US3424578A - Method of producing permanent magnets of rare earth metals containing co,or mixtures of co,fe and mn - Google Patents
Method of producing permanent magnets of rare earth metals containing co,or mixtures of co,fe and mn Download PDFInfo
- Publication number
- US3424578A US3424578A US644460A US3424578DA US3424578A US 3424578 A US3424578 A US 3424578A US 644460 A US644460 A US 644460A US 3424578D A US3424578D A US 3424578DA US 3424578 A US3424578 A US 3424578A
- Authority
- US
- United States
- Prior art keywords
- permanent magnets
- yco5
- magnets
- mixtures
- particles
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title description 19
- 239000000203 mixture Substances 0.000 title description 12
- 229910052761 rare earth metal Inorganic materials 0.000 title description 6
- 150000002910 rare earth metals Chemical class 0.000 title description 6
- 239000002245 particle Substances 0.000 description 22
- 239000000843 powder Substances 0.000 description 22
- 229910045601 alloy Inorganic materials 0.000 description 16
- 239000000956 alloy Substances 0.000 description 16
- 230000005291 magnetic effect Effects 0.000 description 16
- 239000000463 material Substances 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 239000011230 binding agent Substances 0.000 description 11
- 229910052727 yttrium Inorganic materials 0.000 description 11
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 239000013078 crystal Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 8
- 229910017052 cobalt Inorganic materials 0.000 description 7
- 239000010941 cobalt Substances 0.000 description 7
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 7
- 229910052742 iron Inorganic materials 0.000 description 6
- 230000005415 magnetization Effects 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 238000005259 measurement Methods 0.000 description 5
- 238000003801 milling Methods 0.000 description 5
- 239000004570 mortar (masonry) Substances 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 229910000828 alnico Inorganic materials 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- -1 lauthanum Chemical compound 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229910001122 Mischmetal Inorganic materials 0.000 description 3
- 238000000498 ball milling Methods 0.000 description 3
- 239000003822 epoxy resin Substances 0.000 description 3
- 230000005294 ferromagnetic effect Effects 0.000 description 3
- 238000000227 grinding Methods 0.000 description 3
- 239000011572 manganese Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 229920000647 polyepoxide Polymers 0.000 description 3
- 229910052573 porcelain Inorganic materials 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- 238000005245 sintering Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910052684 Cerium Inorganic materials 0.000 description 2
- 229910052692 Dysprosium Inorganic materials 0.000 description 2
- 229910052693 Europium Inorganic materials 0.000 description 2
- 229910052688 Gadolinium Inorganic materials 0.000 description 2
- 229910052779 Neodymium Inorganic materials 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 229910052772 Samarium Inorganic materials 0.000 description 2
- 229910052771 Terbium Inorganic materials 0.000 description 2
- 229910052775 Thulium Inorganic materials 0.000 description 2
- 229910052769 Ytterbium Inorganic materials 0.000 description 2
- 238000005275 alloying Methods 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 239000013065 commercial product Substances 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000013213 extrapolation Methods 0.000 description 2
- 239000003302 ferromagnetic material Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000007731 hot pressing Methods 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 229910052747 lanthanoid Inorganic materials 0.000 description 2
- 150000002602 lanthanoids Chemical class 0.000 description 2
- 238000005339 levitation Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 238000012856 packing Methods 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 238000005381 potential energy Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 229910052706 scandium Inorganic materials 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 229920002972 Acrylic fiber Polymers 0.000 description 1
- 229910052582 BN Inorganic materials 0.000 description 1
- PZNSFCLAULLKQX-UHFFFAOYSA-N Boron nitride Chemical compound N#B PZNSFCLAULLKQX-UHFFFAOYSA-N 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 229910000531 Co alloy Inorganic materials 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 229910052691 Erbium Inorganic materials 0.000 description 1
- 229910000640 Fe alloy Inorganic materials 0.000 description 1
- 229910000760 Hardened steel Inorganic materials 0.000 description 1
- 229910052689 Holmium Inorganic materials 0.000 description 1
- 229910052765 Lutetium Inorganic materials 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229910052777 Praseodymium Inorganic materials 0.000 description 1
- 229910052773 Promethium Inorganic materials 0.000 description 1
- 229910001260 Pt alloy Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- CFQGDIWRTHFZMQ-UHFFFAOYSA-N argon helium Chemical compound [He].[Ar] CFQGDIWRTHFZMQ-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000007596 consolidation process Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- KBQHZAAAGSGFKK-UHFFFAOYSA-N dysprosium atom Chemical compound [Dy] KBQHZAAAGSGFKK-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000005293 ferrimagnetic effect Effects 0.000 description 1
- 230000005307 ferromagnetism Effects 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 229910000765 intermetallic Inorganic materials 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- 235000015250 liver sausages Nutrition 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 239000000696 magnetic material Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical group [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- VQMWBBYLQSCNPO-UHFFFAOYSA-N promethium atom Chemical compound [Pm] VQMWBBYLQSCNPO-UHFFFAOYSA-N 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000012260 resinous material Substances 0.000 description 1
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 description 1
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000006104 solid solution Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 description 1
- 230000008646 thermal stress Effects 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
- NAWDYIZEMPQZHO-UHFFFAOYSA-N ytterbium Chemical compound [Yb] NAWDYIZEMPQZHO-UHFFFAOYSA-N 0.000 description 1
Images
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01F—MAGNETS; INDUCTANCES; TRANSFORMERS; SELECTION OF MATERIALS FOR THEIR MAGNETIC PROPERTIES
- H01F1/00—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties
- H01F1/01—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials
- H01F1/03—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity
- H01F1/032—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity of hard-magnetic materials
- H01F1/04—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity of hard-magnetic materials metals or alloys
- H01F1/047—Alloys characterised by their composition
- H01F1/053—Alloys characterised by their composition containing rare earth metals
- H01F1/055—Alloys characterised by their composition containing rare earth metals and magnetic transition metals, e.g. SmCo5
- H01F1/0555—Alloys characterised by their composition containing rare earth metals and magnetic transition metals, e.g. SmCo5 pressed, sintered or bonded together
- H01F1/0557—Alloys characterised by their composition containing rare earth metals and magnetic transition metals, e.g. SmCo5 pressed, sintered or bonded together sintered
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01F—MAGNETS; INDUCTANCES; TRANSFORMERS; SELECTION OF MATERIALS FOR THEIR MAGNETIC PROPERTIES
- H01F1/00—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties
- H01F1/01—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials
- H01F1/03—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity
- H01F1/032—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity of hard-magnetic materials
- H01F1/04—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity of hard-magnetic materials metals or alloys
- H01F1/047—Alloys characterised by their composition
- H01F1/053—Alloys characterised by their composition containing rare earth metals
- H01F1/055—Alloys characterised by their composition containing rare earth metals and magnetic transition metals, e.g. SmCo5
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01F—MAGNETS; INDUCTANCES; TRANSFORMERS; SELECTION OF MATERIALS FOR THEIR MAGNETIC PROPERTIES
- H01F1/00—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties
- H01F1/01—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials
- H01F1/03—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity
- H01F1/032—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity of hard-magnetic materials
- H01F1/04—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity of hard-magnetic materials metals or alloys
- H01F1/06—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity of hard-magnetic materials metals or alloys in the form of particles, e.g. powder
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S428/00—Stock material or miscellaneous articles
- Y10S428/922—Static electricity metal bleed-off metallic stock
- Y10S428/9265—Special properties
- Y10S428/928—Magnetic property
Definitions
- yttrium pentiacobaltide YCo5. It is to be understood that neither the discovery tof YCo5 per se or its property of ferromagnetism is alleged but rather a specific process for treating YCo5 and related compounds to form a permanent magnet.
- ferromagnet and permanent magnet are by no means synonymous.
- the tirst term simply indicates the existence of an ordered ⁇ arrangement of the atomic magnetic spin moments, a basic physical phenomenon also found in iron and in many other substances.
- a permament magnre however, is a specific device for technological application. While a material has to be ferroor ferri-magnetic to qualify for use in permanent magnets, the properties demanded of the latter are not inherent in any ferromagnetic material, The material must have a certain combination of basic properties -which may be optimized by such measures as adding alloying elements or heat treating. Furthermore, rather complicated processing of the material is usually necessary to produce a permanent magnet with the best possible properties.
- the present invention consists essentially of a novel method of preparing a permanent magnetic material and the product resulting therefrom which is characterized by a high saturation magnetization, a reasonably high Curie temperature of several hundred degrees C., and high coercive force.
- the permanent magnets 'made by the present method are made from particles with magneto-crystalline anisotropy instead of shape anisotropy, and thereby avoid a number of disadvantages noted of the latter.
- the permanent magnets of the present invention nd application in communication equipment, control devices, navigational instruments, auxiliary power generators, etc. Specific examples include instruments which are based on the galvanometer principle, small electrical motors and generators, microwave tubes (in magnetrons and as focusing magnets in traveling wave tubes), biasing magnets for relays, microphones and telephones, and loudspeakers.
- instruments which are based on the galvanometer principle, small electrical motors and generators, microwave tubes (in magnetrons and as focusing magnets in traveling wave tubes), biasing magnets for relays, microphones and telephones, and loudspeakers.
- the use of magnets in motors to replace the conventional stator windings is rapidly gaining acceptance and, while until recently only very small rotating electrical machines were built this way, permanent magnets are now invading tihe medium-power motor field.
- New concepts for equipment to be used on board of airor spacecraft are presently under study which require strong, large-volume, steady magnetic elds such as magnetohydrodyn-amic energy converters, devices which would direct the flow of hot plasma or of radiation particles around a space vehicle, and miagneto-plasmadynamic engines for space vehicles.
- FIGURE 1 is a graph showing the intrinsic coercive force of powders produced by ballmilling plotted as a function of grinding time and particle diameter;
- iFIGURE 2 is a graph showing the magnetization curves of a spherical single crystal of YCo5 measured in the easy and hard directions.
- the present invention is predicated rupon the discovery that permanent magnet materials or alloys having a potential energy product which surpasses available permanent magnet material by a factor of over 2.5 can be prepared from (1) a rare earth metallic component selected from the group consisting -of yttrium, scandium, lauthanum, cerium, praeseodymium, neodymium, promethium, samarium, europium, gadolinium, terbium, dysprosium, lholminurn, erbiurn, thulium, ytterbium, and lutetivum including mixtures thereof and (2) a second metallic component selected from the group consisting of cobalt, manganese and iron including mixtures thereof.
- the permanent magnet materials of the present invention are prepared by melting together the desired amounts of the two general components, such as Y and Co, under a protective noble gas atmosphere or under a vacuum.
- rDhis step may be effected by arc melting on a cold copper hearth, induction melting in pure alumina crucibles, or containerless levitationmelting so as to avoid crncible contamination.
- the resulting alloy, such as YCo5 can be formed in -30 gram buttons and then crushed and thereafter ground in .a ball mill or a vibratory mill.
- the particles of the alloy are bonded together which may be effected by several methods.
- an organic resin or plastic binder such as an epoxy resin
- an organic resin or plastic binder such as an epoxy resin
- ⁇ magnets that are sturdy, easy to shape, and corrosion resistant. They will not be usable at temperatures much above room temperature.
- High temperature capability may be achieved by sintering or hotpressing the powder without a binder, or with an inorganic binder such ⁇ as boron nitride or a metal power.
- magnetic eld of at least several kilo-oersteds must be applied before or during the consolidation if oriented magnets with optimum magnetic properties are desired.
- the nely divided particles of YCo5 have been formed into magnets by the following three different methods: (l) The powder was mixed with molten paraffin and the mixture permitted to solidify in a magnetic field of -l4K oe.; (2) The powder was compacted to ya density of -60 volume percent by means of a hydraulic press in a field of -6K oe. and the resulting magnet soaked in a polystyrene solution and subsequently dried; (3) The powder was stirred into a quick-setting epoxy resin which hardened while the magnet was in a homogeneous 20K oe. field.
- YCo5 was found to have a single easy magnetic direction, the c-axis, and no detectable anisotropy in the basal plane in which the crystal is hardest to magnetize.
- the maximum applied external field of -45K oe. t was by far insucient to saturate the crystal in a direction in the basal plane.
- a straight line extrapolation of the M vs. H curve for the basal plane yields a saturation eld HAl32K oe. (also called anisotropy eld). Based on this extrapolation one can calculate the extremely high anisotropy constant.
- EXAMPLE I The metals yttrium (Y) and cobalt (Co), both commercial products of 99.9% nominal purity, were mixed in the weight ratio of l to 3.31 (atomic ratio 1:5). Peasize lumps or chips from machining on a lathe were used. In the latter case, it was found advantageous to precompact the charge to prevent loss of chips during melting.
- the charges of 5 to l0 lgrams were melted in a levitation furnace (USAF Technical Documentary Report No. ML-TDR-64-90, A Levitation Melting Apparatus for tihe Preparation of Ultrapure Samples of Reactive Materials, by John C.
- the YCo5 alloy was prepared by fusing the alloying constituents Y and Co in an arc melting furnace having a water-cooled copper hearth and a nonconsumable tungsten electrode. Melting was done under a protective atmosphere of either pure argon gas or an argon-helium mixture, the charges weighing between 30 and ⁇ 60 grams. Each charge was melted and resolidied three to four times to assure good mixing, the buttons were turned over between meltings. The ingot usually broke into several pieces under the thermal stress. They were vacuum-annealed for five days at 1,100 C. The material prepared in this manner was again crushed to a coarse powder in the steel mortar. 100 g.
- the application form must be a true solution or a colloidal suspension of particles having an average size below -0.l,u.
- the application viscosity must be centipoise (cps.), preferably on the order of 1 cp.
- the boiling point of the solvent should tbe under C., preferably near 50 C; the coating left on the particles after evaporation of the solvent must bond them into a solid body under pressures of less than 50,000 p.s.i. at temperatures below 70 C.; the resulting plastic must have very low absorption for water from the atmosphere.
- a -resin to be effective as a binder or matrix for coercive force specimens should have the following general properties:
- a method of making a permanent magnet comprising the steps of:
- pulverizing an alloy consisting essentially of a rst component A selected from the group consisting of Y, Sc, La, Ce, Pr, Nd, Sm, Eu, Gd, Tb, Dy, Ho, Er, Tm, Yb, Lu an-d mixtures thereof and a second component B selected from the group consisting of (a) Co alone, (b) Co and at least one metal selected from the group consisting of Mn and Fe in the ratio of 11 to 22 atomic percent for component A and 78 to 89 atomic percent for component B,
- component A is yttrium and component B is cobalt.
- component A is yttrium-rich tmischmetal and component B is cobalt.
- CARL D. QUARFORTH Primary Examiner.
- A. I. STEINER Assistant Examiner.
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Hard Magnetic Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US64446067A | 1967-06-05 | 1967-06-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3424578A true US3424578A (en) | 1969-01-28 |
Family
ID=24585004
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US644460A Expired - Lifetime US3424578A (en) | 1967-06-05 | 1967-06-05 | Method of producing permanent magnets of rare earth metals containing co,or mixtures of co,fe and mn |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3424578A (enrdf_load_html_response) |
| AT (1) | AT290865B (enrdf_load_html_response) |
| BE (1) | BE716121A (enrdf_load_html_response) |
| CH (1) | CH500573A (enrdf_load_html_response) |
| ES (1) | ES355020A1 (enrdf_load_html_response) |
| FR (1) | FR1567697A (enrdf_load_html_response) |
| GB (1) | GB1216607A (enrdf_load_html_response) |
| NL (1) | NL6807894A (enrdf_load_html_response) |
| RO (1) | RO55788A (enrdf_load_html_response) |
| YU (1) | YU33213B (enrdf_load_html_response) |
Cited By (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3501358A (en) * | 1967-08-30 | 1970-03-17 | Gen Electric | Method of making permanent magnet material powders having superior magnetic characteristics |
| US3523836A (en) * | 1967-01-21 | 1970-08-11 | Philips Corp | Permanent magnet constituted of fine particles of a compound m5r |
| US3546030A (en) * | 1966-06-16 | 1970-12-08 | Philips Corp | Permanent magnets built up of m5r |
| DE2121452A1 (de) * | 1970-04-30 | 1971-11-25 | Gen Electric | Wärmegealterte, gesinterte intermetallische Verbindung aus Kobalt und seltenem Erdmetall und Verfahren zu ihrer Herstellung |
| US3625779A (en) * | 1969-08-21 | 1971-12-07 | Gen Electric | Reduction-fusion process for the production of rare earth intermetallic compounds |
| US3639181A (en) * | 1970-05-27 | 1972-02-01 | Gen Electric | Sintered cobalt-rare earth bodies and method of production |
| US3639182A (en) * | 1969-03-27 | 1972-02-01 | Gen Electric | Method for improving the effectiveness of a magnetic field for magnetizing permanent magnets |
| US3652343A (en) * | 1970-09-14 | 1972-03-28 | Gen Electric | Permanent magnet material powders having superior magnetic characteristics |
| US3655464A (en) * | 1970-04-30 | 1972-04-11 | Gen Electric | Process of preparing a liquid sintered cobalt-rare earth intermetallic product |
| US3655463A (en) * | 1970-04-30 | 1972-04-11 | Gen Electric | Sintered cobalt-rare earth intermetallic process using solid sintering additive |
| US3664892A (en) * | 1968-01-31 | 1972-05-23 | Gen Electric | Permanent magnet material powders having superior magnetic characteristics |
| US3755007A (en) * | 1971-04-01 | 1973-08-28 | Gen Electric | Stabilized permanent magnet comprising a sintered and quenched body of compacted cobalt-rare earth particles |
| US3790414A (en) * | 1967-11-15 | 1974-02-05 | Matsushita Electric Industrial Co Ltd | As-CAST, RARE-EARTH-Co-Cu PERMANENT MAGNET MATERIAL |
| US3806743A (en) * | 1970-02-09 | 1974-04-23 | Omega Brandt & Freres Sa Louis | Oscillating harological motor |
| US3839102A (en) * | 1967-11-15 | 1974-10-01 | Matsushita Electric Industrial Co Ltd | Permanent magnet |
| US3855017A (en) * | 1971-06-15 | 1974-12-17 | Bbc Brown Boveri & Cie | Powderized cobalt rare earth metal compounds and process for making such compounds |
| DE2435077A1 (de) * | 1973-07-20 | 1975-02-20 | Matsushita Electric Ind Co Ltd | Dauermagnetmaterialien |
| US3878412A (en) * | 1972-07-21 | 1975-04-15 | Kurpanek W H | Magneto-motive reciprocating device |
| US3891876A (en) * | 1973-12-21 | 1975-06-24 | Singer Co | Permanent magnet electric motor having a non-ferrous solid armature |
| US3901741A (en) * | 1973-08-23 | 1975-08-26 | Gen Electric | Permanent magnets of cobalt, samarium, gadolinium alloy |
| US3905839A (en) * | 1971-12-17 | 1975-09-16 | Gen Electric | Liquid sintered cobalt-rare earth intermetallic product |
| US3905840A (en) * | 1972-06-15 | 1975-09-16 | Gen Electric | Sintered cobalt-rare earth intermetallic product |
| US3909645A (en) * | 1974-07-10 | 1975-09-30 | Singer Co | Permanent magnet motor-tachometer having a single non-ferrous armature wound with two mutually-insulated windings each connected to a separate commutator |
| US3919004A (en) * | 1970-04-30 | 1975-11-11 | Gen Electric | Liquid sintered cobalt-rare earth intermetallic product |
| US3919003A (en) * | 1971-12-17 | 1975-11-11 | Gen Electric | Sintered cobalt-rare earth intermetallic product |
| US3919001A (en) * | 1974-03-04 | 1975-11-11 | Crucible Inc | Sintered rare-earth cobalt magnets comprising mischmetal plus cerium-free mischmetal |
| US3949351A (en) * | 1974-06-03 | 1976-04-06 | The United States Of America As Represented By The Secretary Of The Navy | Variable delay line |
| US3950194A (en) * | 1973-07-20 | 1976-04-13 | Matsushita Electrical Industrial Co., Ltd. | Permanent magnet materials |
| US3956031A (en) * | 1969-12-24 | 1976-05-11 | Texas Instruments Incorporated | Magnetic materials and the formation thereof |
| US3977917A (en) * | 1974-06-17 | 1976-08-31 | Tohoku Metal Industries Limited | Permanent magnet materials |
| US3982971A (en) * | 1974-02-21 | 1976-09-28 | Shin-Etsu Chemical Co., Ltd | Rare earth-containing permanent magnets |
| JPS51122405A (en) * | 1973-03-13 | 1976-10-26 | Seiko Epson Corp | Pickup cartridge |
| US3997371A (en) * | 1973-11-12 | 1976-12-14 | Hitachi Metals, Ltd. | Permanent magnet |
| US4011478A (en) * | 1975-06-02 | 1977-03-08 | Texas Instruments Incorporated | Magnetic speed sensing mechanism |
| US4059775A (en) * | 1976-11-22 | 1977-11-22 | Control Data Corporation | Linear motor |
| US4082582A (en) * | 1974-12-18 | 1978-04-04 | Bbc Brown, Boveri & Company, Limited | As - cast permanent magnet sm-co-cu material, with iron, produced by annealing and rapid quenching |
| US4101348A (en) * | 1970-07-30 | 1978-07-18 | Spin Physics | Process for preparing hot-pressed sintered alloys |
| US4110645A (en) * | 1976-02-23 | 1978-08-29 | Vibrac Corporation | Electric motor |
| US4116726A (en) * | 1974-12-18 | 1978-09-26 | Bbc Brown, Boveri & Company Limited | As-cast permanent magnet Sm-Co-Cu material with iron, produced by annealing and rapid quenching |
| US4152178A (en) * | 1978-01-24 | 1979-05-01 | The United States Of America As Represented By The United States Department Of Energy | Sintered rare earth-iron Laves phase magnetostrictive alloy product and preparation thereof |
| DE3119927A1 (de) * | 1980-05-23 | 1982-04-29 | Shin-Etsu Chemical Co., Ltd., Tokyo | Seltenerdmetall enthaltende legierungen fuer dauermagnete |
| US4375372A (en) * | 1972-03-16 | 1983-03-01 | The United States Of America As Represented By The Secretary Of The Navy | Use of cubic rare earth-iron laves phase intermetallic compounds as magnetostrictive transducer materials |
| US4378258A (en) * | 1972-03-16 | 1983-03-29 | The United States Of America As Represented By The Secretary Of The Navy | Conversion between magnetic energy and mechanical energy |
| US4544904A (en) * | 1984-02-24 | 1985-10-01 | Kishore Tarachand | Composite magnet and magnetic circuit |
| US4585473A (en) * | 1984-04-09 | 1986-04-29 | Crucible Materials Corporation | Method for making rare-earth element containing permanent magnets |
| US4710242A (en) * | 1980-08-11 | 1987-12-01 | Fujitsu Limited | Material for temperature sensitive elements |
| US4810572A (en) * | 1986-02-17 | 1989-03-07 | Mitsui Toatsu Chemicals, Inc. | Permanent magnet and process for producing the same |
| US4832891A (en) * | 1987-11-25 | 1989-05-23 | Eastman Kodak Company | Method of making an epoxy bonded rare earth-iron magnet |
| US20130076469A1 (en) * | 2011-09-26 | 2013-03-28 | Yongjun Hu | Novel composite permanent magnetic material and preparation method thereof |
| WO2016144811A1 (en) * | 2015-03-06 | 2016-09-15 | SDCmaterials, Inc. | Coated magnetic particle and methods of making and using the same |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2110755A5 (enrdf_load_html_response) * | 1970-10-29 | 1972-06-02 | Sermag |
Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1893330A (en) * | 1928-08-07 | 1933-01-03 | Charles L Jones | Permeable metal and method of making the same |
| US2384215A (en) * | 1944-07-03 | 1945-09-04 | Hpm Dev Corp | Powder metallurgy |
| GB590392A (en) * | 1942-04-07 | 1947-07-16 | Electro Chimie Metal | Improvements in or relating to the manufacture of magnets |
| US2661387A (en) * | 1949-09-10 | 1953-12-01 | Basf Ag | Porous electrode plates and process for making such articles |
| US2825670A (en) * | 1952-08-21 | 1958-03-04 | Adams Edmond | Permanent magnet and process for making same |
| US2849312A (en) * | 1954-02-01 | 1958-08-26 | Milton J Peterman | Method of aligning magnetic particles in a non-magnetic matrix |
| US3180012A (en) * | 1963-07-12 | 1965-04-27 | Du Pont | Cobalt alloys |
| US3287112A (en) * | 1963-11-26 | 1966-11-22 | Selas Corp Of America | Production of filter membranes |
| US3322536A (en) * | 1963-06-17 | 1967-05-30 | Stephen D Stoddard | Tungsten slip casting method |
-
1967
- 1967-06-05 US US644460A patent/US3424578A/en not_active Expired - Lifetime
-
1968
- 1968-03-25 CH CH437068A patent/CH500573A/de not_active IP Right Cessation
- 1968-05-24 YU YU1214/68A patent/YU33213B/xx unknown
- 1968-05-29 RO RO56855A patent/RO55788A/ro unknown
- 1968-06-04 ES ES355020A patent/ES355020A1/es not_active Expired
- 1968-06-05 AT AT538368A patent/AT290865B/de not_active IP Right Cessation
- 1968-06-05 NL NL6807894A patent/NL6807894A/xx unknown
- 1968-06-05 GB GB26844/68A patent/GB1216607A/en not_active Expired
- 1968-06-05 FR FR1567697D patent/FR1567697A/fr not_active Expired
- 1968-06-05 BE BE716121D patent/BE716121A/xx not_active IP Right Cessation
Patent Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1893330A (en) * | 1928-08-07 | 1933-01-03 | Charles L Jones | Permeable metal and method of making the same |
| GB590392A (en) * | 1942-04-07 | 1947-07-16 | Electro Chimie Metal | Improvements in or relating to the manufacture of magnets |
| US2384215A (en) * | 1944-07-03 | 1945-09-04 | Hpm Dev Corp | Powder metallurgy |
| US2661387A (en) * | 1949-09-10 | 1953-12-01 | Basf Ag | Porous electrode plates and process for making such articles |
| US2825670A (en) * | 1952-08-21 | 1958-03-04 | Adams Edmond | Permanent magnet and process for making same |
| US2849312A (en) * | 1954-02-01 | 1958-08-26 | Milton J Peterman | Method of aligning magnetic particles in a non-magnetic matrix |
| US3322536A (en) * | 1963-06-17 | 1967-05-30 | Stephen D Stoddard | Tungsten slip casting method |
| US3180012A (en) * | 1963-07-12 | 1965-04-27 | Du Pont | Cobalt alloys |
| US3287112A (en) * | 1963-11-26 | 1966-11-22 | Selas Corp Of America | Production of filter membranes |
Cited By (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3546030A (en) * | 1966-06-16 | 1970-12-08 | Philips Corp | Permanent magnets built up of m5r |
| US3523836A (en) * | 1967-01-21 | 1970-08-11 | Philips Corp | Permanent magnet constituted of fine particles of a compound m5r |
| US3501358A (en) * | 1967-08-30 | 1970-03-17 | Gen Electric | Method of making permanent magnet material powders having superior magnetic characteristics |
| US3839102A (en) * | 1967-11-15 | 1974-10-01 | Matsushita Electric Industrial Co Ltd | Permanent magnet |
| US3790414A (en) * | 1967-11-15 | 1974-02-05 | Matsushita Electric Industrial Co Ltd | As-CAST, RARE-EARTH-Co-Cu PERMANENT MAGNET MATERIAL |
| US3664892A (en) * | 1968-01-31 | 1972-05-23 | Gen Electric | Permanent magnet material powders having superior magnetic characteristics |
| US3639182A (en) * | 1969-03-27 | 1972-02-01 | Gen Electric | Method for improving the effectiveness of a magnetic field for magnetizing permanent magnets |
| US3625779A (en) * | 1969-08-21 | 1971-12-07 | Gen Electric | Reduction-fusion process for the production of rare earth intermetallic compounds |
| US3956031A (en) * | 1969-12-24 | 1976-05-11 | Texas Instruments Incorporated | Magnetic materials and the formation thereof |
| US3806743A (en) * | 1970-02-09 | 1974-04-23 | Omega Brandt & Freres Sa Louis | Oscillating harological motor |
| US3655464A (en) * | 1970-04-30 | 1972-04-11 | Gen Electric | Process of preparing a liquid sintered cobalt-rare earth intermetallic product |
| US3655463A (en) * | 1970-04-30 | 1972-04-11 | Gen Electric | Sintered cobalt-rare earth intermetallic process using solid sintering additive |
| US3919004A (en) * | 1970-04-30 | 1975-11-11 | Gen Electric | Liquid sintered cobalt-rare earth intermetallic product |
| DE2121452A1 (de) * | 1970-04-30 | 1971-11-25 | Gen Electric | Wärmegealterte, gesinterte intermetallische Verbindung aus Kobalt und seltenem Erdmetall und Verfahren zu ihrer Herstellung |
| US3639181A (en) * | 1970-05-27 | 1972-02-01 | Gen Electric | Sintered cobalt-rare earth bodies and method of production |
| US4101348A (en) * | 1970-07-30 | 1978-07-18 | Spin Physics | Process for preparing hot-pressed sintered alloys |
| US3652343A (en) * | 1970-09-14 | 1972-03-28 | Gen Electric | Permanent magnet material powders having superior magnetic characteristics |
| US3755007A (en) * | 1971-04-01 | 1973-08-28 | Gen Electric | Stabilized permanent magnet comprising a sintered and quenched body of compacted cobalt-rare earth particles |
| US3855017A (en) * | 1971-06-15 | 1974-12-17 | Bbc Brown Boveri & Cie | Powderized cobalt rare earth metal compounds and process for making such compounds |
| US3919003A (en) * | 1971-12-17 | 1975-11-11 | Gen Electric | Sintered cobalt-rare earth intermetallic product |
| US3905839A (en) * | 1971-12-17 | 1975-09-16 | Gen Electric | Liquid sintered cobalt-rare earth intermetallic product |
| US4378258A (en) * | 1972-03-16 | 1983-03-29 | The United States Of America As Represented By The Secretary Of The Navy | Conversion between magnetic energy and mechanical energy |
| US4375372A (en) * | 1972-03-16 | 1983-03-01 | The United States Of America As Represented By The Secretary Of The Navy | Use of cubic rare earth-iron laves phase intermetallic compounds as magnetostrictive transducer materials |
| US3905840A (en) * | 1972-06-15 | 1975-09-16 | Gen Electric | Sintered cobalt-rare earth intermetallic product |
| US3919002A (en) * | 1972-06-15 | 1975-11-11 | Gen Electric | Sintered cobalt-rare earth intermetallic product |
| US3878412A (en) * | 1972-07-21 | 1975-04-15 | Kurpanek W H | Magneto-motive reciprocating device |
| JPS51122405A (en) * | 1973-03-13 | 1976-10-26 | Seiko Epson Corp | Pickup cartridge |
| DE2435077A1 (de) * | 1973-07-20 | 1975-02-20 | Matsushita Electric Ind Co Ltd | Dauermagnetmaterialien |
| US3950194A (en) * | 1973-07-20 | 1976-04-13 | Matsushita Electrical Industrial Co., Ltd. | Permanent magnet materials |
| US3901741A (en) * | 1973-08-23 | 1975-08-26 | Gen Electric | Permanent magnets of cobalt, samarium, gadolinium alloy |
| US3997371A (en) * | 1973-11-12 | 1976-12-14 | Hitachi Metals, Ltd. | Permanent magnet |
| US3891876A (en) * | 1973-12-21 | 1975-06-24 | Singer Co | Permanent magnet electric motor having a non-ferrous solid armature |
| US3982971A (en) * | 1974-02-21 | 1976-09-28 | Shin-Etsu Chemical Co., Ltd | Rare earth-containing permanent magnets |
| US3919001A (en) * | 1974-03-04 | 1975-11-11 | Crucible Inc | Sintered rare-earth cobalt magnets comprising mischmetal plus cerium-free mischmetal |
| US3949351A (en) * | 1974-06-03 | 1976-04-06 | The United States Of America As Represented By The Secretary Of The Navy | Variable delay line |
| US3977917A (en) * | 1974-06-17 | 1976-08-31 | Tohoku Metal Industries Limited | Permanent magnet materials |
| US3909645A (en) * | 1974-07-10 | 1975-09-30 | Singer Co | Permanent magnet motor-tachometer having a single non-ferrous armature wound with two mutually-insulated windings each connected to a separate commutator |
| US4082582A (en) * | 1974-12-18 | 1978-04-04 | Bbc Brown, Boveri & Company, Limited | As - cast permanent magnet sm-co-cu material, with iron, produced by annealing and rapid quenching |
| US4116726A (en) * | 1974-12-18 | 1978-09-26 | Bbc Brown, Boveri & Company Limited | As-cast permanent magnet Sm-Co-Cu material with iron, produced by annealing and rapid quenching |
| US4011478A (en) * | 1975-06-02 | 1977-03-08 | Texas Instruments Incorporated | Magnetic speed sensing mechanism |
| US4110645A (en) * | 1976-02-23 | 1978-08-29 | Vibrac Corporation | Electric motor |
| US4059775A (en) * | 1976-11-22 | 1977-11-22 | Control Data Corporation | Linear motor |
| US4152178A (en) * | 1978-01-24 | 1979-05-01 | The United States Of America As Represented By The United States Department Of Energy | Sintered rare earth-iron Laves phase magnetostrictive alloy product and preparation thereof |
| DE3119927A1 (de) * | 1980-05-23 | 1982-04-29 | Shin-Etsu Chemical Co., Ltd., Tokyo | Seltenerdmetall enthaltende legierungen fuer dauermagnete |
| US4710242A (en) * | 1980-08-11 | 1987-12-01 | Fujitsu Limited | Material for temperature sensitive elements |
| US4544904A (en) * | 1984-02-24 | 1985-10-01 | Kishore Tarachand | Composite magnet and magnetic circuit |
| US4585473A (en) * | 1984-04-09 | 1986-04-29 | Crucible Materials Corporation | Method for making rare-earth element containing permanent magnets |
| US4810572A (en) * | 1986-02-17 | 1989-03-07 | Mitsui Toatsu Chemicals, Inc. | Permanent magnet and process for producing the same |
| US4832891A (en) * | 1987-11-25 | 1989-05-23 | Eastman Kodak Company | Method of making an epoxy bonded rare earth-iron magnet |
| US20130076469A1 (en) * | 2011-09-26 | 2013-03-28 | Yongjun Hu | Novel composite permanent magnetic material and preparation method thereof |
| US9048016B2 (en) * | 2011-09-26 | 2015-06-02 | Dongguan Xuanyao Electronics Co., Ltd. | Composite permanent magnetic material and preparation method thereof |
| WO2016144811A1 (en) * | 2015-03-06 | 2016-09-15 | SDCmaterials, Inc. | Coated magnetic particle and methods of making and using the same |
Also Published As
| Publication number | Publication date |
|---|---|
| ES355020A1 (es) | 1969-11-16 |
| FR1567697A (enrdf_load_html_response) | 1969-05-16 |
| AT290865B (de) | 1971-06-25 |
| YU121468A (en) | 1975-12-31 |
| BE716121A (enrdf_load_html_response) | 1968-11-04 |
| RO55788A (enrdf_load_html_response) | 1974-03-01 |
| CH500573A (de) | 1970-12-15 |
| GB1216607A (en) | 1970-12-23 |
| NL6807894A (enrdf_load_html_response) | 1968-12-06 |
| YU33213B (en) | 1976-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3424578A (en) | Method of producing permanent magnets of rare earth metals containing co,or mixtures of co,fe and mn | |
| US3540945A (en) | Permanent magnets | |
| US5858124A (en) | Rare earth magnet of high electrical resistance and production method thereof | |
| Kaneko et al. | Recent developments of high-performance NEOMAX magnets | |
| JPH09186010A (ja) | 高電気抵抗希土類磁石およびその製造方法 | |
| CN104299768B (zh) | 一种制备Sm-Co/Nd-Fe-B复合永磁材料的方法 | |
| US5026438A (en) | Method of making self-aligning anisotropic powder for magnets | |
| JPS6325904A (ja) | 永久磁石およびその製造方法並びに永久磁石製造用組成物 | |
| US4849035A (en) | Rare earth, iron carbon permanent magnet alloys and method for producing the same | |
| US3655464A (en) | Process of preparing a liquid sintered cobalt-rare earth intermetallic product | |
| US3695945A (en) | Method of producing a sintered cobalt-rare earth intermetallic product | |
| US3821035A (en) | Sintered cobalt-neodymium-samarium intermetallic product and permanent magnets produced therefrom | |
| JPH0621324B2 (ja) | 希土類永久磁石合金用組成物 | |
| JPS6181606A (ja) | 希土類磁石の製造方法 | |
| US3682714A (en) | Sintered cobalt-rare earth intermetallic product and permanent magnets produced therefrom | |
| US3682716A (en) | Sintered intermetallic product of cobalt,samarium and cerium mischmetal and permanent magnets produced therefrom | |
| US3684591A (en) | Sintered cobalt-rare earth intermetallic product including samarium and cerium and permanent magnets produced therefrom | |
| JPH0551656B2 (enrdf_load_html_response) | ||
| JPH0352529B2 (enrdf_load_html_response) | ||
| JPH0661022A (ja) | 希土類ボンド磁石の製造方法 | |
| US3919004A (en) | Liquid sintered cobalt-rare earth intermetallic product | |
| US4099995A (en) | Copper-hardened permanent-magnet alloy | |
| JPS6181603A (ja) | 希土類磁石の製造方法 | |
| US3682715A (en) | Sintered cobalt-rare earth intermetallic product including samarium and lanthanum and permanent magnets produced therefrom | |
| JPH05335120A (ja) | 異方性ボンド磁石製造用固体樹脂バインダー被覆磁石粉末およびその製造法 |