SU413168A1 - - Google Patents
Info
- Publication number
- SU413168A1 SU413168A1 SU1725408A SU1725408A SU413168A1 SU 413168 A1 SU413168 A1 SU 413168A1 SU 1725408 A SU1725408 A SU 1725408A SU 1725408 A SU1725408 A SU 1725408A SU 413168 A1 SU413168 A1 SU 413168A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acid
- stirred
- hour
- pigment
- solution
- Prior art date
Links
- 239000000049 pigment Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- INCJNDAQNPWMPZ-UHFFFAOYSA-N 3-amino-4-methoxybenzamide Chemical compound COC1=CC=C(C(N)=O)C=C1N INCJNDAQNPWMPZ-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Landscapes
- Paints Or Removers (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1725408A SU413168A1 (enExample) | 1971-12-13 | 1971-12-13 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1725408A SU413168A1 (enExample) | 1971-12-13 | 1971-12-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU413168A1 true SU413168A1 (enExample) | 1974-01-30 |
Family
ID=20496356
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1725408A SU413168A1 (enExample) | 1971-12-13 | 1971-12-13 |
Country Status (1)
| Country | Link |
|---|---|
| SU (1) | SU413168A1 (enExample) |
-
1971
- 1971-12-13 SU SU1725408A patent/SU413168A1/ru active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2852503A (en) | 2, 5-bis (p-aminophenyl) furan azo derivatives | |
| SU413168A1 (enExample) | ||
| US2361567A (en) | Azo pigment | |
| US1522089A (en) | Azodyestuffs and process of making the same | |
| SU468437A3 (ru) | Способ получени азопигмента | |
| US2694713A (en) | Fast bases of the acridone series | |
| US2361568A (en) | Azo pigment | |
| SU604862A1 (ru) | Способ получени моноазопигмена-2окси-3-карбокси-(2-метокси-5-метиланилин)-нафталин-1-азо-1-(2-метокси-5бензамида) | |
| US2361569A (en) | Azo pigment | |
| US3634462A (en) | 2 3-dihydro-2 2-dimethyl-7-aceto acetamidobenzofuran | |
| US2100378A (en) | Azo dyes | |
| DE2448994A1 (de) | Verfahren zur herstellung von azopigmenten | |
| US1962226A (en) | Azo dyes, and method for their preparation | |
| US2087706A (en) | Azo dyes and their production | |
| RU2047629C1 (ru) | Способ получения дисазопигментов ацетоацетарилидного ряда | |
| US743071A (en) | Monoazo dye and process of making same. | |
| DE341266C (de) | Verfahren zur Herstellung beizenziehender Disazofarbstoffe | |
| US4008215A (en) | Sulfonic-acid substituted disazo dyestuffs | |
| SU411749A1 (ru) | Способп олучени активных монохлортриазиновых дисазокрасителей | |
| US1690774A (en) | Azo dyestuff | |
| SU108315A1 (ru) | Способ получени моноазокрасителей | |
| SU376420A1 (ru) | Способ получения желтого прозрачного азопигмента | |
| SU12598A1 (ru) | Способ получени нерастворимых в воде азокрасителей | |
| SU141966A1 (ru) | Способ получени желтых прозрачных азопигментов | |
| SU1520081A1 (ru) | Способ получени моноазопигментов диоксихинолинового р да |