SU561492A3 - Добавка к корму или питьевой воде дл домашней птицы - Google Patents
Добавка к корму или питьевой воде дл домашней птицыInfo
- Publication number
- SU561492A3 SU561492A3 SU1488051A SU1488051A SU561492A3 SU 561492 A3 SU561492 A3 SU 561492A3 SU 1488051 A SU1488051 A SU 1488051A SU 1488051 A SU1488051 A SU 1488051A SU 561492 A3 SU561492 A3 SU 561492A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- hydrogen
- acid
- ester
- hydroxy
- feed
- Prior art date
Links
- 239000000654 additive Substances 0.000 title claims description 12
- 230000000996 additive effect Effects 0.000 title claims description 9
- 239000003651 drinking water Substances 0.000 title claims description 6
- 235000020188 drinking water Nutrition 0.000 title claims description 6
- 244000144977 poultry Species 0.000 title claims description 4
- -1 trifluoromethyl mercapto group Chemical group 0.000 claims description 46
- 125000000217 alkyl group Chemical group 0.000 claims description 43
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 239000001257 hydrogen Substances 0.000 claims description 32
- 239000002253 acid Substances 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 22
- 150000002148 esters Chemical class 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 17
- 125000001931 aliphatic group Chemical group 0.000 claims description 16
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 125000003342 alkenyl group Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 150000004820 halides Chemical class 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims 19
- 239000000203 mixture Substances 0.000 claims 16
- 150000002431 hydrogen Chemical class 0.000 claims 15
- 231100000252 nontoxic Toxicity 0.000 claims 14
- 230000003000 nontoxic effect Effects 0.000 claims 14
- 125000004494 ethyl ester group Chemical group 0.000 claims 9
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 6
- 239000013543 active substance Substances 0.000 claims 6
- 125000005907 alkyl ester group Chemical group 0.000 claims 5
- 150000007513 acids Chemical class 0.000 claims 4
- 239000003513 alkali Substances 0.000 claims 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 3
- 244000068988 Glycine max Species 0.000 claims 3
- 235000010469 Glycine max Nutrition 0.000 claims 3
- 235000013305 food Nutrition 0.000 claims 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 claims 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims 2
- 240000008042 Zea mays Species 0.000 claims 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 claims 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims 2
- 150000001408 amides Chemical class 0.000 claims 2
- 150000003863 ammonium salts Chemical class 0.000 claims 2
- 229910052791 calcium Inorganic materials 0.000 claims 2
- 239000011575 calcium Substances 0.000 claims 2
- 125000001589 carboacyl group Chemical group 0.000 claims 2
- 235000005822 corn Nutrition 0.000 claims 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims 2
- 235000013312 flour Nutrition 0.000 claims 2
- 150000002430 hydrocarbons Chemical group 0.000 claims 2
- 150000004702 methyl esters Chemical class 0.000 claims 2
- 150000002825 nitriles Chemical class 0.000 claims 2
- 229910052757 nitrogen Inorganic materials 0.000 claims 2
- 125000005447 octyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 claims 2
- 125000005429 oxyalkyl group Chemical group 0.000 claims 2
- 102000004169 proteins and genes Human genes 0.000 claims 2
- 108090000623 proteins and genes Proteins 0.000 claims 2
- 239000002904 solvent Substances 0.000 claims 2
- 229940088594 vitamin Drugs 0.000 claims 2
- 239000011782 vitamin Substances 0.000 claims 2
- 238000005406 washing Methods 0.000 claims 2
- AGWCYWWMYBRXRH-UHFFFAOYSA-N 2-dodecoxy-4-oxo-1H-quinoline-3-carboxylic acid Chemical compound CCCCCCCCCCCCOC1=C(C(=O)C2=CC=CC=C2N1)C(=O)O AGWCYWWMYBRXRH-UHFFFAOYSA-N 0.000 claims 1
- XOQQVKDBGLYPGH-UHFFFAOYSA-N 2-oxo-1h-quinoline-3-carboxylic acid Chemical compound C1=CC=C2NC(=O)C(C(=O)O)=CC2=C1 XOQQVKDBGLYPGH-UHFFFAOYSA-N 0.000 claims 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims 1
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- ZAKOWWREFLAJOT-CEFNRUSXSA-N D-alpha-tocopherylacetate Chemical compound CC(=O)OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C ZAKOWWREFLAJOT-CEFNRUSXSA-N 0.000 claims 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 claims 1
- 235000019733 Fish meal Nutrition 0.000 claims 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims 1
- 240000004658 Medicago sativa Species 0.000 claims 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 claims 1
- 241001465754 Metazoa Species 0.000 claims 1
- 241000521582 Paralvinella palmiformis Species 0.000 claims 1
- 206010033799 Paralysis Diseases 0.000 claims 1
- AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 claims 1
- 239000005862 Whey Substances 0.000 claims 1
- 102000007544 Whey Proteins Human genes 0.000 claims 1
- 108010046377 Whey Proteins Proteins 0.000 claims 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims 1
- 239000003674 animal food additive Substances 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- ZAKOWWREFLAJOT-UHFFFAOYSA-N d-alpha-Tocopheryl acetate Natural products CC(=O)OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C ZAKOWWREFLAJOT-UHFFFAOYSA-N 0.000 claims 1
- 125000006612 decyloxy group Chemical group 0.000 claims 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 1
- DLLJVQNYBYOKGS-UHFFFAOYSA-N ethoxyethane;pentane Chemical compound CCCCC.CCOCC DLLJVQNYBYOKGS-UHFFFAOYSA-N 0.000 claims 1
- 238000000605 extraction Methods 0.000 claims 1
- 239000004467 fishmeal Substances 0.000 claims 1
- 238000005188 flotation Methods 0.000 claims 1
- 230000002641 glycemic effect Effects 0.000 claims 1
- 239000007970 homogeneous dispersion Substances 0.000 claims 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- 229910052748 manganese Inorganic materials 0.000 claims 1
- 239000011572 manganese Substances 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- 239000000155 melt Substances 0.000 claims 1
- 229930182817 methionine Natural products 0.000 claims 1
- 150000004682 monohydrates Chemical class 0.000 claims 1
- 239000011734 sodium Substances 0.000 claims 1
- 239000011780 sodium chloride Substances 0.000 claims 1
- 235000012424 soybean oil Nutrition 0.000 claims 1
- 239000003549 soybean oil Substances 0.000 claims 1
- 238000003756 stirring Methods 0.000 claims 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 claims 1
- 229940124530 sulfonamide Drugs 0.000 claims 1
- 239000013589 supplement Substances 0.000 claims 1
- 229940042585 tocopherol acetate Drugs 0.000 claims 1
- 229930003231 vitamin Natural products 0.000 claims 1
- 235000013343 vitamin Nutrition 0.000 claims 1
- 150000003722 vitamin derivatives Chemical class 0.000 claims 1
- 239000011701 zinc Substances 0.000 claims 1
- 229910052725 zinc Inorganic materials 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 125000003396 thiol group Chemical group [H]S* 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005976 1-phenylethyloxy group Chemical group 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005975 2-phenylethyloxy group Chemical group 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004030 farnesyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])C([H])([H])C([H])=C(C([H])([H])[H])C([H])([H])C([H])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002350 geranyl group Chemical group [H]C([*])([H])/C([H])=C(C([H])([H])[H])/C([H])([H])C([H])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005505 thiomorpholino group Chemical group 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/233—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 4
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23K—FODDER
- A23K20/00—Accessory food factors for animal feeding-stuffs
- A23K20/10—Organic substances
- A23K20/116—Heterocyclic compounds
- A23K20/132—Heterocyclic compounds containing only one nitrogen as hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/44—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by —CHO groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/205—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring the aromatic ring being a non-condensed ring
- C07C43/2055—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring the aromatic ring being a non-condensed ring containing more than one ether bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/008—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with tri- or tetrahalomethyl compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Polymers & Plastics (AREA)
- Life Sciences & Earth Sciences (AREA)
- Zoology (AREA)
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Husbandry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Fodder In General (AREA)
- Feed For Specific Animals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Physical Water Treatments (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US73696268A | 1968-06-14 | 1968-06-14 | |
| US77042668A | 1968-10-24 | 1968-10-24 | |
| US80833369A | 1969-03-18 | 1969-03-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU561492A3 true SU561492A3 (ru) | 1977-06-05 |
Family
ID=27419219
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1488051A SU561492A3 (ru) | 1968-06-14 | 1970-10-22 | Добавка к корму или питьевой воде дл домашней птицы |
Country Status (18)
| Country | Link |
|---|---|
| JP (1) | JPS504673B1 (OSRAM) |
| AT (2) | AT319725B (OSRAM) |
| BE (1) | BE734566A (OSRAM) |
| CH (2) | CH560193A5 (OSRAM) |
| DE (1) | DE1929165A1 (OSRAM) |
| ES (1) | ES368288A2 (OSRAM) |
| FI (1) | FI49407C (OSRAM) |
| FR (1) | FR2010879B1 (OSRAM) |
| GB (2) | GB1270412A (OSRAM) |
| IE (1) | IE33810B1 (OSRAM) |
| IL (1) | IL32362A0 (OSRAM) |
| KE (2) | KE2547A (OSRAM) |
| MY (2) | MY7500153A (OSRAM) |
| NL (1) | NL6908370A (OSRAM) |
| NO (2) | NO132868C (OSRAM) |
| RO (1) | RO56838A (OSRAM) |
| SE (2) | SE387223B (OSRAM) |
| SU (1) | SU561492A3 (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1980001068A1 (fr) * | 1978-11-27 | 1980-05-29 | Orch Sinteza I | 3-(2,2,2-trimethylhydrazine) propionate, sa methode de production et son utilisation |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58219166A (ja) * | 1982-06-14 | 1983-12-20 | Nippon Shinyaku Co Ltd | 4−キノロン誘導体 |
| ES2019335B3 (es) * | 1986-08-29 | 1991-06-16 | American Cyanamid Co | Metodo para la preparacion de anilinofumarato y acido quinolein-2,3-dicarboxilico. |
| MXPA03011558A (es) | 2001-06-12 | 2004-03-26 | Wellstat Therapeutics Corp | Compuestos para el tratamiento de desordenes metabolicos. |
| WO2015148743A1 (en) * | 2014-03-26 | 2015-10-01 | The Procter & Gamble Company | Perfume systems |
-
1969
- 1969-05-12 CH CH724969A patent/CH560193A5/xx not_active IP Right Cessation
- 1969-06-02 NL NL6908370A patent/NL6908370A/xx not_active Application Discontinuation
- 1969-06-08 IL IL32362A patent/IL32362A0/xx unknown
- 1969-06-09 DE DE19691929165 patent/DE1929165A1/de active Pending
- 1969-06-10 FR FR6919073A patent/FR2010879B1/fr not_active Expired
- 1969-06-11 SE SE7206919A patent/SE387223B/xx unknown
- 1969-06-11 SE SE08293/69A patent/SE362424B/xx unknown
- 1969-06-11 IE IE800/69A patent/IE33810B1/xx unknown
- 1969-06-12 ES ES368288A patent/ES368288A2/es not_active Expired
- 1969-06-13 JP JP44046446A patent/JPS504673B1/ja active Pending
- 1969-06-13 AT AT01300/71A patent/AT319725B/de not_active IP Right Cessation
- 1969-06-13 FI FI691755A patent/FI49407C/fi active
- 1969-06-13 BE BE734566D patent/BE734566A/xx unknown
- 1969-06-13 AT AT563069A patent/AT301547B/de not_active IP Right Cessation
- 1969-06-13 NO NO2456/69A patent/NO132868C/no unknown
- 1969-06-14 RO RO60235A patent/RO56838A/ro unknown
- 1969-06-16 GB GB30403/69A patent/GB1270412A/en not_active Expired
- 1969-06-16 GB GB9653/70A patent/GB1270413A/en not_active Expired
-
1970
- 1970-10-22 SU SU1488051A patent/SU561492A3/ru active
-
1973
- 1973-03-16 NO NO1068/73A patent/NO137072C/no unknown
-
1974
- 1974-06-20 CH CH846174A patent/CH610732A5/xx not_active IP Right Cessation
-
1975
- 1975-07-16 KE KE2547*UA patent/KE2547A/xx unknown
- 1975-07-16 KE KE2548*UA patent/KE2548A/xx unknown
- 1975-12-30 MY MY153/75A patent/MY7500153A/xx unknown
- 1975-12-30 MY MY154/75A patent/MY7500154A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1980001068A1 (fr) * | 1978-11-27 | 1980-05-29 | Orch Sinteza I | 3-(2,2,2-trimethylhydrazine) propionate, sa methode de production et son utilisation |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS504673B1 (OSRAM) | 1975-02-22 |
| FI49407C (fi) | 1975-06-10 |
| GB1270413A (en) | 1972-04-12 |
| CH560193A5 (OSRAM) | 1975-03-27 |
| GB1270412A (en) | 1972-04-12 |
| MY7500153A (en) | 1975-12-31 |
| NL6908370A (OSRAM) | 1969-12-16 |
| AT301547B (de) | 1972-09-11 |
| AT319725B (de) | 1975-01-10 |
| NO132868C (OSRAM) | 1976-01-21 |
| IE33810L (en) | 1969-12-14 |
| SE387223B (sv) | 1976-09-06 |
| CH610732A5 (en) | 1979-05-15 |
| RO56838A (OSRAM) | 1975-03-15 |
| KE2548A (en) | 1975-08-01 |
| KE2547A (en) | 1975-08-01 |
| ES368288A2 (es) | 1971-05-01 |
| IE33810B1 (en) | 1974-11-13 |
| NO137072B (no) | 1977-09-19 |
| FR2010879B1 (OSRAM) | 1976-09-03 |
| IL32362A0 (en) | 1969-08-27 |
| BE734566A (OSRAM) | 1969-12-15 |
| FR2010879A1 (OSRAM) | 1970-02-20 |
| MY7500154A (en) | 1975-12-31 |
| SE362424B (OSRAM) | 1973-12-10 |
| NO132868B (OSRAM) | 1975-10-13 |
| NO137072C (no) | 1977-12-28 |
| FI49407B (OSRAM) | 1975-02-28 |
| DE1929165A1 (de) | 1969-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3463858A (en) | Organic zinc feed additive and method of making same | |
| SU682099A3 (ru) | Способ получени кормового средства | |
| SU561492A3 (ru) | Добавка к корму или питьевой воде дл домашней птицы | |
| US3373038A (en) | Estrogenic compounds and animal growth promoters | |
| JPS5529958A (en) | Feed for lobster | |
| SU1635955A1 (ru) | Способ приготовлени корма дл сельскохоз йственной птицы | |
| US3021216A (en) | Animal feed compositions | |
| IL23314A (en) | Esters of the antibiotic pleuro-mutilin,their production and animal feed supplement containing same | |
| US4071534A (en) | Process for producing l-ascorbic acid-2-sulfate | |
| US4282228A (en) | Animal feed and process | |
| JP3148318B2 (ja) | 反すう動物の飼育方法 | |
| US4316901A (en) | Animal feed and process | |
| US3008873A (en) | Controlled particle size of 4, 4-dinitrocarbanilide | |
| SU1709909A3 (ru) | Способ получени производных /2-тиенилметил/-тиомочевины | |
| US3373032A (en) | Estrogenic compounds and animal growth promoters | |
| US3803315A (en) | Animal feed and process | |
| US2860049A (en) | Method and composition for increasing animal growth rate | |
| US3915966A (en) | Morpholino zearalins | |
| SU745480A1 (ru) | Способ получени кормовой добавки | |
| DE2501875A1 (de) | Alkylsulfonylmethyl- und alkylsulfinylmethylchinoxalin-1,4-dioxide | |
| US2941884A (en) | Animal feeds, animal feed supplements, and methods | |
| US4070377A (en) | Process for producing L-ascorbic acid-2-sulfate | |
| IL23409A (en) | New animal feed compositions comprising a phthalazinone derivative | |
| SU621305A3 (ru) | Кормова добавка дл птиц | |
| IE36437B1 (en) | Treatment of lignocellulose materials |