SU283569A1 - - Google Patents
Info
- Publication number
- SU283569A1 SU283569A1 SU1227264A SU1227264A SU283569A1 SU 283569 A1 SU283569 A1 SU 283569A1 SU 1227264 A SU1227264 A SU 1227264A SU 1227264 A SU1227264 A SU 1227264A SU 283569 A1 SU283569 A1 SU 283569A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mol
- kgf
- weight
- hours
- nco
- Prior art date
Links
- 125000003700 epoxy group Chemical group 0.000 description 15
- 238000000034 method Methods 0.000 description 15
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 12
- 229920001971 elastomer Polymers 0.000 description 11
- 239000000806 elastomer Substances 0.000 description 11
- 229920002635 polyurethane Polymers 0.000 description 11
- 239000004814 polyurethane Substances 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 10
- 230000009477 glass transition Effects 0.000 description 8
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 8
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 7
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 6
- 239000004593 Epoxy Substances 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 6
- 150000002009 diols Chemical class 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 125000005442 diisocyanate group Chemical group 0.000 description 5
- 229920005862 polyol Polymers 0.000 description 5
- 150000003077 polyols Chemical class 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 229920001400 block copolymer Polymers 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 150000002118 epoxides Chemical class 0.000 description 2
- -1 for example Chemical group 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical compound OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- IBOFVQJTBBUKMU-UHFFFAOYSA-N 4,4'-methylene-bis-(2-chloroaniline) Chemical compound C1=C(Cl)C(N)=CC=C1CC1=CC=C(N)C(Cl)=C1 IBOFVQJTBBUKMU-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- LZKLAOYSENRNKR-LNTINUHCSA-N iron;(z)-4-oxoniumylidenepent-2-en-2-olate Chemical compound [Fe].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O LZKLAOYSENRNKR-LNTINUHCSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 238000004073 vulcanization Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU283569A1 true SU283569A1 (enExample) |
Family
ID=
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2749379C2 (ru) * | 2018-11-29 | 2021-06-09 | Федеральное государственное бюджетное учреждение науки Пермский федеральный исследовательский центр Уральского отделения Российской академии наук (ПФИЦ УрО РАН) | Эпоксидная композиция холодного отверждения |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2749379C2 (ru) * | 2018-11-29 | 2021-06-09 | Федеральное государственное бюджетное учреждение науки Пермский федеральный исследовательский центр Уральского отделения Российской академии наук (ПФИЦ УрО РАН) | Эпоксидная композиция холодного отверждения |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3808250A (en) | Polyethers containing terminal amino groups | |
| US5227434A (en) | Moisture curable polymers | |
| US2888439A (en) | Polyurethane diamines | |
| US4892920A (en) | Process for the preparation of cyclohexanediisocyanate containing polyisocyanate prepolymers and polyurethanes having high temperature performance | |
| EP0192190B1 (en) | Fluorinated polyurethanes containing polyoxyperfluoroalkylene blocks | |
| US4565645A (en) | Single-stage process for the production of polyamines and polyamines produced by such process | |
| US4515923A (en) | Polyamines and a process for their production | |
| JPS6154812B2 (enExample) | ||
| JPS584054B2 (ja) | カチオンジユウゴウニヨル ヒドロキシマツタ | |
| JPH0149407B2 (enExample) | ||
| US4970342A (en) | Polyamines and a process for the production thereof | |
| EP0240196B1 (en) | Utilisation of Polymeric polyamines for the production of polurethane/polyurea or polyurea. | |
| CA1225786A (en) | Process for the production of polyurethane urea elastomers | |
| EP1314744B1 (en) | Amino-terminated polybutadienes | |
| US4151222A (en) | Amine terminated polymers and the formation of block copolymers | |
| KR101858992B1 (ko) | 아자이드기를 포함하는 열가소성 폴리우레탄의 제조방법 | |
| US4298707A (en) | Amine terminated polymers and the formation of block copolymers | |
| SU283569A1 (enExample) | ||
| US4299932A (en) | Amine terminated polymers and the formation of block copolymers | |
| US5284980A (en) | Block copolyethers via oxonium coupling of poly(tetramethylene ether) glycols | |
| US4740531A (en) | Polyaminohydroxyl compounds containing urethane and/or urea groups and processes for their preparation and use | |
| CN116217442B (zh) | 一种改性胺类扩链剂,以及聚氨酯涂料及其制备方法 | |
| AU613928B2 (en) | Amines | |
| US5055544A (en) | Amino-functional polyesters containing urea, biuret, thiourea, dithiobiuret, thioamide, and/or amide moieties in their backbone and urethane/urea prepolymers and polymers made therefrom | |
| JPH0137406B2 (enExample) |