US2826540A - Method and apparatus for electrolytic cutting, shaping, and grinding - Google Patents
Method and apparatus for electrolytic cutting, shaping, and grinding Download PDFInfo
- Publication number
- US2826540A US2826540A US310244A US31024452A US2826540A US 2826540 A US2826540 A US 2826540A US 310244 A US310244 A US 310244A US 31024452 A US31024452 A US 31024452A US 2826540 A US2826540 A US 2826540A
- Authority
- US
- United States
- Prior art keywords
- electrode
- workpiece
- working face
- abrasive
- electrolytic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000007493 shaping process Methods 0.000 title claims description 22
- 238000000227 grinding Methods 0.000 title description 49
- 238000000034 method Methods 0.000 title description 20
- 238000005520 cutting process Methods 0.000 title description 9
- 239000000463 material Substances 0.000 claims description 37
- 239000002245 particle Substances 0.000 claims description 29
- 239000004020 conductor Substances 0.000 claims description 7
- 238000005299 abrasion Methods 0.000 claims description 3
- 239000003082 abrasive agent Substances 0.000 claims 1
- 239000003792 electrolyte Substances 0.000 description 34
- 125000006850 spacer group Chemical group 0.000 description 24
- 239000010432 diamond Substances 0.000 description 14
- 229910003460 diamond Inorganic materials 0.000 description 13
- 230000008569 process Effects 0.000 description 9
- 230000009471 action Effects 0.000 description 7
- 238000004804 winding Methods 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 5
- UONOETXJSWQNOL-UHFFFAOYSA-N tungsten carbide Chemical compound [W+]#[C-] UONOETXJSWQNOL-UHFFFAOYSA-N 0.000 description 5
- 230000008859 change Effects 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000009713 electroplating Methods 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000001247 metal acetylides Chemical class 0.000 description 2
- 230000010355 oscillation Effects 0.000 description 2
- 230000003534 oscillatory effect Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- -1 tungsten carbide Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 241000208140 Acer Species 0.000 description 1
- 101710083262 Ectin Proteins 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical class OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 230000003416 augmentation Effects 0.000 description 1
- 230000003190 augmentative effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 238000005219 brazing Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 239000008151 electrolyte solution Substances 0.000 description 1
- 229940021013 electrolyte solution Drugs 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- HELHAJAZNSDZJO-OLXYHTOASA-L sodium L-tartrate Chemical compound [Na+].[Na+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O HELHAJAZNSDZJO-OLXYHTOASA-L 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000011083 sodium citrates Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000001433 sodium tartrate Substances 0.000 description 1
- 229960002167 sodium tartrate Drugs 0.000 description 1
- 235000011004 sodium tartrates Nutrition 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
Images
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B23—MACHINE TOOLS; METAL-WORKING NOT OTHERWISE PROVIDED FOR
- B23H—WORKING OF METAL BY THE ACTION OF A HIGH CONCENTRATION OF ELECTRIC CURRENT ON A WORKPIECE USING AN ELECTRODE WHICH TAKES THE PLACE OF A TOOL; SUCH WORKING COMBINED WITH OTHER FORMS OF WORKING OF METAL
- B23H5/00—Combined machining
- B23H5/06—Electrochemical machining combined with mechanical working, e.g. grinding or honing
- B23H5/08—Electrolytic grinding
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Electrical Discharge Machining, Electrochemical Machining, And Combined Machining (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US310244A US2826540A (en) | 1952-09-18 | 1952-09-18 | Method and apparatus for electrolytic cutting, shaping, and grinding |
| GB8139/53A GB753467A (en) | 1952-09-18 | 1953-03-24 | Method and apparatus for electrolytic cutting and shaping |
| DEB25240A DE1009739B (de) | 1952-09-18 | 1953-04-20 | Automatische Abstand-Regelvorrichtung fuer die elektroerosive Bearbeitung von Metallen in einem Elektrolyten |
| FR1080746D FR1080746A (fr) | 1952-09-18 | 1953-04-29 | Perfectionnements apportés aux procédés et dispositifs pour couper, tailler ou meuler des matières très dures par voie électrolytique |
| CH318532D CH318532A (de) | 1952-09-18 | 1953-05-05 | Verfahren und Vorrichtung zur Bearbeitung von elektrisch leitenden Werkstücken durch Elektroerosion |
| BE519887D BE519887A (it) | 1952-09-18 | 1953-05-12 | |
| NL180171A NL87235C (it) | 1952-09-18 | 1953-07-27 | |
| US700493A US3004910A (en) | 1952-09-18 | 1957-12-03 | Apparatus for electrolytic cutting, shaping and grinding |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US310244A US2826540A (en) | 1952-09-18 | 1952-09-18 | Method and apparatus for electrolytic cutting, shaping, and grinding |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US2826540A true US2826540A (en) | 1958-03-11 |
Family
ID=23201608
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US310244A Expired - Lifetime US2826540A (en) | 1952-09-18 | 1952-09-18 | Method and apparatus for electrolytic cutting, shaping, and grinding |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2826540A (it) |
| BE (1) | BE519887A (it) |
| CH (1) | CH318532A (it) |
| DE (1) | DE1009739B (it) |
| FR (1) | FR1080746A (it) |
| GB (1) | GB753467A (it) |
| NL (1) | NL87235C (it) |
Cited By (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2939825A (en) * | 1956-04-09 | 1960-06-07 | Cleveland Twist Drill Co | Sharpening, shaping and finishing of electrically conductive materials |
| US2946731A (en) * | 1956-11-13 | 1960-07-26 | Standard Electrical Tool Compa | Method and apparatus for electrolytic shaping |
| US2997437A (en) * | 1958-09-09 | 1961-08-22 | Thompson Ramo Wooldridge Inc | Abrasive machine and method |
| US3004910A (en) * | 1952-09-18 | 1961-10-17 | George F Keeleric | Apparatus for electrolytic cutting, shaping and grinding |
| US3060114A (en) * | 1958-02-06 | 1962-10-23 | William J Barry | Apparatus for cutting and machining metals electrochemically |
| US3061529A (en) * | 1959-04-06 | 1962-10-30 | Norton Co | Electrolytic grinder and method of grinding |
| US3103482A (en) * | 1963-09-10 | figure | ||
| US3117919A (en) * | 1961-02-10 | 1964-01-14 | George F Keeleric | Electric supply system for electrolytic grinding |
| US3130138A (en) * | 1959-11-27 | 1964-04-21 | Battelle Development Corp | Electrolytic cutting |
| US3194751A (en) * | 1961-09-01 | 1965-07-13 | Ex Cell O Corp | Electrolytic grinder wheel |
| US3223603A (en) * | 1960-04-04 | 1965-12-14 | Inoue Kiyoshi | Machining by combined spark discharge and electrolytic action |
| US3228863A (en) * | 1960-10-27 | 1966-01-11 | Gen Motors Corp | Electrolytic process and apparatus for removing stock from a conductive workpiece |
| US3235475A (en) * | 1960-06-15 | 1966-02-15 | Anocut Eng Co | Electrolytic shaping apparatus and method |
| US3242062A (en) * | 1966-03-22 | Fluorine-cuntaining electrolyte for electrolytic cutting of metals | ||
| US3256172A (en) * | 1960-10-29 | 1966-06-14 | Hoechst Ag | Device for avoiding short circuit damage in electrolytic cells |
| US3267018A (en) * | 1962-10-29 | 1966-08-16 | Micromatic Hone Corp | Electrolytic honing device |
| US3276987A (en) * | 1958-11-10 | 1966-10-04 | Anocut Eng Co | Electrolytic shaping apparatus |
| US3280016A (en) * | 1961-12-29 | 1966-10-18 | Birmingham Small Arms Co Ltd | Electrochemical machining of metals |
| US3287246A (en) * | 1962-06-11 | 1966-11-22 | Anocut Eng Co | Electrolytic shaping and cavity sinking apparatus |
| US3357905A (en) * | 1960-03-28 | 1967-12-12 | Cleveland Twist Drill Co | Electrolyte composition and method of electrolytically removing stock from workpiece |
| US3372099A (en) * | 1963-05-01 | 1968-03-05 | John E. Clifford | Electrochemical machining using a multisegmented electrode with individual current control for each segment |
| US3533927A (en) * | 1967-11-24 | 1970-10-13 | Kms Ind Inc | Spark anticipator circuit for electrochemical devices |
| US3873512A (en) * | 1973-04-30 | 1975-03-25 | Martin Marietta Corp | Machining method |
| USRE28564E (en) * | 1965-12-06 | 1975-09-30 | Electrochemical machining apparatus and method | |
| US6007694A (en) * | 1998-04-07 | 1999-12-28 | Phillips Plastics Corporation | Electrochemical machining |
| US20180161957A1 (en) * | 2016-12-14 | 2018-06-14 | Metal Industries Research & Development Centre | Grind machining apparatus |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU33282A1 (it) * | 1954-01-12 | |||
| BE542737A (it) * | 1954-11-16 | |||
| DE1690752B1 (de) * | 1957-05-15 | 1969-09-04 | Hans J Schulz Ges Fuer Elek Sc | Einrichtung zum Verhindern schaedlicher Auswirkungen von Kurzschluessen bei automatisch im Vorschub geregelten Funkenerosionsmaschinen |
| NL254242A (it) * | 1959-07-27 | |||
| NL255267A (it) | 1959-09-12 | |||
| US3276988A (en) * | 1959-10-06 | 1966-10-04 | Anocut Eng Co | Electrolytic removal of work material |
| NL124255C (it) * | 1959-12-09 | |||
| DE1138875B (de) * | 1960-09-07 | 1962-10-31 | Aeg | Schaltungsanordnung fuer einen Generator zum elektrolytischen Bearbeiten metallisch leitender Werkstoffe |
Citations (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB190403087A (en) * | 1904-02-08 | 1904-12-08 | Henry Maurice Wilton P Johnson | Improvements relating to Apparatus for Amalgamating and Coating Metals or Alloys of Metals with Metals or Alloys of Metals by the Aid of Electricity |
| US1017671A (en) * | 1911-07-27 | 1912-02-20 | Charles Francis Jenkins | Tapering metal bodies. |
| US1098338A (en) * | 1913-05-20 | 1914-05-26 | Charles Herbert Thompson | Cleaning metal surfaces. |
| US1273432A (en) * | 1917-04-04 | 1918-07-23 | Jackson S Weeks | Composition for electrolytes for electrical etching. |
| US1362159A (en) * | 1917-04-04 | 1920-12-14 | Jackson S Weeks | Composition for electrolytes for electrical etching |
| US1376366A (en) * | 1917-12-24 | 1921-04-26 | Gotthold E Wertheimer | Solution or bath for use in electrically preparing stencil-plates, die-plates, and the like |
| US1598731A (en) * | 1925-05-01 | 1926-09-07 | Studebaker Corp | Cleaning of metal by electrolysis |
| US1864490A (en) * | 1926-08-23 | 1932-06-21 | Florence M Harrison | Electrolytic apparatus |
| US1913962A (en) * | 1930-05-27 | 1933-06-13 | Arthur E Sharples | Means for making ferric hydroxide and resulting products |
| US1994762A (en) * | 1929-06-03 | 1935-03-19 | Robert V Funk | Electrolyte for use in testing wells |
| US2320495A (en) * | 1939-10-27 | 1943-06-01 | Aerovox Corp | Forming circuit |
| US2385198A (en) * | 1942-02-06 | 1945-09-18 | Carboloy Company Inc | Method for forming drawing holes in carbide die nibs |
| US2387313A (en) * | 1944-02-07 | 1945-10-23 | Sperry Gyroscope Co Inc | Switch electrolyte |
| US2526423A (en) * | 1947-04-10 | 1950-10-17 | Rudorff Dagobert William | Apparatus and method for cutting materials |
| US2539455A (en) * | 1944-01-27 | 1951-01-30 | Mazia Joseph | Electrolytic polishing of metals |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB637793A (en) * | 1946-09-24 | 1950-05-24 | Boris Romanovitch Lazarenko | A method of working metals and other electro-conductive materials and means for applying same |
-
1952
- 1952-09-18 US US310244A patent/US2826540A/en not_active Expired - Lifetime
-
1953
- 1953-03-24 GB GB8139/53A patent/GB753467A/en not_active Expired
- 1953-04-20 DE DEB25240A patent/DE1009739B/de active Pending
- 1953-04-29 FR FR1080746D patent/FR1080746A/fr not_active Expired
- 1953-05-05 CH CH318532D patent/CH318532A/de unknown
- 1953-05-12 BE BE519887D patent/BE519887A/xx unknown
- 1953-07-27 NL NL180171A patent/NL87235C/xx active
Patent Citations (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB190403087A (en) * | 1904-02-08 | 1904-12-08 | Henry Maurice Wilton P Johnson | Improvements relating to Apparatus for Amalgamating and Coating Metals or Alloys of Metals with Metals or Alloys of Metals by the Aid of Electricity |
| US1017671A (en) * | 1911-07-27 | 1912-02-20 | Charles Francis Jenkins | Tapering metal bodies. |
| US1098338A (en) * | 1913-05-20 | 1914-05-26 | Charles Herbert Thompson | Cleaning metal surfaces. |
| US1273432A (en) * | 1917-04-04 | 1918-07-23 | Jackson S Weeks | Composition for electrolytes for electrical etching. |
| US1362159A (en) * | 1917-04-04 | 1920-12-14 | Jackson S Weeks | Composition for electrolytes for electrical etching |
| US1376366A (en) * | 1917-12-24 | 1921-04-26 | Gotthold E Wertheimer | Solution or bath for use in electrically preparing stencil-plates, die-plates, and the like |
| US1598731A (en) * | 1925-05-01 | 1926-09-07 | Studebaker Corp | Cleaning of metal by electrolysis |
| US1864490A (en) * | 1926-08-23 | 1932-06-21 | Florence M Harrison | Electrolytic apparatus |
| US1994762A (en) * | 1929-06-03 | 1935-03-19 | Robert V Funk | Electrolyte for use in testing wells |
| US1913962A (en) * | 1930-05-27 | 1933-06-13 | Arthur E Sharples | Means for making ferric hydroxide and resulting products |
| US2320495A (en) * | 1939-10-27 | 1943-06-01 | Aerovox Corp | Forming circuit |
| US2385198A (en) * | 1942-02-06 | 1945-09-18 | Carboloy Company Inc | Method for forming drawing holes in carbide die nibs |
| US2539455A (en) * | 1944-01-27 | 1951-01-30 | Mazia Joseph | Electrolytic polishing of metals |
| US2387313A (en) * | 1944-02-07 | 1945-10-23 | Sperry Gyroscope Co Inc | Switch electrolyte |
| US2526423A (en) * | 1947-04-10 | 1950-10-17 | Rudorff Dagobert William | Apparatus and method for cutting materials |
Cited By (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3103482A (en) * | 1963-09-10 | figure | ||
| US3242062A (en) * | 1966-03-22 | Fluorine-cuntaining electrolyte for electrolytic cutting of metals | ||
| US3004910A (en) * | 1952-09-18 | 1961-10-17 | George F Keeleric | Apparatus for electrolytic cutting, shaping and grinding |
| US2939825A (en) * | 1956-04-09 | 1960-06-07 | Cleveland Twist Drill Co | Sharpening, shaping and finishing of electrically conductive materials |
| US2946731A (en) * | 1956-11-13 | 1960-07-26 | Standard Electrical Tool Compa | Method and apparatus for electrolytic shaping |
| US3060114A (en) * | 1958-02-06 | 1962-10-23 | William J Barry | Apparatus for cutting and machining metals electrochemically |
| US2997437A (en) * | 1958-09-09 | 1961-08-22 | Thompson Ramo Wooldridge Inc | Abrasive machine and method |
| US3276987A (en) * | 1958-11-10 | 1966-10-04 | Anocut Eng Co | Electrolytic shaping apparatus |
| US3061529A (en) * | 1959-04-06 | 1962-10-30 | Norton Co | Electrolytic grinder and method of grinding |
| US3130138A (en) * | 1959-11-27 | 1964-04-21 | Battelle Development Corp | Electrolytic cutting |
| US3357905A (en) * | 1960-03-28 | 1967-12-12 | Cleveland Twist Drill Co | Electrolyte composition and method of electrolytically removing stock from workpiece |
| US3223603A (en) * | 1960-04-04 | 1965-12-14 | Inoue Kiyoshi | Machining by combined spark discharge and electrolytic action |
| US3235475A (en) * | 1960-06-15 | 1966-02-15 | Anocut Eng Co | Electrolytic shaping apparatus and method |
| US3228863A (en) * | 1960-10-27 | 1966-01-11 | Gen Motors Corp | Electrolytic process and apparatus for removing stock from a conductive workpiece |
| US3256172A (en) * | 1960-10-29 | 1966-06-14 | Hoechst Ag | Device for avoiding short circuit damage in electrolytic cells |
| US3117919A (en) * | 1961-02-10 | 1964-01-14 | George F Keeleric | Electric supply system for electrolytic grinding |
| US3194751A (en) * | 1961-09-01 | 1965-07-13 | Ex Cell O Corp | Electrolytic grinder wheel |
| US3280016A (en) * | 1961-12-29 | 1966-10-18 | Birmingham Small Arms Co Ltd | Electrochemical machining of metals |
| US3287246A (en) * | 1962-06-11 | 1966-11-22 | Anocut Eng Co | Electrolytic shaping and cavity sinking apparatus |
| US3267018A (en) * | 1962-10-29 | 1966-08-16 | Micromatic Hone Corp | Electrolytic honing device |
| US3372099A (en) * | 1963-05-01 | 1968-03-05 | John E. Clifford | Electrochemical machining using a multisegmented electrode with individual current control for each segment |
| USRE28564E (en) * | 1965-12-06 | 1975-09-30 | Electrochemical machining apparatus and method | |
| US3533927A (en) * | 1967-11-24 | 1970-10-13 | Kms Ind Inc | Spark anticipator circuit for electrochemical devices |
| US3873512A (en) * | 1973-04-30 | 1975-03-25 | Martin Marietta Corp | Machining method |
| US6007694A (en) * | 1998-04-07 | 1999-12-28 | Phillips Plastics Corporation | Electrochemical machining |
| US20180161957A1 (en) * | 2016-12-14 | 2018-06-14 | Metal Industries Research & Development Centre | Grind machining apparatus |
| US10625397B2 (en) * | 2016-12-14 | 2020-04-21 | Metal Industries Research & Development Centre | Grind machining apparatus |
Also Published As
| Publication number | Publication date |
|---|---|
| GB753467A (en) | 1956-07-25 |
| BE519887A (it) | 1955-05-13 |
| CH318532A (de) | 1957-01-15 |
| FR1080746A (fr) | 1954-12-13 |
| DE1009739B (de) | 1957-06-06 |
| NL87235C (it) | 1958-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2826540A (en) | Method and apparatus for electrolytic cutting, shaping, and grinding | |
| US4956056A (en) | Method of abrasive electroerosion grinding | |
| US2764543A (en) | Electrolytic grinding apparatus | |
| CA2088686C (en) | Orbital electrochemical machining | |
| US2905605A (en) | Dressing of abrasive tools | |
| US4236985A (en) | Method for machining works of current-conducting material with current-conducting abrasive tools | |
| JP5363091B2 (ja) | 砥石車を適当な状態にする装置を備えた研磨機及びその方法 | |
| EP0295264B1 (en) | Electrical discharge machining by redressing electrodes | |
| US6162348A (en) | Electrodeless electrolytic dressing grinding method and apparatus | |
| US2798846A (en) | Method and apparatus for the electrolytic erosion of work pieces | |
| US3061708A (en) | Electric machining processes | |
| US2920026A (en) | Grinding machine | |
| US2805197A (en) | Methods of electrolytic grinding and eroding | |
| US3420759A (en) | Electromachining using an electrolyte having substantially the same resistivity as the electrode | |
| US3004910A (en) | Apparatus for electrolytic cutting, shaping and grinding | |
| US2793992A (en) | Electrical cutting and grinding | |
| US3238114A (en) | Cathode for electrolytic erosion of metal | |
| US2772232A (en) | Electrolytic grinding apparatus | |
| US3823515A (en) | Method and means of grinding with electrophoretic assistance | |
| US2746917A (en) | Electrolytic grinding apparatus | |
| US2871177A (en) | Electrolytic grinding apparatus | |
| US3475312A (en) | Electrolytic lathe and grinding apparatus employing a homogeneous carbon electrode-tool | |
| US3043766A (en) | Electrolytic grinding apparatus | |
| US3285843A (en) | Apparatus for electrolytic machining | |
| US5128010A (en) | Apparatus for electrical machining |