US3359678A - Flying saucer - Google Patents
Flying saucer Download PDFInfo
- Publication number
- US3359678A US3359678A US505864A US50586465A US3359678A US 3359678 A US3359678 A US 3359678A US 505864 A US505864 A US 505864A US 50586465 A US50586465 A US 50586465A US 3359678 A US3359678 A US 3359678A
- Authority
- US
- United States
- Prior art keywords
- saucer
- rim
- toy
- central portion
- implement
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 240000002836 Ipomoea tricolor Species 0.000 title description 12
- 210000003811 finger Anatomy 0.000 description 4
- 210000000707 wrist Anatomy 0.000 description 4
- 230000000694 effects Effects 0.000 description 3
- 210000003813 thumb Anatomy 0.000 description 3
- 230000002452 interceptive effect Effects 0.000 description 2
- 241000211181 Manta Species 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- 239000003562 lightweight material Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- NFGXHKASABOEEW-LDRANXPESA-N methoprene Chemical compound COC(C)(C)CCCC(C)C\C=C\C(\C)=C\C(=O)OC(C)C NFGXHKASABOEEW-LDRANXPESA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Images
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H33/00—Other toys
- A63H33/18—Throwing or slinging toys, e.g. flying disc toys
Definitions
- a series of concentric discontinuities are provided adjacent the rim on the convex side of the implement.
- the discontinuities provided on the convex side of the implement exert an interfering effect on the air flow over the implement and create a turbulent unseparated boundary layer over the top of the implement reducing areodynamic drag.
- This invention relates to aerodynamic toys to be thrown through the air and in particular to flying saucers for use in throwing games. 7
- the implement is made of a plastic material in a saucer shape with a rim located around the edge of the saucer, the rim having a somewhat greater thickness than the saucer portion of the implement.
- the rim curves downwardly from the saucer and has a configuration such that the implement when viewed in elevation approximates the shape of an airfoil.
- the toy is used in throwing games and is normally gripped by placing the thumb on the convex side of the saucer and one or more of the fingers on the concave side. Throwing is usually accomplished with a wrist snapping motion wherein the thrower assumes a stance approximately at right hangles to the intended target and retracts his arm across his body. By uncoiling his arm and snapping his wrist, momentum and a spinning motion is imparted to the saucer to cause it to fly toward the target.
- the direction of flight from the thrower depends upon the throwers skill and the type of flight path (e.g. curved or straight) depends upon the angle of the saucer relative to the ground when it is released by the thrower. Its appeal as a toy appears to reside in the fact that it exhibits definite aerodynamics characteristics, can be made to do maneuvers of various kinds depending upon the skill of the user, and is relatively easy to master.
- the present invention provides an improved version of this well-known flying saucer.
- means located on the convex side of the flying saucer are provided for interrupting the smooth flow of air over this surface.
- this action is described as spoiling the air flow and the means by which this is accomplished are described as spoilers.
- this disruption of airflow is thought to create a turbulent unseparated boundary layer over the convex side of the saucer and to result in a reduction of drag especially in high-speed flight and an increase in stability while in flight. This means that a novice thrower can learn to throw the flying saucer more rapidly, that more expert throws will result with less experience, that better accuracy can be achieved and that a reduction in the skill required to use the saucer is made possible.
- the invention contemplates an aerodynamic toy.
- the toy comprises a central portion and a rim ci-rcumscribing the central portion and curving downwardly from the central portion.
- the central portion and the rim together form a concave side and a convex side of the toy.
- means are located on the convex side of the toy ice for interfering with the flow of air over this side of the toy when it is thrown.
- the toy is of a size to be readily gripped with one hand for throwing and for this purpose has a rim height which permits convenient gripping of the implement With fingers placed on the first side of the implement and the thumb placed on the opposite side.
- FIG. 1 is an elevational view of the flying saucer
- FIG. 2 is a view of the top or convex side of the flying saucer
- FIG. 3 is a view of the bottom or concave side of the flying saucer.
- FIG. 4 is a cross-sectional view taken along the lines 4-4 of FIG. 2.
- FIG. 1 there is shown an elevational view of a flying saucer 10 of this invention.
- the toy resembles an inverted saucer having a central portion 12 and formed integrally therewith is a rim 14.
- a curved surface 16 is provided to provide a smooth transition from the central portion 12 to the rim 14.
- the central portion 14, surface 16 and rim 14 together form two sides of the toy which will be referred to herein as the concave and convex sides of the toy.
- the bottom edge 18 of the saucer 10 together with the convex side of the toy resemble an air foil.
- a plateau or crown 20 is formed in the central portion 12 on the convex side of the toy. Although its contribution to the flight of the saucer has not been definitely determined, it is believed that the crown 20 also contributes to the stable flight of the saucer through the air.
- FIG. 1 Also shown in FIG. 1 are a plurality of ridges 22 superimposed or raised on the curved surface 16. As will be discussed in more detail below, the placement of ridges on the convex side of the saucer has been found to produce a beneficial effect on the stability of the implement when thrown. This stability is thought to be due to the ridges causing an effect which is analogous to the effect of a spoiler as that term is used in aerodynamics.
- FIGS. 2 and 3 are shown plan views of the convex and concave sides of the implement 10.
- the implement is circular in form.
- the rim 14 is placed so that it circumscribes the circular central portion 12 of the saucer. Further details of the relationship of the ridges 22 to the flat central portion 12 and the rim 14 can be seen from FIG. 2.
- the outermost ridge is located on the curved portion 16 in the area where the rim 12 and central portion 14 merge.
- the outermost ridge and any others which may be provided circumscribe at least a major portion of the periphery of the saucer.
- the other ribs or ridges 22 which are provided are located in concentric arrangement interiorly of this outermost ridge and in close juxtaposition with adjacent ridges as shown.
- Another discontinuity 26 in the convex surface of the toy is located interiorly of ridges 22 and forms a closed circle on the central portion 12 concentric with the center 28 of the saucer.
- Interiorly of ridge 26 is a ridge 30 marking the beginning of crown 20.
- Crown 20 resembles a circular plateau and is located on the central portion 12 of the saucer with its center coincident with the center 28 of the implement.
- FIG. 3 depicts a view from the concave side of the saucer and as shown therein has a relatively smooth surface 32 extending from the rim 14 interiorly to the crown 20.
- Circle 34 corresponds to the ridge 30 located on the convex side of the saucer. In this view the crown appears as an indentation in the concave side of the saucer.
- FIG. 4 a section view taken along lines 44. of FIG. 2, further details of the relation of the rim 14 to the central portion 12 are shown.
- the lower side of toy is concave and merges into the rim at 31. on the upper side the circular portion 12 is connected to the rim 14 by means of the curved transitional area 16 on which a plurality of ridges 22 have been placed.
- the thickness of the rim portion 14 is substantially greater than the thickness of thecentral portion.
- the rim 14, ridges 22 and central portion 12 are formed integrally from plastic or other lightweight material by means of a molding operation.
- the height of the rim 14' is selected such that the implement may be conveniently gripped by placing the thumb on the convex side of the saucer with the finger or fingers of the hand extending around the rimand being placed on the concave side of the saucer. It has been found that when the implement is thrown in a manner such that the saucer is approximately horizontal with respect to the ground as it leaves the hand that it displays definite aerodynamic properties and tends to fly in the direction in which it is thrown. It is believed that the saucer flies because the saucer approximates an airfoil and hence its flight through the air is enhanced by aerodynamic lift.
- the angle of the saucer with respect to ground can be varied to obtain greater ec'centricities in flight such as causing the saucer to curve in one direction or another.
- the angle of attack with respect to the air can be varied such that if the saucer is thrown at a high angle of attack relative to the wind or airflow, the saucer can be made to demonstrate an action similar to a boomerang.
- the ridges 22 provided on the convex side of the saucer have been found to result in an improved flight of the saucer regardless of the skill of the thrower.
- This improved flight is not completely understood but is thought to be due to an effect analogous to a spoiler on an airfoil which interferes or interrupts the smooth aerodynamic flow over the top of the saucer.
- the ridges or spoilers cause a disruption of the normal airflow pattern over the top of the saucer.
- This interference with the smooth airflow pattern results in a reduction in drag and an increase in stability, especially under high-speed flight conditions.
- the increase in stability under high-speed flight conditions is highly desirable since'slight mistakes in execution of a hardthrow tend to be exaggerated under these conditions. Due to the fact that the spoilers are provided and stability is thereby increased, the chances of a poor flight due to a hard or high-speed throw are reduced.
- the saucer can also be used to perform other maneuvers.
- a high, easy throw of the saucer causes it to stall and float downward gently as lift forces resist the pull of gravity. This floating action enables someone participating with the thrower to easily catch the toy as it settles vertically.
- the throw can be executed by a throy in which the thrower, begins with the toy behind his b ack and carries it in a vertical plane past the thigharid then rotates the wrist such that the saucer is brought to a nearly horizontal plane and released with a flip of the wrist in a relatively horizontal orientation causing it to fly away from him.
- An aerodynamic toy comprising:
- air flow spoiling means located on the convex surface of curvature and extending substantially from said boundary to the point of juncture at the rim, said spoiling means comprising a plurality of concentric circular raised ribs being concentric about said center.
Landscapes
- Toys (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US505864A US3359678A (en) | 1965-11-01 | 1965-11-01 | Flying saucer |
| DE6601650U DE6601650U (de) | 1965-11-01 | 1966-09-07 | Fliegende untertassen |
| DE1578679A DE1578679B2 (de) | 1965-11-01 | 1966-09-08 | Wurfscheibe |
| FR77306A FR1515917A (fr) | 1965-11-01 | 1966-09-22 | Jouets aérodynamiques, en particulier soucoupes volantes |
| GB44187/66A GB1127470A (en) | 1965-11-01 | 1966-10-04 | An aerodynamic toy |
| NL6615113A NL6615113A (enExample) | 1965-11-01 | 1966-10-25 | |
| BE706943D BE706943A (enExample) | 1965-11-01 | 1967-11-23 | |
| CH1736767A CH462018A (de) | 1965-11-01 | 1967-12-12 | Aerodynamisches Wurf-Spielzeug |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US505864A US3359678A (en) | 1965-11-01 | 1965-11-01 | Flying saucer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3359678A true US3359678A (en) | 1967-12-26 |
Family
ID=24012189
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US505864A Expired - Lifetime US3359678A (en) | 1965-11-01 | 1965-11-01 | Flying saucer |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3359678A (enExample) |
| BE (1) | BE706943A (enExample) |
| CH (1) | CH462018A (enExample) |
| DE (2) | DE6601650U (enExample) |
| FR (1) | FR1515917A (enExample) |
| GB (1) | GB1127470A (enExample) |
| NL (1) | NL6615113A (enExample) |
Cited By (136)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3571811A (en) * | 1969-05-19 | 1971-03-23 | Wilson Henry A | Toy hat |
| US3573869A (en) * | 1969-03-26 | 1971-04-06 | American Molded Products Ltd | Playing disc with tacky surface |
| US3673731A (en) * | 1971-06-21 | 1972-07-04 | Raphael Farhi | Reversible aerodynamic disc and gyroscopic toy |
| US3710505A (en) * | 1971-01-04 | 1973-01-16 | Brooklyn Prod Inc | Aerodynamic toy |
| US3724122A (en) * | 1971-03-16 | 1973-04-03 | Wham O Mfg Co | Flying saucer |
| US3765122A (en) * | 1970-10-29 | 1973-10-16 | R English | Flying toy |
| US3767043A (en) * | 1971-10-29 | 1973-10-23 | M Margolis | Package for products |
| US3784200A (en) * | 1973-03-15 | 1974-01-08 | R Hotchkiss | Projectile including a cylindrical body with one flanged end and a target board |
| US3828466A (en) * | 1972-06-22 | 1974-08-13 | E Geiger | Flying saucer |
| US3855728A (en) * | 1974-01-10 | 1974-12-24 | W Hynds | Aerodynamic toy |
| US3930650A (en) * | 1974-12-23 | 1976-01-06 | Molded Foam Industries, Inc. | Throwing device |
| US3948523A (en) * | 1974-08-05 | 1976-04-06 | Michael Henry G | Lighted rotating flying body |
| US3959916A (en) * | 1974-10-17 | 1976-06-01 | Lawrence Peska Associates, Inc. | Whistling scaling toy |
| US4031655A (en) * | 1976-01-30 | 1977-06-28 | Jose Ponciano | Aerodynamic sound-emitting amusement device |
| US4080753A (en) * | 1977-03-28 | 1978-03-28 | Hiner William D | Signal generating flying saucer with thin central vibratile portion |
| US4086723A (en) * | 1976-09-29 | 1978-05-02 | Strawick Raymond L | Chemi-luminescent flying saucer toy |
| US4132029A (en) * | 1977-05-09 | 1979-01-02 | Positive Pyramids, Inc. | Pyramid flyer |
| US4151997A (en) * | 1976-11-08 | 1979-05-01 | A. D. Design Services, Inc. | Hydroplaning disc |
| US4151674A (en) * | 1976-06-14 | 1979-05-01 | Klahn Dale H | Flying cylinder |
| US4153252A (en) * | 1977-10-31 | 1979-05-08 | Sullivan Richard A | Aerodynamic disc |
| US4152863A (en) * | 1977-01-12 | 1979-05-08 | Custom Concepts, Incorporated | Popper toy |
| USD251927S (en) | 1977-02-09 | 1979-05-22 | Amsun Corporation | Aerial toy |
| US4157632A (en) * | 1977-06-10 | 1979-06-12 | Everett Robert A | Aerial toy |
| US4174834A (en) * | 1977-10-03 | 1979-11-20 | Aldo De Martino | Stick-propelled disk game |
| US4196540A (en) * | 1976-08-05 | 1980-04-08 | Hembree Charles B | Aerodynamic toy |
| US4204357A (en) * | 1977-06-21 | 1980-05-27 | Harrington Richard H | Flying disc |
| US4205484A (en) * | 1978-05-18 | 1980-06-03 | Bloeme Peter R | Aerodynamic toy |
| US4216611A (en) * | 1977-05-05 | 1980-08-12 | Psyras Louis G | Aerodynamic toy |
| US4253269A (en) * | 1979-09-13 | 1981-03-03 | Sullivan Richard A | Reversible flexible aerodynamic disc |
| US4265454A (en) * | 1979-06-29 | 1981-05-05 | Bayless Mark S | Disc shaped projectile having notched portion |
| US4288942A (en) * | 1979-08-03 | 1981-09-15 | Nicholl Thomas H | Aerodynamic device |
| EP0040656A1 (en) * | 1980-05-27 | 1981-12-02 | WHAM-O MFG. Co. | Flying disc and method of attaching a disc to a ring |
| WO1981003433A1 (en) * | 1980-05-27 | 1981-12-10 | R Harrington | Flying disc |
| US4431196A (en) * | 1982-09-30 | 1984-02-14 | Mark R. Kutnyak | Lighting adapter kit and method for installing lights in a flying disc |
| US4456265A (en) * | 1979-01-16 | 1984-06-26 | Adler Alan John | Gliding ring |
| USD275976S (en) | 1982-07-12 | 1984-10-16 | Williams Teresa E | Aerial toy |
| US4516947A (en) * | 1983-10-03 | 1985-05-14 | Pircher Donna S | Discoidal amusement device |
| USD286657S (en) | 1983-05-02 | 1986-11-11 | Tom Fields | Lighted aerial toy |
| US4669995A (en) * | 1985-01-07 | 1987-06-02 | Lombard Paul W | Flying toy |
| US4681553A (en) * | 1983-05-09 | 1987-07-21 | Rodarte Michael R | Aerodynamic throwing implement |
| US4737128A (en) * | 1986-12-11 | 1988-04-12 | Parker Brothers Division Of Kenner Parker Toys Inc. | Flexible unitary circular air foil |
| USD295429S (en) | 1987-04-06 | 1988-04-26 | Sandeen Michael W | Flying disc toy |
| US4802875A (en) * | 1987-03-06 | 1989-02-07 | Cunningham Paul E | Tethered flying disc with two-piece bearing means |
| US4889347A (en) * | 1988-12-01 | 1989-12-26 | Mineart Michael V | Flying disk with flexible center |
| DE3942185A1 (de) * | 1989-01-10 | 1990-07-12 | Ettore Marcotti | Fliegende untertasse mit bedienungsvorrichtung |
| USD310691S (en) | 1987-12-22 | 1990-09-18 | Axelrod Herbert R | Aerial toy |
| US5009623A (en) * | 1990-02-20 | 1991-04-23 | Lueschen Jeffrey D | Surfing saucer |
| USD337623S (en) | 1991-12-09 | 1993-07-20 | Franker Kevin R | Flying disk |
| US5232226A (en) * | 1992-08-03 | 1993-08-03 | Rapid Mounting And Finishing Co.-Cadaco Division | Apparatus and method for propelling and retrieving a disk |
| US5254077A (en) * | 1992-01-24 | 1993-10-19 | Nottingham-Spirk Design Associates, Inc. | Tethered ring-shaped toy |
| USD341390S (en) | 1992-01-24 | 1993-11-16 | Nottingham-Spirk Design Associates, Inc. | Flying toy |
| US5263819A (en) * | 1993-06-07 | 1993-11-23 | Leary Michael J O | Paired flying disks |
| US5269716A (en) * | 1992-04-27 | 1993-12-14 | Charles Viola | Flying toy with radial airfoils |
| US5290184A (en) * | 1992-11-12 | 1994-03-01 | Imagination Factory, Inc. | Illuminated flying disk having balanced housing for split circuitry |
| USD346413S (en) | 1992-10-02 | 1994-04-26 | Marvlee, Inc. | Toy discus |
| US5326110A (en) * | 1993-12-06 | 1994-07-05 | Gould John C | Combined hollow container and detachably secured tossable saucer shaped disc |
| USD349930S (en) | 1992-10-08 | 1994-08-23 | Killion Darryl B | Disc for tossing games |
| USD350783S (en) | 1993-06-10 | 1994-09-20 | Bacon Jerry R | Lighted flying disk |
| USD356717S (en) | 1993-02-12 | 1995-03-28 | Mitch Smith | Pizza container |
| US5423705A (en) * | 1994-03-28 | 1995-06-13 | Kransco | Flying disc with laminate surfacing |
| US5484159A (en) * | 1994-07-26 | 1996-01-16 | Lance L. Dean | Covered flying object |
| USD369191S (en) | 1994-02-16 | 1996-04-23 | Innova Champion Discs, Inc. | Flying disc |
| US5531624A (en) * | 1994-02-14 | 1996-07-02 | Innova Champion Discs, Inc. | Flying disc |
| US5540610A (en) * | 1994-11-08 | 1996-07-30 | Mattel, Inc. | Flying disc water toy |
| US5553570A (en) * | 1994-11-14 | 1996-09-10 | Vannatter, Iii; Charlie H. | Disc-shaped animal retrieval toy having treat container |
| USD386222S (en) * | 1996-04-08 | 1997-11-11 | Champion Discs, Inc. | Flying disc |
| USD386223S (en) * | 1996-07-23 | 1997-11-11 | Mattel, Inc. | High performance flying disc |
| USD386221S (en) * | 1994-06-21 | 1997-11-11 | Ybanez Steven R | Illuminated disc flyer |
| USD387817S (en) * | 1996-05-20 | 1997-12-16 | Robert C. Noyes | Flying disc toy with dimple pattern |
| USD388134S (en) * | 1996-02-28 | 1997-12-23 | Innova Champion Discs, Inc. | Flying disc |
| USD390282S (en) | 1996-08-20 | 1998-02-03 | Fi-Shock, Inc. | Lighted throwing disc |
| USD398939S (en) | 1997-07-31 | 1998-09-29 | Harned William D | Disc-shaped flyer having octopus-like tentacles |
| US5816880A (en) * | 1992-01-21 | 1998-10-06 | Forti; William M. | Gyroscopic flying device |
| US5829714A (en) * | 1997-12-29 | 1998-11-03 | Lechtenberg; William Francis | Aerolift mechanism |
| USD401289S (en) | 1997-03-20 | 1998-11-17 | Champion Discs, Inc. | Flying disc |
| USD401288S (en) | 1997-03-20 | 1998-11-17 | Champion Discs, Inc. | Flying disc |
| USD402318S (en) | 1996-02-28 | 1998-12-08 | Innova Champion Discs, Inc. | Flying disc |
| US5964636A (en) * | 1998-07-20 | 1999-10-12 | Carrera; Carlos | Balloon toy |
| US6179737B1 (en) | 1995-01-09 | 2001-01-30 | Alan J. Adler | Flying disc |
| WO2001049385A1 (en) | 2000-01-03 | 2001-07-12 | Lawrence Huset | Circular flying disk toy |
| USD445461S1 (en) | 2001-02-09 | 2001-07-24 | Joseph J. Vodhanel, Jr. | Flying disc |
| US20020066676A1 (en) * | 1996-12-13 | 2002-06-06 | Shannon Morris | Method and apparatus for jewelry organization |
| US20030022586A1 (en) * | 2001-07-25 | 2003-01-30 | Gabriel Beged-Dov | Gyroscopically stabilized throwable implement |
| US6585551B2 (en) | 2001-05-31 | 2003-07-01 | Go-Whiz-It, Inc. | Flyer discs |
| US6672253B1 (en) | 2003-02-10 | 2004-01-06 | Charles A. Viola | Flying disk toy with rope |
| US6755711B2 (en) | 2001-05-31 | 2004-06-29 | Mcclung Karen Therese | Box games and activities |
| US20040132561A1 (en) * | 1994-11-14 | 2004-07-08 | Mcclung John Michael | Disc activities & discs for them |
| US6764371B2 (en) | 2002-02-08 | 2004-07-20 | Hartman William V | Aerodynamic sound-emitting amusement device |
| DE10321945A1 (de) * | 2003-05-15 | 2004-12-09 | Flügge, Erhardt J. | Spielgerät |
| US20040259460A1 (en) * | 2001-02-16 | 2004-12-23 | Stanley Persall | Throw toy for pets |
| US6918809B2 (en) * | 2001-02-16 | 2005-07-19 | Stanley Edwin Persall | Multipurpose disc toy |
| US6971940B2 (en) * | 2002-08-27 | 2005-12-06 | Adam Cohen | Illuminated flying disc |
| US7081032B1 (en) | 2003-01-14 | 2006-07-25 | Holgate Inc. | Flying disc having contoured features |
| US7217169B1 (en) | 2005-06-18 | 2007-05-15 | National Polymers Llc | Dimensionally stable flying disc toy construction |
| USD562918S1 (en) * | 2004-10-04 | 2008-02-26 | Savvier Lp | Exercise disk |
| USD564877S1 (en) * | 2006-07-27 | 2008-03-25 | Progressive International Corporation | Universal lid |
| USD568091S1 (en) * | 2005-01-21 | 2008-05-06 | Norberto Jorge Garcia | Cooking pot |
| USD572315S1 (en) * | 2007-06-20 | 2008-07-01 | Sowinski Thomas D | Flying disk with remote |
| US20080254705A1 (en) * | 2007-04-16 | 2008-10-16 | Southwest Research Institute | Dispensing Device |
| US20080293523A1 (en) * | 2007-05-23 | 2008-11-27 | Perry-Smith Randolph T | Disc launching and catching device |
| US20120225739A1 (en) * | 2011-03-02 | 2012-09-06 | Michael Cheshire | Flying disc toy, accessories and games |
| USD674657S1 (en) * | 2011-03-17 | 2013-01-22 | Alana Fields | Flexible sleeve for a plate |
| USD683516S1 (en) * | 2012-08-01 | 2013-06-04 | Gregory Sean Elias | Edible flying disc dog treat |
| USD687193S1 (en) * | 2010-11-30 | 2013-07-30 | Hawkeye Steel Products, Inc. | Combination feeder and pesticide applicator |
| US8678873B2 (en) | 2011-11-02 | 2014-03-25 | Lang Exterior, Inc. | Dog disk |
| USD704386S1 (en) * | 2012-12-20 | 2014-05-06 | Ebsco Industries, Inc. | Game feeder lid |
| USD725197S1 (en) * | 2013-07-23 | 2015-03-24 | Scott C. Thompson | Flying disc toy |
| USD725713S1 (en) * | 2013-07-23 | 2015-03-31 | Scott C. Thompson | Flying disc toy |
| US9259661B2 (en) | 2015-03-05 | 2016-02-16 | Daniel M Vogel | Mounting clamp for flying disc |
| US9568287B2 (en) * | 2015-07-09 | 2017-02-14 | Jeremy A. Nienke | Recoverable and reusable aerial target |
| US9827474B2 (en) | 2013-08-29 | 2017-11-28 | Kan Jam, LLC | Disc throwing game having illumination and flotation means |
| US10118696B1 (en) | 2016-03-31 | 2018-11-06 | Steven M. Hoffberg | Steerable rotating projectile |
| US10137360B2 (en) | 2014-08-15 | 2018-11-27 | Wild Sales, Llc | Tabletop disc game assembly |
| USD844796S1 (en) * | 2017-03-21 | 2019-04-02 | New Pelvic Pain Technologies Inc. | Trigger point therapy device |
| USD851338S1 (en) * | 2017-05-16 | 2019-06-11 | Joel Brown | Adjustable receptacle for pet foods and beverages |
| USD852628S1 (en) * | 2017-02-02 | 2019-07-02 | Matthew Zerebny | Bottle support shoe |
| US20190255625A1 (en) * | 2017-02-17 | 2019-08-22 | Alain Gary Mazer | Hole saw guide |
| USD859536S1 (en) * | 2018-08-07 | 2019-09-10 | Mike Cope | Flying spinning toy |
| USD860332S1 (en) * | 2018-04-19 | 2019-09-17 | Mike Cope | Flying spinning toy |
| USD873924S1 (en) * | 2018-07-30 | 2020-01-28 | Mike Cope | Flying spinning toy |
| USD890453S1 (en) * | 2018-06-09 | 2020-07-14 | Safestix Ltd | Animal toy |
| US10881978B2 (en) | 2017-06-30 | 2021-01-05 | William Wheelwright Miller | Ergonomic flying disc |
| USD922978S1 (en) * | 2012-01-09 | 2021-06-22 | Apple Inc. | Headset |
| USD928734S1 (en) | 2012-01-09 | 2021-08-24 | Apple Inc. | Headset |
| USD932568S1 (en) * | 2019-02-01 | 2021-10-05 | Brandon Mulhern | Exercise hoop |
| USD935728S1 (en) * | 2020-01-10 | 2021-11-09 | Hakari BV | Mini urn |
| USD954872S1 (en) * | 2019-12-06 | 2022-06-14 | P&P Imports LLC | Shuffleboard disc |
| US11577134B2 (en) * | 2021-07-07 | 2023-02-14 | Jlaser Llc | Spring ring device |
| USD985861S1 (en) * | 2021-11-18 | 2023-05-09 | Ba.Ma. S.P.A. | Toy for animals |
| USD987202S1 (en) * | 2021-01-13 | 2023-05-23 | Silver Fox L.L.C. | Pet lick apparatus for liquid consumables |
| US11712637B1 (en) | 2018-03-23 | 2023-08-01 | Steven M. Hoffberg | Steerable disk or ball |
| USD1006892S1 (en) * | 2023-06-20 | 2023-12-05 | David Laemle | Flying disc |
| US12144328B2 (en) | 2021-10-29 | 2024-11-19 | Silver Fox L.L.C. | Pet lick apparatus for liquid consumables |
| USD1057845S1 (en) * | 2024-06-25 | 2025-01-14 | Chi Cheung Ng | Flying disc |
| USD1062923S1 (en) * | 2020-06-16 | 2025-02-18 | Bala Bangles, Inc. | Concentric ring-shaped free weights set |
| DK182042B1 (en) * | 2024-04-17 | 2025-06-12 | Innovation | Golf disc |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US356929A (en) * | 1887-02-01 | Flying target | ||
| US2659178A (en) * | 1950-12-30 | 1953-11-17 | Carroll H Van Hartesveldt | Toy flying saucer |
| US2835073A (en) * | 1956-08-20 | 1958-05-20 | Chester F Dame | Rotor-type flying device |
-
1965
- 1965-11-01 US US505864A patent/US3359678A/en not_active Expired - Lifetime
-
1966
- 1966-09-07 DE DE6601650U patent/DE6601650U/de not_active Expired
- 1966-09-08 DE DE1578679A patent/DE1578679B2/de not_active Ceased
- 1966-09-22 FR FR77306A patent/FR1515917A/fr not_active Expired
- 1966-10-04 GB GB44187/66A patent/GB1127470A/en not_active Expired
- 1966-10-25 NL NL6615113A patent/NL6615113A/xx unknown
-
1967
- 1967-11-23 BE BE706943D patent/BE706943A/xx not_active IP Right Cessation
- 1967-12-12 CH CH1736767A patent/CH462018A/de unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US356929A (en) * | 1887-02-01 | Flying target | ||
| US2659178A (en) * | 1950-12-30 | 1953-11-17 | Carroll H Van Hartesveldt | Toy flying saucer |
| US2835073A (en) * | 1956-08-20 | 1958-05-20 | Chester F Dame | Rotor-type flying device |
Cited By (155)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3573869A (en) * | 1969-03-26 | 1971-04-06 | American Molded Products Ltd | Playing disc with tacky surface |
| US3571811A (en) * | 1969-05-19 | 1971-03-23 | Wilson Henry A | Toy hat |
| US3765122A (en) * | 1970-10-29 | 1973-10-16 | R English | Flying toy |
| US3710505A (en) * | 1971-01-04 | 1973-01-16 | Brooklyn Prod Inc | Aerodynamic toy |
| US3724122A (en) * | 1971-03-16 | 1973-04-03 | Wham O Mfg Co | Flying saucer |
| US3673731A (en) * | 1971-06-21 | 1972-07-04 | Raphael Farhi | Reversible aerodynamic disc and gyroscopic toy |
| US3767043A (en) * | 1971-10-29 | 1973-10-23 | M Margolis | Package for products |
| US3828466A (en) * | 1972-06-22 | 1974-08-13 | E Geiger | Flying saucer |
| US3784200A (en) * | 1973-03-15 | 1974-01-08 | R Hotchkiss | Projectile including a cylindrical body with one flanged end and a target board |
| US3855728A (en) * | 1974-01-10 | 1974-12-24 | W Hynds | Aerodynamic toy |
| US3948523A (en) * | 1974-08-05 | 1976-04-06 | Michael Henry G | Lighted rotating flying body |
| US3959916A (en) * | 1974-10-17 | 1976-06-01 | Lawrence Peska Associates, Inc. | Whistling scaling toy |
| US3930650A (en) * | 1974-12-23 | 1976-01-06 | Molded Foam Industries, Inc. | Throwing device |
| US4031655A (en) * | 1976-01-30 | 1977-06-28 | Jose Ponciano | Aerodynamic sound-emitting amusement device |
| US4151674A (en) * | 1976-06-14 | 1979-05-01 | Klahn Dale H | Flying cylinder |
| US4196540A (en) * | 1976-08-05 | 1980-04-08 | Hembree Charles B | Aerodynamic toy |
| US4086723A (en) * | 1976-09-29 | 1978-05-02 | Strawick Raymond L | Chemi-luminescent flying saucer toy |
| US4151997A (en) * | 1976-11-08 | 1979-05-01 | A. D. Design Services, Inc. | Hydroplaning disc |
| US4152863A (en) * | 1977-01-12 | 1979-05-08 | Custom Concepts, Incorporated | Popper toy |
| USD251927S (en) | 1977-02-09 | 1979-05-22 | Amsun Corporation | Aerial toy |
| US4080753A (en) * | 1977-03-28 | 1978-03-28 | Hiner William D | Signal generating flying saucer with thin central vibratile portion |
| US4216611A (en) * | 1977-05-05 | 1980-08-12 | Psyras Louis G | Aerodynamic toy |
| US4132029A (en) * | 1977-05-09 | 1979-01-02 | Positive Pyramids, Inc. | Pyramid flyer |
| US4157632A (en) * | 1977-06-10 | 1979-06-12 | Everett Robert A | Aerial toy |
| US4204357A (en) * | 1977-06-21 | 1980-05-27 | Harrington Richard H | Flying disc |
| US4174834A (en) * | 1977-10-03 | 1979-11-20 | Aldo De Martino | Stick-propelled disk game |
| US4153252A (en) * | 1977-10-31 | 1979-05-08 | Sullivan Richard A | Aerodynamic disc |
| US4205484A (en) * | 1978-05-18 | 1980-06-03 | Bloeme Peter R | Aerodynamic toy |
| US4456265A (en) * | 1979-01-16 | 1984-06-26 | Adler Alan John | Gliding ring |
| US4265454A (en) * | 1979-06-29 | 1981-05-05 | Bayless Mark S | Disc shaped projectile having notched portion |
| US4288942A (en) * | 1979-08-03 | 1981-09-15 | Nicholl Thomas H | Aerodynamic device |
| US4253269A (en) * | 1979-09-13 | 1981-03-03 | Sullivan Richard A | Reversible flexible aerodynamic disc |
| EP0040656A1 (en) * | 1980-05-27 | 1981-12-02 | WHAM-O MFG. Co. | Flying disc and method of attaching a disc to a ring |
| WO1981003433A1 (en) * | 1980-05-27 | 1981-12-10 | R Harrington | Flying disc |
| USD275976S (en) | 1982-07-12 | 1984-10-16 | Williams Teresa E | Aerial toy |
| US4431196A (en) * | 1982-09-30 | 1984-02-14 | Mark R. Kutnyak | Lighting adapter kit and method for installing lights in a flying disc |
| USD286657S (en) | 1983-05-02 | 1986-11-11 | Tom Fields | Lighted aerial toy |
| US4681553A (en) * | 1983-05-09 | 1987-07-21 | Rodarte Michael R | Aerodynamic throwing implement |
| US4516947A (en) * | 1983-10-03 | 1985-05-14 | Pircher Donna S | Discoidal amusement device |
| US4669995A (en) * | 1985-01-07 | 1987-06-02 | Lombard Paul W | Flying toy |
| US4737128A (en) * | 1986-12-11 | 1988-04-12 | Parker Brothers Division Of Kenner Parker Toys Inc. | Flexible unitary circular air foil |
| US4802875A (en) * | 1987-03-06 | 1989-02-07 | Cunningham Paul E | Tethered flying disc with two-piece bearing means |
| USD295429S (en) | 1987-04-06 | 1988-04-26 | Sandeen Michael W | Flying disc toy |
| USD310691S (en) | 1987-12-22 | 1990-09-18 | Axelrod Herbert R | Aerial toy |
| US4889347A (en) * | 1988-12-01 | 1989-12-26 | Mineart Michael V | Flying disk with flexible center |
| DE3942185A1 (de) * | 1989-01-10 | 1990-07-12 | Ettore Marcotti | Fliegende untertasse mit bedienungsvorrichtung |
| US5009623A (en) * | 1990-02-20 | 1991-04-23 | Lueschen Jeffrey D | Surfing saucer |
| USD337623S (en) | 1991-12-09 | 1993-07-20 | Franker Kevin R | Flying disk |
| US5816880A (en) * | 1992-01-21 | 1998-10-06 | Forti; William M. | Gyroscopic flying device |
| US5254077A (en) * | 1992-01-24 | 1993-10-19 | Nottingham-Spirk Design Associates, Inc. | Tethered ring-shaped toy |
| USD341390S (en) | 1992-01-24 | 1993-11-16 | Nottingham-Spirk Design Associates, Inc. | Flying toy |
| US5269716A (en) * | 1992-04-27 | 1993-12-14 | Charles Viola | Flying toy with radial airfoils |
| US5232226A (en) * | 1992-08-03 | 1993-08-03 | Rapid Mounting And Finishing Co.-Cadaco Division | Apparatus and method for propelling and retrieving a disk |
| USD346413S (en) | 1992-10-02 | 1994-04-26 | Marvlee, Inc. | Toy discus |
| USD349930S (en) | 1992-10-08 | 1994-08-23 | Killion Darryl B | Disc for tossing games |
| US5290184A (en) * | 1992-11-12 | 1994-03-01 | Imagination Factory, Inc. | Illuminated flying disk having balanced housing for split circuitry |
| USD356717S (en) | 1993-02-12 | 1995-03-28 | Mitch Smith | Pizza container |
| US5263819A (en) * | 1993-06-07 | 1993-11-23 | Leary Michael J O | Paired flying disks |
| USD350783S (en) | 1993-06-10 | 1994-09-20 | Bacon Jerry R | Lighted flying disk |
| US5326110A (en) * | 1993-12-06 | 1994-07-05 | Gould John C | Combined hollow container and detachably secured tossable saucer shaped disc |
| US5531624A (en) * | 1994-02-14 | 1996-07-02 | Innova Champion Discs, Inc. | Flying disc |
| USD369191S (en) | 1994-02-16 | 1996-04-23 | Innova Champion Discs, Inc. | Flying disc |
| US5423705A (en) * | 1994-03-28 | 1995-06-13 | Kransco | Flying disc with laminate surfacing |
| USD386221S (en) * | 1994-06-21 | 1997-11-11 | Ybanez Steven R | Illuminated disc flyer |
| US5484159A (en) * | 1994-07-26 | 1996-01-16 | Lance L. Dean | Covered flying object |
| US5540610A (en) * | 1994-11-08 | 1996-07-30 | Mattel, Inc. | Flying disc water toy |
| US6073588A (en) * | 1994-11-14 | 2000-06-13 | Mcclung, Iii; Guy L. | Throwing plate system and method |
| US5553570A (en) * | 1994-11-14 | 1996-09-10 | Vannatter, Iii; Charlie H. | Disc-shaped animal retrieval toy having treat container |
| US5799616A (en) * | 1994-11-14 | 1998-09-01 | Charlie Van Natter | Animal interaction method |
| US7270332B2 (en) | 1994-11-14 | 2007-09-18 | Go-Whiz-It, Inc. | Activity sets |
| US20040132561A1 (en) * | 1994-11-14 | 2004-07-08 | Mcclung John Michael | Disc activities & discs for them |
| US6179737B1 (en) | 1995-01-09 | 2001-01-30 | Alan J. Adler | Flying disc |
| USD388134S (en) * | 1996-02-28 | 1997-12-23 | Innova Champion Discs, Inc. | Flying disc |
| USD402318S (en) | 1996-02-28 | 1998-12-08 | Innova Champion Discs, Inc. | Flying disc |
| USD386222S (en) * | 1996-04-08 | 1997-11-11 | Champion Discs, Inc. | Flying disc |
| USD387817S (en) * | 1996-05-20 | 1997-12-16 | Robert C. Noyes | Flying disc toy with dimple pattern |
| USD386223S (en) * | 1996-07-23 | 1997-11-11 | Mattel, Inc. | High performance flying disc |
| USD390282S (en) | 1996-08-20 | 1998-02-03 | Fi-Shock, Inc. | Lighted throwing disc |
| US20020066676A1 (en) * | 1996-12-13 | 2002-06-06 | Shannon Morris | Method and apparatus for jewelry organization |
| USD401289S (en) | 1997-03-20 | 1998-11-17 | Champion Discs, Inc. | Flying disc |
| USD401288S (en) | 1997-03-20 | 1998-11-17 | Champion Discs, Inc. | Flying disc |
| USD398939S (en) | 1997-07-31 | 1998-09-29 | Harned William D | Disc-shaped flyer having octopus-like tentacles |
| US5829714A (en) * | 1997-12-29 | 1998-11-03 | Lechtenberg; William Francis | Aerolift mechanism |
| US5964636A (en) * | 1998-07-20 | 1999-10-12 | Carrera; Carlos | Balloon toy |
| WO2001049385A1 (en) | 2000-01-03 | 2001-07-12 | Lawrence Huset | Circular flying disk toy |
| USD445461S1 (en) | 2001-02-09 | 2001-07-24 | Joseph J. Vodhanel, Jr. | Flying disc |
| US6918809B2 (en) * | 2001-02-16 | 2005-07-19 | Stanley Edwin Persall | Multipurpose disc toy |
| US20040259460A1 (en) * | 2001-02-16 | 2004-12-23 | Stanley Persall | Throw toy for pets |
| US6755711B2 (en) | 2001-05-31 | 2004-06-29 | Mcclung Karen Therese | Box games and activities |
| US6991508B2 (en) | 2001-05-31 | 2006-01-31 | Mcclung John Michael | Box games and activities |
| US6585551B2 (en) | 2001-05-31 | 2003-07-01 | Go-Whiz-It, Inc. | Flyer discs |
| US20030022586A1 (en) * | 2001-07-25 | 2003-01-30 | Gabriel Beged-Dov | Gyroscopically stabilized throwable implement |
| US6764371B2 (en) | 2002-02-08 | 2004-07-20 | Hartman William V | Aerodynamic sound-emitting amusement device |
| US6971940B2 (en) * | 2002-08-27 | 2005-12-06 | Adam Cohen | Illuminated flying disc |
| US7081032B1 (en) | 2003-01-14 | 2006-07-25 | Holgate Inc. | Flying disc having contoured features |
| US6672253B1 (en) | 2003-02-10 | 2004-01-06 | Charles A. Viola | Flying disk toy with rope |
| DE10321945A1 (de) * | 2003-05-15 | 2004-12-09 | Flügge, Erhardt J. | Spielgerät |
| USD562918S1 (en) * | 2004-10-04 | 2008-02-26 | Savvier Lp | Exercise disk |
| USD568091S1 (en) * | 2005-01-21 | 2008-05-06 | Norberto Jorge Garcia | Cooking pot |
| US7217169B1 (en) | 2005-06-18 | 2007-05-15 | National Polymers Llc | Dimensionally stable flying disc toy construction |
| USD564877S1 (en) * | 2006-07-27 | 2008-03-25 | Progressive International Corporation | Universal lid |
| US20080254705A1 (en) * | 2007-04-16 | 2008-10-16 | Southwest Research Institute | Dispensing Device |
| US20080293523A1 (en) * | 2007-05-23 | 2008-11-27 | Perry-Smith Randolph T | Disc launching and catching device |
| US7878929B2 (en) | 2007-05-23 | 2011-02-01 | Perry-Smith Randolph T | Disc launching and catching device |
| US8202180B1 (en) * | 2007-05-23 | 2012-06-19 | Perry-Smith Randolph T | Disc launching and catching device |
| USD572315S1 (en) * | 2007-06-20 | 2008-07-01 | Sowinski Thomas D | Flying disk with remote |
| USD687193S1 (en) * | 2010-11-30 | 2013-07-30 | Hawkeye Steel Products, Inc. | Combination feeder and pesticide applicator |
| US20120225739A1 (en) * | 2011-03-02 | 2012-09-06 | Michael Cheshire | Flying disc toy, accessories and games |
| USD674657S1 (en) * | 2011-03-17 | 2013-01-22 | Alana Fields | Flexible sleeve for a plate |
| US8678873B2 (en) | 2011-11-02 | 2014-03-25 | Lang Exterior, Inc. | Dog disk |
| USD1068723S1 (en) | 2012-01-09 | 2025-04-01 | Apple Inc. | Headset |
| USD922978S1 (en) * | 2012-01-09 | 2021-06-22 | Apple Inc. | Headset |
| USD1037204S1 (en) | 2012-01-09 | 2024-07-30 | Apple Inc. | Headset |
| USD992528S1 (en) | 2012-01-09 | 2023-07-18 | Apple Inc. | Headset |
| USD969773S1 (en) | 2012-01-09 | 2022-11-15 | Apple Inc. | Headset |
| USD928734S1 (en) | 2012-01-09 | 2021-08-24 | Apple Inc. | Headset |
| USD683516S1 (en) * | 2012-08-01 | 2013-06-04 | Gregory Sean Elias | Edible flying disc dog treat |
| USD704386S1 (en) * | 2012-12-20 | 2014-05-06 | Ebsco Industries, Inc. | Game feeder lid |
| USD725197S1 (en) * | 2013-07-23 | 2015-03-24 | Scott C. Thompson | Flying disc toy |
| USD725713S1 (en) * | 2013-07-23 | 2015-03-31 | Scott C. Thompson | Flying disc toy |
| US9827474B2 (en) | 2013-08-29 | 2017-11-28 | Kan Jam, LLC | Disc throwing game having illumination and flotation means |
| US10137360B2 (en) | 2014-08-15 | 2018-11-27 | Wild Sales, Llc | Tabletop disc game assembly |
| US9259661B2 (en) | 2015-03-05 | 2016-02-16 | Daniel M Vogel | Mounting clamp for flying disc |
| US9568287B2 (en) * | 2015-07-09 | 2017-02-14 | Jeremy A. Nienke | Recoverable and reusable aerial target |
| US10118696B1 (en) | 2016-03-31 | 2018-11-06 | Steven M. Hoffberg | Steerable rotating projectile |
| US11230375B1 (en) | 2016-03-31 | 2022-01-25 | Steven M. Hoffberg | Steerable rotating projectile |
| USD852628S1 (en) * | 2017-02-02 | 2019-07-02 | Matthew Zerebny | Bottle support shoe |
| US20190255625A1 (en) * | 2017-02-17 | 2019-08-22 | Alain Gary Mazer | Hole saw guide |
| USD1092168S1 (en) | 2017-02-17 | 2025-09-09 | Alain Gary Mazer | Hole saw guide |
| USD910864S1 (en) | 2017-03-21 | 2021-02-16 | New Pelvic Pain Technologies Inc. | Trigger point therapy device |
| USD910865S1 (en) | 2017-03-21 | 2021-02-16 | New Pelvic Pain Technologies Inc. | Trigger point therapy device |
| USD844796S1 (en) * | 2017-03-21 | 2019-04-02 | New Pelvic Pain Technologies Inc. | Trigger point therapy device |
| USD895130S1 (en) | 2017-03-21 | 2020-09-01 | New Pelvic Pain Technologies Inc. | Trigger point therapy device |
| USD898208S1 (en) | 2017-03-21 | 2020-10-06 | New Pelvic Pain Technologies Inc. | Trigger point therapy device |
| USD851338S1 (en) * | 2017-05-16 | 2019-06-11 | Joel Brown | Adjustable receptacle for pet foods and beverages |
| US10881978B2 (en) | 2017-06-30 | 2021-01-05 | William Wheelwright Miller | Ergonomic flying disc |
| US11712637B1 (en) | 2018-03-23 | 2023-08-01 | Steven M. Hoffberg | Steerable disk or ball |
| USD860332S1 (en) * | 2018-04-19 | 2019-09-17 | Mike Cope | Flying spinning toy |
| USD890453S1 (en) * | 2018-06-09 | 2020-07-14 | Safestix Ltd | Animal toy |
| USD873924S1 (en) * | 2018-07-30 | 2020-01-28 | Mike Cope | Flying spinning toy |
| USD859536S1 (en) * | 2018-08-07 | 2019-09-10 | Mike Cope | Flying spinning toy |
| USD932568S1 (en) * | 2019-02-01 | 2021-10-05 | Brandon Mulhern | Exercise hoop |
| USD954872S1 (en) * | 2019-12-06 | 2022-06-14 | P&P Imports LLC | Shuffleboard disc |
| USD935728S1 (en) * | 2020-01-10 | 2021-11-09 | Hakari BV | Mini urn |
| USD1062923S1 (en) * | 2020-06-16 | 2025-02-18 | Bala Bangles, Inc. | Concentric ring-shaped free weights set |
| USD987202S1 (en) * | 2021-01-13 | 2023-05-23 | Silver Fox L.L.C. | Pet lick apparatus for liquid consumables |
| US20230191216A1 (en) * | 2021-07-07 | 2023-06-22 | Jlaser, Llc | Spring Ring Device Flying Disc Apparatus |
| US11957966B2 (en) * | 2021-07-07 | 2024-04-16 | Jlaser Llc | Spring ring device flying disc apparatus |
| US11577134B2 (en) * | 2021-07-07 | 2023-02-14 | Jlaser Llc | Spring ring device |
| US12144328B2 (en) | 2021-10-29 | 2024-11-19 | Silver Fox L.L.C. | Pet lick apparatus for liquid consumables |
| USD985861S1 (en) * | 2021-11-18 | 2023-05-09 | Ba.Ma. S.P.A. | Toy for animals |
| USD1006892S1 (en) * | 2023-06-20 | 2023-12-05 | David Laemle | Flying disc |
| DK182042B1 (en) * | 2024-04-17 | 2025-06-12 | Innovation | Golf disc |
| DK202430173A1 (en) * | 2024-04-17 | 2025-06-12 | Innovation | Golf disc |
| USD1057845S1 (en) * | 2024-06-25 | 2025-01-14 | Chi Cheung Ng | Flying disc |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1578679A1 (de) | 1969-12-11 |
| GB1127470A (en) | 1968-09-18 |
| DE1578679B2 (de) | 1974-02-14 |
| CH462018A (de) | 1968-08-31 |
| BE706943A (enExample) | 1968-04-01 |
| FR1515917A (fr) | 1968-03-08 |
| DE6601650U (de) | 1969-03-27 |
| NL6615113A (enExample) | 1967-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3359678A (en) | Flying saucer | |
| US3724122A (en) | Flying saucer | |
| US3312472A (en) | Throwing disc employing raised aerodynamic sections | |
| US4157632A (en) | Aerial toy | |
| US4337950A (en) | Circular boomerang | |
| US4205484A (en) | Aerodynamic toy | |
| US3828466A (en) | Flying saucer | |
| US3580580A (en) | Aerial spinning disc | |
| US3765122A (en) | Flying toy | |
| US4132029A (en) | Pyramid flyer | |
| US4874169A (en) | Ball | |
| US5531624A (en) | Flying disc | |
| US4297809A (en) | Chirping flying saucer | |
| US5269716A (en) | Flying toy with radial airfoils | |
| US4216611A (en) | Aerodynamic toy | |
| US4906007A (en) | Hand-throwable flying toy | |
| US4104822A (en) | Rotating circular airfoil | |
| US4174834A (en) | Stick-propelled disk game | |
| US3673732A (en) | Aerial toy | |
| US3855728A (en) | Aerodynamic toy | |
| US4196540A (en) | Aerodynamic toy | |
| JPH09508825A (ja) | ゲームボール | |
| US4075781A (en) | Flying disk | |
| US2690339A (en) | Flying disk and catcher | |
| US4516947A (en) | Discoidal amusement device |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AS | Assignment |
Owner name: KRANSCO MANUFACTURING, INC., 501 FORBES BLVD., S. Free format text: ASSIGNMENT OF ASSIGNORS INTEREST.;ASSIGNOR:KRANSCO A CORP. OF CA;REEL/FRAME:004170/0393 Effective date: 19830912 |
|
| AS | Assignment |
Owner name: KRANSCO Free format text: MERGER;ASSIGNOR:WHAM-O MFG. CO.;REEL/FRAME:004253/0963 Effective date: 19821109 |