SU686626A3 - Способ получени полифениленоксидов - Google Patents
Способ получени полифениленоксидовInfo
- Publication number
- SU686626A3 SU686626A3 SU752159082A SU2159082A SU686626A3 SU 686626 A3 SU686626 A3 SU 686626A3 SU 752159082 A SU752159082 A SU 752159082A SU 2159082 A SU2159082 A SU 2159082A SU 686626 A3 SU686626 A3 SU 686626A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- manganese
- reaction
- chelate
- methanol
- xylenol
- Prior art date
Links
- 239000004721 Polyphenylene oxide Substances 0.000 title claims description 20
- 229920006380 polyphenylene oxide Polymers 0.000 title claims description 20
- 238000000034 method Methods 0.000 title claims description 19
- 239000011572 manganese Substances 0.000 claims description 49
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 40
- 229910052748 manganese Inorganic materials 0.000 claims description 37
- 239000003054 catalyst Substances 0.000 claims description 17
- 239000012429 reaction media Substances 0.000 claims description 15
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 11
- 229910052760 oxygen Inorganic materials 0.000 claims description 11
- 239000001301 oxygen Substances 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 9
- 150000003141 primary amines Chemical class 0.000 claims description 9
- 238000006068 polycondensation reaction Methods 0.000 claims description 8
- 150000002923 oximes Chemical class 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 230000001590 oxidative effect Effects 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 66
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 39
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 35
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 239000013522 chelant Substances 0.000 description 29
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 22
- -1 polyphenyleneoxy Polymers 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- 238000006116 polymerization reaction Methods 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 15
- 229920000642 polymer Polymers 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- 235000011121 sodium hydroxide Nutrition 0.000 description 10
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 8
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 8
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 8
- 235000002867 manganese chloride Nutrition 0.000 description 8
- 239000011565 manganese chloride Substances 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 7
- 239000003446 ligand Substances 0.000 description 7
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- 229940099607 manganese chloride Drugs 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 230000003197 catalytic effect Effects 0.000 description 5
- 238000009833 condensation Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- LIASWTUFJMBWEN-UHFFFAOYSA-N [Mn+] Chemical compound [Mn+] LIASWTUFJMBWEN-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003518 caustics Substances 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- VHRGRCVQAFMJIZ-UHFFFAOYSA-N cadaverine Chemical compound NCCCCCN VHRGRCVQAFMJIZ-UHFFFAOYSA-N 0.000 description 2
- 230000009849 deactivation Effects 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000002697 manganese compounds Chemical class 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- ORIHZIZPTZTNCU-YVMONPNESA-N salicylaldoxime Chemical compound O\N=C/C1=CC=CC=C1O ORIHZIZPTZTNCU-YVMONPNESA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- ZHGIKBCGOGBDFG-UHFFFAOYSA-N 1-icosylnaphthalene Chemical compound C1=CC=C2C(CCCCCCCCCCCCCCCCCCCC)=CC=CC2=C1 ZHGIKBCGOGBDFG-UHFFFAOYSA-N 0.000 description 1
- PZPVXSMCRLNVRD-UHFFFAOYSA-N 2,6-dibutylphenol Chemical class CCCCC1=CC=CC(CCCC)=C1O PZPVXSMCRLNVRD-UHFFFAOYSA-N 0.000 description 1
- METWAQRCMRWDAW-UHFFFAOYSA-N 2,6-diethylphenol Chemical compound CCC1=CC=CC(CC)=C1O METWAQRCMRWDAW-UHFFFAOYSA-N 0.000 description 1
- NAILKKRDWBJCNH-UHFFFAOYSA-N 2,6-dipropylphenol Chemical class CCCC1=CC=CC(CCC)=C1O NAILKKRDWBJCNH-UHFFFAOYSA-N 0.000 description 1
- CFPNMYCFVVUHHC-UHFFFAOYSA-N 2-(hydroxyiminomethyl)-4-methylphenol Chemical compound CC1=CC=C(O)C(C=NO)=C1 CFPNMYCFVVUHHC-UHFFFAOYSA-N 0.000 description 1
- LGXALNHIJRTPIM-UHFFFAOYSA-N 2-(hydroxyiminomethyl)phenol manganese(2+) Chemical compound [Mn+2].ON=CC1=CC=CC=C1O.ON=CC1=CC=CC=C1O LGXALNHIJRTPIM-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical compound C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- QPIOXOJERGNNMX-UHFFFAOYSA-N 3-(3-aminopropylsulfanyl)propan-1-amine Chemical compound NCCCSCCCN QPIOXOJERGNNMX-UHFFFAOYSA-N 0.000 description 1
- POTQBGGWSWSMCX-UHFFFAOYSA-N 3-[2-(3-aminopropoxy)ethoxy]propan-1-amine Chemical compound NCCCOCCOCCCN POTQBGGWSWSMCX-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- WYHSHHJLHFEEFE-UHFFFAOYSA-N 4-(4-aminophenyl)-6,6-dimethylcyclohexa-1,3-dien-1-amine Chemical compound C1=C(N)C(C)(C)CC(C=2C=CC(N)=CC=2)=C1 WYHSHHJLHFEEFE-UHFFFAOYSA-N 0.000 description 1
- IPDXWXPSCKSIII-UHFFFAOYSA-N 4-propan-2-ylbenzene-1,3-diamine Chemical compound CC(C)C1=CC=C(N)C=C1N IPDXWXPSCKSIII-UHFFFAOYSA-N 0.000 description 1
- MFRKYEJMLQUSJX-UHFFFAOYSA-N 4-propan-2-ylcyclohexan-1-amine Chemical compound CC(C)C1CCC(N)CC1 MFRKYEJMLQUSJX-UHFFFAOYSA-N 0.000 description 1
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- RXJCFNJCINLTNC-UHFFFAOYSA-N COC(CCN)CCCN.CN(CCCN)CCCN Chemical compound COC(CCN)CCCN.CN(CCCN)CCCN RXJCFNJCINLTNC-UHFFFAOYSA-N 0.000 description 1
- 101100346198 Caenorhabditis elegans mpc-2 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- QLBRROYTTDFLDX-UHFFFAOYSA-N [3-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCCC(CN)C1 QLBRROYTTDFLDX-UHFFFAOYSA-N 0.000 description 1
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 150000004984 aromatic diamines Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000006849 chlorophenylene group Chemical group 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 125000004367 cycloalkylaryl group Chemical group 0.000 description 1
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910001437 manganese ion Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- KFIGICHILYTCJF-UHFFFAOYSA-N n'-methylethane-1,2-diamine Chemical compound CNCCN KFIGICHILYTCJF-UHFFFAOYSA-N 0.000 description 1
- DKAABRFYCBBONX-UHFFFAOYSA-N n-methyl-3-propylnaphthalen-1-amine Chemical compound C1=CC=CC2=CC(CCC)=CC(NC)=C21 DKAABRFYCBBONX-UHFFFAOYSA-N 0.000 description 1
- KQSABULTKYLFEV-UHFFFAOYSA-N naphthalene-1,5-diamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1N KQSABULTKYLFEV-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920001955 polyphenylene ether Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/34—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives
- C08G65/38—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols
- C08G65/44—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols by oxidation of phenols
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyethers (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Lubricants (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/491,475 US3972851A (en) | 1974-07-24 | 1974-07-24 | Preparation of polyphenylene oxide using a manganese(II) ortho-hydroxyarene-oxime chelate reaction promoter |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU686626A3 true SU686626A3 (ru) | 1979-09-15 |
Family
ID=23952395
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU752159082A SU686626A3 (ru) | 1974-07-24 | 1975-07-24 | Способ получени полифениленоксидов |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3972851A (OSRAM) |
| JP (1) | JPS5921894B2 (OSRAM) |
| BE (1) | BE831664A (OSRAM) |
| CA (1) | CA1066846A (OSRAM) |
| DE (1) | DE2528045C2 (OSRAM) |
| DK (1) | DK336375A (OSRAM) |
| FR (1) | FR2279788A1 (OSRAM) |
| GB (1) | GB1518186A (OSRAM) |
| IT (1) | IT1039995B (OSRAM) |
| NL (1) | NL7508815A (OSRAM) |
| SE (1) | SE7508406L (OSRAM) |
| SU (1) | SU686626A3 (OSRAM) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4054553A (en) * | 1975-06-02 | 1977-10-18 | General Electric Company | Polyphenylene oxide process |
| US4097462A (en) * | 1976-01-23 | 1978-06-27 | General Electric Company | Process for making polyphenylene oxides |
| US4075174A (en) * | 1976-12-21 | 1978-02-21 | General Electric Company | Promotion of manganese chelate catalyzed polyphenylene ether oxide polymerization reactions |
| US4427594A (en) | 1976-12-21 | 1984-01-24 | General Electric Company | Oxidative coupling of phenolic monomers with manganese complexes of phenyl benzoin oxime catalysts |
| US4093598A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Oxidative coupling of phenolic monomers in the presence of manganese complexes of manganese phenyl benzoin oxime catalysts |
| US4093597A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Polymerization of 2,6-di-substituted phenols |
| US4093596A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Method for polymerization of polyphenylene oxides |
| US4098766A (en) * | 1977-04-14 | 1978-07-04 | Ici Americas Inc. | Method of oxidatively coupling alkyl phenols utilizing a tetravalent manganese-carbon catalyst |
| US4196278A (en) * | 1977-12-29 | 1980-04-01 | General Electric Company | Method for the controlled polymerization of polyphenylene oxide polymers |
| US4226951A (en) * | 1978-06-19 | 1980-10-07 | General Electric Company | Block polymers of polyphenylene oxide and polystyrene |
| US4335234A (en) * | 1979-10-24 | 1982-06-15 | General Electric Company | Use of manganese chelate to oxidatively couple phenolic compound in a self-precipitating system |
| US4385168A (en) * | 1981-03-06 | 1983-05-24 | Sumitomo Chemical Company, Limited | Process for producing polyphenylene oxide |
| JPS58114842A (ja) * | 1981-12-28 | 1983-07-08 | Yamazaki Mazak Corp | 数値制御工作機械に於ける工具寿命管理方法 |
| JPS59115124A (ja) * | 1982-12-22 | 1984-07-03 | Mitsubishi Electric Corp | 放電加工装置 |
| JPS59142046A (ja) * | 1983-02-04 | 1984-08-15 | Ikegai Corp | 工具寿命の管理方法及び装置 |
| JPS609638A (ja) * | 1983-06-30 | 1985-01-18 | Toyoda Mach Works Ltd | 工具寿命検出方法 |
| DE3504646A1 (de) | 1985-02-12 | 1986-08-14 | Basf Ag, 6700 Ludwigshafen | Halogenfreie, selbstverloeschende thermoplastische formmasse |
| JPS61249248A (ja) * | 1985-04-24 | 1986-11-06 | Hitachi Metals Ltd | 刃具寿命管理装置 |
| JPS63295157A (ja) * | 1987-05-26 | 1988-12-01 | Fanuc Ltd | 数値制御装置 |
| JPS6434636A (en) * | 1987-07-29 | 1989-02-06 | Fanuc Ltd | Tool life control system |
| JPH01146644A (ja) * | 1987-12-02 | 1989-06-08 | Fanuc Ltd | 加工セル工具の補修情報指示装置 |
| JPH033757A (ja) * | 1989-05-30 | 1991-01-09 | Fanuc Ltd | 切削負荷管理方式 |
| JPH03245949A (ja) * | 1990-02-26 | 1991-11-01 | Fanuc Ltd | 工具寿命管理方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1570458A1 (de) * | 1965-07-14 | 1969-09-18 | Dynamit Nobel Ag | Verfahren zur Herstellung von Polyphenylenoxyden |
| US3825521A (en) * | 1971-07-31 | 1974-07-23 | Asahi Dow Ltd | Manganese amine chelate catalyzed aromatic polyether formation |
-
1974
- 1974-07-24 US US05/491,475 patent/US3972851A/en not_active Expired - Lifetime
-
1975
- 1975-06-24 DE DE2528045A patent/DE2528045C2/de not_active Expired
- 1975-06-26 CA CA230,753A patent/CA1066846A/en not_active Expired
- 1975-07-08 GB GB28718/75A patent/GB1518186A/en not_active Expired
- 1975-07-23 SE SE7508406A patent/SE7508406L/xx unknown
- 1975-07-23 IT IT25662/75A patent/IT1039995B/it active
- 1975-07-23 BE BE158550A patent/BE831664A/xx unknown
- 1975-07-23 NL NL7508815A patent/NL7508815A/xx not_active Application Discontinuation
- 1975-07-24 FR FR7523171A patent/FR2279788A1/fr active Granted
- 1975-07-24 SU SU752159082A patent/SU686626A3/ru active
- 1975-07-24 JP JP50089689A patent/JPS5921894B2/ja not_active Expired
- 1975-07-24 DK DK336375A patent/DK336375A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| NL7508815A (nl) | 1976-01-27 |
| DE2528045A1 (de) | 1976-02-05 |
| SE7508406L (sv) | 1976-01-26 |
| IT1039995B (it) | 1979-12-10 |
| BE831664A (fr) | 1975-11-17 |
| FR2279788B1 (OSRAM) | 1981-08-28 |
| JPS5921894B2 (ja) | 1984-05-23 |
| CA1066846A (en) | 1979-11-20 |
| JPS5134995A (OSRAM) | 1976-03-25 |
| DK336375A (da) | 1976-01-25 |
| US3972851A (en) | 1976-08-03 |
| GB1518186A (en) | 1978-07-19 |
| DE2528045C2 (de) | 1984-07-12 |
| FR2279788A1 (fr) | 1976-02-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU686626A3 (ru) | Способ получени полифениленоксидов | |
| US3956242A (en) | Preparation of polyphenylene oxide using a manganese (II) ω-hydroxyoxime chelate reaction promoter | |
| SU649325A3 (ru) | Способ получени полифениленоксида | |
| US4011200A (en) | Novel polyphenylene ether and process for preparing the same | |
| US3970640A (en) | Process for the production of polyphenylene ethers having a desired polymerization degree | |
| US3965069A (en) | Polyphenylene oxide is prepared using a mixture of manganese chelates as a catalyst | |
| US3337501A (en) | Manganese and cobalt salt-amine complex catalysts in polyphenylene ether formation | |
| US3444133A (en) | Cobalt chelate catalysts in the production of polyphenylene oxides | |
| US5250486A (en) | Polyphenylene ether process and resin composition | |
| US4287321A (en) | Poly(phenylene ether)poly(vinyl aromatic) compositions | |
| US4075174A (en) | Promotion of manganese chelate catalyzed polyphenylene ether oxide polymerization reactions | |
| US4097462A (en) | Process for making polyphenylene oxides | |
| US4184034A (en) | Manganese benzoin-imine catalysts and process of preparing polyphenylene ethers using said compounds as catalysts | |
| US4093597A (en) | Polymerization of 2,6-di-substituted phenols | |
| US7649075B2 (en) | Process for preparing polyphenylene ether | |
| US3793246A (en) | Process for producing aromatic polyethers | |
| US5037943A (en) | Polyphenylene ether process and resin composition | |
| US4340696A (en) | Formal-coupled polyphenylene oxides | |
| US4093596A (en) | Method for polymerization of polyphenylene oxides | |
| US4032512A (en) | Process for the preparation of polyphenylene ethers at elevated pressure | |
| CA1239940A (en) | Copper (i)-phenoxides useful in polyphenylene oxide preparation | |
| US4102865A (en) | Moderation of manganese chelate catalyzed polymerization of phenolic monomers with polyfunctional alkanolamines | |
| KR940009243A (ko) | 저 미립자 함량의 폴리페닐렌 에테르 제조방법 | |
| US4205007A (en) | Manganese complexes of salicyl-aldehyde-alkanolimines as catalysts for the polymerization of 2,6-di-substituted phenols | |
| US3989671A (en) | Process for producing polyphenylene oxides |