SE411904B - Forfarande for framstellning av steroidderivat tillhorande androstan-serien - Google Patents
Forfarande for framstellning av steroidderivat tillhorande androstan-serienInfo
- Publication number
- SE411904B SE411904B SE7509650A SE7509650A SE411904B SE 411904 B SE411904 B SE 411904B SE 7509650 A SE7509650 A SE 7509650A SE 7509650 A SE7509650 A SE 7509650A SE 411904 B SE411904 B SE 411904B
- Authority
- SE
- Sweden
- Prior art keywords
- procedure
- preparation
- steroid derivatives
- androstan
- series
- Prior art date
Links
- QZLYKIGBANMMBK-UGCZWRCOSA-N 5α-Androstane Chemical class C([C@@H]1CC2)CCC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CCC[C@@]2(C)CC1 QZLYKIGBANMMBK-UGCZWRCOSA-N 0.000 title 1
- 150000003431 steroids Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J3/00—Normal steroids containing carbon, hydrogen, halogen or oxygen, substituted in position 17 beta by one carbon atom
- C07J3/005—Normal steroids containing carbon, hydrogen, halogen or oxygen, substituted in position 17 beta by one carbon atom the carbon atom being part of a carboxylic function
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Steroid Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB38089/74A GB1517278A (en) | 1974-08-30 | 1974-08-30 | Alkyl and haloalkyl androsta-1,4,15-triene and-4,15-diene-17beta-carboxylates |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7509650L SE7509650L (sv) | 1976-03-01 |
| SE411904B true SE411904B (sv) | 1980-02-11 |
Family
ID=10401103
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7509650A SE411904B (sv) | 1974-08-30 | 1975-08-29 | Forfarande for framstellning av steroidderivat tillhorande androstan-serien |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3981894A (enExample) |
| JP (1) | JPS5148648A (enExample) |
| BE (1) | BE832888A (enExample) |
| CH (1) | CH612687A5 (enExample) |
| DE (1) | DE2538627A1 (enExample) |
| DK (1) | DK136075B (enExample) |
| FR (1) | FR2282898A1 (enExample) |
| GB (1) | GB1517278A (enExample) |
| IE (1) | IE41662B1 (enExample) |
| NL (1) | NL7510225A (enExample) |
| SE (1) | SE411904B (enExample) |
| ZA (1) | ZA755554B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3002746A1 (de) * | 1980-01-23 | 1981-07-30 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | 1-hydroxysteroide, verfahren zu ihrer herstellung und pharmazeutische praeparate, die diese verbindungen enthalten |
| IL78144A0 (en) * | 1985-04-04 | 1986-07-31 | Draco Ab | Novel androstane-17beta-carboxylic acid esters |
| SE8501693D0 (sv) * | 1985-04-04 | 1985-04-04 | Draco Ab | Novel 16,17-acetalsubstituted androstane-17beta-carboxylic acid esters |
| US6750210B2 (en) | 2000-08-05 | 2004-06-15 | Smithkline Beecham Corporation | Formulation containing novel anti-inflammatory androstane derivative |
| US6777400B2 (en) * | 2000-08-05 | 2004-08-17 | Smithkline Beecham Corporation | Anti-inflammatory androstane derivative compositions |
| US6759398B2 (en) * | 2000-08-05 | 2004-07-06 | Smithkline Beecham Corporation | Anti-inflammatory androstane derivative |
| US6858593B2 (en) | 2000-08-05 | 2005-02-22 | Smithkline Beecham Corporation | Anti-inflammatory androstane derivative compositions |
| PT1305329E (pt) * | 2000-08-05 | 2007-12-24 | Glaxo Group Ltd | Éster s-fluorometílico do ácido 6.alfa.,9.alfa.-difluoro- 17.alfa.-(2-furanilcarboxil)oxi-11.beta.-hidroxi-16.alfa.-metil- 3-oxo-androsta-1,4-dieno-17-carbotióico como um agente antiinflamatório |
| GB0019172D0 (en) * | 2000-08-05 | 2000-09-27 | Glaxo Group Ltd | Novel compounds |
| US6787532B2 (en) | 2000-08-05 | 2004-09-07 | Smithkline Beecham Corporation | Formulation containing anti-inflammatory androstane derivatives |
| US6858596B2 (en) | 2000-08-05 | 2005-02-22 | Smithkline Beecham Corporation | Formulation containing anti-inflammatory androstane derivative |
| US6777399B2 (en) | 2000-08-05 | 2004-08-17 | Smithkline Beecham Corporation | Anti-inflammatory androstane derivative compositions |
| UA77656C2 (en) | 2001-04-07 | 2007-01-15 | Glaxo Group Ltd | S-fluoromethyl ester of 6-alpha, 9-alpha-difluoro-17-alpha-[(2-furanylcarbonyl)oxy]-11-beta-hydroxy-16- alpha-methyl-3-oxoandrosta-1,4-dien-17-beta-carbothioacid as anti-inflammatory agent |
| MY137522A (en) * | 2001-04-30 | 2009-02-27 | Glaxo Group Ltd | Novel anti-inflammatory androstane derivatives. |
| US20050175545A1 (en) * | 2002-02-04 | 2005-08-11 | Keith Biggadike | Formulation for inhalation comprising a glucocorticoid and a beta 2-adrenoreceptor agonist |
| GB0202635D0 (en) * | 2002-02-05 | 2002-03-20 | Glaxo Wellcome Mfg Pte Ltd | Formulation containing novel anti-inflammatory androstane derivative |
| GB2389530B (en) | 2002-06-14 | 2007-01-10 | Cipla Ltd | Pharmaceutical compositions |
| GB0507165D0 (en) * | 2005-04-08 | 2005-05-18 | Glaxo Group Ltd | Novel crystalline pharmaceutical product |
| GB0615108D0 (en) * | 2006-07-28 | 2006-09-06 | Glaxo Group Ltd | Novel formulations |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3828080A (en) * | 1972-01-20 | 1974-08-06 | Glaxo Lab Ltd | Androstane-17beta-carboxylic acids and processes for the preparation thereof |
-
1974
- 1974-08-30 GB GB38089/74A patent/GB1517278A/en not_active Expired
-
1975
- 1975-08-29 DE DE19752538627 patent/DE2538627A1/de not_active Withdrawn
- 1975-08-29 BE BE159586A patent/BE832888A/xx unknown
- 1975-08-29 CH CH1120475A patent/CH612687A5/xx not_active IP Right Cessation
- 1975-08-29 FR FR7526649A patent/FR2282898A1/fr active Granted
- 1975-08-29 IE IE1903/75A patent/IE41662B1/en unknown
- 1975-08-29 ZA ZA00755554A patent/ZA755554B/xx unknown
- 1975-08-29 NL NL7510225A patent/NL7510225A/xx not_active Application Discontinuation
- 1975-08-29 SE SE7509650A patent/SE411904B/xx unknown
- 1975-08-29 US US05/608,982 patent/US3981894A/en not_active Expired - Lifetime
- 1975-08-29 DK DK389375AA patent/DK136075B/da unknown
- 1975-08-29 JP JP50104824A patent/JPS5148648A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DK389375A (enExample) | 1976-03-01 |
| JPS5148648A (enExample) | 1976-04-26 |
| BE832888A (fr) | 1976-03-01 |
| IE41662B1 (en) | 1980-02-27 |
| NL7510225A (nl) | 1976-03-02 |
| DK136075C (enExample) | 1978-01-09 |
| ZA755554B (en) | 1976-08-25 |
| SE7509650L (sv) | 1976-03-01 |
| DK136075B (da) | 1977-08-08 |
| FR2282898B1 (enExample) | 1978-11-10 |
| IE41662L (en) | 1976-02-29 |
| US3981894A (en) | 1976-09-21 |
| GB1517278A (en) | 1978-07-12 |
| DE2538627A1 (de) | 1976-03-11 |
| FR2282898A1 (fr) | 1976-03-26 |
| CH612687A5 (enExample) | 1979-08-15 |
| AU8440375A (en) | 1977-03-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE411904B (sv) | Forfarande for framstellning av steroidderivat tillhorande androstan-serien | |
| SE419605B (sv) | Forfarande for framstellning av undertrycksformad gjutform | |
| NO144418C (no) | Fremgangsmaate til fremstilling av klorerte etenderivater | |
| SE7513085L (sv) | Forfarande for framstellning av etrar | |
| SE426828B (sv) | Nytt forfarande for framstellning av 7beta-acylamino-7alfa-alkoxicefalosporiner eller 6beta-acylamino-6alfa-alkoxipenicilliner | |
| SE409452B (sv) | Forfarande for framstellning av stilbenderivat | |
| SE423996B (sv) | Forfarande for framstellning av daunomycin- och adriamycin-derivat | |
| SE7506160L (sv) | Forfarande for framstellning av n-cykloalkylmetyldekahydroisokinoline | |
| SE7901000L (sv) | Forfarande for framstellning av terpenoidestrar av steroider | |
| SE7506237L (sv) | Forfarande for framstellning av dekahydroisokinolinderivat | |
| SE405976B (sv) | Forfarande for framstellning av anti-inflammatoriska steroider tillhorande androstan-serien | |
| SE425790B (sv) | Forfarande for framstellning av polylaurinlactam | |
| SE411453B (sv) | Forfarande for framstellning av 3-fluorcefalosporiner | |
| SE403477B (sv) | Forfarande for famstellning av substituerade indoleniner | |
| SE431207B (sv) | Forfarande for framstellning av tiazolidinderivat | |
| SE419646B (sv) | Forfarande for framstellning av 8-halogen-dibensofuran-3-ettiksyra-derivat | |
| SE7507648L (sv) | Forfarande for framstellning av basiskt substituerade derivat av 4-hydroxi-bensimidazol | |
| SE426827B (sv) | Nytt forfarande for framstellning av 7beta-acylamino-7alfa-alkoxicefalosporiner | |
| SE7513739L (sv) | Forfarande for framstellning av 2-scyl-4-oxo-pyrazino-isokonolin-derivat | |
| SE414028B (sv) | Forfarande for framstellning av terapeutisk verksamma fentiazinderivat | |
| SE7506196L (sv) | Forfarande for framstellning av amidin-hydrazon-derivat | |
| SE388854B (sv) | Forfarande for framstellning av fenylpyridylaminderivat | |
| SE7511801L (sv) | Forfarande for framstellning av ympsampolymerisat | |
| SE7508654L (sv) | Forfarande for framstellning av steroider | |
| SE431547B (sv) | Forfarande for framstellning av 3-metylencefamsulfoxider |