US2245528A - Catalytic oxidation of alkyl substituted aromatic compounds - Google Patents
Catalytic oxidation of alkyl substituted aromatic compounds Download PDFInfo
- Publication number
- US2245528A US2245528A US235578A US23557838A US2245528A US 2245528 A US2245528 A US 2245528A US 235578 A US235578 A US 235578A US 23557838 A US23557838 A US 23557838A US 2245528 A US2245528 A US 2245528A
- Authority
- US
- United States
- Prior art keywords
- oxidation
- grams
- compounds
- benzoic acid
- atmospheres
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 230000003647 oxidation Effects 0.000 title description 76
- 238000007254 oxidation reaction Methods 0.000 title description 76
- 150000001491 aromatic compounds Chemical class 0.000 title description 23
- 125000000217 alkyl group Chemical group 0.000 title description 5
- 230000003197 catalytic effect Effects 0.000 title description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 61
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 60
- 235000010233 benzoic acid Nutrition 0.000 description 27
- 150000002978 peroxides Chemical class 0.000 description 27
- 239000005711 Benzoic acid Substances 0.000 description 26
- 238000000034 method Methods 0.000 description 24
- 239000007789 gas Substances 0.000 description 22
- 239000003999 initiator Substances 0.000 description 22
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 21
- 229910052760 oxygen Inorganic materials 0.000 description 21
- 239000001301 oxygen Substances 0.000 description 21
- 239000002904 solvent Substances 0.000 description 21
- 239000003054 catalyst Substances 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 150000001875 compounds Chemical class 0.000 description 18
- 239000000203 mixture Substances 0.000 description 14
- 239000007791 liquid phase Substances 0.000 description 13
- 239000002253 acid Substances 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 229930195733 hydrocarbon Natural products 0.000 description 9
- 150000002430 hydrocarbons Chemical class 0.000 description 9
- 235000011054 acetic acid Nutrition 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 7
- 159000000032 aromatic acids Chemical class 0.000 description 6
- 229940011182 cobalt acetate Drugs 0.000 description 6
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- 239000004215 Carbon black (E152) Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 230000001590 oxidative effect Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 4
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 4
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 4
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- -1 nitric Chemical class 0.000 description 4
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 150000003022 phthalic acids Chemical class 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229910052684 Cerium Inorganic materials 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000004996 alkyl benzenes Chemical class 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 229940071125 manganese acetate Drugs 0.000 description 2
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 150000003738 xylenes Chemical class 0.000 description 2
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical group CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- AOPDRZXCEAKHHW-UHFFFAOYSA-N 1-pentoxypentane Chemical class CCCCCOCCCCC AOPDRZXCEAKHHW-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- ITHZDDVSAWDQPZ-UHFFFAOYSA-L barium acetate Chemical compound [Ba+2].CC([O-])=O.CC([O-])=O ITHZDDVSAWDQPZ-UHFFFAOYSA-L 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 150000004648 butanoic acid derivatives Chemical class 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical class [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 235000011167 hydrochloric acid Nutrition 0.000 description 1
- 150000001261 hydroxy acids Chemical class 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- CPRRHERYRRXBRZ-SRVKXCTJSA-N methyl n-[(2s)-1-[[(2s)-1-hydroxy-3-[(3s)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate Chemical compound COC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CO)C[C@@H]1CCNC1=O CPRRHERYRRXBRZ-SRVKXCTJSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- XCRBXWCUXJNEFX-UHFFFAOYSA-N peroxybenzoic acid Chemical class OOC(=O)C1=CC=CC=C1 XCRBXWCUXJNEFX-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical class [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000003385 ring cleavage reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- DNYWZCXLKNTFFI-UHFFFAOYSA-N uranium Chemical compound [U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U] DNYWZCXLKNTFFI-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/14—Monocyclic dicarboxylic acids
- C07C63/15—Monocyclic dicarboxylic acids all carboxyl groups bound to carbon atoms of the six-membered aromatic ring
- C07C63/26—1,4 - Benzenedicarboxylic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07B—GENERAL METHODS OF ORGANIC CHEMISTRY; APPARATUS THEREFOR
- C07B35/00—Reactions without formation or introduction of functional groups containing hetero atoms, involving a change in the type of bonding between two carbon atoms already directly linked
- C07B35/04—Dehydrogenation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/04—Monocyclic monocarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/04—Monocyclic monocarboxylic acids
- C07C63/06—Benzoic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/14—Monocyclic dicarboxylic acids
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01F—CHEMICAL FEATURES IN THE MANUFACTURE OF ARTIFICIAL FILAMENTS, THREADS, FIBRES, BRISTLES OR RIBBONS; APPARATUS SPECIALLY ADAPTED FOR THE MANUFACTURE OF CARBON FILAMENTS
- D01F6/00—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof
- D01F6/78—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof from copolycondensation products
- D01F6/80—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof from copolycondensation products from copolyamides
Definitions
- This invention relates to oxidation of alkylsubstituted aromatic compounds and, more particularly to the production of aromatic acids by oxidation of alkyl-substituted aromatic hydrocarbons.
- oxidation without ring cleavage of alkyl-substituted aromatic compounds with production in good yield of the corresponding acids can be accomplished by subjecting the said compounds to oxidation in the liquid phase by means of an oxygen-containing gas, for example oxygen or air or air enriched with oxygen.
- an oxygen-containing gas for example oxygen or air or air enriched with oxygen.
- alkyl-substituted aromatic compounds which contain substituents, in addition to alkyl groups may also be oxidized ac cording to this invention, such for example as alkyl-substituted aromatic compounds containing N02, halogen, and carboxyl groups. While my process may be carried out at various temperatures ranging upward from about 100 C. to about 320 0., generally speaking the use of temperatures in the more restricted range of 130-250 0., tends, other conditions remaining the same, to give less of partial oxidation products, less loss of carbon to oxides of carbon, and a higher proportion of acids.
- the yields of acid produced according to my invention may be considerably increased by carrying on the oxidation in the presence of an oxidation catalyst, such, specifically as the solid polyvalent metals having an atomic weight between about and about 200.
- I may use such metals in the finely divided metallic state or asorganic and inorganic salts or oxides including such specific metals as cerium, cobalt, copper, manganese, and uranium, with or without inorganic acids such as nitric, phosphoric and hydrochloric acids or mixtures of any two or more of these substances,
- specific catalysts under the above description there may be employed vanadium, cerium and cobalt chlorides, manganese acetate alone or together with barium acetate, barium or cobalt permanganate, sodium cobalti nitrite or mixtures of two or more of such compounds.
- promoters such as the alkali and alkaline earth metals may also be employed, if desired, such, for example as the barium, magnesium and potassium acetates, butyrates, propionates, and the like.
- the yields and efilciency of the process may be even further improved by carrying on the oxidation, whether with or without the solvents referred to, in the presence of one or more initiators, which term I employ herein to designate substances capable of initiating attack on the hydrocarbon molecule which may itself not readily react with molecular oxygen under my preferred low temperature conditions.
- ⁇ орcerol ⁇ peroxides such as benzoyl peroxide; inorganic peroxides: peracids, such as peracetic and perbenzoic acids; the aldehydes, such as acetaldehyde, propionaldehyde, and isobutyraldehyde; ketones, such as acetone, methyl ethyl ketone, diethyl ketone, and cyclohexanone; ethers, such as diisopropyl, diethyl and diamyl ethers; olefines such as cyclohexene and octylene, and, in fact, any organic compound which tends to form peroxide bodies under the reaction conditions.
- peracids such as peracetic and perbenzoic acids
- the aldehydes such as acetaldehyde, propionaldehyde, and isobutyraldehyde
- ketones such as acetone, methyl eth
- the initiator may be added to the reactants at the start or continuously during the oxidation or both; or, if preferred the oxidation may be begun at a temperature and pressure at which partial oxidation products, capable of being oxidized to or acting as oxygen carriers are formed, and the partially oxidized hydrocarbons thus produced may thereafter act as oxygen carriers capable of attacking other hydrocarbon molecules at the relatively low temperatures which I have generally outlined and will hereinafter more specifically describe.
- the constant maintenance of a concentration of initiator is important, however, and therefore, in general, I deliberately add the initiator to the reactants as described hereinafter.
- the oxygen carrier is thus able to initiate the oxidation which then may become at least partially self-sustaining at temperatures very much lower than otherwise possible.
- the proportions of initiators which are desirable according to this invention range from about 0.1 to per cent, based upon the weight of the hydrocarbon being treated. I do not wish to be restricted to these proportions, however, for I have found that as much as 50 per cent initiator may be utilized without deleterious effect upon progress of the oxidation and at the same time as low as 0.05 per cent initiator may be employed with an increased eillciency and yield of aromatic acid. Although primarily applicable to ketones such as acetone, dimethyl or methyl ethyl ketones, or cyclohexanone, or mixtures thereof, these ranges describe satisfactorily the amounts of other initiators which are suitable according to my invention.
- While the process is operable at ordinary pressures I prefer to use elevated pressures rangingupwards from about 2 atmospheres to about 100 atmospheres. Although pressures in the neighborhood of from 10 to 50 atmospheres are: preferred, higher pressures, for example as high as 1000 atmospheres, may be used.
- the minimum pressure is that required to permit effecting the reaction in the liquid phase, by which is meant that the hydrocarbon is preferably oxidized in the liquid or dissolved state. Pressures in excess of this minimum may be used, however, since pressure has been found to favor the reaction rate.
- Example 1 A mixture containing 276 grams toluene, 276 grams acetic acid, 0.23 grams cobalt acetate, 0.23 grams manganesipcetate and 4.3 grams methylethyl tantalum lined converter of 1200 cc. capacity, provided with suitably valved gas outlet and inlet lines at top and bottom, respectively.
- Example 2 A mixture containing 425.0 grams ethyl benzene, 63.1 grams acetic acid, and 0.05 grams cobalt acetate was charged into a tantalum-lined converter of v1200 cc. capacity, provided with suitably valved outlet and inlet lines at top and bottom, respectively. The mixture was heated to 168-178" C. for 1% hours under a pressure of 50 atmospheres. Air was bubbled through the mixture for 1% hours at the rate of 225 liters per hour, the pressure being maintained at 50 atmospheres and the temperature at 'l68-178 C. The exit gas was directed through a condenser, and traps cooled by dry ice.
- Solid benzoic acid was removed from the oxidation product and recovered by cooling the final products to' crystallize the benzoic acid.
- the total weight of benzoic acid recovered was 24.1 grams.
- there was separated from the final product 2.8 grams phenyl ethyl ester, 1.1 grams phenyl ethanol, and 53.6 grams 122.2 grams of unreacted ethyl benzene was recovered.
- the conversion and yield to benzoic acid were, respectively, 18.2% and 25.6%.
- the conversion and yield to acetophenone were, respectively, 41.4% and 58%.
- Example 3 Into a tantalum-lined converter, such as described in Examples 1 and 2, was charged 236.0 grams of mixed xylenes, 130.6 grams acetic acid, 3.7 grams diethyl ketone, 0.185 grams cobalt acetate and 0.185 grams manganese acetate. This mixture was heated to 187-202 C. under a pressure of 50 atmospheres and air was bubbled through the mixture at this temperature and pressure for 2 hours at the rate of 250 liters per hour.
- reaction products were separated to give 75.7 grams of unreacted xylenes, and 50.3% yield of toluic acids, 2.0% yield of phthalic acids, 1.5% yield of toluyl alcohols, 8.1% yield of toluyl esters and 5.7% yield of toluic aldehydes.
- Example 4 Into a converter such as described in Examples 1 and 2 there was charged a mixture containing 400 grams isopropyl benzene, 4 grams water and 0.4 gram cobalt acetate. This mixture was heated at a temperature of 170-229" C. under a pressure of 30 atmospheres and air was bubbled through this-mixture for 2 hours at the rate of 250 liters per hour. At the expiration of this time the reaction products were separated by distillation to give 45 grams benzoic acid, and 230 grams cumene. The remaining material was of a tarry nature. The yield of benzoic acid was about 35%.
- a method of oxidizing aromatic compounds containing alkvl substituents which comprises subjecting such compounds to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst and a solvent for the aromatic compound which is substantially inert to the oxidation.
- a method of oxidizing aromatic compounds containing alkyl substituents which comprises subjecting such compounds to oxidation by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions and a solvent for the aromatic compound which is substantially inert to the oxidation at a temperature in the range of 100-320 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
- a method of oxidizing aromatic compounds containing alkyl substituents which comprises subjecting such compounds to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator. selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions and a solvent for the aromatic compound which is substantially inert to the oxidation at r a temperature in the range of lO-320 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
- a method of oxidizing aromatic compounds containing alkyl substituents which comprises subjecting such compounds to oxidation in the liquid phase by means of a gas containing gase ous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions and a solvent for the aromatic compound which is substantially inert to the oxidation at a temperature in the range of 130-250 C. and at a pressure in the range of 2 to 100 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
- a method of producing aromatic acids which comprises subjecting an alkyl substituted aromatic compound to oxidation by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions and a solvent for the aromatic compound which is substantially inert to the oxidation at a temperature in the range of -320 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
- a method of producing aromatic acids which comprises subjecting an alkyl substituted aromatic compound to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions and a solvent for the aromatic compound which is substantially inert to the oxidation at a temperature in the range of 100-320 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
- a method of producing aromatic acids which comprises subjecting an alkyl substituted aromatic compound to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions and a solvent for the aromatic compound which is substantially inert to the oxidation at a temperature in the range of -250 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
- a method of producing benzoic acid which comprises subjecting toluene to oxidation by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst and a solvent for the toluene" which is substantially inert to the oxidation.
- a method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst and a solvent for the toluene which is substantially inert to the oxidation.
- a method of producing benzoic acid which comprises subjecting toluene to oxidation by means 01' a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions, and a solvent for the toluene which is substantially inert to the oxidation at a temperature in the range of l00-320 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the benzoic acid from the reaction mixture.
- a method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions, and a solvent for the toluene which is substantially inert to the oxidation at a temperature in the range of l00320 C. and at a pressure in the range of 2 to 1000 atmospheres,
- a method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which ,form peroxides under the reaction conditions, and a solvent for the toluene which is substantially inert to the oxidation at a temperature in the range of 130-250 C., and at a pressure in the range of 2 to 100 atmospheres, and separating the benzoic acid from the reaction mixture.
- a method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of a cobalt acetate catalyst, an acetic acid'solvent, and an oxidation initiator selected from the group consisting oi! peroxides and compounds which form peroxides under the reaction conditions, at a temperature in the range of 100-320 0., and at a pressure in the range of 2 to 100 atmospheres, and separating the benzoic acid from the reaction mixture.
- a method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of a cobalt acetate catalyst, an acetic acid solvent, and an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions, at a temperature in the range of 130-250 C.', and at a pressure in the range of 2 to 1000 atmospheres, and separating the benzoic acid from the reaction mixture.
- a method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions, and a lower aliphatic acid solvent for the toluene at a temperature in the range of 130- 250 C., and at a pressure in the range of 2 to 100 atmospheres, and separating the benzoic acid from the reaction mixture.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Description
Patented June 10, 1%41 CATALYTIC OXIDATION OF ALKYL SUBSTI- TUTED AROMATIC COMPOUNDS Donald J. Loder, Wilmington, Del., assignor to E. I. du Pont de Nemours & Company, WilminI- ton, DeL, a corporation of Delaware No Drawing. Application October 1a. 1938, Serial No. 235,578
Claims.
This invention relates to oxidation of alkylsubstituted aromatic compounds and, more particularly to the production of aromatic acids by oxidation of alkyl-substituted aromatic hydrocarbons.
It is an object of the present invention to provide a process for the controlled oxidation of alkyl-substituted aromatic compounds, particularly toluene, xylene and the substituted benzenes.
It is a further and more specific object of the present invention to provide a new and improved process for the production, from alkyl-substituted aromatic compounds, of aromatic acids without rupture of the aromatic ring, and more particularly to obtain benzoic acid from toluene, toluic and phthalic acids from xylene, and benzene mono or polycarboxylic acids and alkyl-substituted derivatives from the corresponding alkylsubstituted benzenes.
Other objects and advantages of the present invention will be apparent by reference to the following specification.
I have found that oxidation without ring cleavage of alkyl-substituted aromatic compounds with production in good yield of the corresponding acids can be accomplished by subjecting the said compounds to oxidation in the liquid phase by means of an oxygen-containing gas, for example oxygen or air or air enriched with oxygen.
In this manner it is possible to oxidize hydrocarbons, such as toluene, xylene and other alkylsubstituted benzenes with production of benzoic, toluic and phthalic acids or other benzene monoor polycarboxylic acids and alkyl-substltuted derivatives thereof. Similarly alkyl-substituted aromatic compounds which contain substituents, in addition to alkyl groups may also be oxidized ac cording to this invention, such for example as alkyl-substituted aromatic compounds containing N02, halogen, and carboxyl groups. While my process may be carried out at various temperatures ranging upward from about 100 C. to about 320 0., generally speaking the use of temperatures in the more restricted range of 130-250 0., tends, other conditions remaining the same, to give less of partial oxidation products, less loss of carbon to oxides of carbon, and a higher proportion of acids.
I have further discovered three factors which, all taken together, produce the optimum result but which, nevertheless, individually contribute to an improved result as will appear hereinafter. Each of these factors, or methods, facilitate oxidation at low temperatures, improved results are obtained when any two of them are employed and the best results are secured when all three methods are used simultaneously.
As one of the three factors previously mentioried, I have found that the yields of acid produced according to my invention may be considerably increased by carrying on the oxidation in the presence of an oxidation catalyst, such, specifically as the solid polyvalent metals having an atomic weight between about and about 200. For example, I may use such metals in the finely divided metallic state or asorganic and inorganic salts or oxides including such specific metals as cerium, cobalt, copper, manganese, and uranium, with or without inorganic acids such as nitric, phosphoric and hydrochloric acids or mixtures of any two or more of these substances, As specific catalysts under the above description there may be employed vanadium, cerium and cobalt chlorides, manganese acetate alone or together with barium acetate, barium or cobalt permanganate, sodium cobalti nitrite or mixtures of two or more of such compounds, In addition to the oxidation catalysts, promoters such as the alkali and alkaline earth metals may also be employed, if desired, such, for example as the barium, magnesium and potassium acetates, butyrates, propionates, and the like.
I have also found that enhanced yields of arcmatic acids are obtained if the oxidation is carried on in the presence of a solvent for the hydrocarbons. Various liquids substantially inert to the oxidation and capable of dissolving the hydrocarbons such as carbon tetrachloride and benzene can be used, but I prefer to use as solvent an organic acid, such as acetic, propionic, butyric, trimethyl acetic and isobutyric, such aromatic acids as phenyl acetic, and such hydroxy acids or derivatives as methoxy acetic, and the like. Varying proportions of these acids, based upon the weight per cent. present in the solution being oxidized, may be utilized, such as from 1 to 99 per cent. by weight "although I prefer to utilize about 10 to 50 per cent. Within these indicated ranges I have found that the solvents eifect a considerable increase in the yield, of aromatic acid obtained by oxidation of the hydrocarbon.
As a further feature of the invention I have found that, especially when operating at the lower temperatures, say 200 or below, the yields and efilciency of the process may be even further improved by carrying on the oxidation, whether with or without the solvents referred to, in the presence of one or more initiators, which term I employ herein to designate substances capable of initiating attack on the hydrocarbon molecule which may itself not readily react with molecular oxygen under my preferred low temperature conditions. Forexample, there may be employed or- 'ganic peroxides such as benzoyl peroxide; inorganic peroxides: peracids, such as peracetic and perbenzoic acids; the aldehydes, such as acetaldehyde, propionaldehyde, and isobutyraldehyde; ketones, such as acetone, methyl ethyl ketone, diethyl ketone, and cyclohexanone; ethers, such as diisopropyl, diethyl and diamyl ethers; olefines such as cyclohexene and octylene, and, in fact, any organic compound which tends to form peroxide bodies under the reaction conditions.
The initiator may be added to the reactants at the start or continuously during the oxidation or both; or, if preferred the oxidation may be begun at a temperature and pressure at which partial oxidation products, capable of being oxidized to or acting as oxygen carriers are formed, and the partially oxidized hydrocarbons thus produced may thereafter act as oxygen carriers capable of attacking other hydrocarbon molecules at the relatively low temperatures which I have generally outlined and will hereinafter more specifically describe. The constant maintenance of a concentration of initiator is important, however, and therefore, in general, I deliberately add the initiator to the reactants as described hereinafter. The oxygen carrier is thus able to initiate the oxidation which then may become at least partially self-sustaining at temperatures very much lower than otherwise possible.
The proportions of initiators which are desirable according to this invention range from about 0.1 to per cent, based upon the weight of the hydrocarbon being treated. I do not wish to be restricted to these proportions, however, for I have found that as much as 50 per cent initiator may be utilized without deleterious effect upon progress of the oxidation and at the same time as low as 0.05 per cent initiator may be employed with an increased eillciency and yield of aromatic acid. Although primarily applicable to ketones such as acetone, dimethyl or methyl ethyl ketones, or cyclohexanone, or mixtures thereof, these ranges describe satisfactorily the amounts of other initiators which are suitable according to my invention.
While the process is operable at ordinary pressures I prefer to use elevated pressures rangingupwards from about 2 atmospheres to about 100 atmospheres. Although pressures in the neighborhood of from 10 to 50 atmospheres are: preferred, higher pressures, for example as high as 1000 atmospheres, may be used. The minimum pressure is that required to permit effecting the reaction in the liquid phase, by which is meant that the hydrocarbon is preferably oxidized in the liquid or dissolved state. Pressures in excess of this minimum may be used, however, since pressure has been found to favor the reaction rate.
Having described separately some of the features of my invention, the following examples will illustrate how these features may be combined for oxidation of alkyl-substituted aromatic compounds generally.
Example 1.--A mixture containing 276 grams toluene, 276 grams acetic acid, 0.23 grams cobalt acetate, 0.23 grams manganesipcetate and 4.3 grams methylethyl tantalum lined converter of 1200 cc. capacity, provided with suitably valved gas outlet and inlet lines at top and bottom, respectively. The
ketone wascharged into av acetophenone.
mixture was heated to 190 C., under a pressure of 50 atmospheres and air was bubbled through the mixture for 3 hours at the rate of 200 liters per hour, the pressure being maintained at 50 atmospheres and the temperature at 185-200 C. The exit gas was directed through a condenser, and traps cooled by dry ice. Solid benzoic acid was removed from the oxidation products and recovered by cooling the final product to crystallize the benzoic acid. The total.
weight of benzoic acid recovered was 126.9 grams. An additional 45.8 grams of benzoic acid was recovered from the filtrate after stripping of! the acetic acid and unconverted toluene. 123.2 grams of unused toluene was recovered. The conversion and yield were 47.2% and 85.2% respectively. The residue obtained after recovery of benzoic and acetic acids consisted of henzaldehyde and tar.
Example 2.A mixture containing 425.0 grams ethyl benzene, 63.1 grams acetic acid, and 0.05 grams cobalt acetate was charged into a tantalum-lined converter of v1200 cc. capacity, provided with suitably valved outlet and inlet lines at top and bottom, respectively. The mixture was heated to 168-178" C. for 1% hours under a pressure of 50 atmospheres. Air was bubbled through the mixture for 1% hours at the rate of 225 liters per hour, the pressure being maintained at 50 atmospheres and the temperature at 'l68-178 C. The exit gas was directed through a condenser, and traps cooled by dry ice.
Solid benzoic acid was removed from the oxidation product and recovered by cooling the final products to' crystallize the benzoic acid. The total weight of benzoic acid recovered was 24.1 grams. In addition, there was separated from the final product 2.8 grams phenyl ethyl ester, 1.1 grams phenyl ethanol, and 53.6 grams 122.2 grams of unreacted ethyl benzene was recovered. The conversion and yield to benzoic acid were, respectively, 18.2% and 25.6%. The conversion and yield to acetophenone were, respectively, 41.4% and 58%.
Example 3.-Into a tantalum-lined converter, such as described in Examples 1 and 2, was charged 236.0 grams of mixed xylenes, 130.6 grams acetic acid, 3.7 grams diethyl ketone, 0.185 grams cobalt acetate and 0.185 grams manganese acetate. This mixture was heated to 187-202 C. under a pressure of 50 atmospheres and air was bubbled through the mixture at this temperature and pressure for 2 hours at the rate of 250 liters per hour.
By distillation under atmospheric and reduced pressures, the reaction products were separated to give 75.7 grams of unreacted xylenes, and 50.3% yield of toluic acids, 2.0% yield of phthalic acids, 1.5% yield of toluyl alcohols, 8.1% yield of toluyl esters and 5.7% yield of toluic aldehydes.
Example 4.--Into a converter such as described in Examples 1 and 2 there was charged a mixture containing 400 grams isopropyl benzene, 4 grams water and 0.4 gram cobalt acetate. This mixture was heated at a temperature of 170-229" C. under a pressure of 30 atmospheres and air was bubbled through this-mixture for 2 hours at the rate of 250 liters per hour. At the expiration of this time the reaction products were separated by distillation to give 45 grams benzoic acid, and 230 grams cumene. The remaining material was of a tarry nature. The yield of benzoic acid was about 35%.
Although specific disclosure has been made in the examples of methods for carrying on my invention in a batch process, it should be understood that this invention may also be practiced in a continuous manner. Thus, after completion of the benzoic acid or other acid production, such as shown in the specific examples, the materials capable of being converted to the desired acid, plus the catalyst, solvent, and initiator may be recovered and recycled to the reaction zone together with further quantities of aromatic hydrocarbon. In a continuous process it will also be found desirable to make such additions of catalyst, solvent, and initiator as will maintain the reaction rate and yield of acid at the desired high degree.
While the process as described in the examples involves passage of the oxidizing gas through a body of liquid, it will be understood that other means of assuring the desired liquid-gas contact may be employed, as, for example, passage or liquid and gas co-current or counter-current through a tube or tower, which may be supplied with plates, packing or other devices for enhancing contact.
I claim:
1. A method of oxidizing aromatic compounds containing alkvl substituents which comprises subjecting such compounds to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst and a solvent for the aromatic compound which is substantially inert to the oxidation.
2. A method of oxidizing aromatic compounds containing alkyl substituents which comprises subjecting such compounds to oxidation by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions and a solvent for the aromatic compound which is substantially inert to the oxidation at a temperature in the range of 100-320 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
3. A method of oxidizing aromatic compounds containing alkyl substituents which comprises subjecting such compounds to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator. selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions and a solvent for the aromatic compound which is substantially inert to the oxidation at r a temperature in the range of lO-320 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
4. A method of oxidizing aromatic compounds containing alkyl substituents which comprises subjecting such compounds to oxidation in the liquid phase by means of a gas containing gase ous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions and a solvent for the aromatic compound which is substantially inert to the oxidation at a temperature in the range of 130-250 C. and at a pressure in the range of 2 to 100 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
5. A method of producing aromatic acids which comprises subjecting an alkyl substituted aromatic compound to oxidation by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions anda solvent for the aromatic compound which is substantially inert to the oxidation at a temperature in the range of -320 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
6. A method of producing aromatic acids which comprises subjecting an alkyl substituted aromatic compound to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions and a solvent for the aromatic compound which is substantially inert to the oxidation at a temperature in the range of 100-320 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
7. A method of producing aromatic acids which comprises subjecting an alkyl substituted aromatic compound to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions and a solvent for the aromatic compound which is substantially inert to the oxidation at a temperature in the range of -250 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the corresponding aromatic acid from the reaction mixture.
8. A method of producing benzoic acid which comprises subjecting toluene to oxidation by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst and a solvent for the toluene" which is substantially inert to the oxidation.
9. A method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst and a solvent for the toluene which is substantially inert to the oxidation.
10. A method of producing benzoic acid which comprises subjecting toluene to oxidation by means 01' a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions, and a solvent for the toluene which is substantially inert to the oxidation at a temperature in the range of l00-320 C. and at a pressure in the range of 2 to 1000 atmospheres and separating the benzoic acid from the reaction mixture.
11. A method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions, and a solvent for the toluene which is substantially inert to the oxidation at a temperature in the range of l00320 C. and at a pressure in the range of 2 to 1000 atmospheres,
and separating the benzoic acid from the reaction mixture.
12. A method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which ,form peroxides under the reaction conditions, and a solvent for the toluene which is substantially inert to the oxidation at a temperature in the range of 130-250 C., and at a pressure in the range of 2 to 100 atmospheres, and separating the benzoic acid from the reaction mixture.
13. A method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of a cobalt acetate catalyst, an acetic acid'solvent, and an oxidation initiator selected from the group consisting oi! peroxides and compounds which form peroxides under the reaction conditions, at a temperature in the range of 100-320 0., and at a pressure in the range of 2 to 100 atmospheres, and separating the benzoic acid from the reaction mixture.
14. A method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of a cobalt acetate catalyst, an acetic acid solvent, and an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions, at a temperature in the range of 130-250 C.', and at a pressure in the range of 2 to 1000 atmospheres, and separating the benzoic acid from the reaction mixture.
15. A method of producing benzoic acid which comprises subjecting toluene to oxidation in the liquid phase by means of a gas containing gaseous oxygen in the presence of an oxidation catalyst, an oxidation initiator selected from the group consisting of peroxides and compounds which form peroxides under the reaction conditions, and a lower aliphatic acid solvent for the toluene at a temperature in the range of 130- 250 C., and at a pressure in the range of 2 to 100 atmospheres, and separating the benzoic acid from the reaction mixture.
DONALD J. LODER.
CERTIFICATE OF CORRECTION.
Patent No.2; 214.5,528. June 10, 19in.
' DONALD J. LODER.
It is hereby certified that error appears in the printed specification of the above numbered pstent requiring correction as follows: Page 11.; first column, line 25, claim 15, for "2 to 100" read --2 to 1000"; and secon'd column, 11m 10, claim 1A, for "2 to 1000" read --2 to 1oo--; and that are said Letters Patent should be read with this correction therein that the same may conform to therecord of the case in the Patent Office.
Signed and sealed this 15th day of July, A. 4). 191m.
Henry Van Arsdale,
Acting Commissioner of Patents. (Seal)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US235578A US2245528A (en) | 1938-10-18 | 1938-10-18 | Catalytic oxidation of alkyl substituted aromatic compounds |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US235578A US2245528A (en) | 1938-10-18 | 1938-10-18 | Catalytic oxidation of alkyl substituted aromatic compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US2245528A true US2245528A (en) | 1941-06-10 |
Family
ID=22886083
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US235578A Expired - Lifetime US2245528A (en) | 1938-10-18 | 1938-10-18 | Catalytic oxidation of alkyl substituted aromatic compounds |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | US2245528A (en) |
Cited By (150)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2443832A (en) * | 1946-03-30 | 1948-06-22 | Standard Oil Dev Co | Oxidation of aromatic compounds |
| US2479067A (en) * | 1947-06-05 | 1949-08-16 | Du Pont | Preparation of terephthalic acid |
| US2501088A (en) * | 1946-06-26 | 1950-03-21 | Universal Oil Prod Co | Catalytic oxidation of aromatic hydrocarbons in presence of nitroalkanes |
| US2507048A (en) * | 1946-03-04 | 1950-05-09 | Allied Chem & Dye Corp | Purifying crude acetophenone |
| US2531173A (en) * | 1947-11-17 | 1950-11-21 | California Research Corp | Preparation of terephthalic acid |
| US2531172A (en) * | 1947-11-17 | 1950-11-21 | California Research Corp | Preparation of isophthalic acid |
| US2545870A (en) * | 1946-08-26 | 1951-03-20 | Celanese Corp | Catalytic oxidation of alkyl benzenes to produce aryl alkyl ketones and carbinols |
| US2552278A (en) * | 1949-03-22 | 1951-05-08 | Monsanto Chemicals | Liquid phase oxidation |
| US2552268A (en) * | 1949-03-22 | 1951-05-08 | Monsanto Chemicals | Liquid phase oxidation |
| US2552267A (en) * | 1949-03-22 | 1951-05-08 | Monsanto Chemicals | Liquid phase oxidation |
| US2559147A (en) * | 1949-05-24 | 1951-07-03 | Monsanto Chemicals | Preparation of dibasic aromatic acids by oxidation |
| US2563820A (en) * | 1947-10-04 | 1951-08-14 | California Research Corp | Preparation of aryl dicarboxylic acids |
| US2569440A (en) * | 1949-08-11 | 1951-10-02 | Texas Co | Separation of isophthalic acid from terephthalic acid by noncatalytic esterification |
| US2572710A (en) * | 1949-09-23 | 1951-10-23 | Monsanto Chemicals | Preparation of terephthalic acid |
| US2572575A (en) * | 1949-09-23 | 1951-10-23 | Monsanto Chemicals | Preparation of terephthalic acid |
| US2578759A (en) * | 1950-01-27 | 1951-12-18 | Eastman Kodak Co | Process of preparing polycarboxylated naphthalene derivatives |
| US2588388A (en) * | 1949-12-16 | 1952-03-11 | Eastman Kodak Co | Oxidation of alkyl-substituted cyclohexanes using aldehydeactivated catalysts |
| US2644840A (en) * | 1948-08-07 | 1953-07-07 | Monsanto Chemicals | Oxidation of hydrocarbons |
| US2673217A (en) * | 1951-09-21 | 1954-03-23 | Eastman Kodak Co | Selective oxidation of substituted aromatic compounds using aldehyde-activated catalysts |
| US2673218A (en) * | 1952-05-24 | 1954-03-23 | Eastman Kodak Co | Process for preparing sulfonyl dibenzoic acids and derivatives thereof |
| US2674628A (en) * | 1951-09-17 | 1954-04-06 | Monsanto Chemicals | Method of making alkyl-nitroaromatic ketones |
| US2696499A (en) * | 1952-07-01 | 1954-12-07 | Richfield Oil Corp | Preparation of toluic acids |
| US2698865A (en) * | 1951-08-06 | 1955-01-04 | Imhausen & Compagnie G M B H | Process for production of aromatic polycarboxylic acids |
| US2723994A (en) * | 1951-01-15 | 1955-11-15 | Shell Dev | Oxidation of xylene and toluic acid mixtures to phthalic acids |
| US2727919A (en) * | 1952-08-21 | 1955-12-20 | Hercules Powder Co Ltd | Process for oxidizing polyalkylaromatic hydrocarbons and derivatives thereof using an acid anhydride catalyst |
| US2744925A (en) * | 1952-03-22 | 1956-05-08 | California Research Corp | Production of aromatic nitriles |
| DE949564C (en) * | 1951-04-13 | 1956-09-20 | Imhausen & Co G M B H | Process for the preparation of terephthalic acid monomethyl ester |
| US2772305A (en) * | 1952-08-26 | 1956-11-27 | California Research Corp | Oxidation of toluate esters and xylene mixtures |
| DE1004159B (en) * | 1953-03-19 | 1957-03-14 | Chempatents Inc | Process for the preparation of terephthalic acid |
| US2788367A (en) * | 1953-03-05 | 1957-04-09 | Union Oil Co | Xylene oxidation process |
| US2791608A (en) * | 1955-01-13 | 1957-05-07 | Du Pont | Manufacture of phthaloyl chlorides |
| US2797245A (en) * | 1953-03-06 | 1957-06-25 | Universal Oil Prod Co | Production of acetophenone |
| US2802859A (en) * | 1954-05-27 | 1957-08-13 | Shell Dev | Oxidation of alkylated benzenes in the presence of aliphatic hydrocarbons |
| US2806059A (en) * | 1954-03-30 | 1957-09-10 | Olin Mathieson | Process for making diaryl ketone polycarboxylic acids |
| DE1015421B (en) * | 1953-04-15 | 1957-09-12 | Chempatents Inc | Process for the production of isophthalic acid |
| US2809211A (en) * | 1952-05-24 | 1957-10-08 | Imhausen Werke G M B H | Process for oxidation of xylenes |
| US2810750A (en) * | 1952-07-07 | 1957-10-22 | Imhausen Werke G M B H | Process for converting aromatic alcohols to aromatic carboxylic acids |
| US2813119A (en) * | 1954-05-07 | 1957-11-12 | Hercules Powder Co Ltd | Hydrocarbon oxidation |
| US2821551A (en) * | 1951-08-06 | 1958-01-28 | Imhausen Werke G M B H | Process for production of aromatic carboxylic acids |
| US2833817A (en) * | 1956-06-27 | 1958-05-06 | Mid Century Corp | Process for the preparation of terephthalic acid |
| US2833818A (en) * | 1956-07-30 | 1958-05-06 | Mid Century Corp | Process for the preparation of terephthalic acid |
| US2833778A (en) * | 1955-03-22 | 1958-05-06 | Mid Century Corp | Process for preparation of carboxyl derivatives of certain n-heterocyclics by oxidation |
| US2833816A (en) * | 1954-05-03 | 1958-05-06 | Mid Century Corp | Preparation of aromatic polycarboxylic acids |
| DE969266C (en) * | 1951-04-28 | 1958-05-14 | Rhone Poulenc Sa | Process for the production of cumene hydroperoxide by the catalytic oxidation of cumene |
| DE969994C (en) * | 1951-04-14 | 1958-08-07 | Imhausen & Co G M B H | Process for the preparation of terephthalic acid esters by the oxidation of p-xylene |
| US2848486A (en) * | 1955-07-20 | 1958-08-19 | American Cyanamid Co | 4, 4'-(2, 2-butylidene) dibenzoic acid |
| US2850527A (en) * | 1952-03-31 | 1958-09-02 | Bayer Ag | Process for the production of aromatic dicarboxylic acids |
| US2853514A (en) * | 1955-07-22 | 1958-09-23 | Olin Mathieson | Process for the preparation of aromatic carboxylic acids |
| US2858334A (en) * | 1954-11-26 | 1958-10-28 | Mid Century Corp | Preparation of phthalic acids |
| US2859247A (en) * | 1954-11-23 | 1958-11-04 | Inst Francais Du Petrole | Process for the preparation of bicyclic ketones |
| US2880237A (en) * | 1957-05-20 | 1959-03-31 | Standard Oil Co | Process for production of aromatic polycarboxylic acids |
| US2883421A (en) * | 1956-12-24 | 1959-04-21 | Basf Ag | Production of benzene dicarboxylic acids |
| US2887511A (en) * | 1953-01-26 | 1959-05-19 | Union Oil Co | Preparation of aromatic acids by oxidation |
| US2887512A (en) * | 1956-10-29 | 1959-05-19 | Eastman Kodak Co | Oxidation of acetals |
| US2892868A (en) * | 1955-08-16 | 1959-06-30 | Sinclair Refining Co | Process for oxidizing durene to durylic acid |
| DE1060378B (en) * | 1952-08-23 | 1959-07-02 | Mid Century Corp | Process for the preparation of terephthalic acid |
| US2899466A (en) * | 1959-08-11 | Purification of terephthalic acid | ||
| DE1080539B (en) * | 1956-05-07 | 1960-04-28 | Ici Ltd | Process for the preparation of terephthalic acid |
| DE1081445B (en) * | 1954-05-03 | 1960-05-12 | Mid Century Corp | Process for the production of aromatic di- or polycarboxylic acids |
| US2946800A (en) * | 1957-06-05 | 1960-07-26 | Standard Oil Co | Process for the preparation of isonicotinic acid |
| US2946801A (en) * | 1957-06-05 | 1960-07-26 | Standard Oil Co | Production of pyridine carboxylic acids |
| US2947783A (en) * | 1960-08-02 | Process for the production of alicyclic | ||
| US2952703A (en) * | 1958-07-31 | 1960-09-13 | Rohm & Haas | Manufacture of benzoic acid |
| US2959613A (en) * | 1957-02-08 | 1960-11-08 | Ici Ltd | Oxidation process |
| US2963508A (en) * | 1958-03-10 | 1960-12-06 | Mid Century Corp | Process for oxidation of monoalkyl naphthalene |
| US2963509A (en) * | 1958-03-10 | 1960-12-06 | Mid Century Corp | Process for oxidation of mono-alkyl benzene |
| US2964559A (en) * | 1957-11-12 | 1960-12-13 | Standard Oil Co | Process for recovery of oxidation catalysts |
| DE1097972B (en) * | 1954-03-16 | 1961-01-26 | Mid Century Corp | Process for the preparation of benzene dicarboxylic acids |
| US2992271A (en) * | 1956-03-27 | 1961-07-11 | Gen Electric | Catalytic oxidation of aralkyl compounds |
| DE1112972B (en) * | 1955-04-22 | 1961-08-24 | Mid Century Corp | Process for the preparation of terephthalic acid |
| US2998448A (en) * | 1957-09-30 | 1961-08-29 | Sinclair Refining Co | Preparation of benzene carboxylic acids |
| US3004066A (en) * | 1958-09-08 | 1961-10-10 | Exxon Research Engineering Co | Oxidation of dialkylbenzenes |
| US3008983A (en) * | 1957-10-07 | 1961-11-14 | Olin Mathieson | Preparation of methylaromatic dicarboxylic acids |
| US3012038A (en) * | 1956-11-05 | 1961-12-05 | Ici Ltd | Process for preparing carboxylic acid by oxidation |
| US3020312A (en) * | 1958-01-13 | 1962-02-06 | Sun Oil Co | Purifying phthalic acids |
| US3025306A (en) * | 1960-05-31 | 1962-03-13 | Union Carbide Corp | Process for the production of epsiloncaprolactones and carboxylic acids |
| US3030414A (en) * | 1958-05-05 | 1962-04-17 | Mid Century Corp | Process of preparing meta- and para-nitrobenzoic acids |
| US3030415A (en) * | 1958-05-14 | 1962-04-17 | Standard Oil Co | Separation of ortho-nitrotoluene from nitrotoluene mixtures |
| US3036122A (en) * | 1957-09-03 | 1962-05-22 | Olin Mathieson | Preparation of aromatic carboxylic acids |
| DE975712C (en) * | 1951-08-07 | 1962-07-05 | Witten Gmbh Chem Werke | Process for the preparation of aromatic polycarboxylic acids or their esters by oxidation of alkyl aromatics |
| US3064044A (en) * | 1957-08-15 | 1962-11-13 | Standard Oil Co | Multistage oxidation system for preparing dicarboxylic acid |
| US3075009A (en) * | 1958-09-30 | 1963-01-22 | Sinclair Refining Co | Oxidation of alkylbenzene carboxylic acids |
| US3075008A (en) * | 1958-04-29 | 1963-01-22 | Heyden Newport Chemical Corp | Production of polychlorobenzoic acid |
| US3077497A (en) * | 1958-03-04 | 1963-02-12 | Sun Oil Co | Heat removal in xylene oxidation for preparation of carboxylic acid |
| DE1148537B (en) * | 1955-09-28 | 1963-05-16 | Mid Century Corp | Process for reducing the oxidative degradation of low molecular weight aliphatic monocarboxylic acids |
| US3130015A (en) * | 1958-10-31 | 1964-04-21 | Mid Century Corp | High pressure reactor |
| US3131212A (en) * | 1957-01-03 | 1964-04-28 | Biller Efim | Process for carrying out chemical reactions in a layer of sprayed whirling liquid |
| US3139452A (en) * | 1957-02-25 | 1964-06-30 | Gen Electric | Oxidation of p-xylene to terephthalic acid |
| DE976866C (en) * | 1951-06-23 | 1964-07-16 | Witten Gmbh Chem Werke | Process for the production of terephthalic acid esters |
| US3155717A (en) * | 1956-06-27 | 1964-11-03 | Mid Century Corp | Process for the preparation of trimesic acid |
| US3161693A (en) * | 1962-08-06 | 1964-12-15 | Standard Oil Co | Aromatic polycarboxylic acids |
| US3162683A (en) * | 1959-06-23 | 1964-12-22 | Exxon Research Engineering Co | Liquid phase oxidation of alkyl-substituted aromatics |
| US3183279A (en) * | 1961-05-11 | 1965-05-11 | Sun Oil Co | Purification of 2-methylnaphthalenes by selective oxidation of their isomers |
| US3187038A (en) * | 1961-01-09 | 1965-06-01 | Standard Oil Co | Continuous oxidation process for production of benzoic acid |
| US3215733A (en) * | 1961-06-05 | 1965-11-02 | Celanese Corp | Oxidation of alkanes and alkyl aromatics to aliphatic and aromatic acids |
| US3240803A (en) * | 1961-08-14 | 1966-03-15 | Eastman Kodak Co | Preparation of benzenecarboxylic acid |
| US3255243A (en) * | 1961-07-24 | 1966-06-07 | Socaty | Process for the catalytic oxidation of aromatic substances to produce mono-and dicarboxylic acids |
| US3256324A (en) * | 1960-04-04 | 1966-06-14 | Socony Mobil Oil Co Inc | Oxidation of methylaromatic hydrocarbons in the presence of a promoter |
| US3258368A (en) * | 1963-05-20 | 1966-06-28 | Dow Chemical Co | Organic electrolyte for magnesium primary cells |
| US3284493A (en) * | 1963-10-07 | 1966-11-08 | Mobil Oil Corp | Process for the conversion of methyl-substituted benzene compounds to carboxylic acids |
| DE1263742B (en) * | 1962-04-28 | 1968-03-21 | Kyowa Hakko Kogyo Kk | Process for the preparation of mixtures of benzene dicarboxylic acids and adipic acid |
| DE1266296B (en) * | 1953-03-19 | 1968-04-18 | Mid Century Corp | Process for the preparation of terephthalic acid |
| US3442954A (en) * | 1968-01-23 | 1969-05-06 | Atlantic Richfield Co | Transition metal salts of alkylbenzene sulfonic acids for selective oxidation reactions |
| US3452087A (en) * | 1967-05-08 | 1969-06-24 | Marathon Oil Co | Process for the autoxidation of substituted benzenes |
| US3467698A (en) * | 1965-10-21 | 1969-09-16 | Gulf Research Development Co | Oxidation of alkyl aromatic compounds to aromatic carboxylic acids |
| US3505397A (en) * | 1967-05-01 | 1970-04-07 | Marathon Oil Co | Processes for the autoxidation of substituted benzenes |
| US3507912A (en) * | 1966-01-18 | 1970-04-21 | Mobil Oil Corp | Process for the preparation of benzene carboxylic acids |
| US3513192A (en) * | 1969-08-13 | 1970-05-19 | Daniel Lumbroso | Process for manufacturing terephthalic acid by oxidation of para-xylene |
| US3518301A (en) * | 1966-10-06 | 1970-06-30 | Sun Oil Co | Alkyl aromatic oxidation process |
| US3519684A (en) * | 1966-12-27 | 1970-07-07 | Enrique Roberto Witt | Preparation of aromatic disubstituted carboxylic acids |
| US3529020A (en) * | 1965-08-16 | 1970-09-15 | Mobil Oil Corp | Oxidation processes employing aluminosilicate catalysts and an initiator |
| US3626000A (en) * | 1968-01-05 | 1971-12-07 | Toray Industries | Process for preparing benzene carboxylic acids |
| US3673244A (en) * | 1969-07-07 | 1972-06-27 | Sir Soc Italiana Resine Spa | Method of producing aromatic carboxylic acids from alkylbenzenes |
| US3676488A (en) * | 1970-05-01 | 1972-07-11 | Gulf Research Development Co | Process for preparing phenyl sulfone carboxylic acids |
| US3678105A (en) * | 1968-08-28 | 1972-07-18 | Petro Tex Chem Corp | Promotion of liquid phase oxidation catalysts |
| US3681446A (en) * | 1970-04-01 | 1972-08-01 | Velsicol Chemical Corp | Process for the production of para-chloro-benzoic acid |
| US3686293A (en) * | 1970-07-13 | 1972-08-22 | Giorgio Gualdi | Process for the preparation of aromatic carboxylic acids |
| US3700731A (en) * | 1969-02-28 | 1972-10-24 | Du Pont | Process for oxidizing xylenes to phthalic acids |
| US3708531A (en) * | 1971-06-02 | 1973-01-02 | Petro Tex Chem Corp | Promotion of the oxidation of mononuclear aromatic compounds |
| US3715390A (en) * | 1968-08-28 | 1973-02-06 | Petro Tex Chem Corp | Promotion of the oxidation of mononuclear aromatic compounds |
| US3715391A (en) * | 1968-08-28 | 1973-02-06 | Petro Tex Chem Corp | Promotion of the oxidation of mononuclear aromatic compounds |
| US3723518A (en) * | 1968-08-28 | 1973-03-27 | Petro Tex Chem Corp | Promotion of the oxidation of mononuclear aromatic compounds |
| US3723515A (en) * | 1968-08-28 | 1973-03-27 | Petro Tex Chem Corp | Promotion of the oxidation of mononuclear aromatic compounds |
| US3725471A (en) * | 1970-04-27 | 1973-04-03 | Gulf Research Development Co | Process for preparing hydroxybenzoic acid |
| US3832395A (en) * | 1972-12-18 | 1974-08-27 | Atlantic Richfield Co | Method for the production of phthalic and toluic acids by the catalytic oxidation of xylenes |
| US3898288A (en) * | 1969-12-11 | 1975-08-05 | Labofina Sa | Oxidation of alkyl aromatics |
| US3903148A (en) * | 1972-08-14 | 1975-09-02 | Teijin Hercules Chem Co Ltd | Process for preparation of benzoic acid |
| US4016206A (en) * | 1972-12-18 | 1977-04-05 | Gulf Research & Development Company | Process for preparing pyromellitic acid |
| US4113782A (en) * | 1975-02-18 | 1978-09-12 | Agency Of Industrial Science And Technology | Process for the preparation of formylated phenoxy compounds |
| US4323692A (en) * | 1978-08-04 | 1982-04-06 | Rohm And Haas Company | Process for preparing phenoxybenzoic acids |
| US4346230A (en) * | 1971-12-18 | 1982-08-24 | Dynamit Nobel Aktiengesellschaft | Process for the preparation of dimethyl terephthalate |
| US4401828A (en) * | 1978-08-04 | 1983-08-30 | Rohm And Haas Company | Process for preparing phenoxybenzoic acids |
| US4625056A (en) * | 1979-12-19 | 1986-11-25 | Occidental Research Corporation | Process for producing benzene carboxylic acids from aromatic material utilizing an aliphatic organic acid agent |
| US4786753A (en) * | 1987-05-18 | 1988-11-22 | Amoco Corporation | Oxidation process for the manufacture of aromatic acids from alkylaromatic compounds |
| US4820862A (en) * | 1970-03-04 | 1989-04-11 | Dynamit Nobel Aktiengesellschaft | Process for the preparation of dimethyl terephthalate |
| US5739384A (en) * | 1995-09-21 | 1998-04-14 | Intercontinental Quimica, S.A. (Interquisa) | Industrial process to manufacture aromatic carboxylic acids |
| US5955394A (en) * | 1996-08-16 | 1999-09-21 | Mobile Process Technology, Co. | Recovery process for oxidation catalyst in the manufacture of aromatic carboxylic acids |
| US6437176B2 (en) * | 1996-05-17 | 2002-08-20 | Toray Industries, Inc. | Method for preparing aromatic carboxylic acids, aromatic aldehydes, and aromatic alcohols |
| US6476257B1 (en) | 1972-03-31 | 2002-11-05 | Korea Institute Of Chemical Technology | Method for preparing aromatic carboxylic acids from alkylaromatics by liquid-phase oxidation |
| US6649773B2 (en) | 2002-03-22 | 2003-11-18 | General Electric Company | Method for the manufacture of halophthalic acids and anhydrides |
| US6657067B2 (en) | 2002-03-22 | 2003-12-02 | General Electric Company | Method for the manufacture of chlorophthalic anhydride |
| US6657068B2 (en) | 2002-03-22 | 2003-12-02 | General Electric Company | Liquid phase oxidation of halogenated ortho-xylenes |
| US20040199006A1 (en) * | 2000-07-19 | 2004-10-07 | E. I. Dupont De Nemours And Company | Production of aromatic carboxylic acids |
| US20060004224A1 (en) * | 2004-06-30 | 2006-01-05 | General Electric Company | Method of making halophthalic acids and halophthalic anhydrides |
| US20060004223A1 (en) * | 2004-06-30 | 2006-01-05 | General Electric Company | Method of making halophthalic acids and halophthalic anhydrides |
| US20070232807A1 (en) * | 2004-10-01 | 2007-10-04 | Thomas William B | Process for producing heteroaromatic carboxylic acids |
| CN101279906B (en) * | 2007-12-27 | 2010-08-25 | 浙江科技学院 | A method for producing acetic acid by liquid-phase catalytic degradation of waste polypropylene plastics |
| US8653207B1 (en) * | 2012-11-30 | 2014-02-18 | Westlake Longview Corporation | Process and apparatus for polymerizing ethylene under ultra-high pressure |
| US9388110B2 (en) | 2013-12-12 | 2016-07-12 | Saudi Arabian Oil Company | Liquid phase oxidation of aromatic feedstocks with manganate recycling to produce carboxylic acids |
| US20180305287A1 (en) * | 2015-10-23 | 2018-10-25 | Sabic Global Technologies B.V. | Process for producing terephthalic acid |
-
1938
- 1938-10-18 US US235578A patent/US2245528A/en not_active Expired - Lifetime
Cited By (164)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2899466A (en) * | 1959-08-11 | Purification of terephthalic acid | ||
| US2947783A (en) * | 1960-08-02 | Process for the production of alicyclic | ||
| US2507048A (en) * | 1946-03-04 | 1950-05-09 | Allied Chem & Dye Corp | Purifying crude acetophenone |
| US2443832A (en) * | 1946-03-30 | 1948-06-22 | Standard Oil Dev Co | Oxidation of aromatic compounds |
| US2501088A (en) * | 1946-06-26 | 1950-03-21 | Universal Oil Prod Co | Catalytic oxidation of aromatic hydrocarbons in presence of nitroalkanes |
| US2545870A (en) * | 1946-08-26 | 1951-03-20 | Celanese Corp | Catalytic oxidation of alkyl benzenes to produce aryl alkyl ketones and carbinols |
| US2479067A (en) * | 1947-06-05 | 1949-08-16 | Du Pont | Preparation of terephthalic acid |
| US2563820A (en) * | 1947-10-04 | 1951-08-14 | California Research Corp | Preparation of aryl dicarboxylic acids |
| US2531172A (en) * | 1947-11-17 | 1950-11-21 | California Research Corp | Preparation of isophthalic acid |
| US2531173A (en) * | 1947-11-17 | 1950-11-21 | California Research Corp | Preparation of terephthalic acid |
| US2644840A (en) * | 1948-08-07 | 1953-07-07 | Monsanto Chemicals | Oxidation of hydrocarbons |
| US2552278A (en) * | 1949-03-22 | 1951-05-08 | Monsanto Chemicals | Liquid phase oxidation |
| US2552268A (en) * | 1949-03-22 | 1951-05-08 | Monsanto Chemicals | Liquid phase oxidation |
| US2552267A (en) * | 1949-03-22 | 1951-05-08 | Monsanto Chemicals | Liquid phase oxidation |
| US2559147A (en) * | 1949-05-24 | 1951-07-03 | Monsanto Chemicals | Preparation of dibasic aromatic acids by oxidation |
| US2569440A (en) * | 1949-08-11 | 1951-10-02 | Texas Co | Separation of isophthalic acid from terephthalic acid by noncatalytic esterification |
| US2572575A (en) * | 1949-09-23 | 1951-10-23 | Monsanto Chemicals | Preparation of terephthalic acid |
| US2572710A (en) * | 1949-09-23 | 1951-10-23 | Monsanto Chemicals | Preparation of terephthalic acid |
| US2588388A (en) * | 1949-12-16 | 1952-03-11 | Eastman Kodak Co | Oxidation of alkyl-substituted cyclohexanes using aldehydeactivated catalysts |
| US2578759A (en) * | 1950-01-27 | 1951-12-18 | Eastman Kodak Co | Process of preparing polycarboxylated naphthalene derivatives |
| US2723994A (en) * | 1951-01-15 | 1955-11-15 | Shell Dev | Oxidation of xylene and toluic acid mixtures to phthalic acids |
| DE949564C (en) * | 1951-04-13 | 1956-09-20 | Imhausen & Co G M B H | Process for the preparation of terephthalic acid monomethyl ester |
| DE969994C (en) * | 1951-04-14 | 1958-08-07 | Imhausen & Co G M B H | Process for the preparation of terephthalic acid esters by the oxidation of p-xylene |
| DE969266C (en) * | 1951-04-28 | 1958-05-14 | Rhone Poulenc Sa | Process for the production of cumene hydroperoxide by the catalytic oxidation of cumene |
| DE976866C (en) * | 1951-06-23 | 1964-07-16 | Witten Gmbh Chem Werke | Process for the production of terephthalic acid esters |
| US2698865A (en) * | 1951-08-06 | 1955-01-04 | Imhausen & Compagnie G M B H | Process for production of aromatic polycarboxylic acids |
| US2821551A (en) * | 1951-08-06 | 1958-01-28 | Imhausen Werke G M B H | Process for production of aromatic carboxylic acids |
| DE975712C (en) * | 1951-08-07 | 1962-07-05 | Witten Gmbh Chem Werke | Process for the preparation of aromatic polycarboxylic acids or their esters by oxidation of alkyl aromatics |
| US2674628A (en) * | 1951-09-17 | 1954-04-06 | Monsanto Chemicals | Method of making alkyl-nitroaromatic ketones |
| US2673217A (en) * | 1951-09-21 | 1954-03-23 | Eastman Kodak Co | Selective oxidation of substituted aromatic compounds using aldehyde-activated catalysts |
| US2744925A (en) * | 1952-03-22 | 1956-05-08 | California Research Corp | Production of aromatic nitriles |
| US2850527A (en) * | 1952-03-31 | 1958-09-02 | Bayer Ag | Process for the production of aromatic dicarboxylic acids |
| US2809211A (en) * | 1952-05-24 | 1957-10-08 | Imhausen Werke G M B H | Process for oxidation of xylenes |
| US2673218A (en) * | 1952-05-24 | 1954-03-23 | Eastman Kodak Co | Process for preparing sulfonyl dibenzoic acids and derivatives thereof |
| US2696499A (en) * | 1952-07-01 | 1954-12-07 | Richfield Oil Corp | Preparation of toluic acids |
| US2810750A (en) * | 1952-07-07 | 1957-10-22 | Imhausen Werke G M B H | Process for converting aromatic alcohols to aromatic carboxylic acids |
| US2727919A (en) * | 1952-08-21 | 1955-12-20 | Hercules Powder Co Ltd | Process for oxidizing polyalkylaromatic hydrocarbons and derivatives thereof using an acid anhydride catalyst |
| DE1060378B (en) * | 1952-08-23 | 1959-07-02 | Mid Century Corp | Process for the preparation of terephthalic acid |
| US2772305A (en) * | 1952-08-26 | 1956-11-27 | California Research Corp | Oxidation of toluate esters and xylene mixtures |
| US2887511A (en) * | 1953-01-26 | 1959-05-19 | Union Oil Co | Preparation of aromatic acids by oxidation |
| US2788367A (en) * | 1953-03-05 | 1957-04-09 | Union Oil Co | Xylene oxidation process |
| US2797245A (en) * | 1953-03-06 | 1957-06-25 | Universal Oil Prod Co | Production of acetophenone |
| DE1266296B (en) * | 1953-03-19 | 1968-04-18 | Mid Century Corp | Process for the preparation of terephthalic acid |
| DE1004159B (en) * | 1953-03-19 | 1957-03-14 | Chempatents Inc | Process for the preparation of terephthalic acid |
| DE1015421B (en) * | 1953-04-15 | 1957-09-12 | Chempatents Inc | Process for the production of isophthalic acid |
| DE1097972B (en) * | 1954-03-16 | 1961-01-26 | Mid Century Corp | Process for the preparation of benzene dicarboxylic acids |
| US2806059A (en) * | 1954-03-30 | 1957-09-10 | Olin Mathieson | Process for making diaryl ketone polycarboxylic acids |
| DE1081445B (en) * | 1954-05-03 | 1960-05-12 | Mid Century Corp | Process for the production of aromatic di- or polycarboxylic acids |
| US2833816A (en) * | 1954-05-03 | 1958-05-06 | Mid Century Corp | Preparation of aromatic polycarboxylic acids |
| US2813119A (en) * | 1954-05-07 | 1957-11-12 | Hercules Powder Co Ltd | Hydrocarbon oxidation |
| US2802859A (en) * | 1954-05-27 | 1957-08-13 | Shell Dev | Oxidation of alkylated benzenes in the presence of aliphatic hydrocarbons |
| US2859247A (en) * | 1954-11-23 | 1958-11-04 | Inst Francais Du Petrole | Process for the preparation of bicyclic ketones |
| US2858334A (en) * | 1954-11-26 | 1958-10-28 | Mid Century Corp | Preparation of phthalic acids |
| US2791608A (en) * | 1955-01-13 | 1957-05-07 | Du Pont | Manufacture of phthaloyl chlorides |
| US2833778A (en) * | 1955-03-22 | 1958-05-06 | Mid Century Corp | Process for preparation of carboxyl derivatives of certain n-heterocyclics by oxidation |
| DE1112972B (en) * | 1955-04-22 | 1961-08-24 | Mid Century Corp | Process for the preparation of terephthalic acid |
| US2848486A (en) * | 1955-07-20 | 1958-08-19 | American Cyanamid Co | 4, 4'-(2, 2-butylidene) dibenzoic acid |
| US2853514A (en) * | 1955-07-22 | 1958-09-23 | Olin Mathieson | Process for the preparation of aromatic carboxylic acids |
| DE1125416B (en) * | 1955-07-22 | 1962-03-15 | Olin Mathieson | Process for the production of benzene carboxylic acids |
| US2892868A (en) * | 1955-08-16 | 1959-06-30 | Sinclair Refining Co | Process for oxidizing durene to durylic acid |
| DE1148537B (en) * | 1955-09-28 | 1963-05-16 | Mid Century Corp | Process for reducing the oxidative degradation of low molecular weight aliphatic monocarboxylic acids |
| US2992271A (en) * | 1956-03-27 | 1961-07-11 | Gen Electric | Catalytic oxidation of aralkyl compounds |
| DE1125903B (en) * | 1956-03-27 | 1962-03-22 | Gen Electric | Process for the production of aromatic carboxylic acids |
| DE1080539B (en) * | 1956-05-07 | 1960-04-28 | Ici Ltd | Process for the preparation of terephthalic acid |
| US3155717A (en) * | 1956-06-27 | 1964-11-03 | Mid Century Corp | Process for the preparation of trimesic acid |
| US2833817A (en) * | 1956-06-27 | 1958-05-06 | Mid Century Corp | Process for the preparation of terephthalic acid |
| US2833818A (en) * | 1956-07-30 | 1958-05-06 | Mid Century Corp | Process for the preparation of terephthalic acid |
| US2887512A (en) * | 1956-10-29 | 1959-05-19 | Eastman Kodak Co | Oxidation of acetals |
| US3012038A (en) * | 1956-11-05 | 1961-12-05 | Ici Ltd | Process for preparing carboxylic acid by oxidation |
| US2883421A (en) * | 1956-12-24 | 1959-04-21 | Basf Ag | Production of benzene dicarboxylic acids |
| US3131212A (en) * | 1957-01-03 | 1964-04-28 | Biller Efim | Process for carrying out chemical reactions in a layer of sprayed whirling liquid |
| US2959613A (en) * | 1957-02-08 | 1960-11-08 | Ici Ltd | Oxidation process |
| US3139452A (en) * | 1957-02-25 | 1964-06-30 | Gen Electric | Oxidation of p-xylene to terephthalic acid |
| US2880237A (en) * | 1957-05-20 | 1959-03-31 | Standard Oil Co | Process for production of aromatic polycarboxylic acids |
| US2946801A (en) * | 1957-06-05 | 1960-07-26 | Standard Oil Co | Production of pyridine carboxylic acids |
| US2946800A (en) * | 1957-06-05 | 1960-07-26 | Standard Oil Co | Process for the preparation of isonicotinic acid |
| US3064044A (en) * | 1957-08-15 | 1962-11-13 | Standard Oil Co | Multistage oxidation system for preparing dicarboxylic acid |
| DE1220408B (en) * | 1957-09-03 | 1966-07-07 | Socony Mobil Oil Co Inc | Process for the preparation of benzene carboxylic acids |
| US3036122A (en) * | 1957-09-03 | 1962-05-22 | Olin Mathieson | Preparation of aromatic carboxylic acids |
| US2998448A (en) * | 1957-09-30 | 1961-08-29 | Sinclair Refining Co | Preparation of benzene carboxylic acids |
| US3008983A (en) * | 1957-10-07 | 1961-11-14 | Olin Mathieson | Preparation of methylaromatic dicarboxylic acids |
| DE1147935B (en) * | 1957-10-07 | 1963-05-02 | Olin Mathieson | Process for the preparation of mixtures of methyl or dimethyl terephthalic and isophthalic acid |
| US2964559A (en) * | 1957-11-12 | 1960-12-13 | Standard Oil Co | Process for recovery of oxidation catalysts |
| US3020312A (en) * | 1958-01-13 | 1962-02-06 | Sun Oil Co | Purifying phthalic acids |
| US3077497A (en) * | 1958-03-04 | 1963-02-12 | Sun Oil Co | Heat removal in xylene oxidation for preparation of carboxylic acid |
| US2963508A (en) * | 1958-03-10 | 1960-12-06 | Mid Century Corp | Process for oxidation of monoalkyl naphthalene |
| US2963509A (en) * | 1958-03-10 | 1960-12-06 | Mid Century Corp | Process for oxidation of mono-alkyl benzene |
| US3075008A (en) * | 1958-04-29 | 1963-01-22 | Heyden Newport Chemical Corp | Production of polychlorobenzoic acid |
| US3030414A (en) * | 1958-05-05 | 1962-04-17 | Mid Century Corp | Process of preparing meta- and para-nitrobenzoic acids |
| US3030415A (en) * | 1958-05-14 | 1962-04-17 | Standard Oil Co | Separation of ortho-nitrotoluene from nitrotoluene mixtures |
| US2952703A (en) * | 1958-07-31 | 1960-09-13 | Rohm & Haas | Manufacture of benzoic acid |
| US3004066A (en) * | 1958-09-08 | 1961-10-10 | Exxon Research Engineering Co | Oxidation of dialkylbenzenes |
| US3075009A (en) * | 1958-09-30 | 1963-01-22 | Sinclair Refining Co | Oxidation of alkylbenzene carboxylic acids |
| US3130015A (en) * | 1958-10-31 | 1964-04-21 | Mid Century Corp | High pressure reactor |
| US3162683A (en) * | 1959-06-23 | 1964-12-22 | Exxon Research Engineering Co | Liquid phase oxidation of alkyl-substituted aromatics |
| US3256324A (en) * | 1960-04-04 | 1966-06-14 | Socony Mobil Oil Co Inc | Oxidation of methylaromatic hydrocarbons in the presence of a promoter |
| US3025306A (en) * | 1960-05-31 | 1962-03-13 | Union Carbide Corp | Process for the production of epsiloncaprolactones and carboxylic acids |
| US3187038A (en) * | 1961-01-09 | 1965-06-01 | Standard Oil Co | Continuous oxidation process for production of benzoic acid |
| US3183279A (en) * | 1961-05-11 | 1965-05-11 | Sun Oil Co | Purification of 2-methylnaphthalenes by selective oxidation of their isomers |
| US3215733A (en) * | 1961-06-05 | 1965-11-02 | Celanese Corp | Oxidation of alkanes and alkyl aromatics to aliphatic and aromatic acids |
| US3255243A (en) * | 1961-07-24 | 1966-06-07 | Socaty | Process for the catalytic oxidation of aromatic substances to produce mono-and dicarboxylic acids |
| DE1235887B (en) * | 1961-08-14 | 1967-03-09 | Eastman Kodak Co | Process and device for the continuous production of benzene dicarboxylic acids |
| US3240803A (en) * | 1961-08-14 | 1966-03-15 | Eastman Kodak Co | Preparation of benzenecarboxylic acid |
| US3474137A (en) * | 1962-04-28 | 1969-10-21 | Kyowa Hakko Kogyo Kk | Liquid phase oxidation of xylenes |
| DE1263742B (en) * | 1962-04-28 | 1968-03-21 | Kyowa Hakko Kogyo Kk | Process for the preparation of mixtures of benzene dicarboxylic acids and adipic acid |
| US3161693A (en) * | 1962-08-06 | 1964-12-15 | Standard Oil Co | Aromatic polycarboxylic acids |
| US3258368A (en) * | 1963-05-20 | 1966-06-28 | Dow Chemical Co | Organic electrolyte for magnesium primary cells |
| US3284493A (en) * | 1963-10-07 | 1966-11-08 | Mobil Oil Corp | Process for the conversion of methyl-substituted benzene compounds to carboxylic acids |
| US3529020A (en) * | 1965-08-16 | 1970-09-15 | Mobil Oil Corp | Oxidation processes employing aluminosilicate catalysts and an initiator |
| US3467698A (en) * | 1965-10-21 | 1969-09-16 | Gulf Research Development Co | Oxidation of alkyl aromatic compounds to aromatic carboxylic acids |
| US3507912A (en) * | 1966-01-18 | 1970-04-21 | Mobil Oil Corp | Process for the preparation of benzene carboxylic acids |
| US3518301A (en) * | 1966-10-06 | 1970-06-30 | Sun Oil Co | Alkyl aromatic oxidation process |
| US3519684A (en) * | 1966-12-27 | 1970-07-07 | Enrique Roberto Witt | Preparation of aromatic disubstituted carboxylic acids |
| US3505397A (en) * | 1967-05-01 | 1970-04-07 | Marathon Oil Co | Processes for the autoxidation of substituted benzenes |
| US3452087A (en) * | 1967-05-08 | 1969-06-24 | Marathon Oil Co | Process for the autoxidation of substituted benzenes |
| US3626000A (en) * | 1968-01-05 | 1971-12-07 | Toray Industries | Process for preparing benzene carboxylic acids |
| US3442954A (en) * | 1968-01-23 | 1969-05-06 | Atlantic Richfield Co | Transition metal salts of alkylbenzene sulfonic acids for selective oxidation reactions |
| US3723515A (en) * | 1968-08-28 | 1973-03-27 | Petro Tex Chem Corp | Promotion of the oxidation of mononuclear aromatic compounds |
| US3723518A (en) * | 1968-08-28 | 1973-03-27 | Petro Tex Chem Corp | Promotion of the oxidation of mononuclear aromatic compounds |
| US3678105A (en) * | 1968-08-28 | 1972-07-18 | Petro Tex Chem Corp | Promotion of liquid phase oxidation catalysts |
| US3715391A (en) * | 1968-08-28 | 1973-02-06 | Petro Tex Chem Corp | Promotion of the oxidation of mononuclear aromatic compounds |
| US3715390A (en) * | 1968-08-28 | 1973-02-06 | Petro Tex Chem Corp | Promotion of the oxidation of mononuclear aromatic compounds |
| US3700731A (en) * | 1969-02-28 | 1972-10-24 | Du Pont | Process for oxidizing xylenes to phthalic acids |
| US3673244A (en) * | 1969-07-07 | 1972-06-27 | Sir Soc Italiana Resine Spa | Method of producing aromatic carboxylic acids from alkylbenzenes |
| US3513192A (en) * | 1969-08-13 | 1970-05-19 | Daniel Lumbroso | Process for manufacturing terephthalic acid by oxidation of para-xylene |
| US3898288A (en) * | 1969-12-11 | 1975-08-05 | Labofina Sa | Oxidation of alkyl aromatics |
| US4820862A (en) * | 1970-03-04 | 1989-04-11 | Dynamit Nobel Aktiengesellschaft | Process for the preparation of dimethyl terephthalate |
| US3681446A (en) * | 1970-04-01 | 1972-08-01 | Velsicol Chemical Corp | Process for the production of para-chloro-benzoic acid |
| US3725471A (en) * | 1970-04-27 | 1973-04-03 | Gulf Research Development Co | Process for preparing hydroxybenzoic acid |
| US3676488A (en) * | 1970-05-01 | 1972-07-11 | Gulf Research Development Co | Process for preparing phenyl sulfone carboxylic acids |
| US3686293A (en) * | 1970-07-13 | 1972-08-22 | Giorgio Gualdi | Process for the preparation of aromatic carboxylic acids |
| US3708531A (en) * | 1971-06-02 | 1973-01-02 | Petro Tex Chem Corp | Promotion of the oxidation of mononuclear aromatic compounds |
| US4346230A (en) * | 1971-12-18 | 1982-08-24 | Dynamit Nobel Aktiengesellschaft | Process for the preparation of dimethyl terephthalate |
| US6476257B1 (en) | 1972-03-31 | 2002-11-05 | Korea Institute Of Chemical Technology | Method for preparing aromatic carboxylic acids from alkylaromatics by liquid-phase oxidation |
| US3903148A (en) * | 1972-08-14 | 1975-09-02 | Teijin Hercules Chem Co Ltd | Process for preparation of benzoic acid |
| US3832395A (en) * | 1972-12-18 | 1974-08-27 | Atlantic Richfield Co | Method for the production of phthalic and toluic acids by the catalytic oxidation of xylenes |
| US4016206A (en) * | 1972-12-18 | 1977-04-05 | Gulf Research & Development Company | Process for preparing pyromellitic acid |
| US4113782A (en) * | 1975-02-18 | 1978-09-12 | Agency Of Industrial Science And Technology | Process for the preparation of formylated phenoxy compounds |
| US4323692A (en) * | 1978-08-04 | 1982-04-06 | Rohm And Haas Company | Process for preparing phenoxybenzoic acids |
| US4401828A (en) * | 1978-08-04 | 1983-08-30 | Rohm And Haas Company | Process for preparing phenoxybenzoic acids |
| US4625056A (en) * | 1979-12-19 | 1986-11-25 | Occidental Research Corporation | Process for producing benzene carboxylic acids from aromatic material utilizing an aliphatic organic acid agent |
| US4786753A (en) * | 1987-05-18 | 1988-11-22 | Amoco Corporation | Oxidation process for the manufacture of aromatic acids from alkylaromatic compounds |
| US5739384A (en) * | 1995-09-21 | 1998-04-14 | Intercontinental Quimica, S.A. (Interquisa) | Industrial process to manufacture aromatic carboxylic acids |
| US6437176B2 (en) * | 1996-05-17 | 2002-08-20 | Toray Industries, Inc. | Method for preparing aromatic carboxylic acids, aromatic aldehydes, and aromatic alcohols |
| US6590129B2 (en) | 1996-05-17 | 2003-07-08 | Toray Industries, Inc. | Method for preparing aromatic carboxylic acids, aromatic aldehydes, and aromatic alcohols |
| US5955394A (en) * | 1996-08-16 | 1999-09-21 | Mobile Process Technology, Co. | Recovery process for oxidation catalyst in the manufacture of aromatic carboxylic acids |
| US20040199006A1 (en) * | 2000-07-19 | 2004-10-07 | E. I. Dupont De Nemours And Company | Production of aromatic carboxylic acids |
| US7238833B2 (en) * | 2000-07-19 | 2007-07-03 | Invista North America S.A.R.L. | Production of aromatic carboxylic acids |
| US6649773B2 (en) | 2002-03-22 | 2003-11-18 | General Electric Company | Method for the manufacture of halophthalic acids and anhydrides |
| US6657067B2 (en) | 2002-03-22 | 2003-12-02 | General Electric Company | Method for the manufacture of chlorophthalic anhydride |
| US6657068B2 (en) | 2002-03-22 | 2003-12-02 | General Electric Company | Liquid phase oxidation of halogenated ortho-xylenes |
| US20060004224A1 (en) * | 2004-06-30 | 2006-01-05 | General Electric Company | Method of making halophthalic acids and halophthalic anhydrides |
| US20060004223A1 (en) * | 2004-06-30 | 2006-01-05 | General Electric Company | Method of making halophthalic acids and halophthalic anhydrides |
| US20080275211A1 (en) * | 2004-06-30 | 2008-11-06 | Robert Edgar Colborn | Method of making halophthalic acids and halophthalic anhydrides |
| US7541489B2 (en) | 2004-06-30 | 2009-06-02 | Sabic Innovative Plastics Ip B.V. | Method of making halophthalic acids and halophthalic anhydrides |
| US7732559B2 (en) | 2004-06-30 | 2010-06-08 | Sabic Innovative Plastics Ip B.V. | Method of making halophthalic acids and halophthalic anhydrides |
| US20070232807A1 (en) * | 2004-10-01 | 2007-10-04 | Thomas William B | Process for producing heteroaromatic carboxylic acids |
| US7560566B2 (en) * | 2004-10-01 | 2009-07-14 | Invista North America S.A.R.L. | Process for producing heteroaromatic carboxylic acids |
| CN101279906B (en) * | 2007-12-27 | 2010-08-25 | 浙江科技学院 | A method for producing acetic acid by liquid-phase catalytic degradation of waste polypropylene plastics |
| US8653207B1 (en) * | 2012-11-30 | 2014-02-18 | Westlake Longview Corporation | Process and apparatus for polymerizing ethylene under ultra-high pressure |
| US9388110B2 (en) | 2013-12-12 | 2016-07-12 | Saudi Arabian Oil Company | Liquid phase oxidation of aromatic feedstocks with manganate recycling to produce carboxylic acids |
| US9902677B2 (en) | 2013-12-12 | 2018-02-27 | Saudi Arabian Oil Company | Liquid phase oxidation of aromatic feedstocks with manganate recycling to produce carboxylic acids |
| US20180305287A1 (en) * | 2015-10-23 | 2018-10-25 | Sabic Global Technologies B.V. | Process for producing terephthalic acid |
| US10676420B2 (en) * | 2015-10-23 | 2020-06-09 | Sabic Global Technologies B.V. | Process for producing terephthalic acid |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2223493A (en) | Oxidation of cyclic compounds | |
| US2265948A (en) | Catalytic oxidation of lower aliphatic hydrocarbons | |
| US2223494A (en) | Production of cyclic alcohols and ketones | |
| US2845461A (en) | Non-catalytic liquid phase isobutane oxidation | |
| US2479067A (en) | Preparation of terephthalic acid | |
| US2316604A (en) | Oxidation of organic compounds | |
| US3231608A (en) | Preparation of dibasic acids | |
| US3361806A (en) | Process for oxidizing cyclohexane to adipic acid | |
| US3700731A (en) | Process for oxidizing xylenes to phthalic acids | |
| US3234271A (en) | Adipic acid production by the two step oxidation of cyclohexane with oxygen | |
| WO1994007833A1 (en) | A process for the preparation of adipic acid and other aliphatic dibasic acids | |
| US2723994A (en) | Oxidation of xylene and toluic acid mixtures to phthalic acids | |
| US2415800A (en) | Controlled oxidation of alkylated aromatic hydrocarbons | |
| US3293292A (en) | Butane oxidation | |
| US2839575A (en) | Oxidation of alkyl-substituted benzene carboxylic acids | |
| US2452741A (en) | Production of dibasic acids | |
| US2292950A (en) | Catalytic oxidation | |
| US2746990A (en) | Preparation of terephthalic acid | |
| US2675407A (en) | Air oxidation of cycloalkanes | |
| US2853514A (en) | Process for the preparation of aromatic carboxylic acids | |
| US2376674A (en) | Method for oxidation of aromatic hydrocarbons | |
| US2813119A (en) | Hydrocarbon oxidation | |
| US2316543A (en) | Catalytic oxidation | |
| US3406196A (en) | Oxidation of polyalkyl aromatics to polycarboxylic acids | |
| US2519754A (en) | Manufacture of ethylene glycol esters |