US3244691A - Metal complex monoazo dyestuffs - Google Patents
Metal complex monoazo dyestuffs Download PDFInfo
- Publication number
- US3244691A US3244691A US256235A US25623563A US3244691A US 3244691 A US3244691 A US 3244691A US 256235 A US256235 A US 256235A US 25623563 A US25623563 A US 25623563A US 3244691 A US3244691 A US 3244691A
- Authority
- US
- United States
- Prior art keywords
- metal complex
- monoazo dyestuffs
- dyestuff
- complex monoazo
- metallization
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000975 dye Substances 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 5
- 150000004696 coordination complex Chemical class 0.000 claims description 5
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000004043 dyeing Methods 0.000 description 7
- 238000001465 metallisation Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- -1 monoazo compound Chemical class 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000008431 aliphatic amides Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical compound [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- ORFSSYGWXNGVFB-UHFFFAOYSA-N sodium 4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=NC3=C(C4=C(C=C3)C(=CC(=C4N)S(=O)(=O)O)S(=O)(=O)O)O)OC)N=NC5=C(C6=C(C=C5)C(=CC(=C6N)S(=O)(=O)O)S(=O)(=O)O)O.[Na+] ORFSSYGWXNGVFB-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/14—Monoazo compounds
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/01—Complex metal compounds of azo dyes characterised by the method of metallisation
Definitions
- the monoazo dyestuff which previously has been dried, is treated under anhydrous conditions with the metalizing agent and a mixture of organic compounds, comprising from 30 to 130% of ethylene glycol (or ethers of ethylene glycol), formamide or dimethylformamide and from to 100 parts of urea, in the molten state.
- the preferred ratios are 100 parts urea per 30 parts of one or more of the other substances.
- metallizing agents simple chromium or cobalt salts are used, e.g., acetates, sulphates, chlorides, etc.
- the amount of metal salt used is generally stoichiometric, in order to form 1:2 complexes; that is 0.5 g. atoms of metal per mole of the monoazoic compound.
- the temperature of the metallization reaction is maintained at from about 110 to 140 C.; the duration for completing the metallization reaction is short, generally from about 30 to 100 minutes.
- the molten mass is poured in water or is diluted with water, eventually with the addition of alkalies (NaOH, Na CO etc.), and the finished dyestuff is separated by conventional methods.
- the process of the present invention offers a number of advantages as compared to known metallization methods carried out in the aqueous phase, i.e.:
- Dyestuffs obtained in anhydrous phase have, as compared to those obtained in aqueous medium, a higher concentration (about double), a higher purity and an improved solubility.
- the metal complex dyestuffs of the present invention are valuable for dyeing polyamides.
- the dyeing of polyamide materials is carried out in an aqueous bath containing the metal complex dyestuff derived from a monoazoic compound comprised in the general Formula 1 together with compounds able to maintain a neutral or slightly acid pH, such as ammonium acetate, ammonium sulphate or small amounts of acetic acid.
- the polyamide material is immersed in the dyeing bath at about 50 to 60 C., then gradually raising the temperature up to the boiling temperature.
- Appropriate additives may be added as desired, to obtain a more uniform dyeing such as condensation products of aliphatic amides or amines with ethylene oxide.
- Example 32.3 g. of 3,5-bis-(N-ethylsulfamido)-2-aminophenol are dissolved in 200 ml. of H 0 and 15 ml. NaOH (36 1%.). Said solution is indirectly diazotized at 0-5 C. by pouring the solution of its sodium salt added with 6.9 g. NaNO on 30 ml. of hydrochloric acid (20 B6.) and 200 ml. of H O+i-ce. The temperature is maintained at 0-5 C. by addition of ice. The volume at the end of the diazotation is 600 ml.
- the solution is neutralized to Congo red with a Na CO 10% (vol.) solution.
- the neutralized solution is poured on a solution of 15.1 g. ialpha-naphthol in 300 ml. water and 15 ml. 36 B. NaOH, at 05 C.
- the monoazo dyestuff is separated by sa'lting or light acidification, filtered, and purified, if necessary, by removing the small amounts of pcoupled product, and dried at 7080 C.
- the monoazo paste is dissolved in 500 ml. acetone, and afterwards is acidified with 30-35 ml. of HCl 5 N-subsequentlly shaken for 15 minutes, filtered and washed with 20-25 ml. of acetone. The red product is dried at C.
- the dried monoazo compound is heated to C. with a mixture consisting of 100 g. urea, 30 g. ethylene glycol and 0.05 gram mole chromium acetate. Then the mixture is heated up to 128 C. and is kept at this temperature for 2 hours in order to complete the metallization.
- the mixture is poured in water, salted to 5%, filtered and dried at 7080 C.
- a blue-black powder is obtained, which dyes wool in a neutral or weak acid bath in a pure blue shade, the resultant dye having a good uniformity and fastness to wet treatments and light, and being markedly superior to that obtained using a dyestuff prepared in aqueous media.
- a dyebath is prepared with:
- a metal complex dyestuff which contains one atom of a metal selected from the group consisting of chromium and cobalt bound in complex union to two molecules References Cited by the Examiner Of a compound Of thE formula 2,813,853 11/1957 Steinemann 260-151 X R 2,891,938 6/1959 Schetty 260-151 X 5 2,933,489 4/1960 Biedermann 260-151 X 2,991,280 7/1961 Schetty et al 260-151 X 3,086,004 4/1963 Gross et a1 260-151 RNHSO SONHR 3,126,368 3/1964 Bossard et a1. 260151 10 3,131,989 5/1964 Buehler et al.
- R is an alkyl group having from 1 to 4 carbon 3157458 11/1964 Dawson et 843 atoms.
- FOREIGN PATENTS 2 The complex of claim 1 wherein the metal is chro- 33 5 11/1951 Great Britain mium.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT260962 | 1962-02-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3244691A true US3244691A (en) | 1966-04-05 |
Family
ID=11103160
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US256235A Expired - Lifetime US3244691A (en) | 1962-02-09 | 1963-02-05 | Metal complex monoazo dyestuffs |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3244691A (en:Method) |
| BE (1) | BE633094A (en:Method) |
| CH (1) | CH453536A (en:Method) |
| DE (1) | DE1444563A1 (en:Method) |
| DK (1) | DK102812C (en:Method) |
| ES (1) | ES284907A1 (en:Method) |
| GB (1) | GB965379A (en:Method) |
| NL (1) | NL293371A (en:Method) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2918634A1 (de) * | 1979-05-09 | 1980-11-20 | Basf Ag | Verfahren zur herstellung von kobalt- und chrom-1 zu 2-komplexfarbstoffen |
| DE3160489D1 (en) * | 1980-07-16 | 1983-07-28 | Ciba Geigy Ag | 1:2-chromium and cobalt complex dyestuffs |
Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2813853A (en) * | 1954-06-29 | 1957-11-19 | Saul & Co | Monoazo dyestuffs and metal complex compounds thereof |
| US2891938A (en) * | 1957-03-29 | 1959-06-23 | Geigy Ag J R | Chromium-containing monoazo dyestuffs |
| US2933489A (en) * | 1960-04-19 | Heavy metal-containing dyestuffs | ||
| US2991280A (en) * | 1955-07-15 | 1961-07-04 | Geigy Ag J R | Metallisable monoazo dyestuffs and the complex heavy metal compounds thereof |
| GB882531A (en) * | 1958-05-16 | 1961-11-15 | Bayer Ag | Chromium-containing monoazo dyestuffs |
| US3086004A (en) * | 1959-12-18 | 1963-04-16 | Hoechst Ag | Complex metal compounds of waterinsoluble azo-dyestuffs |
| US3126368A (en) * | 1958-10-21 | 1964-03-24 | Azodyestuffs containing a | |
| US3131989A (en) * | 1964-05-05 | Hoas oh | ||
| US3157458A (en) * | 1961-05-10 | 1964-11-17 | Ici Ltd | Process for dyeing woolen textiles with metal complex azo dyestuffs |
-
0
- BE BE633094D patent/BE633094A/xx unknown
- NL NL293371D patent/NL293371A/xx unknown
-
1963
- 1963-02-04 GB GB4471/63A patent/GB965379A/en not_active Expired
- 1963-02-05 DE DE19631444563 patent/DE1444563A1/de active Pending
- 1963-02-05 US US256235A patent/US3244691A/en not_active Expired - Lifetime
- 1963-02-07 DK DK57963AA patent/DK102812C/da active
- 1963-02-07 ES ES284907A patent/ES284907A1/es not_active Expired
- 1963-02-08 CH CH155763A patent/CH453536A/de unknown
Patent Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2933489A (en) * | 1960-04-19 | Heavy metal-containing dyestuffs | ||
| US3131989A (en) * | 1964-05-05 | Hoas oh | ||
| US2813853A (en) * | 1954-06-29 | 1957-11-19 | Saul & Co | Monoazo dyestuffs and metal complex compounds thereof |
| US2991280A (en) * | 1955-07-15 | 1961-07-04 | Geigy Ag J R | Metallisable monoazo dyestuffs and the complex heavy metal compounds thereof |
| US2891938A (en) * | 1957-03-29 | 1959-06-23 | Geigy Ag J R | Chromium-containing monoazo dyestuffs |
| GB882531A (en) * | 1958-05-16 | 1961-11-15 | Bayer Ag | Chromium-containing monoazo dyestuffs |
| US3126368A (en) * | 1958-10-21 | 1964-03-24 | Azodyestuffs containing a | |
| US3086004A (en) * | 1959-12-18 | 1963-04-16 | Hoechst Ag | Complex metal compounds of waterinsoluble azo-dyestuffs |
| US3157458A (en) * | 1961-05-10 | 1964-11-17 | Ici Ltd | Process for dyeing woolen textiles with metal complex azo dyestuffs |
Also Published As
| Publication number | Publication date |
|---|---|
| ES284907A1 (es) | 1963-11-16 |
| DE1444563A1 (de) | 1969-10-02 |
| CH453536A (de) | 1968-06-14 |
| GB965379A (en) | 1964-07-29 |
| DK102812C (da) | 1965-10-11 |
| BE633094A (en:Method) | |
| NL293371A (en:Method) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3416875A (en) | Process for dyeing cellulose textile materials with quaternized reactive dyestuffs | |
| US3244691A (en) | Metal complex monoazo dyestuffs | |
| US2776956A (en) | Soinhi | |
| EP0157733B1 (de) | Verfahren zur Herstellung von 1:2-Chromkomplexazofarbstoffen | |
| US3163635A (en) | Water-soluble azo dyestuffs | |
| US3288777A (en) | Metallized monoazodyestuffs containing a dihalopyrimidyl group | |
| US3067191A (en) | chschohchaoh | |
| US3484432A (en) | Water-soluble,reactive 1:2-cobalt azo dyestuffs containing halogeno or sulpho-s-triazine groups | |
| US3594363A (en) | Diazo dyes for nylon | |
| US3511827A (en) | Metallized monoazo dye for nylon | |
| US2714588A (en) | Copper-containing disazo dyestuffs | |
| EP0156768A2 (de) | Verfahren zur Herstellung von 1:2-Chromkomplexfarbstoffen | |
| US2832762A (en) | Monoazo dyestuffs and complex metal compounds thereof | |
| US3098063A (en) | Water-soluble monoazo dyestuffs | |
| DE1644096B2 (de) | Monoazofarbstoffe | |
| CH495564A (de) | Filmprojektor mit einem Filmschaltwerk | |
| DE2501449A1 (de) | Neue chromkomplexfarbstoffe, deren herstellung und verwendung | |
| US2714102A (en) | O-hydroxy-o'-carboxy azo dyestuffs | |
| US2753335A (en) | Copper-containing disazo dyestuffs | |
| US2855394A (en) | Metallisable monoazo dyestuffs and complex heavy metal compounds thereof | |
| US2779757A (en) | Metal-containing azo dyestuffs | |
| US2525610A (en) | Metallized dyes from trimethylacetoacetonitrile | |
| US2047647A (en) | Cupriferous azo dyestuffs and their production | |
| US1829646A (en) | Metalliferous azo-dyestuffs and process of making same | |
| US1871477A (en) | Azo-dyestuffs containing metal and process of making same |