SU417416A1 - - Google Patents
Info
- Publication number
- SU417416A1 SU417416A1 SU1692659A SU1692659A SU417416A1 SU 417416 A1 SU417416 A1 SU 417416A1 SU 1692659 A SU1692659 A SU 1692659A SU 1692659 A SU1692659 A SU 1692659A SU 417416 A1 SU417416 A1 SU 417416A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mol
- alcohol
- potassium
- toluenesulfamide
- theory
- Prior art date
Links
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 5
- 125000003396 thiol group Chemical group [H]S* 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 4
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 4
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical class NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001414 amino alcohols Chemical class 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000005358 mercaptoalkyl group Chemical group 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 125000005490 tosylate group Chemical group 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- JYWKEVKEKOTYEX-UHFFFAOYSA-N 2,6-dibromo-4-chloroiminocyclohexa-2,5-dien-1-one Chemical compound ClN=C1C=C(Br)C(=O)C(Br)=C1 JYWKEVKEKOTYEX-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- -1 M-phenyl-toluene sulfamide Chemical compound 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000282898 Sus scrofa Species 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- DUYAAUVXQSMXQP-UHFFFAOYSA-N ethanethioic S-acid Chemical compound CC(S)=O DUYAAUVXQSMXQP-UHFFFAOYSA-N 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229940046892 lead acetate Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- DUYAAUVXQSMXQP-UHFFFAOYSA-M thioacetate Chemical compound CC([S-])=O DUYAAUVXQSMXQP-UHFFFAOYSA-M 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000007070 tosylation reaction Methods 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1692659A SU417416A1 (https=) | 1971-08-20 | 1971-08-20 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1692659A SU417416A1 (https=) | 1971-08-20 | 1971-08-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU417416A1 true SU417416A1 (https=) | 1974-02-28 |
Family
ID=20486490
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1692659A SU417416A1 (https=) | 1971-08-20 | 1971-08-20 |
Country Status (1)
| Country | Link |
|---|---|
| SU (1) | SU417416A1 (https=) |
-
1971
- 1971-08-20 SU SU1692659A patent/SU417416A1/ru active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU417416A1 (https=) | ||
| US2840602A (en) | Nu-[beta-(3-amino-2, 4, 6-triiodophenyl) propionyl] amino acids, nu-acyl derivativesthereof, and process | |
| US2543345A (en) | Method of preparing glutamic acid amides | |
| US2647904A (en) | Derivatives of tropic acid and proc | |
| US2563035A (en) | Preparation of nitrogen and sulfur containing beta-substituted carboxylic acids | |
| US3299095A (en) | 1-benzyl tetramic acid derivatives | |
| US2519530A (en) | Biotin aliphatic amides and method for their preparation | |
| US2785191A (en) | Acylmercapto-alkylamines and process for the manufacture thereof | |
| US2413833A (en) | Substituted 4,4'-diaminodiphenyl sulfones and process of making same | |
| IL30546A (en) | Cephalosporin compounds for use as antibacterial agents and a process for their production | |
| US2829157A (en) | Novel hydantoic acids and their alkyl esters | |
| US2593563A (en) | Phloroglucinol derivatives | |
| US2994692A (en) | Process of preparing nu-trityl peptides | |
| SU561508A3 (ru) | Способ получени производных 2-бензоил3-(аминоацетиламидо)-пиридина или их солей | |
| US2999863A (en) | Alpha-phthalimido-acetamide derivatives | |
| US2686788A (en) | Process for the production of nitro phenyl amino diol derivatives | |
| US2991307A (en) | Process of resolving nu, nu-dibenzyl-dl-alpha-amino acids and products | |
| US2457371A (en) | Acylated p-aminobenzene sulfonamides | |
| US2399600A (en) | Substituted 4, 4'-diaminodiphenyl sulphones and process of making same | |
| US3270027A (en) | 2-trichloromethyl-4-thiazolidones | |
| US2850518A (en) | Amino acid derivatives | |
| SU394363A1 (ru) | Способ получения м-(меркаптоалкил)-сульфамидов | |
| DE951273C (de) | Verfahren zur Herstellung von N-acylierten ª‰-Aminoaethylmercaptanen | |
| US2413835A (en) | Substituted 4,4'-diaminodiphenyl sulfones and process of making same | |
| SU436492A3 (ru) | Способ получения производных пиколиновойкислоты |