SU160064A1 - - Google Patents
Info
- Publication number
- SU160064A1 SU160064A1 SU811933A SU811933A SU160064A1 SU 160064 A1 SU160064 A1 SU 160064A1 SU 811933 A SU811933 A SU 811933A SU 811933 A SU811933 A SU 811933A SU 160064 A1 SU160064 A1 SU 160064A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- electrolyte
- nickel
- coatings
- brittleness
- value
- Prior art date
Links
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 8
- 239000003792 electrolyte Substances 0.000 description 6
- 229910052759 nickel Inorganic materials 0.000 description 4
- 238000000576 coating method Methods 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- YZMHQCWXYHARLS-UHFFFAOYSA-N naphthalene-1,2-disulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC=C21 YZMHQCWXYHARLS-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 241000246099 Legionellales Species 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Inorganic materials [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU160064A1 true SU160064A1 (https=) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3682788A (en) | Copper electroplating | |
| CA1045075A (en) | Bright tin-nickel alloy plating electrolyte | |
| SU160064A1 (https=) | ||
| US3862019A (en) | Composition of electroplating bath for the electrodeposition of bright nickel | |
| US3793162A (en) | Electrodeposition of ruthenium | |
| EP0892087A2 (en) | Electroplating of low-stress nickel | |
| SU443108A1 (ru) | Электролит меднени | |
| US3186926A (en) | Electroplating solution containing a diester of selenious acid | |
| US3400059A (en) | Acidic copper electroplating baths and method | |
| US3558448A (en) | Method of electroplating zinc and electrolyte therefor | |
| US4430172A (en) | Method of increasing corrosion resistance in galvanically deposited palladium/nickel coatings | |
| SU413211A1 (https=) | ||
| RU2071996C1 (ru) | Водный электролит блестящего никелирования, его вариант | |
| US3296101A (en) | Cyanide electroplating baths and processes | |
| US2765269A (en) | Bath for plating bright gold | |
| US3261772A (en) | Nickel electroplating bath and process | |
| RU2820435C1 (ru) | Электролит для электроосаждения блестящих цинковых покрытий | |
| SU663762A1 (ru) | Электролит блест щего цинковани | |
| SU380748A1 (ru) | Способ электролитического кадмирования | |
| RU2013469C1 (ru) | Электролит для нанесения покрытий из сплава никель-кадмий | |
| US3748236A (en) | Additive for nickel plating baths | |
| SU1224353A1 (ru) | Электролит дл осаждени покрытий сплавом железо-никель | |
| EP2405034A1 (en) | Copper-zinc alloy electroplating bath and method of plating using same | |
| US3520785A (en) | Electroplating gold and thiomalate electrolyte therefor | |
| SU433242A1 (https=) |