SU352466A1 - - Google Patents
Info
- Publication number
- SU352466A1 SU352466A1 SU1310790A SU1310790A SU352466A1 SU 352466 A1 SU352466 A1 SU 352466A1 SU 1310790 A SU1310790 A SU 1310790A SU 1310790 A SU1310790 A SU 1310790A SU 352466 A1 SU352466 A1 SU 352466A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- amino
- hydroxy
- acid
- sulfophenylazo
- naphthalene
- Prior art date
Links
- -1 phenylene, diphenylene Chemical group 0.000 description 39
- 239000002253 acid Substances 0.000 description 34
- 239000000975 dye Substances 0.000 description 28
- 239000000463 material Substances 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 6
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 6
- 238000004043 dyeing Methods 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000004753 textile Substances 0.000 description 5
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 150000004699 copper complex Chemical class 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- YNLJEDNYQOVLRX-UHFFFAOYSA-N 1,2-diamino-1,2-diphenoxyethane-1,2-disulfonic acid Chemical compound NC(C(S(=O)(=O)O)(OC1=CC=CC=C1)N)(S(=O)(=O)O)OC1=CC=CC=C1 YNLJEDNYQOVLRX-UHFFFAOYSA-N 0.000 description 2
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 2
- XXZDPVOWJBCNQC-UHFFFAOYSA-N 3-[(4-amino-2-methylphenyl)diazenyl]naphthalene-1,5-disulfonic acid Chemical compound CC1=CC(N)=CC=C1N=NC1=CC(S(O)(=O)=O)=C(C=CC=C2S(O)(=O)=O)C2=C1 XXZDPVOWJBCNQC-UHFFFAOYSA-N 0.000 description 2
- APZQNXAMDJGBJZ-UHFFFAOYSA-N 6-[(2-acetamido-4-aminophenyl)diazenyl]naphthalene-1,3-disulfonic acid Chemical compound CC(=O)NC1=CC(N)=CC=C1N=NC1=CC=C(C(=CC(=C2)S(O)(=O)=O)S(O)(=O)=O)C2=C1 APZQNXAMDJGBJZ-UHFFFAOYSA-N 0.000 description 2
- UYJDHSGEGWMTLJ-UHFFFAOYSA-N 7-[[4-amino-2-(carbamoylamino)phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid Chemical compound NC(=O)NC1=CC(N)=CC=C1N=NC1=CC2=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C=C2C=C1S(O)(=O)=O UYJDHSGEGWMTLJ-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- LSNWBXAWXCAKBM-UHFFFAOYSA-N CNC1=CC=C(C=C1)N=NC2(CC(C(C=C2)C=CC3=CC=CC=C3)(S(=O)(=O)O)S(=O)(=O)O)[N+](=O)[O-] Chemical compound CNC1=CC=C(C=C1)N=NC2(CC(C(C=C2)C=CC3=CC=CC=C3)(S(=O)(=O)O)S(=O)(=O)O)[N+](=O)[O-] LSNWBXAWXCAKBM-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 235000019233 fast yellow AB Nutrition 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003918 triazines Chemical class 0.000 description 2
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- XNOOBVYHWNGUOR-UHFFFAOYSA-N 1-amino-4-(4-aminoanilino)anthracene-9,10-dione Chemical compound C1=CC(N)=CC=C1NC1=CC=C(N)C2=C1C(=O)C1=CC=CC=C1C2=O XNOOBVYHWNGUOR-UHFFFAOYSA-N 0.000 description 1
- VMKHNXYWSCMKSS-UHFFFAOYSA-N 2-amino-5-hydroxy-6-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC2=C(S(O)(=O)=O)C(N)=CC=C2C(O)=C1N=NC1=CC(S(O)(=O)=O)=CC=C1O VMKHNXYWSCMKSS-UHFFFAOYSA-N 0.000 description 1
- WHJNKCNHEVCICH-UHFFFAOYSA-N 2-nitro-1-n-phenylbenzene-1,4-diamine Chemical compound [O-][N+](=O)C1=CC(N)=CC=C1NC1=CC=CC=C1 WHJNKCNHEVCICH-UHFFFAOYSA-N 0.000 description 1
- KOXYXBGVZGWXED-UHFFFAOYSA-N 3-[(2-acetamido-4-aminophenyl)diazenyl]naphthalene-1,5-disulfonic acid Chemical compound CC(=O)NC1=CC(N)=CC=C1N=NC1=CC(S(O)(=O)=O)=C(C=CC=C2S(O)(=O)=O)C2=C1 KOXYXBGVZGWXED-UHFFFAOYSA-N 0.000 description 1
- IHDBZCJYSHDCKF-UHFFFAOYSA-N 4,6-dichlorotriazine Chemical class ClC1=CC(Cl)=NN=N1 IHDBZCJYSHDCKF-UHFFFAOYSA-N 0.000 description 1
- BFHBHOQPMKJDCQ-UHFFFAOYSA-N 4-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid Chemical compound C=12C=CC=CC2=CC(S(=O)(=O)O)=CC=1N=NC1=CC=CC=C1S(O)(=O)=O BFHBHOQPMKJDCQ-UHFFFAOYSA-N 0.000 description 1
- XHHWJFFOFMYBHG-UHFFFAOYSA-N 4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]-6-(methylamino)naphthalene-2-sulfonic acid Chemical compound OC=1C2=CC(NC)=CC=C2C=C(S(O)(=O)=O)C=1N=NC1=CC=C(OC)C=C1S(O)(=O)=O XHHWJFFOFMYBHG-UHFFFAOYSA-N 0.000 description 1
- BCKLFBZLLBBVHX-UHFFFAOYSA-N 5-[(3-aminobenzoyl)amino]-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid Chemical compound NC1=CC=CC(C(=O)NC=2C3=C(O)C(N=NC=4C(=CC=CC=4)S(O)(=O)=O)=C(C=C3C=C(C=2)S(O)(=O)=O)S(O)(=O)=O)=C1 BCKLFBZLLBBVHX-UHFFFAOYSA-N 0.000 description 1
- YEZBOLDRJIAVBA-UHFFFAOYSA-N 5-[(8-amino-1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]-2-hydroxybenzoic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=C(O)C(C(O)=O)=C1 YEZBOLDRJIAVBA-UHFFFAOYSA-N 0.000 description 1
- WZNRCYVMHBODTD-UHFFFAOYSA-N 5-acetamido-3-[(3-amino-4-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(NC(=O)C)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=C(S(O)(=O)=O)C(N)=C1 WZNRCYVMHBODTD-UHFFFAOYSA-N 0.000 description 1
- CCABXCUZXGZDFM-UHFFFAOYSA-N 5-amino-2-[[1-hydroxy-3-sulfo-7-(3-sulfoanilino)naphthalen-2-yl]diazenyl]benzoic acid Chemical compound S(=O)(=O)(O)C=1C=C(C=CC1)NC1=CC=C2C=C(C(=C(C2=C1)O)N=NC1=C(C=C(C=C1)N)C(=O)O)S(=O)(=O)O CCABXCUZXGZDFM-UHFFFAOYSA-N 0.000 description 1
- ISTNBIUEOOWHHO-UHFFFAOYSA-N 5-amino-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=CC=C1S(O)(=O)=O ISTNBIUEOOWHHO-UHFFFAOYSA-N 0.000 description 1
- UDCKXEFJOHLCKM-UHFFFAOYSA-N 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=CC=C1 UDCKXEFJOHLCKM-UHFFFAOYSA-N 0.000 description 1
- BPODHNQWROPACN-UHFFFAOYSA-N 5-amino-8-(3-amino-2,4,6-trimethylanilino)-9,10-dioxoanthracene-1,6-disulfonic acid Chemical compound CC1=C(N)C(C)=CC(C)=C1NC1=CC(S(O)(=O)=O)=C(N)C2=C1C(=O)C1=C(S(O)(=O)=O)C=CC=C1C2=O BPODHNQWROPACN-UHFFFAOYSA-N 0.000 description 1
- ZBILXVWKWMKHEA-UHFFFAOYSA-N 7-amino-4-hydroxy-3-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC2=CC(N)=CC=C2C(O)=C1N=NC1=CC(S(O)(=O)=O)=CC=C1O ZBILXVWKWMKHEA-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DJYGZIMSRKQMGO-UHFFFAOYSA-N C1=CC=C(C(=C1)N2C(=O)C(C(=N2)C(=O)O)N=NC3=C(C=CC(=C3)N)S(=O)(=O)O)S(=O)(=O)O Chemical compound C1=CC=C(C(=C1)N2C(=O)C(C(=N2)C(=O)O)N=NC3=C(C=CC(=C3)N)S(=O)(=O)O)S(=O)(=O)O DJYGZIMSRKQMGO-UHFFFAOYSA-N 0.000 description 1
- IRDQNLLVRXMERV-UHFFFAOYSA-N CCCC[Na] Chemical class CCCC[Na] IRDQNLLVRXMERV-UHFFFAOYSA-N 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- UKJXQDJACAKWJG-UHFFFAOYSA-N NC1=CC(CC=C1S(=O)(=O)O)(S(=O)(=O)O)N=NC Chemical compound NC1=CC(CC=C1S(=O)(=O)O)(S(=O)(=O)O)N=NC UKJXQDJACAKWJG-UHFFFAOYSA-N 0.000 description 1
- CGCJQLZTAMHNBV-UHFFFAOYSA-N O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=C(S(O)(=O)=O)CC2(S(O)(=O)=O)NC1=CC=CC(N)=C1 Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=C(S(O)(=O)=O)CC2(S(O)(=O)=O)NC1=CC=CC(N)=C1 CGCJQLZTAMHNBV-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- ICIDZHMCYAIUIJ-UHFFFAOYSA-N dinaphthalen-1-yldiazene Chemical compound C1=CC=C2C(N=NC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ICIDZHMCYAIUIJ-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- YYHJPNVCYHVPJK-UHFFFAOYSA-N naphthalen-1-yl-(2-phenylnaphthalen-1-yl)diazene Chemical class C1=CC=CC=C1C1=CC=C(C=CC=C2)C2=C1N=NC1=CC=CC2=CC=CC=C12 YYHJPNVCYHVPJK-UHFFFAOYSA-N 0.000 description 1
- VILFVXYKHXVYAB-UHFFFAOYSA-N naphthalene-2,7-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 VILFVXYKHXVYAB-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N phenyldimethylamine Natural products CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000985 reactive dye Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU884444475A Addition SU1534451A2 (ru) | 1988-04-22 | 1988-04-22 | Автоматический регул тор коэффициента мощности |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SU301933A1 SU301933A1 (ru) | |
| SU352466A1 true SU352466A1 (enExample) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ228956A (en) | Preventing yellowing of a polyamide fibre treated with a stain-blocking agent by treatment with a water-soluble light stabilising agent | |
| NO124964B (enExample) | ||
| JPS637581B2 (enExample) | ||
| JPS6048546B2 (ja) | 繊維反応性染料およびその製法 | |
| DE2616683A1 (de) | Farbstoffe | |
| PL82823B1 (en) | Fibre-reactive dyestuffs[gb1320921a] | |
| NO124932B (enExample) | ||
| US4230852A (en) | Triazinyl-antraquinone dyes | |
| US2951837A (en) | New monoazo dyestuffs | |
| SU352466A1 (enExample) | ||
| EP0256650B1 (en) | Reactive dyes | |
| US4066389A (en) | Sulfophenylamino containing tetrareactive triazine disazo dyestuffs and dyestuff compositions thereof | |
| US3709869A (en) | Reactive triazine azo dyestuffs | |
| US2951071A (en) | New monoazo dyestuffs | |
| KR910006993B1 (ko) | 수용성디스아조화합물의제조방법 | |
| CA1199632A (en) | Water-soluble disazo compounds | |
| US4148790A (en) | Metallized triazine reactive dyes | |
| SU340182A1 (enExample) | ||
| PT1311621E (pt) | Corante azo reactivo, processo para a sua preparação e sua utilização | |
| US3527745A (en) | Reactive azo dyestuffs containing a thiophene dioxide | |
| US5196033A (en) | BIS-azotriazinyl reactive dyes having an N-alkyl-phenylenediamine link for cellulose textiles | |
| US4372892A (en) | Process for the preparation of 1-aminobenzene-5-β-sulfatoethylsulfone-2,4-disulfonic acid, the 5-vinylsulfone compound and the alkali salts thereof | |
| JPH06157931A (ja) | 水溶性ジスアゾ化合物、その製法及び染料としてのその用途 | |
| NO125637B (enExample) | ||
| US5202436A (en) | Triphendioxazine dyestuffs |