SU190206A1 - - Google Patents
Info
- Publication number
- SU190206A1 SU190206A1 SU1061048A SU1061048A SU190206A1 SU 190206 A1 SU190206 A1 SU 190206A1 SU 1061048 A SU1061048 A SU 1061048A SU 1061048 A SU1061048 A SU 1061048A SU 190206 A1 SU190206 A1 SU 190206A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- alcohol
- ether
- added
- mixture
- triethylamine
- Prior art date
Links
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 42
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 235000019441 ethanol Nutrition 0.000 description 20
- 239000000203 mixture Substances 0.000 description 9
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 9
- 238000009835 boiling Methods 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 238000001816 cooling Methods 0.000 description 6
- 239000000975 dye Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- -1 2-anilinovinyl nitrogen Chemical compound 0.000 description 4
- 206010070834 Sensitisation Diseases 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- JKLNYGDWYRKFKR-UHFFFAOYSA-N ethyl methyl sulfate Chemical compound CCOS(=O)(=O)OC JKLNYGDWYRKFKR-UHFFFAOYSA-N 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000008313 sensitization Effects 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000003839 salts Chemical group 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- AVCVDUDESCZFHJ-UHFFFAOYSA-N triphenylphosphane;hydrochloride Chemical compound [Cl-].C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 AVCVDUDESCZFHJ-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000298 carbocyanine Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- QWYZFXLSWMXLDM-UHFFFAOYSA-M pinacyanol iodide Chemical compound [I-].C1=CC2=CC=CC=C2N(CC)C1=CC=CC1=CC=C(C=CC=C2)C2=[N+]1CC QWYZFXLSWMXLDM-UHFFFAOYSA-M 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- AIGNCQCMONAWOL-UHFFFAOYSA-N 1,3-benzoselenazole Chemical compound C1=CC=C2[se]C=NC2=C1 AIGNCQCMONAWOL-UHFFFAOYSA-N 0.000 description 1
- KRQUFUKTQHISJB-YYADALCUSA-N 2-[(E)-N-[2-(4-chlorophenoxy)propoxy]-C-propylcarbonimidoyl]-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one Chemical compound CCC\C(=N/OCC(C)OC1=CC=C(Cl)C=C1)C1=C(O)CC(CC1=O)C1CCCSC1 KRQUFUKTQHISJB-YYADALCUSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 101100327797 Penaeus monodon CHH5 gene Proteins 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- YYDZNOUMWKJXMG-UHFFFAOYSA-N chloro(phenyl)phosphane Chemical compound ClPC1=CC=CC=C1 YYDZNOUMWKJXMG-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 230000004064 dysfunction Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- NHZLDRXCSVFATE-UHFFFAOYSA-N methyl perchlorate Chemical compound COCl(=O)(=O)=O NHZLDRXCSVFATE-UHFFFAOYSA-N 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 description 1
- 229910001488 sodium perchlorate Inorganic materials 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU190206A1 true SU190206A1 (enExample) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3148187A (en) | Sulfonated cyanine and merocyanine dyes | |
| SU190206A1 (enExample) | ||
| US2954376A (en) | Polymethine dyes containing a 4-(hydroxymethyl)-or 4-(acetoxymethyl)-delta2-thiazoline or oxazoline nucleus, and preparation thereof | |
| Brooker et al. | Studies in the cyanine dye series. I. A new method of preparing certain carbocyanines | |
| US2068047A (en) | Thio-and seleno-carbocyanines | |
| US2326497A (en) | Water-soluble nitrogen-containing heterocyclic compound | |
| DE955261C (de) | Verfahren zur Herstellung von drei heterocyclische Kerne enthaltenden Cyaninfarbstoffen | |
| US3723419A (en) | Preparation of formylmethylene compounds and corresponding photographic dyestuffs | |
| US3745157A (en) | Cyanine dyes | |
| US2292021A (en) | Manufacture of cyanine dyestuffs | |
| US2179990A (en) | Dyes and process for the preparation thereof | |
| US2475949A (en) | beta-naphthoselenazole compounds | |
| US2289303A (en) | Methine dyestuffs | |
| US2704755A (en) | Polynuclear cyanine dyes | |
| US3337573A (en) | Substituted 2-methyl-benzoxazoles and 2-methyl-benzothiazoles | |
| US2450400A (en) | Process for producing dye intermediates | |
| SU93374A1 (ru) | Способ получени тиа-, селена- и тиаселена-карбоцианиновых красителей | |
| US2335861A (en) | Tricarbocyanine dyestuff and method of preparation | |
| US1969448A (en) | Photographic emulsion containing oxa-/-cyanines | |
| SU93340A1 (enExample) | ||
| SU184614A1 (ru) | Способ получения 9-сульфоалкокси- или 9-сульфатоалкокситиакарбоцианинбетаинов | |
| US2481698A (en) | Thioketones and process for preparing the same | |
| US2653152A (en) | Cyanine dye and process of making same | |
| US3926971A (en) | Novel chemical synthesis | |
| SU105639A1 (ru) | Способ получения 9-алкилзамещепных 3,3'-ди-(карбоксиалкил)тиакарбоцианинов |