SU170680A1 - - Google Patents
Info
- Publication number
- SU170680A1 SU170680A1 SU892612A SU892612A SU170680A1 SU 170680 A1 SU170680 A1 SU 170680A1 SU 892612 A SU892612 A SU 892612A SU 892612 A SU892612 A SU 892612A SU 170680 A1 SU170680 A1 SU 170680A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- polymerization
- polymeric materials
- heterocyclic compound
- monomer
- order
- Prior art date
Links
- FOCVUCIESVLUNU-UHFFFAOYSA-N Thiotepa Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 7
- 239000000178 monomer Substances 0.000 claims description 7
- 229920000642 polymer Polymers 0.000 claims description 7
- 238000006116 polymerization reaction Methods 0.000 claims description 6
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 3
- 230000000379 polymerizing effect Effects 0.000 claims description 2
- 239000007870 radical polymerization initiator Substances 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 239000002685 polymerization catalyst Substances 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000004342 Benzoyl peroxide Substances 0.000 description 3
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 3
- 235000019400 benzoyl peroxide Nutrition 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 241000428199 Mustelinae Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU170680A1 true SU170680A1 (enExample) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Suwa et al. | Synthesis and functionalities of poly (N‐vinylalkylamide). IV. Synthesis and free radical polymerization of N‐vinylisobutyramide and thermosensitive properties of the polymer | |
| US3235626A (en) | Polymers of controlled branch configuration | |
| US4463168A (en) | Polycaprolactone polymers | |
| Oishi | Polymerizations and copolymerizations of N-(4-substituted phenyl) itaconimides | |
| US3294765A (en) | Ethylidene-bis-3 (nu-vinyl-2-pyrrolidone) and polymers thereof | |
| KR102656198B1 (ko) | 분지형 중합체 | |
| SU170680A1 (enExample) | ||
| DE69930807T2 (de) | Zusammensetzung aus Acryloylmonomeren, Acrylatcopolymerisat und wärmefestes Harz | |
| CN115626969A (zh) | 嵌段型中性聚合物键合剂及其制备方法 | |
| US3862091A (en) | Quaternized n-vinyl lactam polymeric compositions and mannich adducts thereof | |
| Bibiao et al. | Preparation of hyperbranched polymers by self-condensing vinyl radical polymerization | |
| Akashi et al. | Functional monomers and polymers, 31. On the stereoregularity of vinyl polymers containing nucleic acid bases | |
| US3226372A (en) | Novel heterocyclic compounds and polymers | |
| SU469256A3 (ru) | Способ получени сополимеров изобутилена | |
| US3803104A (en) | High molecular weight and low viscosity vinylpyrrolidone polymer flocculants and catalyst and process producing the same | |
| US3329663A (en) | Allyl azaphosphorine compounds and polymers thereof | |
| Stille et al. | Free-Radical Polymerization of 2-Phenyl-5-(4'-vinyl) phenyltetrazole. Reactivity Ratios and Q and e Values | |
| SU218431A1 (ru) | Способ получения полимеров с концевыми перекисными группами | |
| KR900003910B1 (ko) | 비스실록산 중합개시제를 이용한 중합체의 제조방법 | |
| US2469295A (en) | Synthetic resins and method for producing same | |
| RU2734242C1 (ru) | Способ получения сополимеров акрилонитрила в массе | |
| SU218432A1 (ru) | Способ получения термостойких сополимеров | |
| SU403692A1 (ru) | Способ получения полимеров | |
| SU519425A1 (ru) | Способ получени волокнообразующих поли- и сополимеров акрилонитрила | |
| SU390110A1 (ru) | Способ получения антраценсодержащих полимеров |