SE462755B - Foerfarande foer drift av en cell foer framstaellning av vaeteperoxid - Google Patents
Foerfarande foer drift av en cell foer framstaellning av vaeteperoxidInfo
- Publication number
- SE462755B SE462755B SE8901802A SE8901802A SE462755B SE 462755 B SE462755 B SE 462755B SE 8901802 A SE8901802 A SE 8901802A SE 8901802 A SE8901802 A SE 8901802A SE 462755 B SE462755 B SE 462755B
- Authority
- SE
- Sweden
- Prior art keywords
- cell
- cells
- cathode
- air
- electrolyte
- Prior art date
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 title claims abstract description 30
- 238000000034 method Methods 0.000 title claims abstract description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 40
- 239000001301 oxygen Substances 0.000 claims abstract description 40
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 40
- 239000003792 electrolyte Substances 0.000 claims abstract description 31
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims abstract description 24
- 239000001569 carbon dioxide Substances 0.000 claims abstract description 12
- 229910002092 carbon dioxide Inorganic materials 0.000 claims abstract description 12
- 239000007789 gas Substances 0.000 claims abstract description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 33
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000002474 experimental method Methods 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 7
- -1 hydroxyl ions Chemical class 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000011148 porous material Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 3
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 3
- 239000004810 polytetrafluoroethylene Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000002360 explosive Substances 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000011244 liquid electrolyte Substances 0.000 description 2
- 229920006267 polyester film Polymers 0.000 description 2
- 238000004064 recycling Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 206010021143 Hypoxia Diseases 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000003487 electrochemical reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 230000002706 hydrostatic effect Effects 0.000 description 1
- 239000003014 ion exchange membrane Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- MSLRPWGRFCKNIZ-UHFFFAOYSA-J tetrasodium;hydrogen peroxide;dicarbonate Chemical compound [Na+].[Na+].[Na+].[Na+].OO.OO.OO.[O-]C([O-])=O.[O-]C([O-])=O MSLRPWGRFCKNIZ-UHFFFAOYSA-J 0.000 description 1
- 230000001550 time effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/28—Per-compounds
- C25B1/30—Peroxides
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
- Hybrid Cells (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/932,833 US4693794A (en) | 1986-11-20 | 1986-11-20 | Process for manufacturing hydrogen peroxide electrolytically |
| PCT/US1987/001530 WO1988003965A1 (en) | 1986-11-20 | 1987-06-30 | Process for manufacturing hydrogen peroxide electrolytically |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| SE8901802D0 SE8901802D0 (sv) | 1989-05-19 |
| SE8901802L SE8901802L (sv) | 1989-05-19 |
| SE462755B true SE462755B (sv) | 1990-08-27 |
Family
ID=25463021
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8901802A SE462755B (sv) | 1986-11-20 | 1989-05-19 | Foerfarande foer drift av en cell foer framstaellning av vaeteperoxid |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4693794A (fi) |
| BR (1) | BR8707898A (fi) |
| CA (1) | CA1316485C (fi) |
| FI (1) | FI88409C (fi) |
| MX (1) | MX169648B (fi) |
| SE (1) | SE462755B (fi) |
| WO (1) | WO1988003965A1 (fi) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5316629A (en) * | 1991-09-20 | 1994-05-31 | H-D Tech Inc. | Process for maintaining electrolyte flow rate through a microporous diaphragm during electrochemical production of hydrogen peroxide |
| DE4311665C1 (de) * | 1993-04-08 | 1994-08-18 | Metallgesellschaft Ag | Verfahren zur Herstellung von Alkaliperoxid-Lösungen |
| DE4317349C1 (de) * | 1993-05-25 | 1994-10-13 | Metallgesellschaft Ag | Verfahren zur Herstellung von Alkaliperoxid/Percarbonat-Lösungen |
| US5565073A (en) * | 1994-07-15 | 1996-10-15 | Fraser; Mark E. | Electrochemical peroxide generator |
| DE19516304C1 (de) * | 1995-05-04 | 1996-07-25 | Metallgesellschaft Ag | Verfahren zur Herstellung von Alkaliperoxid-Hydrat |
| WO2001010215A1 (en) | 1999-08-05 | 2001-02-15 | Steris Inc. | Electrolytic synthesis of peracetic acid |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR654592A (fr) * | 1927-07-13 | 1929-04-08 | Ig Farbenindustrie Ag | Procédé d'obtention d'eau oxygénée par réduction cathodique d'oxygène |
| US3459652A (en) * | 1966-12-27 | 1969-08-05 | Kimberly Clark Co | Paraffin-active carbon electrode |
| US3454477A (en) * | 1966-12-27 | 1969-07-08 | Kimberly Clark Co | Electrochemical process of producing peroxide solutions and porous electrode therefor |
| US3506560A (en) * | 1967-01-30 | 1970-04-14 | Kimberly Clark Co | Electrolytic cell having novel electrolyte flow path means |
| US3462351A (en) * | 1967-01-30 | 1969-08-19 | Kimberly Clark Co | Process for alkaline peroxide solution production including alkali concentration control |
| US3507769A (en) * | 1967-01-30 | 1970-04-21 | Kimberly Clark Co | Simplified electrolytic cell |
| US3856640A (en) * | 1971-06-02 | 1974-12-24 | Wright H D | Production of hydrogen peroxide |
| US3969201A (en) * | 1975-01-13 | 1976-07-13 | Canadian Patents And Development Limited | Electrolytic production of alkaline peroxide solutions |
| US4430177A (en) * | 1979-12-11 | 1984-02-07 | The Dow Chemical Company | Electrolytic process using oxygen-depolarized cathodes |
| US4511441A (en) * | 1982-02-18 | 1985-04-16 | The Dow Chemical Company | Method of operating a liquid-gas electrochemical cell |
| US4406758A (en) * | 1982-02-18 | 1983-09-27 | The Dow Chemical Company | Method of operating a liquid-gas electrochemical cell |
-
1986
- 1986-11-20 US US06/932,833 patent/US4693794A/en not_active Expired - Fee Related
-
1987
- 1987-06-30 WO PCT/US1987/001530 patent/WO1988003965A1/en active IP Right Grant
- 1987-06-30 BR BR8707898A patent/BR8707898A/pt not_active IP Right Cessation
- 1987-07-03 CA CA000541300A patent/CA1316485C/en not_active Expired - Fee Related
- 1987-07-14 MX MX007354A patent/MX169648B/es unknown
-
1989
- 1989-05-12 FI FI892298A patent/FI88409C/fi not_active IP Right Cessation
- 1989-05-19 SE SE8901802A patent/SE462755B/sv not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BR8707898A (pt) | 1989-10-31 |
| WO1988003965A1 (en) | 1988-06-02 |
| FI88409C (fi) | 1993-05-10 |
| FI892298A0 (fi) | 1989-05-12 |
| SE8901802D0 (sv) | 1989-05-19 |
| FI88409B (fi) | 1993-01-29 |
| CA1316485C (en) | 1993-04-20 |
| MX169648B (es) | 1993-07-16 |
| FI892298A (fi) | 1989-05-12 |
| US4693794A (en) | 1987-09-15 |
| SE8901802L (sv) | 1989-05-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3969201A (en) | Electrolytic production of alkaline peroxide solutions | |
| US3511712A (en) | Process of removing carbon dioxide from gas streams using fuel cell | |
| US3864236A (en) | Apparatus for the electrolytic production of alkali | |
| AU557245B2 (en) | Electrochemical cell and method | |
| US4818638A (en) | System for hydrogen thermal-electrochemical conversion | |
| US4595469A (en) | Electrolytic process for production of gaseous hydrogen chloride and aqueous alkali metal hydroxide | |
| US4455203A (en) | Process for the electrolytic production of hydrogen peroxide | |
| US3280014A (en) | Method of producing electricity and chemicals | |
| US3669751A (en) | Electric battery comprising a fuel cell hydrogen generator and heat exchanger | |
| JPH05504170A (ja) | 塩素酸・アルカリ金属塩素酸塩混合物の電気化学的製造方法 | |
| US4256551A (en) | Electrolytic process | |
| EA024480B1 (ru) | Ячейка для деполяризованного электродиализа растворов солей | |
| US20030194369A1 (en) | Gas generation system | |
| US4271003A (en) | Chemoelectric cell | |
| US3274029A (en) | Recovering water formed in a fuel cell and apparatus therefor | |
| US5296110A (en) | Apparatus and method for separating oxygen from air | |
| US4239607A (en) | Electrochemical chlorine production process | |
| SE462755B (sv) | Foerfarande foer drift av en cell foer framstaellning av vaeteperoxid | |
| US4305793A (en) | Method of concentrating alkali metal hydroxide in hybrid cells having cation selective membranes | |
| US4872957A (en) | Electrochemical cell having dual purpose electrode | |
| US3152014A (en) | Dual membrane fuel cell and the use of the same for producing electrical energy | |
| CA1250404A (en) | Membrane pervaporation process | |
| US4246078A (en) | Method of concentrating alkali metal hydroxide in hybrid cells having cation selective membranes | |
| US3734842A (en) | Electrolytic process for the production of alkali metal borohydrides | |
| US7785450B2 (en) | “On-site” carbon dioxide generator |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 8901802-2 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8901802-2 Format of ref document f/p: F |