SU410813A1 - - Google Patents
Info
- Publication number
- SU410813A1 SU410813A1 SU1491344A SU1491344A SU410813A1 SU 410813 A1 SU410813 A1 SU 410813A1 SU 1491344 A SU1491344 A SU 1491344A SU 1491344 A SU1491344 A SU 1491344A SU 410813 A1 SU410813 A1 SU 410813A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- gears
- chevron
- gear
- stage
- shafts
- Prior art date
Links
- 230000005540 biological transmission Effects 0.000 description 3
- 239000004568 cement Substances 0.000 description 2
- 241000219112 Cucumis Species 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
Landscapes
- Gear Transmission (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1491344A SU410813A1 (cs) | 1970-11-09 | 1970-11-09 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1491344A SU410813A1 (cs) | 1970-11-09 | 1970-11-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU410813A1 true SU410813A1 (cs) | 1974-01-15 |
Family
ID=20459721
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1491344A SU410813A1 (cs) | 1970-11-09 | 1970-11-09 |
Country Status (1)
| Country | Link |
|---|---|
| SU (1) | SU410813A1 (cs) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EA005431B1 (ru) * | 2003-04-24 | 2005-02-24 | Общество с ограниченной ответственностью "ВЕСТ-ТЕР" | Электромеханический регулируемый привод выгребной цепи щебнеочистительной машины |
| RU2561184C2 (ru) * | 2010-01-06 | 2015-08-27 | Компани Ангренаж Э Редюктёр-Месьян-Дюран | Дробилка, оборудованная устройством привода для зубчатого венца |
| RU2598549C2 (ru) * | 2012-03-13 | 2016-09-27 | Компани Ангренаж Э Редюктер-Мессиан-Дюран | Приводное устройство и дробилка |
-
1970
- 1970-11-09 SU SU1491344A patent/SU410813A1/ru active
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EA005431B1 (ru) * | 2003-04-24 | 2005-02-24 | Общество с ограниченной ответственностью "ВЕСТ-ТЕР" | Электромеханический регулируемый привод выгребной цепи щебнеочистительной машины |
| RU2561184C2 (ru) * | 2010-01-06 | 2015-08-27 | Компани Ангренаж Э Редюктёр-Месьян-Дюран | Дробилка, оборудованная устройством привода для зубчатого венца |
| RU2598549C2 (ru) * | 2012-03-13 | 2016-09-27 | Компани Ангренаж Э Редюктер-Мессиан-Дюран | Приводное устройство и дробилка |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3214991A (en) | Mechanism for transforming a movement of rotation into a movement of translation | |
| US4586402A (en) | Drive for two-worm extruder | |
| US4391163A (en) | Planetary gear assembly | |
| US3427901A (en) | Gearing | |
| US1968604A (en) | Transmitting gear | |
| US5087230A (en) | Drive transmissions | |
| US1404675A (en) | Epicyclic gear | |
| US2481627A (en) | Transmission unit | |
| SU410813A1 (cs) | ||
| CA1181965A (en) | Dual output stage for internal planetary gear winches | |
| US2831358A (en) | Multiple belt, variable-speed transmission with differentially associated pulleys | |
| US2208614A (en) | Shaft coupling | |
| US1762199A (en) | Variable-speed transmission | |
| US2284934A (en) | Shaft coupling | |
| GB1523253A (en) | Planetary gear | |
| US1338377A (en) | Mechanical movement | |
| US4252034A (en) | Free-floating planetary transmission with reversible output | |
| US2209367A (en) | Shaft coupling | |
| US3844184A (en) | Load equalized transmission | |
| US1077519A (en) | Reversing mechanism. | |
| US3357277A (en) | Variable speed planetary friction gear transmission | |
| NO143642B (no) | Planetveksel. | |
| GB1265557A (cs) | ||
| US2447136A (en) | Locomotive reversing gearing apparatus | |
| RU2084725C1 (ru) | Редуктор равнооборотных соосных валов встречного вращения |