SE404775B - Tryckkensligt uppteckningsmaterial omfattande ett kromogent material, ett med detta reaktivt material samt ett terfenyllosningsmedel - Google Patents
Tryckkensligt uppteckningsmaterial omfattande ett kromogent material, ett med detta reaktivt material samt ett terfenyllosningsmedelInfo
- Publication number
- SE404775B SE404775B SE7301718A SE7301718A SE404775B SE 404775 B SE404775 B SE 404775B SE 7301718 A SE7301718 A SE 7301718A SE 7301718 A SE7301718 A SE 7301718A SE 404775 B SE404775 B SE 404775B
- Authority
- SE
- Sweden
- Prior art keywords
- chromogenate
- terphenyl
- solvent
- printing recording
- reactive
- Prior art date
Links
- 239000000463 material Substances 0.000 title 3
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical compound C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 title 1
- 239000002904 solvent Substances 0.000 title 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/165—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components characterised by the use of microcapsules; Special solvents for incorporating the ingredients
- B41M5/1655—Solvents
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US22565872A | 1972-02-11 | 1972-02-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE404775B true SE404775B (sv) | 1978-10-30 |
Family
ID=22845711
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7301718A SE404775B (sv) | 1972-02-11 | 1973-02-08 | Tryckkensligt uppteckningsmaterial omfattande ett kromogent material, ett med detta reaktivt material samt ett terfenyllosningsmedel |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS4892112A (index.php) |
| AR (1) | AR196904A1 (index.php) |
| BE (1) | BE795255A (index.php) |
| BR (1) | BR7300972D0 (index.php) |
| CA (1) | CA977963A (index.php) |
| CH (1) | CH569594A5 (index.php) |
| DE (1) | DE2306454C3 (index.php) |
| FI (1) | FI59051C (index.php) |
| FR (1) | FR2171818A5 (index.php) |
| GB (1) | GB1398199A (index.php) |
| IT (1) | IT978974B (index.php) |
| SE (1) | SE404775B (index.php) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA937824A (en) * | 1970-07-11 | 1973-12-04 | Kureha Kagaku Kogyo Kabushiki Kaisha | Microcapsules for carbonless copying paper |
| US3979327A (en) * | 1975-09-08 | 1976-09-07 | Monsanto Company | Dye solvents for pressure-sensitive copying systems |
| DE2950116A1 (de) * | 1978-12-16 | 1980-07-03 | Kores Nordic Deutschland | Durchschreibeformsatz |
| GB2061991B (en) * | 1979-10-26 | 1983-06-22 | Ciba Geigy Ag | Colour former composition |
| JPS5711085A (en) * | 1980-06-25 | 1982-01-20 | Nippon Petrochem Co Ltd | Recording material |
| DE3442268C1 (de) * | 1984-03-09 | 1990-08-02 | Papierfabrik August Koehler AG, 7602 Oberkirch | Verfahren zum Einkapseln geloester Reaktionspartner von Farbreaktionssystemen,die danach erhaeltlichen Kapseln sowie deren Verwendung in Farbreaktionspapieren |
| JPS62257879A (ja) * | 1986-05-02 | 1987-11-10 | Kureha Chem Ind Co Ltd | 感圧記録紙用染料溶剤及びその溶剤を用いた感圧記録紙 |
| DE3633116A1 (de) * | 1986-09-30 | 1988-04-07 | Feldmuehle Ag | Druckempfindliches aufzeichnungsmaterial |
| JPS6475283A (en) * | 1987-09-17 | 1989-03-20 | Nippon Kokan Kk | Solvent for pressure-sensitive copying paper |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2646367A (en) * | 1951-06-28 | 1953-07-21 | Ncr Co | Transfer paper |
| US3244550A (en) * | 1961-08-31 | 1966-04-05 | Burroughs Corp | Manifold sheets coated with lactone and related chromogenous compounds and reactive phenolics and method of marking |
| US3336337A (en) * | 1961-08-31 | 1967-08-15 | Burroughs Corp | Chromogenous tetrakis(aminophenyl) derivatives of benzodifuran |
| US3268537A (en) * | 1961-08-31 | 1966-08-23 | Burroughs Corp | Chromogenous aminophenyl derivatives of benzodifurandione |
| US3244549A (en) * | 1961-08-31 | 1966-04-05 | Burroughs Corp | Manifold sheets coated with lactone and related chromogenous compounds and reactive phenolics and method of marking |
| US3244728A (en) * | 1961-08-31 | 1966-04-05 | Burroughs Corp | Chromogenous amino derivatives of diphenylphthalan and marking method using same |
| US3244548A (en) * | 1961-08-31 | 1966-04-05 | Burroughs Corp | Manifold sheets coated with lactone and related chromogenous compounds and reactive phenolics and method of marking |
| JPS5249565B2 (index.php) * | 1972-04-20 | 1977-12-17 | ||
| JPS5316483B2 (index.php) * | 1972-06-20 | 1978-06-01 |
-
0
- BE BE795255D patent/BE795255A/xx not_active IP Right Cessation
-
1973
- 1973-02-06 FI FI34573A patent/FI59051C/fi active
- 1973-02-08 BR BR97273A patent/BR7300972D0/pt unknown
- 1973-02-08 SE SE7301718A patent/SE404775B/xx unknown
- 1973-02-09 GB GB643873A patent/GB1398199A/en not_active Expired
- 1973-02-09 CA CA163,432A patent/CA977963A/en not_active Expired
- 1973-02-09 DE DE19732306454 patent/DE2306454C3/de not_active Expired
- 1973-02-09 CH CH191673A patent/CH569594A5/xx not_active IP Right Cessation
- 1973-02-09 JP JP48015755A patent/JPS4892112A/ja active Pending
- 1973-02-09 IT IT2022973A patent/IT978974B/it active
- 1973-02-09 FR FR7304741A patent/FR2171818A5/fr not_active Expired
- 1973-02-09 AR AR24651073A patent/AR196904A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| BE795255A (fr) | 1973-08-09 |
| DE2306454B2 (de) | 1977-11-17 |
| BR7300972D0 (pt) | 1973-09-20 |
| FI59051C (fi) | 1981-06-10 |
| DE2306454A1 (de) | 1973-08-16 |
| FI59051B (fi) | 1981-02-27 |
| CH569594A5 (index.php) | 1975-11-28 |
| DE2306454C3 (de) | 1978-08-10 |
| IT978974B (it) | 1974-09-20 |
| CA977963A (en) | 1975-11-18 |
| JPS4892112A (index.php) | 1973-11-30 |
| GB1398199A (en) | 1975-06-18 |
| AR196904A1 (es) | 1974-02-28 |
| FR2171818A5 (index.php) | 1973-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL180048C (nl) | Electrofotografisch registreermateriaal. | |
| JPS55113583A (en) | Ink injection type recorder | |
| SE396720B (sv) | Skrivdon med indragbar skrivenhet | |
| AR193314A1 (es) | Un material en hojas provisto de un estrato reproductor de imagenes | |
| SE407196B (sv) | Anordning for tryckning och pasettning av en etikett under en och samma arbetscykel | |
| ATA903873A (de) | Schnelldrucker | |
| SE392244B (sv) | Hoghastighetsskrivare med roterbart typhjul | |
| AT327241B (de) | Schnelldrucker | |
| SE384778B (sv) | Potatisupptagningsmaskin | |
| NL175108C (nl) | Elektrofotografisch registreermateriaal. | |
| NL180708C (nl) | Elektrofotografisch registreermateriaal. | |
| DK129567B (da) | Beholder eller tromle med et låg. | |
| NL7409897A (nl) | Magnetisch registratiemateriaal. | |
| RO68683A (ro) | Canal cu turbionare | |
| SE404775B (sv) | Tryckkensligt uppteckningsmaterial omfattande ett kromogent material, ett med detta reaktivt material samt ett terfenyllosningsmedel | |
| NL7409554A (nl) | Electrofotografisch registreermateriaal. | |
| AR201294A1 (es) | Material de registro fotografico | |
| SE7602096L (sv) | Tryckkensligt uppteckningsmaterial | |
| IT980859B (it) | Carrello elevatore a forca | |
| ZA741382B (en) | Thermoreactive recording material | |
| AT331059B (de) | Banddrucker | |
| CH554007A (de) | Elektrophotographisches aufzeichnungsmaterial. | |
| NL7610055A (nl) | Drukmachine met roterende schablonen. | |
| AT325638B (de) | Aufzeichnungsmaterial | |
| BE797558A (nl) | Elektrografisch registreermateriaal |