SU370874A1 - - Google Patents
Info
- Publication number
- SU370874A1 SU370874A1 SU1432451A SU1432451A SU370874A1 SU 370874 A1 SU370874 A1 SU 370874A1 SU 1432451 A SU1432451 A SU 1432451A SU 1432451 A SU1432451 A SU 1432451A SU 370874 A1 SU370874 A1 SU 370874A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- lithium
- weight
- reaction
- sludge
- heated
- Prior art date
Links
- 229910052744 lithium Inorganic materials 0.000 description 14
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000010802 sludge Substances 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 150000001350 alkyl halides Chemical class 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- -1 alkyl lithium compounds Chemical class 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- YZSKZXUDGLALTQ-UHFFFAOYSA-N [Li][C] Chemical compound [Li][C] YZSKZXUDGLALTQ-UHFFFAOYSA-N 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 150000002900 organolithium compounds Chemical class 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1432451A SU370874A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1970-04-20 | 1970-04-20 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1432451A SU370874A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1970-04-20 | 1970-04-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU370874A1 true SU370874A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1974-10-15 |
Family
ID=20452356
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1432451A SU370874A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1970-04-20 | 1970-04-20 |
Country Status (1)
| Country | Link |
|---|---|
| SU (1) | SU370874A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2024107085A1 (ru) * | 2022-11-16 | 2024-05-23 | Публичное Акционерное Общество "Сибур Холдинг" (Пао "Сибур Холдинг") | Способ получения раствора алкиллития |
| RU2825388C2 (ru) * | 2022-11-16 | 2024-08-26 | Публичное акционерное общество "СИБУР Холдинг" | Способ получения раствора алкиллития |
-
1970
- 1970-04-20 SU SU1432451A patent/SU370874A1/ru active
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2024107085A1 (ru) * | 2022-11-16 | 2024-05-23 | Публичное Акционерное Общество "Сибур Холдинг" (Пао "Сибур Холдинг") | Способ получения раствора алкиллития |
| RU2825388C2 (ru) * | 2022-11-16 | 2024-08-26 | Публичное акционерное общество "СИБУР Холдинг" | Способ получения раствора алкиллития |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4006095A (en) | Stable hydrocarbon solutions of aluminum hydride | |
| US4595779A (en) | Stable lithium diisopropylamide and method of preparation | |
| US3766280A (en) | Diorganomagnesium reagents and methods of preparing same | |
| SU370874A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE69428443T2 (de) | Alkyllithium-verfahren | |
| DE3854948T2 (de) | Verfahren zur Herstellung von organobimetallischen Verbindungen | |
| US3197516A (en) | Stable solutions of aryllithium compounds | |
| US2380057A (en) | Dialkylated silicon esters and method of making them | |
| US3446860A (en) | Method of making phenyllithium | |
| FREY Jr et al. | Bimetallic Ethyl Compounds as Reagents for the Synthesis of Tetraethyllead from Lead Metal | |
| US5211887A (en) | High purity alkyllithium compounds and process of preparation | |
| Wright | The role of boron trichloride in the synthesis of phenyltrichlorosilane from benzene and trichlorosilane | |
| US2739165A (en) | Stabilization of aromatic chlorosilanes | |
| US4615843A (en) | Treatment of hydrocarbon solutions of dialkylmagnesium compounds to reduce the content of soluble chloride-containing complexes | |
| US3468959A (en) | Separation of cesium from potassium and rubidium | |
| US20070187847A1 (en) | Process for the preparation of pure aryllithium compounds and their use | |
| US3405155A (en) | Process for the preparation of diphenylsilanediol | |
| DE2535591C2 (de) | Verfahren zur Herstellung von Bis-(dihalogenoaluminium)-äthanen | |
| US2293214A (en) | Purifying tetraethyl lead | |
| Harada | REDUCTION OF TRIMETHYL STANNYL HYDROXIDE IN LIQUID AMMONIA | |
| US3082232A (en) | Preparation of organometallic monohalides | |
| SU497225A1 (ru) | Способ получени дигидрофосфинидов щелочных металлов | |
| US3488369A (en) | Process for the production of hydrocarbonlead compounds | |
| SU438653A1 (ru) | Способ дезактивации отходов производства литийалкилов | |
| DE2615351C2 (de) | Organomagnesiumkomplexe und Verfahren zu ihrer Herstellung |