SU1149870A3 - Способ получени фосфорной кислоты - Google Patents
Способ получени фосфорной кислоты Download PDFInfo
- Publication number
- SU1149870A3 SU1149870A3 SU802999191A SU2999191A SU1149870A3 SU 1149870 A3 SU1149870 A3 SU 1149870A3 SU 802999191 A SU802999191 A SU 802999191A SU 2999191 A SU2999191 A SU 2999191A SU 1149870 A3 SU1149870 A3 SU 1149870A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- concentration
- reaction zone
- reaction
- processing
- zone
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 20
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 title claims abstract description 16
- 229910000147 aluminium phosphate Inorganic materials 0.000 title claims abstract description 8
- 238000006243 chemical reaction Methods 0.000 claims abstract description 27
- 239000002994 raw material Substances 0.000 claims abstract description 12
- 229910019142 PO4 Inorganic materials 0.000 claims abstract description 11
- 238000001914 filtration Methods 0.000 claims abstract description 11
- 239000010452 phosphate Substances 0.000 claims abstract description 11
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims abstract description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical class S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims abstract description 9
- PASHVRUKOFIRIK-UHFFFAOYSA-L calcium sulfate dihydrate Chemical compound O.O.[Ca+2].[O-]S([O-])(=O)=O PASHVRUKOFIRIK-UHFFFAOYSA-L 0.000 claims abstract description 8
- 238000002425 crystallisation Methods 0.000 claims abstract description 6
- 238000005406 washing Methods 0.000 claims abstract description 6
- 230000008025 crystallization Effects 0.000 claims abstract description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 5
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims abstract 2
- 239000011574 phosphorus Substances 0.000 claims abstract 2
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 7
- 238000000926 separation method Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 235000013351 cheese Nutrition 0.000 claims 1
- 239000012066 reaction slurry Substances 0.000 abstract description 2
- 229910021653 sulphate ion Inorganic materials 0.000 abstract 2
- -1 sulphate ions Chemical class 0.000 abstract 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 5
- QVLTXCYWHPZMCA-UHFFFAOYSA-N po4-po4 Chemical compound OP(O)(O)=O.OP(O)(O)=O QVLTXCYWHPZMCA-UHFFFAOYSA-N 0.000 description 3
- 235000011132 calcium sulphate Nutrition 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000001175 calcium sulphate Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- VCSZKSHWUBFOOE-UHFFFAOYSA-N dioxidanium;sulfate Chemical compound O.O.OS(O)(=O)=O VCSZKSHWUBFOOE-UHFFFAOYSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B25/00—Phosphorus; Compounds thereof
- C01B25/16—Oxyacids of phosphorus; Salts thereof
- C01B25/18—Phosphoric acid
- C01B25/22—Preparation by reacting phosphate-containing material with an acid, e.g. wet process
- C01B25/222—Preparation by reacting phosphate-containing material with an acid, e.g. wet process with sulfuric acid, a mixture of acids mainly consisting of sulfuric acid or a mixture of compounds forming it in situ, e.g. a mixture of sulfur dioxide, water and oxygen
- C01B25/223—Preparation by reacting phosphate-containing material with an acid, e.g. wet process with sulfuric acid, a mixture of acids mainly consisting of sulfuric acid or a mixture of compounds forming it in situ, e.g. a mixture of sulfur dioxide, water and oxygen only one form of calcium sulfate being formed
- C01B25/225—Dihydrate process
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B25/00—Phosphorus; Compounds thereof
- C01B25/16—Oxyacids of phosphorus; Salts thereof
- C01B25/18—Phosphoric acid
- C01B25/22—Preparation by reacting phosphate-containing material with an acid, e.g. wet process
- C01B25/222—Preparation by reacting phosphate-containing material with an acid, e.g. wet process with sulfuric acid, a mixture of acids mainly consisting of sulfuric acid or a mixture of compounds forming it in situ, e.g. a mixture of sulfur dioxide, water and oxygen
- C01B25/223—Preparation by reacting phosphate-containing material with an acid, e.g. wet process with sulfuric acid, a mixture of acids mainly consisting of sulfuric acid or a mixture of compounds forming it in situ, e.g. a mixture of sulfur dioxide, water and oxygen only one form of calcium sulfate being formed
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7926993A FR2468548A1 (fr) | 1979-10-31 | 1979-10-31 | Perfectionnements au procede de preparation d'acide phosphorique de voie humide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU1149870A3 true SU1149870A3 (ru) | 1985-04-07 |
Family
ID=9231225
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU802999191A SU1149870A3 (ru) | 1979-10-31 | 1980-10-30 | Способ получени фосфорной кислоты |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4350671A (enExample) |
| AU (1) | AU534318B2 (enExample) |
| BE (1) | BE885953A (enExample) |
| BR (1) | BR8007000A (enExample) |
| CA (1) | CA1140315A (enExample) |
| FR (1) | FR2468548A1 (enExample) |
| GR (1) | GR70223B (enExample) |
| IL (1) | IL61357A (enExample) |
| MA (1) | MA18985A1 (enExample) |
| OA (1) | OA06646A (enExample) |
| SU (1) | SU1149870A3 (enExample) |
| YU (1) | YU43124B (enExample) |
| ZA (1) | ZA806676B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2873119B1 (fr) * | 2004-07-13 | 2008-02-01 | Vichem Soc Par Actions Simplif | Procede perfectionne de fabrication d'acide phosphorique |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE418069A (enExample) * | 1935-10-28 | |||
| US2233956A (en) * | 1938-12-01 | 1941-03-04 | U S Phosphoric Products Corp | Process for the manufacture of phosphoric acid |
| BE538799A (enExample) * | 1955-06-07 | 1955-06-30 | Union Chimique Belge Sa | |
| US2890936A (en) * | 1956-02-01 | 1959-06-16 | Curt S Benefield | Method for producing phosphoric acid |
| BE581747A (enExample) * | 1958-08-25 | |||
| GB1135951A (en) * | 1965-02-12 | 1968-12-11 | Fisons Ltd | Phosphoric acid |
| US3755539A (en) * | 1970-01-02 | 1973-08-28 | Pechiney Saint Gobain | Process for the manufacture of phosphoric acid in the wet way |
| FR2130847A5 (en) * | 1971-03-23 | 1972-11-10 | Pechiney Saint Gobain | Wet process phosphoric acid prodn - high phosphorus pentoxide concn |
| US4029743A (en) * | 1975-12-24 | 1977-06-14 | Hauge Douglas O | Phosphoric acid manufacture |
-
1979
- 1979-10-31 FR FR7926993A patent/FR2468548A1/fr active Granted
-
1980
- 1980-10-22 US US06/199,645 patent/US4350671A/en not_active Expired - Lifetime
- 1980-10-28 IL IL61357A patent/IL61357A/xx not_active IP Right Cessation
- 1980-10-29 GR GR63236A patent/GR70223B/el unknown
- 1980-10-29 OA OA57244A patent/OA06646A/xx unknown
- 1980-10-29 YU YU2761/80A patent/YU43124B/xx unknown
- 1980-10-30 ZA ZA00806676A patent/ZA806676B/xx unknown
- 1980-10-30 SU SU802999191A patent/SU1149870A3/ru active
- 1980-10-30 AU AU63849/80A patent/AU534318B2/en not_active Ceased
- 1980-10-30 CA CA000363581A patent/CA1140315A/fr not_active Expired
- 1980-10-30 BE BE0/202657A patent/BE885953A/fr not_active IP Right Cessation
- 1980-10-30 BR BR8007000A patent/BR8007000A/pt not_active IP Right Cessation
- 1980-10-31 MA MA19185A patent/MA18985A1/fr unknown
Non-Patent Citations (1)
| Title |
|---|
| . 1. Патент FR № 1600680, кл. С 01 В 25/22, опублик. 1970. 2. Патент FR № 2130847, ют. С 01 В 25/00, опублик. 1972. * |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2468548B1 (enExample) | 1983-08-05 |
| ZA806676B (en) | 1981-11-25 |
| OA06646A (fr) | 1981-08-31 |
| MA18985A1 (fr) | 1981-07-01 |
| AU6384980A (en) | 1981-05-07 |
| CA1140315A (fr) | 1983-02-01 |
| US4350671A (en) | 1982-09-21 |
| FR2468548A1 (fr) | 1981-05-08 |
| BR8007000A (pt) | 1981-05-05 |
| GR70223B (enExample) | 1982-08-31 |
| YU43124B (en) | 1989-04-30 |
| AU534318B2 (en) | 1984-01-19 |
| BE885953A (fr) | 1981-04-30 |
| YU276180A (en) | 1983-02-28 |
| IL61357A (en) | 1984-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3552918A (en) | Process for the production of phosphoric acid | |
| US3418077A (en) | Phosphoric acid | |
| US3632307A (en) | Process for the preparation of phosphoric acid and gypsum from phosphate rock | |
| SU867292A3 (ru) | Способ получени экстракционной фосфорной кислоты | |
| JPS61168510A (ja) | 燐酸及び硫酸カルシウムの製造方法 | |
| SU1149870A3 (ru) | Способ получени фосфорной кислоты | |
| US3745208A (en) | Wet process manufacture of phosphoric acid and calcium sulphate | |
| US2885263A (en) | Anhydrite process for phosphoric acid manufacture | |
| SU1223838A3 (ru) | Способ получени фосфорной кислоты | |
| IL26394A (en) | Process for the preparation of phosphoric acid and gypsum from phosphate rock | |
| SU1289816A1 (ru) | Способ получени фосфорной кислоты | |
| RU2094365C1 (ru) | Способ получения фосфорной кислоты | |
| SU1586999A1 (ru) | Способ получени фосфорной кислоты | |
| SU1147694A1 (ru) | Способ получени фосфорной кислоты | |
| SU1595793A1 (ru) | Способ получени фосфорной кислоты | |
| SU1171418A1 (ru) | Способ получени фосфорной кислоты | |
| SU998441A1 (ru) | Способ получени фосфатов аммони | |
| RU2106299C1 (ru) | Способ получения экстракционной фосфорной кислоты | |
| SU570547A1 (ru) | Способ получени фосфорной кислоты | |
| SU1530569A1 (ru) | Способ получени фосфорной кислоты | |
| SU1157017A1 (ru) | Способ получени фосфорной кислоты | |
| SU1370074A1 (ru) | Способ получени фосфорной кислоты | |
| SU833486A1 (ru) | Способ получени фосфорной кислоты | |
| SU882922A1 (ru) | Способ получени фосфорной кислоты и дигидрата сульфата кальци | |
| SU1051046A1 (ru) | Способ получени фосфорной кислоты |