SU646875A3 - "Способ регулировани роста растений - Google Patents
"Способ регулировани роста растенийInfo
- Publication number
- SU646875A3 SU646875A3 SU762357804A SU2357804A SU646875A3 SU 646875 A3 SU646875 A3 SU 646875A3 SU 762357804 A SU762357804 A SU 762357804A SU 2357804 A SU2357804 A SU 2357804A SU 646875 A3 SU646875 A3 SU 646875A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- plants
- plant growth
- growth regulator
- sugar
- active ingredient
- Prior art date
Links
- 239000005648 plant growth regulator Substances 0.000 title 1
- 239000004480 active ingredient Substances 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 10
- 239000000203 mixture Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 4
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000003306 harvesting Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- TXOKQMSSJAIOPM-UHFFFAOYSA-N 2-(2-oxo-1,3-benzothiazol-3-yl)acetonitrile Chemical compound C1=CC=C2N(CC#N)C(=O)SC2=C1 TXOKQMSSJAIOPM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000007979 thiazole derivatives Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/576,512 US3993468A (en) | 1975-05-12 | 1975-05-12 | Use of 3-substituted benzothiazolines as plant growth regulants |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU646875A3 true SU646875A3 (ru) | 1979-02-05 |
Family
ID=24304735
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU762357804A SU646875A3 (ru) | 1975-05-12 | 1976-05-11 | "Способ регулировани роста растений |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3993468A (enExample) |
| AR (1) | AR220668A1 (enExample) |
| AU (1) | AU501111B2 (enExample) |
| BE (1) | BE841692A (enExample) |
| BR (1) | BR7602932A (enExample) |
| CS (1) | CS188136B2 (enExample) |
| DD (1) | DD124944A5 (enExample) |
| DE (1) | DE2620789A1 (enExample) |
| EG (1) | EG12036A (enExample) |
| FR (1) | FR2310699A1 (enExample) |
| GB (1) | GB1501825A (enExample) |
| HU (1) | HU177691B (enExample) |
| IT (1) | IT1060037B (enExample) |
| MX (1) | MX7002E (enExample) |
| NL (1) | NL164730C (enExample) |
| PH (1) | PH11534A (enExample) |
| PL (1) | PL97902B1 (enExample) |
| SU (1) | SU646875A3 (enExample) |
| ZA (1) | ZA762798B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2823424C2 (ru) * | 2019-04-04 | 2024-07-23 | Юпл Лтд | Способ повышения содержания сахара в растении |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE31068E (en) * | 1976-10-26 | 1982-10-26 | Monsanto Company | Substituted benzothiazolines and their use as plant growth regulants |
| US4075216A (en) * | 1976-10-26 | 1978-02-21 | Monsanto Company | Certain benzothiazolin-2-one derivatives |
| USRE32769E (en) * | 1976-10-26 | 1988-10-18 | Monsanto Company | Amides and hydrazides of 2-oxo-benzothiazoline-3-acetic acid |
| US4308052A (en) * | 1977-09-21 | 1981-12-29 | Monsanto Company | N-Substituted benzothiazolines substituted with thiol esters useful as herbicides and plant growth regulants |
| US4323677A (en) * | 1977-12-16 | 1982-04-06 | Monsanto Company | N-Amides of 2-benzothiazolinone |
| CA1097634A (en) * | 1977-12-16 | 1981-03-17 | John J. D'amico | N-amides of 2-benzothiazolinone |
| US4187097A (en) * | 1977-12-16 | 1980-02-05 | Monsanto Company | N-hydrazides of 2-benzothiazolinone as plant growth regulants |
| US4210439A (en) * | 1977-12-22 | 1980-07-01 | Monsanto Company | N-Substituted oxobenzothiazolines and their use as plant growth regulators |
| US4171213A (en) * | 1978-05-18 | 1979-10-16 | Monsanto Company | N-substituted oxybenzothiazoline derivatives and their use as plant growth regulants |
| US4227915A (en) * | 1978-05-18 | 1980-10-14 | Monsanto Company | N-Substituted oxobenzothiazoline and oxobenzoxazoline derivatives and their use as plant growth regulants |
| US4228292A (en) * | 1978-07-20 | 1980-10-14 | Monsanto Company | N-Substituted benzothiazolines and benzoxazolines and their use as herbicides and plant growth regulants |
| US4185990A (en) * | 1978-08-28 | 1980-01-29 | Monsanto Company | Imides derived from 2-oxo-3-benzothiazolineacetic acid and butyric acid |
| IL60469A0 (en) * | 1979-07-05 | 1980-09-16 | Monsanto Co | Derivatives of 2-thioxo-3-benzothiazoline acetonitrile and their use as leguminous plant growth regulants |
| US4283220A (en) * | 1979-08-23 | 1981-08-11 | Monsanto Company | Imidamides derived from 2-oxo-3-benzothiazoline acetic acid plant growth regulants |
| US4474965A (en) * | 1980-01-25 | 1984-10-02 | Monsanto Company | 3-Substituted aminoalkyl-2-benzothiazolinones |
| US4371388A (en) * | 1980-01-25 | 1983-02-01 | Monsanto Company | 3-Substituted aminoalkyl-2-benzothiazolinones as plant growth regulants |
| US4731451A (en) * | 1980-03-25 | 1988-03-15 | Monsanto Company | N-((2-oxo-3(2H)benzothiazolyl)methyl)-2-chloroacetanilides |
| US4790868A (en) * | 1986-03-17 | 1988-12-13 | Ppg Industries, Inc. | Herbicidally active substituted phenoxy or phenylthio benzoxazolone (or benzthiazolone) compounds |
| FR2674524B1 (fr) * | 1991-03-25 | 1993-05-21 | Adir | Nouveaux amides alkyl heterocycliques, leur procede de preparation et les compositions pharmaceutiques qui les contiennent. |
-
1975
- 1975-05-12 US US05/576,512 patent/US3993468A/en not_active Expired - Lifetime
-
1976
- 1976-05-09 EG EG274/76A patent/EG12036A/xx active
- 1976-05-10 NL NL7604959.A patent/NL164730C/xx not_active IP Right Cessation
- 1976-05-11 DD DD192781A patent/DD124944A5/xx unknown
- 1976-05-11 AR AR263251A patent/AR220668A1/es active
- 1976-05-11 BR BR2932/76A patent/BR7602932A/pt unknown
- 1976-05-11 PL PL1976189459A patent/PL97902B1/pl unknown
- 1976-05-11 GB GB19329/76A patent/GB1501825A/en not_active Expired
- 1976-05-11 ZA ZA762798A patent/ZA762798B/xx unknown
- 1976-05-11 PH PH18424A patent/PH11534A/en unknown
- 1976-05-11 DE DE19762620789 patent/DE2620789A1/de not_active Withdrawn
- 1976-05-11 MX MX76225U patent/MX7002E/es unknown
- 1976-05-11 CS CS763155A patent/CS188136B2/cs unknown
- 1976-05-11 FR FR7614122A patent/FR2310699A1/fr active Granted
- 1976-05-11 AU AU13820/76A patent/AU501111B2/en not_active Expired
- 1976-05-11 BE BE166920A patent/BE841692A/xx not_active IP Right Cessation
- 1976-05-11 HU HU76MO959A patent/HU177691B/hu unknown
- 1976-05-11 SU SU762357804A patent/SU646875A3/ru active
- 1976-05-11 IT IT23156/76A patent/IT1060037B/it active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2823424C2 (ru) * | 2019-04-04 | 2024-07-23 | Юпл Лтд | Способ повышения содержания сахара в растении |
Also Published As
| Publication number | Publication date |
|---|---|
| AR220668A1 (es) | 1980-11-28 |
| NL7604959A (nl) | 1976-11-16 |
| HU177691B (en) | 1981-12-28 |
| CS188136B2 (en) | 1979-02-28 |
| NL164730B (nl) | 1980-09-15 |
| BR7602932A (pt) | 1976-11-23 |
| FR2310699B1 (enExample) | 1979-04-27 |
| GB1501825A (en) | 1978-02-22 |
| PH11534A (en) | 1978-03-10 |
| FR2310699A1 (fr) | 1976-12-10 |
| DE2620789A1 (de) | 1976-11-25 |
| EG12036A (en) | 1978-06-30 |
| NL164730C (nl) | 1981-02-16 |
| PL97902B1 (pl) | 1978-03-30 |
| DD124944A5 (enExample) | 1977-03-23 |
| MX7002E (es) | 1987-01-30 |
| BE841692A (fr) | 1976-11-12 |
| AU501111B2 (en) | 1979-06-14 |
| ZA762798B (en) | 1977-04-27 |
| IT1060037B (it) | 1982-07-10 |
| US3993468A (en) | 1976-11-23 |
| AU1382076A (en) | 1977-11-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU646875A3 (ru) | "Способ регулировани роста растений | |
| US4315765A (en) | Trialkylsulfonium salts of n-phosphonomethylglycine and their use as plant growth regulators and herbicides | |
| DE2513732C2 (enExample) | ||
| DE2643477C2 (enExample) | ||
| US4384880A (en) | Trialkylsulfonium salts of N-phosphonomethyl-glycine and their use as plant growth regulators and herbicides | |
| SU728687A3 (ru) | Способ борьбы с сорной растительностью | |
| DE2515113C2 (enExample) | ||
| KR900004906B1 (ko) | 농원예용 살균제 | |
| SU694044A3 (ru) | Состав дл регулировани роста растений | |
| US4437874A (en) | Tri-mixed alkylsulfonium salts of N-phosphonomethylgylcine and their use as plant growth regulators and herbicides | |
| US3932458A (en) | Antimicrobial and plant-active 4,5-dihalopyrrole-2-carbonitriles | |
| SU596149A3 (ru) | Гербицидна композици | |
| EP0150596A2 (en) | Method of controlling weeds using Salinomycin | |
| US3985539A (en) | 4,5-Dihalopyrrole-2-carbonitrile-containing terrestrial and aquatic hebicidal composition | |
| US4376644A (en) | Tri-mixed alkylsulfonium salts of N-phosphonomethylglycine and their use as plant growth regulators and herbicides | |
| US3116994A (en) | Inhibiting plant growth with 6-azauracil and salts thereof | |
| SU654146A3 (ru) | Средство дл торможени роста растений | |
| US4280832A (en) | Pyridyloxy-phenoxyalkane carboxylic acids and derivatives as sugar enhancers for plants | |
| US4284425A (en) | Method of increasing the recoverable sugar from sugar beets | |
| HU184234B (en) | Preparations for controlling the plant growth | |
| SU698512A3 (ru) | Гербицидна композици | |
| US3994715A (en) | Vanillin as ripener for sugarcane | |
| SU1111673A3 (ru) | Способ борьбы с сорн ками | |
| EP0230207B1 (en) | Triazine derivative, its preparation and use | |
| US4486222A (en) | Herbicide composition and process for the preparation of the active ingredients herbicidal phenyl carbonates |