SU439087A1 - - Google Patents
Info
- Publication number
- SU439087A1 SU439087A1 SU1773037A SU1773037A SU439087A1 SU 439087 A1 SU439087 A1 SU 439087A1 SU 1773037 A SU1773037 A SU 1773037A SU 1773037 A SU1773037 A SU 1773037A SU 439087 A1 SU439087 A1 SU 439087A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- optically active
- formula
- compound
- acid
- solution
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 description 20
- 239000000243 solution Substances 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- -1 alkaline earth metal salts Chemical class 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 150000002596 lactones Chemical class 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 2
- MLOSJPZSZWUDSK-UHFFFAOYSA-N 4-carboxybutyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CCCCC(=O)O)C1=CC=CC=C1 MLOSJPZSZWUDSK-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003180 prostaglandins Chemical class 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- WZUZROCCERRXFZ-UHFFFAOYSA-N sodium;bis(methylsulfinyl)methane Chemical compound [Na+].CS(=O)[CH-]S(C)=O WZUZROCCERRXFZ-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- QMGVPVSNSZLJIA-UHFFFAOYSA-N Nux Vomica Natural products C1C2C3C4N(C=5C6=CC=CC=5)C(=O)CC3OCC=C2CN2C1C46CC2 QMGVPVSNSZLJIA-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- RRKTZKIUPZVBMF-IBTVXLQLSA-N brucine Chemical compound O([C@@H]1[C@H]([C@H]2C3)[C@@H]4N(C(C1)=O)C=1C=C(C(=CC=11)OC)OC)CC=C2CN2[C@@H]3[C@]41CC2 RRKTZKIUPZVBMF-IBTVXLQLSA-N 0.000 description 1
- RRKTZKIUPZVBMF-UHFFFAOYSA-N brucine Natural products C1=2C=C(OC)C(OC)=CC=2N(C(C2)=O)C3C(C4C5)C2OCC=C4CN2C5C31CC2 RRKTZKIUPZVBMF-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 238000004810 partition chromatography Methods 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000004304 visual acuity Effects 0.000 description 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US13334271A | 1971-04-12 | 1971-04-12 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SU439087A1 true SU439087A1 (enrdf_load_stackoverflow) | 1974-08-05 |
| SU439087A3 SU439087A3 (enrdf_load_stackoverflow) | 1974-08-05 |
Family
ID=22458141
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1773037A SU439087A3 (enrdf_load_stackoverflow) | 1971-04-12 | 1972-04-11 | |
| SU721821458A SU628814A3 (ru) | 1971-04-12 | 1972-08-21 | Способ получени 16,16-дизамещенных аналогов простагландина |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU721821458A SU628814A3 (ru) | 1971-04-12 | 1972-08-21 | Способ получени 16,16-дизамещенных аналогов простагландина |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS5314551B1 (enrdf_load_stackoverflow) |
| AR (2) | AR194589A1 (enrdf_load_stackoverflow) |
| ES (1) | ES401665A1 (enrdf_load_stackoverflow) |
| FI (1) | FI54293C (enrdf_load_stackoverflow) |
| HU (2) | HU166656B (enrdf_load_stackoverflow) |
| IL (3) | IL47150A (enrdf_load_stackoverflow) |
| NO (3) | NO135936C (enrdf_load_stackoverflow) |
| PH (1) | PH10946A (enrdf_load_stackoverflow) |
| PL (2) | PL96861B1 (enrdf_load_stackoverflow) |
| SU (2) | SU439087A3 (enrdf_load_stackoverflow) |
| ZA (1) | ZA721936B (enrdf_load_stackoverflow) |
-
1972
- 1972-03-21 ZA ZA721936A patent/ZA721936B/xx unknown
- 1972-03-26 IL IL4715072A patent/IL47150A/en unknown
- 1972-03-26 IL IL39079A patent/IL39079A/en unknown
- 1972-03-26 IL IL4715172A patent/IL47151A/en unknown
- 1972-04-03 PH PH13409A patent/PH10946A/en unknown
- 1972-04-05 JP JP3358872A patent/JPS5314551B1/ja active Pending
- 1972-04-06 AR AR24133772A patent/AR194589A1/es active
- 1972-04-10 PL PL15464272A patent/PL96861B1/pl unknown
- 1972-04-10 PL PL18399072A patent/PL96666B1/pl unknown
- 1972-04-11 HU HUUO000081 patent/HU166656B/hu unknown
- 1972-04-11 SU SU1773037A patent/SU439087A3/ru active
- 1972-04-11 ES ES401665A patent/ES401665A1/es not_active Expired
- 1972-04-11 HU HUUO000075 patent/HU165856B/hu unknown
- 1972-04-11 NO NO122772A patent/NO135936C/no unknown
- 1972-04-11 FI FI101772A patent/FI54293C/fi active
- 1972-08-21 SU SU721821458A patent/SU628814A3/ru active
- 1972-11-27 NO NO434172A patent/NO138252C/no unknown
- 1972-11-27 NO NO434272A patent/NO140423C/no unknown
-
1973
- 1973-02-27 AR AR24682173A patent/AR194784A1/es active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU662008A3 (ru) | Способ получени оптически активных соединений р да простагландинов или их рацематов | |
| US3845042A (en) | 11-substituted-prostaglandin derivatives | |
| US3532721A (en) | Cyclopentyl-alkanoic acids | |
| CA1192903A (en) | 4,5-unsaturated prostanoic acid derivatives | |
| EP0134246B1 (en) | Prostacyclines and process for their preparation | |
| JPS6234027B2 (enrdf_load_stackoverflow) | ||
| SU439087A1 (enrdf_load_stackoverflow) | ||
| CA2012081C (en) | 2,5,6,7-tetranor-4,8-inter-m-phenylene pgi 2 derivatives | |
| GB1568017A (en) | Prostaglandins | |
| US4024181A (en) | Analogues of prostanoic acids | |
| DK147070B (da) | Analogifremgangsmaade til fremstilling af 13,14-dehydro-11-deoxy-prostaglandiner | |
| US4277401A (en) | Total synthesis of 1RS,4SR,5RS-4-(4,8-dimethyl)-5-hydroxy-7-nonen-1-yl)-4-methyl-3,8-dioxabicyclo[3.2.1]octane-1-acetic acid | |
| US4110532A (en) | 5-Hydroxy-PGI1 compounds | |
| US4958037A (en) | Precursors and synthesis of methyl-9-oxo-11α, 16-dihydroxy-16-vinyl-5-cis-13-trans-prostadienoates | |
| FR2515642A1 (fr) | Nouvelles (11r)-11-deoxy-11-alkyl-6-oxo-prostaglandines et compositions pharmaceutiques les contenant | |
| US4202972A (en) | Δ2 -Prostacyclin analogs | |
| JPS5921864B2 (ja) | フルオロプロスタグランジン及びその製造法 | |
| US3991080A (en) | Prostaglandin intermediates | |
| US3975406A (en) | Hexahydro-5-oxy-2-loweralkoxy-2H-cyclopenta[b]-furan-4-carbonitrile intermediates for prostaglandins | |
| US4985571A (en) | 6-membered lactones useful as intermediates for antilipemic mevalonic acid lactones | |
| SU843736A3 (ru) | Способ получени оптически активныхпРОСТАглАНдиНОВ или иХ ОпТичЕСКиХАНТипОдОВ, или иХ РАцЕМАТОВ | |
| US4122093A (en) | Process for preparing a lactone | |
| US3970674A (en) | Certain hexahydro-2-loweralkoxy-5-oxycyclopenta [b] furans containing an olefinic substituent in the 4-position | |
| US3974185A (en) | Hexahydro-cyclopentano[b]furans having a 2-C.tbd.C containing substituent in the 4-position | |
| CH659472A5 (de) | Epoxycarbacyclinderivate, ihre herstellung und verwendung. |