SU489354A3 - Способ крашени и набивки текстильных материалов - Google Patents
Способ крашени и набивки текстильных материаловInfo
- Publication number
- SU489354A3 SU489354A3 SU1776272A SU1776272A SU489354A3 SU 489354 A3 SU489354 A3 SU 489354A3 SU 1776272 A SU1776272 A SU 1776272A SU 1776272 A SU1776272 A SU 1776272A SU 489354 A3 SU489354 A3 SU 489354A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- weight
- dyeing
- group
- textile materials
- cii
- Prior art date
Links
- 239000000463 material Substances 0.000 title description 5
- 238000004043 dyeing Methods 0.000 title description 4
- 238000000034 method Methods 0.000 title description 3
- 239000004753 textile Substances 0.000 title description 2
- 239000000975 dye Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 125000003118 aryl group Chemical group 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- -1 6-hydroxy-2-pyridoyl Chemical class 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- AJHPGXZOIAYYDW-UHFFFAOYSA-N 3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=CC=C1C#N AJHPGXZOIAYYDW-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- LPXQRXLUHJKZIE-UHFFFAOYSA-N 8-azaguanine Chemical compound NC1=NC(O)=C2NN=NC2=N1 LPXQRXLUHJKZIE-UHFFFAOYSA-N 0.000 description 1
- 241001116389 Aloe Species 0.000 description 1
- 235000013912 Ceratonia siliqua Nutrition 0.000 description 1
- 240000008886 Ceratonia siliqua Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 101100134922 Gallus gallus COR5 gene Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 235000011399 aloe vera Nutrition 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000000779 depleting effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- LIBWRRJGKWQFSD-UHFFFAOYSA-M sodium;2-nitrobenzenesulfonate Chemical compound [Na+].[O-][N+](=O)C1=CC=CC=C1S([O-])(=O)=O LIBWRRJGKWQFSD-UHFFFAOYSA-M 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
- C09B29/3617—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom
- C09B29/3621—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring
- C09B29/3626—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O)
- C09B29/363—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O) from diazotized amino carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712120095 DE2120095A1 (de) | 1971-04-24 | 1971-04-24 | Wasserunlösliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU489354A3 true SU489354A3 (ru) | 1975-10-25 |
Family
ID=5805799
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1776272A SU489354A3 (ru) | 1971-04-24 | 1972-04-21 | Способ крашени и набивки текстильных материалов |
Country Status (15)
| Country | Link |
|---|---|
| AT (1) | AT309620B (enExample) |
| AU (1) | AU468752B2 (enExample) |
| BE (1) | BE782424A (enExample) |
| BR (1) | BR7202466D0 (enExample) |
| CA (1) | CA958006A (enExample) |
| CH (1) | CH566370A5 (enExample) |
| DD (1) | DD105623A5 (enExample) |
| DE (1) | DE2120095A1 (enExample) |
| ES (1) | ES402044A1 (enExample) |
| FR (1) | FR2134400B1 (enExample) |
| GB (1) | GB1388701A (enExample) |
| IT (1) | IT954842B (enExample) |
| NL (1) | NL7204977A (enExample) |
| SU (1) | SU489354A3 (enExample) |
| ZA (1) | ZA722696B (enExample) |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH471861A (de) * | 1968-01-18 | 1969-04-30 | Sandoz Ag | Verfahren zur Herstellung von Monoazoverbindungen |
| CH503781A (de) * | 1968-05-15 | 1971-02-28 | Sandoz Ag | Verfahren zur Herstellung von basischen Farbstoffen |
| DE1917278B2 (de) * | 1969-04-03 | 1974-06-27 | Basf Ag, 6700 Ludwigshafen | Monoazofarbstoffe, Verfahren zu deren Herstellung und Farbstoffzubereitungen |
-
1971
- 1971-04-24 DE DE19712120095 patent/DE2120095A1/de active Pending
-
1972
- 1972-04-13 NL NL7204977A patent/NL7204977A/xx not_active Application Discontinuation
- 1972-04-19 IT IT23410/72A patent/IT954842B/it active
- 1972-04-20 DD DD162445A patent/DD105623A5/xx unknown
- 1972-04-20 BR BR2466/72A patent/BR7202466D0/pt unknown
- 1972-04-20 BE BE782424A patent/BE782424A/xx unknown
- 1972-04-21 AU AU41455/72A patent/AU468752B2/en not_active Expired
- 1972-04-21 FR FR7214181A patent/FR2134400B1/fr not_active Expired
- 1972-04-21 ZA ZA722696A patent/ZA722696B/xx unknown
- 1972-04-21 SU SU1776272A patent/SU489354A3/ru active
- 1972-04-21 AT AT353272A patent/AT309620B/de not_active IP Right Cessation
- 1972-04-21 CA CA140,231A patent/CA958006A/en not_active Expired
- 1972-04-24 CH CH604672A patent/CH566370A5/xx not_active IP Right Cessation
- 1972-04-24 ES ES402044A patent/ES402044A1/es not_active Expired
- 1972-04-24 GB GB1883872A patent/GB1388701A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT309620B (de) | 1973-08-27 |
| DE2120095A1 (de) | 1972-11-02 |
| AU4145572A (en) | 1973-10-25 |
| ZA722696B (en) | 1973-02-28 |
| CH566370A5 (enExample) | 1975-09-15 |
| AU468752B2 (en) | 1976-01-22 |
| BE782424A (fr) | 1972-10-20 |
| DD105623A5 (enExample) | 1974-05-05 |
| CA958006A (en) | 1974-11-19 |
| GB1388701A (en) | 1975-03-26 |
| NL7204977A (enExample) | 1972-10-26 |
| FR2134400B1 (enExample) | 1974-12-20 |
| IT954842B (it) | 1973-09-15 |
| FR2134400A1 (enExample) | 1972-12-08 |
| BR7202466D0 (pt) | 1973-06-12 |
| ES402044A1 (es) | 1975-11-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH652736A5 (it) | Sali di coloranti basici, loro preparazione ed impieghi. | |
| JPH0579705B2 (enExample) | ||
| SU489354A3 (ru) | Способ крашени и набивки текстильных материалов | |
| US3148180A (en) | Thiazole azo compounds | |
| US3458880A (en) | Polyester and polyamide fiber dyeing with 7-amino-coumarins | |
| US2844594A (en) | 3-aryl-7-dialkylaminocoumarins | |
| US2547910A (en) | Acylated derivatives of certain diamino distyrylbenzene disulfonic acids | |
| GB2027733A (en) | Navy Blue Disperse Dyes, Dyeing Preparations and Compositions Containing Them, Process for Their Preparation and Their Use for the Dyeing or Printing of Synthetic Fibre Materials | |
| US2793192A (en) | Optical bleaching compositions containing tertiary amino substituted 2-aryl aryleneazoles | |
| US3342799A (en) | N-heterocyclic monoazo azo dyes | |
| US3253876A (en) | Textile dyeing using disazo dyes | |
| US2865916A (en) | Triazole brighteners | |
| US3980651A (en) | Water-insoluble barbituric acid-substituted naphthalactam dyestuff | |
| US2713056A (en) | Fluorescent whitening agents | |
| US2186629A (en) | Process of dyeing | |
| US3213081A (en) | Benzothiazole azo compounds | |
| US3839351A (en) | Triazolyl-coumarins | |
| US3547952A (en) | 7-mercapto-coumarins | |
| US2700043A (en) | Fluorescent whitening agents | |
| US2391179A (en) | Fluorine containing azo compounds | |
| US3101333A (en) | Stilbyl-acenaphthenotriazole | |
| US3058797A (en) | Process for the manufacture of fast black dyeings | |
| US2980697A (en) | Benzothiophene compounds | |
| US3254073A (en) | Disazo dyes for hydrophobic fibers | |
| US3380991A (en) | Thiazole azo aniline dyestuffs containing vinylsulfonylethyl groups |