2=CC=CC=C2CC2=CC=CC=C21 QPJORFLSOJAUNL-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 229940124597 therapeutic agent Drugs 0.000 description 3
- KMNLXSBXPRWKQH-UHFFFAOYSA-N 1-(3-benzhydrylidene-2-methylpyrrolidin-1-yl)propan-2-ol Chemical compound OC(CN1C(C(CC1)=C(C1=CC=CC=C1)C1=CC=CC=C1)C)C KMNLXSBXPRWKQH-UHFFFAOYSA-N 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 2
- 229930003347 Atropine Natural products 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 241000282414 Homo sapiens Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241000735235 Ligustrum vulgare Species 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 206010044565 Tremor Diseases 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 230000008485 antagonism Effects 0.000 description 2
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 2
- 229960000396 atropine Drugs 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 229910010277 boron hydride Inorganic materials 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 239000012059 conventional drug carrier Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229960001340 histamine Drugs 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 210000003405 ileum Anatomy 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 229960001412 pentobarbital Drugs 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 210000001187 pylorus Anatomy 0.000 description 2
- 150000003235 pyrrolidines Chemical class 0.000 description 2
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 229940083608 sodium hydroxide Drugs 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- CEWQXYIHVSLPDV-BTJKTKAUSA-N (z)-but-2-enedioic acid;pyrrolidine Chemical compound C1CCNC1.OC(=O)\C=C/C(O)=O CEWQXYIHVSLPDV-BTJKTKAUSA-N 0.000 description 1
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- WTGKEDWTXKZVBI-UHFFFAOYSA-N 2,3-dihydro-1h-pyrrol-1-ium;bromide Chemical compound [Br-].C1CC=C[NH2+]1 WTGKEDWTXKZVBI-UHFFFAOYSA-N 0.000 description 1
- BWRDVLOVUDMMMH-UHFFFAOYSA-N 2-benzhydrylidenepyrrolidine Chemical compound C1(=CC=CC=C1)C(C1=CC=CC=C1)=C1NCCC1 BWRDVLOVUDMMMH-UHFFFAOYSA-N 0.000 description 1
- ZXNMIUJDTOMBPV-UHFFFAOYSA-N 2-chloroethyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCCCl)C=C1 ZXNMIUJDTOMBPV-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- LDKWAIONLKQFAI-UHFFFAOYSA-N 3-benzhydrylidene-2-methylpyrrolidine Chemical compound CC1NCCC1=C(C1=CC=CC=C1)C1=CC=CC=C1 LDKWAIONLKQFAI-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 235000006491 Acacia senegal Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000189617 Chorda Species 0.000 description 1
- NPYJPEVICHXKFA-UHFFFAOYSA-N Cl.C=C1NCCC1 Chemical compound Cl.C=C1NCCC1 NPYJPEVICHXKFA-UHFFFAOYSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 108010076876 Keratins Proteins 0.000 description 1
- 102000011782 Keratins Human genes 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 230000002921 anti-spasmodic effect Effects 0.000 description 1
- 230000003594 anti-tremorine Effects 0.000 description 1
- 229940125688 antiparkinson agent Drugs 0.000 description 1
- 239000000939 antiparkinson agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 1
- XLKNMWIXNFVJRR-UHFFFAOYSA-N boron potassium Chemical compound [B].[K] XLKNMWIXNFVJRR-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- ZXIJMRYMVAMXQP-UHFFFAOYSA-N cycloheptene Chemical compound C1CCC=CCC1 ZXIJMRYMVAMXQP-UHFFFAOYSA-N 0.000 description 1
- PJQCANLCUDUPRF-UHFFFAOYSA-N dibenzocycloheptene Chemical compound C1CC2=CC=CC=C2CC2=CC=CC=C12 PJQCANLCUDUPRF-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- GXGAKHNRMVGRPK-UHFFFAOYSA-N dimagnesium;dioxido-bis[[oxido(oxo)silyl]oxy]silane Chemical compound [Mg+2].[Mg+2].[O-][Si](=O)O[Si]([O-])([O-])O[Si]([O-])=O GXGAKHNRMVGRPK-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- SBBFZWWBMFILKH-UHFFFAOYSA-N ethanesulfonyl bromide Chemical compound CCS(Br)(=O)=O SBBFZWWBMFILKH-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000003944 halohydrins Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229940099273 magnesium trisilicate Drugs 0.000 description 1
- 229910000386 magnesium trisilicate Inorganic materials 0.000 description 1
- 235000019793 magnesium trisilicate Nutrition 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 239000003863 metallic catalyst Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- ITYJDNHFRZSTJY-UHFFFAOYSA-N methanesulfonyl bromide Chemical compound CS(Br)(=O)=O ITYJDNHFRZSTJY-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- CZXGXYBOQYQXQD-UHFFFAOYSA-N methyl benzenesulfonate Chemical compound COS(=O)(=O)C1=CC=CC=C1 CZXGXYBOQYQXQD-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- PZHNNJXWQYFUTD-UHFFFAOYSA-N phosphorus triiodide Chemical compound IP(I)I PZHNNJXWQYFUTD-UHFFFAOYSA-N 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003236 pyrrolines Chemical class 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 210000003296 saliva Anatomy 0.000 description 1
- 210000001581 salivary duct Anatomy 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 231100000041 toxicology testing Toxicity 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/20—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Definitions
- X and X are same or different hydrogen, halogen, lower alkyl or lower alkoxy; Y is hydroxy or halogen; R and R are hydrogen or R and R are bound together intervening ethylene, oxygen or sulfur; R is lower alkyl; and R is lower alkylene and pharmaceutically acceptable salts thereof.
- This invention relates to new 1,2,3-trisubstituted pyrrolidine derivatives having gastric secretion inhibiting action or anti-tremorine action.
- X, and X are same or different hydrogen, halogen, lower alkyl or lower alkoxy; Y is hydroxy or halogen; R and R are hydrogen or R and R are bound together intervening ethylene, oxygen or sulfur; R is lower alkyl; and R is lower alkylene.
- alkyl, alkoxy or alkylene group is intended to mean group having from one to four carbon atoms in alkyl part and said alkyl part may be straight or branched.
- Halogen chlorine, bromine, fluorine, etc.
- Lower alkyl methyl, ethyl, propyl, isopropyl, butyl, isobutyl, etc.
- Lower alkylene ethylene, propylene, 2-methylethylene,
- a basic object of this invention is to embody the compounds [I] and their salts.
- Another object of this invention is to embody the compounds [I] and their salts having gastric secretion inhibiting action or anti-tremor action.
- a further object of the invention is to embody the compounds [I] and their salts useful as a gastric secretioninhibiting agent or anti-tremor agent (e.g. antiparkinson agent).
- a still further object of the invention is to embody a process for preparing the compounds [I] and their salts.
- the compound of the general Formula I is prepared by reacting the compound of the Formula II;
- X X R R and R are the same significance as defined above, or the acid salt thereof with a N-substituting agent selected from the group of 1,2-epoxyalkane [III] and the compound of the formula;
- the starting compound [11] may be prepared, for example, by the following methods. That is, 2-lower alkyl- 3-diphenylmethylenepyrrolidine may be prepared by reducing 2-lower alkyl-3-diphenylmethylene 1 pyrroline, which can be prepared according to the method as described in Japanese patent gazette No. 19454/ 19-64, with sodium boron hydride.
- the other starting compounds i.e. 2-lower a1kyl-3-( 10,1 l-dihydro-SH-dibenzo [a,d] cycloheptene-S-ylidene)-pyrrolidine,. 2-lower alkyl-3-(xanthene-9- ylidene)pyrrolidine and 2-lower.
- a1kyl-3-(thioxanthene-9- yliden6)pyrrolidine may be prepared by reducing the corresponding pyrroline compounds, which may be prepared, in the substantially same method as described in the gazette, from each material of -(3-halo-propylidene)- 10,11 dihydro-SH-dibenzo[a,d]cyc1oheptene, 9'-(3-halopropylidene)xanthene and 4,5-dihydrospiro [furan-Z (3H) 9'-9'H-xanthene].
- the starting compound [II] wherein the benzene ring(s) is (are) substituted with halogen, lower alkyl or lower alkoxy at the optional position(s), may be prepared in the substantially same manner as aforementioned.
- the reaction is'carried out by treating the starting compound [II] or the acid salt thereof with N-substituting agent selected from the group of 1,2-epoxyalkane [III] and the compound of the formula [IV] preferably in the presence of an basic condensing agent.
- N-substituting agent selected from the group of 1,2-epoxyalkane [III] and the compound of the formula [IV] preferably in the presence of an basic condensing agent.
- the acid salt of the starting compound [II] are the salts with a mineral acid (e.g. hydrochloric acid, sulfuric acid, etc.) and with an organic acid (e.g. acetic acid, oxalic acid, maleic acid, picric acid, etc.).
- Examples of the reagent, 1,2-epoxyalklane [III] include epoxyethane, 1,2-epoxypropane, 1,2-epoxybutane and the like.
- examples of an acidic residue represented by the symbol Z are as follows: halogen (e.g. chlorine, bromine, iodine, etc.); sulfuric acid residue; and sulfonic acid residue (e.g. methanesulfonyloxy, benzenesulfonyloxy, toluenesulfonyloxy, etc.) and the like, provided that when Z is an acid residue of hydrohalogenic acid, i.e. halogen, the halogen should be higher in reactivity than that in the symbol Y. Thereaction is usually carried out in an inert solvent,
- the solvent when the N-substituting agent itself is liquid and can be also employed as a solvent accordingly.
- the solvent are frequently used methanol, ethanol, acetone, chloroform, dioxane, n-hexane, benzene, toluene, xylene, N,N-dimethyl formamide, etc., and the other inert solvents.
- the reaction may be preferably carried out in the presence of a basic condensing agent such as an alkalimetal (e.g. sodium, potassium, lithium) and an alkaline earth metal (e.g. calcium) and their hydroxide (e.g. sodiumhydroxide, potassium hydroxide), amide (e.g. sodium amide), alkoxide (e.g. sodium ethoxide), carbonate (e.g.. sodium carbonate, potassium carbonate), and bicarbonate (e.g. sodium bicarbonate, potassium bicarbonate); and an organic tertiary amine (e.g. pyridine, triethylamine, picoline, N-methylmorphorine).
- a basic condensing agent such as an alkalimetal (e.g. sodium, potassium, lithium) and an alkaline earth metal (e.g. calcium) and their hydroxide (e.g. sodiumhydroxide, potassium hydroxide), amide (e.g. sodium amide), alkoxide (e.g. sodium
- the reaction temperature varies according to the kinds of the starting compound [II], the N-substituting agent, the condensing agent and the solvent to be used, and is nonlimitative, but the reaction is usually etfected under warming or heating around the boiling point of the solvent to be used.
- the pyrrolinium compound [V] to be used as the starting materials in this procedure may be prepared, for example, by reacting the corresponding pyrroline 'compounds, which can be prepared according to the method as described before, with a N-substituted agent of the formula: Z'R -OH wherein Z' and R are the same significance as defined above.
- the reaction is conducted by reducing the pyrrolinium compound [V] in a solvent.
- the reduction method of this procedure there may be used any conventional methods which are generally employed for the reduction of an immonium salt, for example, the reduction method using alkali boron hydride (e.g. lithium, sodium or potassium boron hydride), alkali metal hydride (e.g. lithium aluminum hydride) and. the like; the reduction method using a metal (e.g. iron, zinc, tin, etc.) and an acid (e.g. hydrochloric acid, sulfuricacid, acetic acid, etc.); the catalytic reduction method using metallic catalyst (e.g. platinium oxide, palladium-carbon, Raney-nickel, etc.); and so forth.
- the reaction temperature and the solvent to be employed in this reaction are optionally selected depending on the reduction methods as described above.
- the reaction may he usually conducted in a solvent such as water, methanol, ethanol, dioxane, tetrahydrofuran and the like, at room temperature or under heating; in case of the reduction using alkalimetal aluminum hydride, it may be under substantially anhydrous condition in an inert solvent (e.g. ether, tetrahydrofuran, dioxane, etc.) at room temperature or under heating; in case of the catalytic reduction, it may be in a solvent such as methanol, ethanol, dioxane, ether, water, benzene, acetic acid, etc. under warming or heating; and in case of the reduction using an acid and a metal, it may be at the room temperature and the acid can be used as a solvent, too.
- a solvent such as water, methanol, ethanol, dioxane, tetrahydrofuran and the like
- an inert solvent e.g. ether, tetrahydrofuran,
- the said compound can be halogenated with a halogenating agent thereby to provide the compound [I] wherein Y is halogen as shown by the following scheme:
- the reaction is effected by treating the compound [I] with a halogenating agent.
- halogenating agent there may be exemplified hydrogen halide (e.g. hydrogen chloride, hydrogen bromide, hydrogen iodide, etc.), alkalimetal halide (e.g. sodium bromide, potassium bromide, potassium iodide, sodium iodide, etc.), thionylhalide (e.g. thionylchloride, thionylbromide, etc.), phosphorus halide (e.g. phosphorus trichloride, phosphorus tribromide, phosphorus triiodide, phosphorus pentachloride, phosphorus pentabromide, 0 etc.), phosphorus oxyhalide (e.g.
- phosphorus oxychloride phosphorus, oxybromide, etc.
- alkanesulfonyl halide e.g. methanesulfonylchloride, ethanesulfonylbromide, methanesulfonylbromide, etc.
- phosgen e.g. phosgen and the like.
- the halogenating reaction is conducted with a hydrogen halide or metalhalide
- the reaction may be carried out in the presence of sulfuric acid, phosphoric acid, zinc halide, or the like.
- reaction may be also carried out in an inert solvent.
- solvent examples of the said solvent are chloroform, tetrahydrofuran, etc.
- reaction temperature There is no limitation to the reaction temperature. However, it is usually decided in accordance with the kinds of the compound [I] and the halogenating agent to be used.
- the acid salts of thus prepared compound [I] are produced by causing the pyrrolidine base to react with an acid such as hydrochloric acid, hydrobromic acid, hydroiodic acid, phosphoric acid, sulfuric acid, citric acid, tartaric acid and lactic acid.
- an acid such as hydrochloric acid, hydrobromic acid, hydroiodic acid, phosphoric acid, sulfuric acid, citric acid, tartaric acid and lactic acid.
- the quarternary ammonium salts are obtained by reacting thus prepared compound [I] with an aliphatic or aromatic agent such as methyl chloride, methyl bromide, methyl iodide, dimethyl sulfate, methyl benzene sulfonate, methyl p-toluene sulfonate, ethyl bromide, propyl bromide and benzyl chloride.
- an aliphatic or aromatic agent such as methyl chloride, methyl bromide, methyl iodide, dimethyl sulfate, methyl benzene sulfonate, methyl p-toluene sulfonate, ethyl bromide, propyl bromide and benzyl chloride.
- Guinea pig ileum was placed in the organ bath filled with Tyrodes solution. Drugs were studied for their antagonism with acetylcholine (0.2 #QJIHL).
- chorda tympani was stimulated electrically.
- the drops of saliva from the Whartons duct was counted. Drugs were tested for their inhibitory action of these salivary secretions.
- Dogs were anesthetized with morphine-urethane, and the spontaneous motility of the jejunal portion was recorded using balloon-transducer system. The amplitude of each wave was chosen to investigate dose-response relationship.
- mice of 1GB. strain ranging from 4 to 6 Weeks of age and Weighing between 23 g. and 32 g., were subcutaneously given the test compound in varying doses. Thirty minutes thereafter, each animal was given 10 mg. per kg. of tremorme dihydrochloride intraperitoneally. Any tremor observed Within 30 minutes was noted. The EDm values to inhibit tremor was determined by the Lichfield-Wilcoxon method.
- Anti-acetylcholine potency was measured by Magnus method using the isolated intestines of guinea pigs.
- the ED value to inhibit acetylcholine contraction was deterrmned by graphing the mean potency at each dose level from an inhibitory potency of the test compound against contraction induced by acetylcholine.
- the same test as aforementioned was conducted on atropine to determine the equipotent ratio of the test compound with respect to atropine.
- the anti-histamine potency was determined by using the ISO- lated small intestines of guinea pigs according to the Mag-nus method.
- the EDw value, at which histamine contraction was inhibited, was determined by graphing the mean potency at each dose level from an inhibitory potency of the test compound against contraction induced by histamine. The same test as aforementioned was conducted on dophene hydramme to determine the equipotent ratio of the test compound with respect to diphene hydrarm'nc.
- the compounds [I] canbe administered by the conventional methods, the conventional types of unit dosages or with the conventional pharmaceutical carriers to produce a gastric secretion inhibiting or anti-tremor in human beings and animals.
- they can be used in the form of pharmaceutical preparation, which contain them in admixture with a pharmaceutical organic or inorganic carrier material suitable for enteral, parenteral or local application.
- Oral administration by the use of tablets, capsules or in liquid form such as suspensions, solution or emulsion is particularly advantageous.
- the conventional binding and disintegrating agents used in therapeutic unit dosages can be employed.
- binding agents there can be mentioned glucose, lactose, gum acacia, gelatin, mannitol, starch paste, magnesium trisilicate and talc.
- disintegrating agents there can be mentioned corn starch, keratin, colloidal silica and potato starch.
- the conventional liquid carriers can be used.
- Y is hydroxy or halogen
- R and R bound together are ethylene
- R is lower alkyl
- R is lower alkylene and their pharmaceutically acceptable salts.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP179069A JPS4819631B1 (cg-RX-API-DMAC10.html) | 1969-01-09 | 1969-01-09 | |
| JP179169A JPS4819632B1 (cg-RX-API-DMAC10.html) | 1969-01-09 | 1969-01-09 | |
| JP178869A JPS4819629B1 (cg-RX-API-DMAC10.html) | 1969-01-09 | 1969-01-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3699125A true US3699125A (en) | 1972-10-17 |
Family
ID=27275074
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US886328A Expired - Lifetime US3699125A (en) | 1969-01-09 | 1969-12-18 | 1,2,3-trisubstituted pyrrolidine derivatives |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3699125A (cg-RX-API-DMAC10.html) |
| BE (1) | BE744014A (cg-RX-API-DMAC10.html) |
| CA (1) | CA971569A (cg-RX-API-DMAC10.html) |
| CH (2) | CH528505A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2000463A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2034459B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1259400A (cg-RX-API-DMAC10.html) |
| NL (1) | NL7000277A (cg-RX-API-DMAC10.html) |
| SE (1) | SE366308B (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3992409A (en) * | 1975-06-18 | 1976-11-16 | Fujisawa Pharmaceutical Co., Ltd. | 1-Alkanesulfonyloxyalkyl-2-alkyl-3-diphenylmethylenepyrrolidines |
-
1969
- 1969-12-18 US US886328A patent/US3699125A/en not_active Expired - Lifetime
- 1969-12-31 GB GB1259400D patent/GB1259400A/en not_active Expired
-
1970
- 1970-01-02 BE BE744014D patent/BE744014A/xx unknown
- 1970-01-07 DE DE19702000463 patent/DE2000463A1/de active Pending
- 1970-01-08 FR FR7000606A patent/FR2034459B1/fr not_active Expired
- 1970-01-08 SE SE00163/70A patent/SE366308B/xx unknown
- 1970-01-09 CH CH783672A patent/CH528505A/de not_active IP Right Cessation
- 1970-01-09 CH CH26470A patent/CH527184A/de not_active IP Right Cessation
- 1970-01-09 CA CA071,843A patent/CA971569A/en not_active Expired
- 1970-01-09 NL NL7000277A patent/NL7000277A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3992409A (en) * | 1975-06-18 | 1976-11-16 | Fujisawa Pharmaceutical Co., Ltd. | 1-Alkanesulfonyloxyalkyl-2-alkyl-3-diphenylmethylenepyrrolidines |
Also Published As
| Publication number | Publication date |
|---|---|
| CH527184A (de) | 1972-08-31 |
| DE2000463A1 (de) | 1970-12-10 |
| FR2034459B1 (cg-RX-API-DMAC10.html) | 1974-08-30 |
| FR2034459A1 (cg-RX-API-DMAC10.html) | 1970-12-11 |
| GB1259400A (cg-RX-API-DMAC10.html) | 1972-01-05 |
| SE366308B (cg-RX-API-DMAC10.html) | 1974-04-22 |
| BE744014A (fr) | 1970-06-15 |
| CH528505A (de) | 1972-09-30 |
| CA971569A (en) | 1975-07-22 |
| NL7000277A (cg-RX-API-DMAC10.html) | 1970-07-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL69767B1 (en) | 11-substituted 5 11-dihydro-6h-pyrido(2 3-b)(1 4)benzodiazepin-6-ones [us3660380a] | |
| US5571820A (en) | Heterocyclic compound | |
| US3763183A (en) | 1,2,3,10,11,11a-hexahydro-5h-pyrrolo (2,1-c)(1,4)benzodiazepines | |
| US3280122A (en) | Diphenylalkyloxadiazoles | |
| SU772484A3 (ru) | Способ получени производных бензодиазепинона или их солей | |
| US4379160A (en) | Carbazole compounds and medicinal use thereof | |
| US4021552A (en) | 10-[ω-(BENZOYLPIPERIDINYL)ALKYL]PHENOTHIAZINES | |
| US4316900A (en) | Piperazinopyrrolobenzodiazepines | |
| IE911406A1 (en) | New pyridazines | |
| US3699125A (en) | 1,2,3-trisubstituted pyrrolidine derivatives | |
| EP0551527B1 (en) | Pyrroloazepine derivative | |
| US3502667A (en) | Indole derivatives | |
| US3726900A (en) | Dibenzo(a-d)cycloheptadi(or tri)ene-5:2'-dioxalanes(i,3') | |
| US4096259A (en) | Non-amphetaminic psychostimulating compositions of 1,4-disubstituted piperazines | |
| US3972994A (en) | Disubstituted azabicycloalkanes | |
| US5041436A (en) | 1-arylsulphonyl-2-piperidinone derivatives, process and intermediates for the preparation thereof, their application as antispasmodics and compositions containing them | |
| US4393210A (en) | 1(2H)-Isoquinolone compounds and acid addition salts thereof | |
| PL69663B1 (cg-RX-API-DMAC10.html) | ||
| US3458515A (en) | Piperazine substituted pyrroles | |
| US3949081A (en) | 4-Carbamoyl-1-benzazepines as antiinflammatory agents | |
| US3974285A (en) | 10,11-Furo-derivatives of cyproheptadine | |
| US3472855A (en) | 1-((benz(g)-indolyl)-lower-alkyl)-4-substituted-piperazines | |
| US5510366A (en) | Indole derivatives, salts thereof, and congestive heart failure therapeutic agents comprising the same | |
| IE50059B1 (en) | 1-benzoxepin-5(2h)-one derivatives and their salts;processes and intermediate products for their preparation and pharmaceutical compositions containing these compounds | |
| US4362666A (en) | Diazepinopyrrolobenzodiazepines |