SE187595C1 - - Google Patents
Info
- Publication number
- SE187595C1 SE187595C1 SE187595DA SE187595C1 SE 187595 C1 SE187595 C1 SE 187595C1 SE 187595D A SE187595D A SE 187595DA SE 187595 C1 SE187595 C1 SE 187595C1
- Authority
- SE
- Sweden
- Prior art keywords
- acid
- water
- potassium permanganate
- solution
- oxidized
- Prior art date
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 15
- 239000012286 potassium permanganate Substances 0.000 claims description 15
- 150000002148 esters Chemical class 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 235000011007 phosphoric acid Nutrition 0.000 claims 2
- 150000003016 phosphoric acids Chemical class 0.000 claims 2
- 230000004888 barrier function Effects 0.000 claims 1
- 239000013256 coordination polymer Substances 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 150000003457 sulfones Chemical class 0.000 claims 1
- 150000003462 sulfoxides Chemical class 0.000 claims 1
- 125000000101 thioether group Chemical group 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 239000000243 solution Substances 0.000 description 16
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 9
- 239000003921 oil Substances 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 5
- -1 oxyalkyl alkyl sulfones Chemical class 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000010802 sludge Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 3
- 150000003568 thioethers Chemical class 0.000 description 3
- 229920000297 Rayon Polymers 0.000 description 2
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical compound OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FZAJEGWDPOYEEC-UHFFFAOYSA-N 1-[ethoxy(ethylsulfonylmethyl)phosphoryl]oxyethane Chemical compound CCOP(=O)(OCC)CS(=O)(=O)CC FZAJEGWDPOYEEC-UHFFFAOYSA-N 0.000 description 1
- BULBBCFURGVLNZ-UHFFFAOYSA-N 1-diethoxyphosphorylpropane-1-thiol Chemical compound SC(CC)P(OCC)(OCC)=O BULBBCFURGVLNZ-UHFFFAOYSA-N 0.000 description 1
- JBGWMRAMUROVND-UHFFFAOYSA-N 1-sulfanylidenethiophene Chemical compound S=S1C=CC=C1 JBGWMRAMUROVND-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 208000000044 Amnesia Diseases 0.000 description 1
- 208000031091 Amnestic disease Diseases 0.000 description 1
- 241001474374 Blennius Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108091006629 SLC13A2 Proteins 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000006986 amnesia Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- UCQFCFPECQILOL-UHFFFAOYSA-N diethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OCC UCQFCFPECQILOL-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- GGZSXNGEPOXZRP-UHFFFAOYSA-N sulfanyl dihydrogen phosphate Chemical class OP(O)(=O)OS GGZSXNGEPOXZRP-UHFFFAOYSA-N 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE187595T |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE187595C1 true SE187595C1 (enExample) | 1963-01-01 |
Family
ID=41974696
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE187595D SE187595C1 (enExample) |
Country Status (1)
| Country | Link |
|---|---|
| SE (1) | SE187595C1 (enExample) |
-
0
- SE SE187595D patent/SE187595C1/sv unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2881201A (en) | Substituted mercaptoalkyl esters of phosphoric acids and their derivatives | |
| US2758115A (en) | Derivatives of thiophosphoric acid | |
| US3042703A (en) | Thiophosphoric acid esters and their production | |
| DD201685A5 (de) | Verfahren zur herstellung von alkanol-phosphorsaeureammoniumalkylestern | |
| EP0032202B1 (de) | Verfahren zur Herstellung neutraler Phosphorigsäurearylester | |
| US2862019A (en) | Thiophosphoric acid esters and their production | |
| US3629411A (en) | Fungicidal compositions and methods of combating fungi using o-alkyl-s s-dialkyl dithiophosphates | |
| US2552538A (en) | Diamidothiophosphates | |
| US3056825A (en) | Thiophosphoric acid esters and a process for their production | |
| US2952700A (en) | Thiophosphoric acid esters and their production | |
| SE187595C1 (enExample) | ||
| US3070619A (en) | Production of 2-mercapto-2-thiono-derivatives of heterocyclic phosphoruscontaining compounds | |
| US2843588A (en) | Derivatives of thiophosphoric acid | |
| DE948241C (de) | Verfahren zur Herstellung von sulfongruppenhaltigen Estern der Saeuren des Phosphors | |
| US3076009A (en) | Thiophosphoric acid esters and production | |
| US2903474A (en) | Production of spiro heterocyclic phosphorus-containing compounds | |
| Michalski et al. | 335. Organophosphorus compounds of sulphur and selenium. Part XV. Reactions of organic thiosulphonates with trialkyl phosphites and dialkyl phosphites | |
| NO118208B (enExample) | ||
| US3156718A (en) | Process for preparing thiophosphoric, thiophosphonic, and thiophosphinic acid esters | |
| US3197494A (en) | S-(10-phenoxarsinyl) xanthates | |
| NO130697B (enExample) | ||
| US3053847A (en) | Phosphorus compounds and processes for their production | |
| US2957018A (en) | Cyanoethyl esters of phosphoroamidic acids | |
| US3035082A (en) | Disulfides of the phosphoric, phosphonic and phosphinic acid series and process for the production thereof | |
| US3082240A (en) | Process for the production of phosphoric acid esters |