SU95746A1 - - Google Patents
Info
- Publication number
- SU95746A1 SU95746A1 SU95746A1 SU 95746 A1 SU95746 A1 SU 95746A1 SU 95746 A1 SU95746 A1 SU 95746A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- aromatic
- residues
- acid
- fact
- blue
- Prior art date
Links
- 239000000243 solution Substances 0.000 claims description 9
- 239000000839 emulsion Substances 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 3
- 238000009792 diffusion process Methods 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims 2
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000012895 dilution Substances 0.000 claims 1
- 238000010790 dilution Methods 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 239000004332 silver Substances 0.000 claims 1
- 229910052709 silver Inorganic materials 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 238000010521 absorption reaction Methods 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 4
- 239000012670 alkaline solution Substances 0.000 description 4
- 239000000975 dye Substances 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- -1 monosubstituted amide Chemical class 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- UXEIBIFIAVGXFS-UHFFFAOYSA-N 1-hydroxy-4-sulfonaphthalene-2-carboxylic acid Chemical compound C1=CC=CC2=C(O)C(C(=O)O)=CC(S(O)(=O)=O)=C21 UXEIBIFIAVGXFS-UHFFFAOYSA-N 0.000 description 1
- HZGDECXEHFCYLL-UHFFFAOYSA-N 1-sulfonaphthalene-2-carboxylic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(C(=O)O)=CC=C21 HZGDECXEHFCYLL-UHFFFAOYSA-N 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- TXBQVOWAZRPPHI-UHFFFAOYSA-N 4-N-ethylbenzene-1,4-diamine sulfuric acid Chemical compound S(=O)(=O)(O)O.NC1=CC=C(NCC)C=C1 TXBQVOWAZRPPHI-UHFFFAOYSA-N 0.000 description 1
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US3520689A (en) | Color developing process utilizing pyridinium salts | |
US3764337A (en) | Color photographic materials containing dihydroxyspirochroman compounds as stabilizers | |
US2313586A (en) | Hydroxynaphthoic acid amide coupler | |
US4009035A (en) | Process for forming cyan dye photographic images | |
US2482546A (en) | Phenoxyalkylamines as accelerators for photographic developers | |
US4207393A (en) | Photographic contrast enhancers | |
DE1931057C2 (de) | Verfahren zur Herstellung farbphotographischer Bilder | |
US3113025A (en) | Diazotype materials for the production of black images | |
US3615503A (en) | Color-developing composition containing an antioxidant | |
DE3444091A1 (de) | Photographische farbbildner-zusammensetzung | |
SU95746A1 (cs) | ||
DE60009638T2 (de) | Gegenüber Calciumionen stabile photographische Farbentwicklungszusammensetzung sowie Verfahren zu ihrer Verwendung | |
US4363873A (en) | Photographic contrast enhancers | |
DE3784051T2 (de) | Verfahren zur behandlung eines farbphotographischen silberhalogenidmaterials. | |
US2357395A (en) | Photographic emulsion | |
US2350138A (en) | Nondiffusing acylacetyl sulphonamide coupler | |
JPS6113748B2 (cs) | ||
EP0570973A1 (en) | Color photographic materials and methods containing DIR or DIAR couplers and phenolic coupler solvents | |
US3135609A (en) | 1-hydroxy-2-naphthamide couplers for color photography | |
US2496903A (en) | Photographic developer containing a negatively substituted aralkylamine and process of development | |
US4004926A (en) | Formation of azine dyes | |
US2688538A (en) | Photographic elements and process of color correction utilizing styryl dyes as couplers | |
US2197311A (en) | Color forming developer and process of color development | |
US3597203A (en) | Preparation of photographic colour images | |
JPS6228459B2 (cs) |