SE425390B - Sett att framstella nya 11-oxo-prostaglandinderivat - Google Patents
Sett att framstella nya 11-oxo-prostaglandinderivatInfo
- Publication number
- SE425390B SE425390B SE7604083A SE7604083A SE425390B SE 425390 B SE425390 B SE 425390B SE 7604083 A SE7604083 A SE 7604083A SE 7604083 A SE7604083 A SE 7604083A SE 425390 B SE425390 B SE 425390B
- Authority
- SE
- Sweden
- Prior art keywords
- prostagland
- oxo
- ingredients
- make new
- new
- Prior art date
Links
- RZRPTBIGEANTGU-IRIMSJTPSA-N adrenosterone Chemical compound O=C1CC[C@]2(C)[C@H]3C(=O)C[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1 RZRPTBIGEANTGU-IRIMSJTPSA-N 0.000 title 1
- 239000004615 ingredient Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/93—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems condensed with a ring other than six-membered
- C07D307/935—Not further condensed cyclopenta [b] furans or hydrogenated cyclopenta [b] furans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
- Pyridine Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752517773 DE2517773A1 (de) | 1975-04-18 | 1975-04-18 | Neue 11-oxo-prostaglandin-derivate und verfahren zu ihrer herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7604083L SE7604083L (sv) | 1976-10-19 |
| SE425390B true SE425390B (sv) | 1982-09-27 |
Family
ID=5944671
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7604083A SE425390B (sv) | 1975-04-18 | 1976-04-07 | Sett att framstella nya 11-oxo-prostaglandinderivat |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4346228A (sv) |
| JP (1) | JPS51131859A (sv) |
| BE (1) | BE840871A (sv) |
| CA (1) | CA1092102A (sv) |
| DE (1) | DE2517773A1 (sv) |
| DK (1) | DK142876A (sv) |
| FR (1) | FR2307526A1 (sv) |
| GB (1) | GB1549342A (sv) |
| HU (1) | HU175422B (sv) |
| IE (1) | IE43465B1 (sv) |
| LU (1) | LU74765A1 (sv) |
| NL (1) | NL7604113A (sv) |
| SE (1) | SE425390B (sv) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2950027A1 (de) * | 1979-12-10 | 1981-06-11 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | 9-chlor-prostaglandinderivate, verfahren zur herstellung und verwendung als arzneimittel |
| JPS591463A (ja) * | 1982-06-28 | 1984-01-06 | Ono Pharmaceut Co Ltd | 新規なプロスタグランジンｄ類似化合物 |
| JPS60155154A (ja) * | 1983-10-07 | 1985-08-15 | Teijin Ltd | プロスタグランデインｄ２類の製法 |
| IN167720B (sv) * | 1987-10-02 | 1990-12-08 | Tsuneyoshi Kawate | |
| IL143477A (en) * | 2001-05-31 | 2009-07-20 | Finetech Pharmaceutical Ltd | Process for the preparation of 17-phenyl-18,19,20-trinor-pgf2?? and its derivatives |
| IL134241A (en) * | 2000-01-27 | 2006-06-11 | Finetech Pharmaceutical Ltd | Process for the preparation of latanoprost |
| WO2001087816A1 (en) * | 2000-05-15 | 2001-11-22 | Pharmacia & Upjohn Company | Process and intermediates to prepare latanoprost |
| GB0112699D0 (en) * | 2001-05-24 | 2001-07-18 | Resolution Chemicals Ltd | Process for the preparation of prostglandins and analogues thereof |
-
1975
- 1975-04-18 DE DE19752517773 patent/DE2517773A1/de not_active Ceased
-
1976
- 1976-03-30 DK DK142876A patent/DK142876A/da not_active IP Right Cessation
- 1976-04-07 SE SE7604083A patent/SE425390B/sv unknown
- 1976-04-14 LU LU74765A patent/LU74765A1/xx unknown
- 1976-04-15 US US05/677,420 patent/US4346228A/en not_active Expired - Lifetime
- 1976-04-15 NL NL7604113A patent/NL7604113A/xx not_active Application Discontinuation
- 1976-04-15 GB GB15552/76A patent/GB1549342A/en not_active Expired
- 1976-04-15 IE IE810/76A patent/IE43465B1/en unknown
- 1976-04-16 HU HU76SCHE561A patent/HU175422B/hu unknown
- 1976-04-16 BE BE166254A patent/BE840871A/xx not_active IP Right Cessation
- 1976-04-16 FR FR7611334A patent/FR2307526A1/fr active Granted
- 1976-04-19 JP JP51044407A patent/JPS51131859A/ja active Pending
- 1976-04-20 CA CA250,481A patent/CA1092102A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1092102A (en) | 1980-12-23 |
| FR2307526A1 (fr) | 1976-11-12 |
| DE2517773A1 (de) | 1976-10-28 |
| BE840871A (fr) | 1976-10-18 |
| HU175422B (hu) | 1980-07-28 |
| US4346228A (en) | 1982-08-24 |
| GB1549342A (en) | 1979-08-08 |
| IE43465B1 (en) | 1981-03-11 |
| NL7604113A (nl) | 1976-10-20 |
| SE7604083L (sv) | 1976-10-19 |
| LU74765A1 (sv) | 1976-11-11 |
| DK142876A (da) | 1976-10-19 |
| JPS51131859A (en) | 1976-11-16 |
| IE43465L (en) | 1976-10-18 |
| FR2307526B1 (sv) | 1979-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE432247B (sv) | Sett att framstella dihydro-cyklosporin c | |
| SE433222B (sv) | Sett att framstella modifierad polysackarid | |
| SE441528B (sv) | Sett att framstella nya 3-kinolin-karboxylsyraderivat | |
| SE7604719L (sv) | Nya eldsleckande kompositioner | |
| SE7600277L (sv) | Sett att framstella sampolymerisatpulver | |
| SE7606280L (sv) | Sett att framstella etrar | |
| SE433492B (sv) | Sett att framstella fenylettiksyraderivat | |
| SE7607152L (sv) | Sett att framstella nya 2-piperidinoalkyl-1,4-bensdioxaner | |
| SE435928B (sv) | Sett att framstella nya 3-aryl-oxazolidin-2-oner | |
| SE418860B (sv) | Sett att framstella nya 1-aryl-2-(1-imidazolyl)-alkyletrar och -tioetrar | |
| SE425736B (sv) | Sett att framstella kromanon-(4) | |
| SE420728B (sv) | Sett att framstella piperazinyliminorifamyciner | |
| SE7602729L (sv) | Sett att framstella nya indolylalkylpiperidiner | |
| SE435280B (sv) | Sett att framstella nya 0-(3-amino-2-hydroxipropyl)-amidoximderivat | |
| SE424991B (sv) | Sett att framstella nya 5-fenyl-oxazolidinoner | |
| SE434842B (sv) | Sett att framstella nya 7-amino-tiazolyl-acetamido-cefalosporansyraderivat | |
| SE425390B (sv) | Sett att framstella nya 11-oxo-prostaglandinderivat | |
| SE430156B (sv) | Sett att framstella 2-subst-1-(omega-aminoalkoxi)-bensener | |
| SE7601927L (sv) | Nya isocyanater och sett att framstella dessa | |
| SE412233B (sv) | Sett att framstella nya fenotiazinderivat | |
| SE420690B (sv) | Sett att kontinuerligt framstella vermeisolerande ledningsror | |
| SE7609666L (sv) | Sett att framstella nya 5-aminometyltiazolderivat | |
| SE420731B (sv) | Sett att framstella 5-androsten-17-on-derivat | |
| SE7605357L (sv) | Sett att framstella nya cefemforeningar | |
| SE415252B (sv) | Sett att framstella nya oxifenylbutazonderivat |