SU152718A1 - - Google Patents
Info
- Publication number
- SU152718A1 SU152718A1 SU778582A SU778582A SU152718A1 SU 152718 A1 SU152718 A1 SU 152718A1 SU 778582 A SU778582 A SU 778582A SU 778582 A SU778582 A SU 778582A SU 152718 A1 SU152718 A1 SU 152718A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- oil
- additive
- concentrate
- sulfonate
- sulfonates
- Prior art date
Links
- 239000000654 additive Substances 0.000 description 10
- 239000003921 oil Substances 0.000 description 9
- 239000012141 concentrate Substances 0.000 description 8
- 230000000996 additive effect Effects 0.000 description 6
- 239000002283 diesel fuel Substances 0.000 description 6
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 6
- 150000003871 sulfonates Chemical class 0.000 description 6
- PQUCIEFHOVEZAU-UHFFFAOYSA-N Diammonium sulfite Chemical compound [NH4+].[NH4+].[O-]S([O-])=O PQUCIEFHOVEZAU-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 239000000446 fuel Substances 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 239000003879 lubricant additive Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 230000009972 noncorrosive effect Effects 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 238000012031 short term test Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU152718A1 true SU152718A1 (enrdf_load_html_response) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US9284507B2 (en) | Universal synthetic diesel fuel additive product-by-process to replace the lost sulfur lubrication when using low-sulfur diesel fuels | |
| EP0635558B1 (en) | Gas oil composition | |
| DE972052C (de) | Zylinderschmiermittel fuer mit schwefelhaltigen Treibstoffen eines Schwefelgehaltes von mindestens 0, 01 bis ueber 5 Gewichtsprozent betriebene Verbrennungskraftmaschinen | |
| CA2710403C (en) | Universal synthetic gasoline fuel conditioner additive, method and product-by-process | |
| US2614985A (en) | Lubricating composition containing boric acid | |
| KR970703409A (ko) | 연료유 조성물(fuel oil compositions) | |
| SU152718A1 (enrdf_load_html_response) | ||
| UA88878C2 (uk) | Універсальна присадка до мастильних та паливних матеріалів, паливо для двигуна внутрішнього згоряння /варіанти/, для дизельного двигуна /варіанти/ та топкове паливо | |
| US7976590B2 (en) | Fuel or fuel additive composition and method for its manufacture and use | |
| US3085866A (en) | Fuel oil compositions of improved combustion characteristics | |
| US4336149A (en) | Fuel economy in internal combustion engines | |
| US4543195A (en) | Friction-reducing lubricating compositions each comprising an additive | |
| RU2305127C1 (ru) | Многофункциональная добавка к углеводородным топливам | |
| US3238257A (en) | N-tertiary-alkyl alkanesulfonamides | |
| US3415632A (en) | Fuel oil compositions | |
| US2944021A (en) | Marine diesel lubricant | |
| AU2013101665A4 (en) | A Fuel Additive and a Fuel Containing Said Additive | |
| RU2796678C1 (ru) | Многофункциональная присадка к автомобильным бензинам и топливная композиция на ее основе | |
| RU2723116C1 (ru) | Противоизносная присадка к дизельному топливу с ультранизким содержанием серы | |
| RU2668225C1 (ru) | Топливная эмульсия | |
| Fukumoto et al. | Experimental investigation of lubricity improvement of gas-to-liquid (GTL) fuels with additives for low sulphur diesel fuel | |
| RU2751712C1 (ru) | Противоизносная присадка к ультрамалосернистому дизельному топливу | |
| US2989564A (en) | Nu-substituted aminopropylamine monosulfonates | |
| US2685502A (en) | Diesel fuel | |
| Klimentova et al. | Synthesis and screening of components of anti-wear additives based on plant raw materials |