RU2584688C2 - Синтез и противораковая активность производных арил и гетероарилхинолинов - Google Patents
Синтез и противораковая активность производных арил и гетероарилхинолинов Download PDFInfo
- Publication number
- RU2584688C2 RU2584688C2 RU2013105151/04A RU2013105151A RU2584688C2 RU 2584688 C2 RU2584688 C2 RU 2584688C2 RU 2013105151/04 A RU2013105151/04 A RU 2013105151/04A RU 2013105151 A RU2013105151 A RU 2013105151A RU 2584688 C2 RU2584688 C2 RU 2584688C2
- Authority
- RU
- Russia
- Prior art keywords
- compound
- fluorophenyl
- nmr
- mhz
- methoxyphenyl
- Prior art date
Links
- -1 heteroaryl quinolines Chemical class 0.000 title claims description 265
- 230000001093 anti-cancer Effects 0.000 title abstract description 11
- 238000003786 synthesis reaction Methods 0.000 title description 97
- 230000015572 biosynthetic process Effects 0.000 title description 91
- 229940111121 antirheumatic drug quinolines Drugs 0.000 title description 3
- 125000005418 aryl aryl group Chemical group 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 342
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 60
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 47
- 239000001257 hydrogen Substances 0.000 claims abstract description 45
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 42
- 150000003839 salts Chemical class 0.000 claims abstract description 30
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 16
- 201000011510 cancer Diseases 0.000 claims abstract description 11
- 229910021645 metal ion Inorganic materials 0.000 claims abstract description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims abstract 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 20
- 229910052757 nitrogen Inorganic materials 0.000 claims description 18
- 231100000135 cytotoxicity Toxicity 0.000 claims description 17
- 230000003013 cytotoxicity Effects 0.000 claims description 17
- 150000002431 hydrogen Chemical group 0.000 claims description 17
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 11
- 239000011734 sodium Substances 0.000 claims description 9
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- WTNCYYJUSGGGBL-UHFFFAOYSA-N 2-(2-fluorophenyl)-6-methoxy-7-phenylmethoxy-3h-quinolin-4-one Chemical compound COC1=CC=2C(=O)CC(C=3C(=CC=CC=3)F)=NC=2C=C1OCC1=CC=CC=C1 WTNCYYJUSGGGBL-UHFFFAOYSA-N 0.000 claims description 5
- YGNALDVIZJZTID-UHFFFAOYSA-N 2-(3-fluorophenyl)-5-hydroxy-6-methoxy-3h-quinolin-4-one Chemical compound C1C(=O)C2=C(O)C(OC)=CC=C2N=C1C1=CC=CC(F)=C1 YGNALDVIZJZTID-UHFFFAOYSA-N 0.000 claims description 5
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 5
- HDFFVHSMHLDSLO-UHFFFAOYSA-M dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)([O-])OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-M 0.000 claims description 5
- YJBQYJRJKQRHBY-UHFFFAOYSA-N 2-(2-fluorophenyl)-5,6-dihydroxy-3h-quinolin-4-one Chemical compound C1C(=O)C2=C(O)C(O)=CC=C2N=C1C1=CC=CC=C1F YJBQYJRJKQRHBY-UHFFFAOYSA-N 0.000 claims description 4
- ADZGYPFAPJHMFO-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-6-pyrrolidin-1-yl-3h-quinolin-4-one Chemical compound OC1=CC=CC(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCCC2)=C1 ADZGYPFAPJHMFO-UHFFFAOYSA-N 0.000 claims description 4
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 125000001617 2,3-dimethoxy phenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 3
- CDUXDSPQSMZJAM-UHFFFAOYSA-N 2-(1,3-benzodioxol-4-yl)-6-pyrrolidin-1-yl-3h-quinolin-4-one Chemical compound C1=C2C(=O)CC(C=3C=4OCOC=4C=CC=3)=NC2=CC=C1N1CCCC1 CDUXDSPQSMZJAM-UHFFFAOYSA-N 0.000 claims description 3
- QIRSKBYFUQMDFQ-UHFFFAOYSA-N 2-(2,3-dimethoxyphenyl)-6-morpholin-4-yl-3h-quinolin-4-one Chemical compound COC1=CC=CC(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCOCC2)=C1OC QIRSKBYFUQMDFQ-UHFFFAOYSA-N 0.000 claims description 3
- GVSZPGGMJBJOAQ-UHFFFAOYSA-N 2-(2,3-dimethoxyphenyl)-6-pyrrolidin-1-yl-3h-quinolin-4-one Chemical compound COC1=CC=CC(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCCC2)=C1OC GVSZPGGMJBJOAQ-UHFFFAOYSA-N 0.000 claims description 3
- YQNUDOQWUQMLON-UHFFFAOYSA-N 2-(2,5-dimethoxyphenyl)-6-morpholin-4-yl-3h-quinolin-4-one Chemical compound COC1=CC=C(OC)C(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCOCC2)=C1 YQNUDOQWUQMLON-UHFFFAOYSA-N 0.000 claims description 3
- JNISVSOAPNYYSA-UHFFFAOYSA-N 2-(2,5-dimethoxyphenyl)-6-pyrrolidin-1-yl-3h-quinolin-4-one Chemical compound COC1=CC=C(OC)C(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCCC2)=C1 JNISVSOAPNYYSA-UHFFFAOYSA-N 0.000 claims description 3
- BTFRGECHKBPNKA-UHFFFAOYSA-N 2-(2-fluorophenyl)-5-hydroxy-6-methoxy-3h-quinolin-4-one Chemical compound C1C(=O)C2=C(O)C(OC)=CC=C2N=C1C1=CC=CC=C1F BTFRGECHKBPNKA-UHFFFAOYSA-N 0.000 claims description 3
- DDLKWZRPCZKPDZ-UHFFFAOYSA-N 2-(2-fluorophenyl)-7-hydroxy-6-methoxy-3h-quinolin-4-one Chemical compound N=1C=2C=C(O)C(OC)=CC=2C(=O)CC=1C1=CC=CC=C1F DDLKWZRPCZKPDZ-UHFFFAOYSA-N 0.000 claims description 3
- GAUPJJSVSFSEQC-UHFFFAOYSA-N 2-(2-hydroxyphenyl)-6-pyrrolidin-1-yl-3H-quinolin-4-one Chemical compound OC1=CC=CC=C1C1=NC2=CC=C(N3CCCC3)C=C2C(=O)C1 GAUPJJSVSFSEQC-UHFFFAOYSA-N 0.000 claims description 3
- NWSFBOUOSDYCRL-UHFFFAOYSA-N 2-(2-methoxyphenyl)-6-morpholin-4-yl-3h-quinolin-4-one Chemical compound COC1=CC=CC=C1C1=NC2=CC=C(N3CCOCC3)C=C2C(=O)C1 NWSFBOUOSDYCRL-UHFFFAOYSA-N 0.000 claims description 3
- NQBHETYEYGCSLX-UHFFFAOYSA-N 2-(2-methoxyphenyl)-6-pyrrolidin-1-yl-3h-quinolin-4-one Chemical compound COC1=CC=CC=C1C1=NC2=CC=C(N3CCCC3)C=C2C(=O)C1 NQBHETYEYGCSLX-UHFFFAOYSA-N 0.000 claims description 3
- KLCLLEJBPGRPDZ-UHFFFAOYSA-N 2-(3-fluorophenyl)-6-methoxy-7-phenylmethoxy-3h-quinolin-4-one Chemical compound COC1=CC=2C(=O)CC(C=3C=C(F)C=CC=3)=NC=2C=C1OCC1=CC=CC=C1 KLCLLEJBPGRPDZ-UHFFFAOYSA-N 0.000 claims description 3
- MIVPZZCDDAFUKJ-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-6-morpholin-4-yl-3h-quinolin-4-one Chemical compound OC1=CC=CC(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCOCC2)=C1 MIVPZZCDDAFUKJ-UHFFFAOYSA-N 0.000 claims description 3
- DLPCEGDMVYYYGK-UHFFFAOYSA-N 2-(4-fluorophenyl)-6-methoxy-7-phenylmethoxy-3h-quinolin-4-one Chemical compound COC1=CC=2C(=O)CC(C=3C=CC(F)=CC=3)=NC=2C=C1OCC1=CC=CC=C1 DLPCEGDMVYYYGK-UHFFFAOYSA-N 0.000 claims description 3
- KCEZEENOJKUQHV-UHFFFAOYSA-N 2-(4-hydroxy-3-methoxyphenyl)-6-morpholin-4-yl-3H-quinolin-4-one Chemical compound C1=C(O)C(OC)=CC(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCOCC2)=C1 KCEZEENOJKUQHV-UHFFFAOYSA-N 0.000 claims description 3
- YVFBEGXEFNPUFP-UHFFFAOYSA-N 2-(4-hydroxy-3-methoxyphenyl)-6-pyrrolidin-1-yl-3H-quinolin-4-one Chemical compound C1=C(O)C(OC)=CC(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCCC2)=C1 YVFBEGXEFNPUFP-UHFFFAOYSA-N 0.000 claims description 3
- GALIUVMLPUODIN-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-6-morpholin-4-yl-3H-quinolin-4-one Chemical compound C1=CC(O)=CC=C1C1=NC2=CC=C(N3CCOCC3)C=C2C(=O)C1 GALIUVMLPUODIN-UHFFFAOYSA-N 0.000 claims description 3
- OMXRWTNQGMAOTC-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-6-pyrrolidin-1-yl-3H-quinolin-4-one Chemical compound C1=CC(O)=CC=C1C1=NC2=CC=C(N3CCCC3)C=C2C(=O)C1 OMXRWTNQGMAOTC-UHFFFAOYSA-N 0.000 claims description 3
- YMKXPXMQLCFQHR-UHFFFAOYSA-N 2-(4-methoxyphenyl)-6-morpholin-4-yl-3h-quinolin-4-one Chemical compound C1=CC(OC)=CC=C1C1=NC2=CC=C(N3CCOCC3)C=C2C(=O)C1 YMKXPXMQLCFQHR-UHFFFAOYSA-N 0.000 claims description 3
- OXPJDSNLYGKWKK-UHFFFAOYSA-N 2-(4-methoxyphenyl)-6-pyrrolidin-1-yl-3h-quinolin-4-one Chemical compound C1=CC(OC)=CC=C1C1=NC2=CC=C(N3CCCC3)C=C2C(=O)C1 OXPJDSNLYGKWKK-UHFFFAOYSA-N 0.000 claims description 3
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 3
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 3
- QTSVXBHDSGTRIZ-UHFFFAOYSA-N 6-(3-hydroxy-5-methoxyphenyl)-7h-[1,3]dioxolo[4,5-g]quinolin-8-one Chemical compound COC1=CC(O)=CC(C=2CC(=O)C3=CC=4OCOC=4C=C3N=2)=C1 QTSVXBHDSGTRIZ-UHFFFAOYSA-N 0.000 claims description 3
- BPRQAMGRSAVFFA-UHFFFAOYSA-N 6-(dimethylamino)-2-(2-hydroxyphenyl)-3H-quinolin-4-one Chemical compound C1C(=O)C2=CC(N(C)C)=CC=C2N=C1C1=CC=CC=C1O BPRQAMGRSAVFFA-UHFFFAOYSA-N 0.000 claims description 3
- GGRFKQQPDXKDSF-UHFFFAOYSA-N 6-(dimethylamino)-2-(3-hydroxyphenyl)-3h-quinolin-4-one Chemical compound C1C(=O)C2=CC(N(C)C)=CC=C2N=C1C1=CC=CC(O)=C1 GGRFKQQPDXKDSF-UHFFFAOYSA-N 0.000 claims description 3
- FERCZPQMLJECHI-UHFFFAOYSA-N 6-(dimethylamino)-2-(4-hydroxyphenyl)-3H-quinolin-4-one Chemical compound C1C(=O)C2=CC(N(C)C)=CC=C2N=C1C1=CC=C(O)C=C1 FERCZPQMLJECHI-UHFFFAOYSA-N 0.000 claims description 3
- VKHGNORXULMNLM-UHFFFAOYSA-N 7-(2-fluorophenyl)-8h-[1,3]dioxolo[4,5-f]quinolin-9-one Chemical compound FC1=CC=CC=C1C1=NC2=CC=C(OCO3)C3=C2C(=O)C1 VKHGNORXULMNLM-UHFFFAOYSA-N 0.000 claims description 3
- IUQRJJDFIZXQKB-UHFFFAOYSA-N dibenzyl [3-[8-bis(phenylmethoxy)phosphoryloxy-[1,3]dioxolo[4,5-g]quinolin-6-yl]-5-methoxyphenyl] phosphate Chemical compound C=1C(C=2N=C3C=C4OCOC4=CC3=C(OP(=O)(OCC=3C=CC=CC=3)OCC=3C=CC=CC=3)C=2)=CC(OC)=CC=1OP(=O)(OCC=1C=CC=CC=1)OCC1=CC=CC=C1 IUQRJJDFIZXQKB-UHFFFAOYSA-N 0.000 claims description 3
- NJTWKXCHMCHOMA-UHFFFAOYSA-N dibenzyl [3-methoxy-5-(8-oxo-7h-[1,3]dioxolo[4,5-g]quinolin-6-yl)phenyl] phosphate Chemical compound C=1C(C=2CC(=O)C3=CC=4OCOC=4C=C3N=2)=CC(OC)=CC=1OP(=O)(OCC=1C=CC=CC=1)OCC1=CC=CC=C1 NJTWKXCHMCHOMA-UHFFFAOYSA-N 0.000 claims description 3
- ZDWFMAHQGDEALT-UHFFFAOYSA-N foslinanib Chemical compound C=1C(=O)C2=C(OP(O)(O)=O)C(OC)=CC=C2NC=1C1=CC=CC(F)=C1 ZDWFMAHQGDEALT-UHFFFAOYSA-N 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- MFGDULMVCLCTNJ-UHFFFAOYSA-N 2-(2-hydroxyphenyl)-6-morpholin-4-yl-3H-quinolin-4-one Chemical compound OC1=CC=CC=C1C1=NC2=CC=C(N3CCOCC3)C=C2C(=O)C1 MFGDULMVCLCTNJ-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- LPYHSNNDHBQGKT-UHFFFAOYSA-N [2-(3-fluorophenyl)-6-methoxy-4-phosphonooxyquinolin-5-yl] dihydrogen phosphate Chemical compound C1=C(OP(O)(O)=O)C2=C(OP(O)(O)=O)C(OC)=CC=C2N=C1C1=CC=CC(F)=C1 LPYHSNNDHBQGKT-UHFFFAOYSA-N 0.000 claims description 2
- QALVOQLIVKMZLG-UHFFFAOYSA-N [3-(4-oxo-6-pyrrolidin-1-yl-1h-quinolin-2-yl)phenyl] dihydrogen phosphate Chemical compound OP(O)(=O)OC1=CC=CC(C=2NC3=CC=C(C=C3C(=O)C=2)N2CCCC2)=C1 QALVOQLIVKMZLG-UHFFFAOYSA-N 0.000 claims description 2
- 125000005605 benzo group Chemical group 0.000 claims description 2
- NXOBWWCPDKBZEC-UHFFFAOYSA-N dibenzyl [2-(3-fluorophenyl)-6-methoxy-4-oxo-1h-quinolin-5-yl] phosphate Chemical compound COC1=CC=C2NC(C=3C=C(F)C=CC=3)=CC(=O)C2=C1OP(=O)(OCC=1C=CC=CC=1)OCC1=CC=CC=C1 NXOBWWCPDKBZEC-UHFFFAOYSA-N 0.000 claims description 2
- ZHHHZNACNCCELR-UHFFFAOYSA-N dibenzyl [3-(4-oxo-6-pyrrolidin-1-yl-1h-quinolin-2-yl)phenyl] phosphate Chemical compound C1=C2C(=O)C=C(C=3C=C(OP(=O)(OCC=4C=CC=CC=4)OCC=4C=CC=CC=4)C=CC=3)NC2=CC=C1N1CCCC1 ZHHHZNACNCCELR-UHFFFAOYSA-N 0.000 claims description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 claims description 2
- 229910000397 disodium phosphate Inorganic materials 0.000 claims description 2
- 235000019800 disodium phosphate Nutrition 0.000 claims description 2
- 230000001939 inductive effect Effects 0.000 claims description 2
- 239000001488 sodium phosphate Substances 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims 6
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 claims 2
- 125000005530 alkylenedioxy group Chemical group 0.000 claims 2
- 229910001415 sodium ion Inorganic materials 0.000 claims 2
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims 1
- RCUUBYOFFCKFAT-UHFFFAOYSA-N 2-(2,5-dihydroxyphenyl)-6-morpholin-4-yl-3H-quinolin-4-one Chemical compound OC1=CC=C(O)C(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCOCC2)=C1 RCUUBYOFFCKFAT-UHFFFAOYSA-N 0.000 claims 1
- CQXWGQXYEMNTFP-UHFFFAOYSA-N 2-(2,5-dihydroxyphenyl)-6-pyrrolidin-1-yl-3H-quinolin-4-one Chemical compound OC1=CC=C(O)C(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCCC2)=C1 CQXWGQXYEMNTFP-UHFFFAOYSA-N 0.000 claims 1
- DKFPLGIHEOROJP-UHFFFAOYSA-N 2-(5-hydroxy-2-methoxyphenyl)-6-morpholin-4-yl-3h-quinolin-4-one Chemical compound COC1=CC=C(O)C=C1C1=NC2=CC=C(N3CCOCC3)C=C2C(=O)C1 DKFPLGIHEOROJP-UHFFFAOYSA-N 0.000 claims 1
- HVWAEBBEEFGNSN-UHFFFAOYSA-N 2-(5-hydroxy-2-methoxyphenyl)-6-pyrrolidin-1-yl-3h-quinolin-4-one Chemical compound COC1=CC=C(O)C=C1C1=NC2=CC=C(N3CCCC3)C=C2C(=O)C1 HVWAEBBEEFGNSN-UHFFFAOYSA-N 0.000 claims 1
- 206010005003 Bladder cancer Diseases 0.000 claims 1
- 206010005949 Bone cancer Diseases 0.000 claims 1
- 208000018084 Bone neoplasm Diseases 0.000 claims 1
- 208000003174 Brain Neoplasms Diseases 0.000 claims 1
- 206010006187 Breast cancer Diseases 0.000 claims 1
- 208000026310 Breast neoplasm Diseases 0.000 claims 1
- 206010008342 Cervix carcinoma Diseases 0.000 claims 1
- 206010009944 Colon cancer Diseases 0.000 claims 1
- 206010014733 Endometrial cancer Diseases 0.000 claims 1
- 206010014759 Endometrial neoplasm Diseases 0.000 claims 1
- 208000000461 Esophageal Neoplasms Diseases 0.000 claims 1
- 208000008839 Kidney Neoplasms Diseases 0.000 claims 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims 1
- 206010025323 Lymphomas Diseases 0.000 claims 1
- 206010030155 Oesophageal carcinoma Diseases 0.000 claims 1
- 206010033128 Ovarian cancer Diseases 0.000 claims 1
- 206010061535 Ovarian neoplasm Diseases 0.000 claims 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims 1
- 206010060862 Prostate cancer Diseases 0.000 claims 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims 1
- 206010038389 Renal cancer Diseases 0.000 claims 1
- 206010039491 Sarcoma Diseases 0.000 claims 1
- 208000000453 Skin Neoplasms Diseases 0.000 claims 1
- 208000021712 Soft tissue sarcoma Diseases 0.000 claims 1
- 208000005718 Stomach Neoplasms Diseases 0.000 claims 1
- 208000024770 Thyroid neoplasm Diseases 0.000 claims 1
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 claims 1
- 208000006105 Uterine Cervical Neoplasms Diseases 0.000 claims 1
- 201000010881 cervical cancer Diseases 0.000 claims 1
- 208000029742 colonic neoplasm Diseases 0.000 claims 1
- 201000004101 esophageal cancer Diseases 0.000 claims 1
- 206010017758 gastric cancer Diseases 0.000 claims 1
- 201000010536 head and neck cancer Diseases 0.000 claims 1
- 208000014829 head and neck neoplasm Diseases 0.000 claims 1
- 201000010982 kidney cancer Diseases 0.000 claims 1
- 208000032839 leukemia Diseases 0.000 claims 1
- 201000007270 liver cancer Diseases 0.000 claims 1
- 208000014018 liver neoplasm Diseases 0.000 claims 1
- 201000005202 lung cancer Diseases 0.000 claims 1
- 208000020816 lung neoplasm Diseases 0.000 claims 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 claims 1
- 201000002528 pancreatic cancer Diseases 0.000 claims 1
- 208000008443 pancreatic carcinoma Diseases 0.000 claims 1
- 201000000849 skin cancer Diseases 0.000 claims 1
- 201000011549 stomach cancer Diseases 0.000 claims 1
- 201000002510 thyroid cancer Diseases 0.000 claims 1
- 201000005112 urinary bladder cancer Diseases 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 12
- 239000000126 substance Substances 0.000 abstract description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 165
- 239000007787 solid Substances 0.000 description 131
- 238000005160 1H NMR spectroscopy Methods 0.000 description 127
- 238000004458 analytical method Methods 0.000 description 119
- 238000000034 method Methods 0.000 description 119
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 95
- 238000004440 column chromatography Methods 0.000 description 79
- 239000012043 crude product Substances 0.000 description 63
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 58
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 57
- 239000000741 silica gel Substances 0.000 description 57
- 229910002027 silica gel Inorganic materials 0.000 description 57
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 54
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 54
- 239000000203 mixture Substances 0.000 description 47
- 239000000243 solution Substances 0.000 description 40
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 36
- 239000000460 chlorine Substances 0.000 description 33
- 125000003118 aryl group Chemical group 0.000 description 32
- 125000000217 alkyl group Chemical group 0.000 description 31
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 210000004027 cell Anatomy 0.000 description 29
- 125000000623 heterocyclic group Chemical group 0.000 description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 26
- 235000019439 ethyl acetate Nutrition 0.000 description 26
- 239000002244 precipitate Substances 0.000 description 26
- 125000001072 heteroaryl group Chemical group 0.000 description 25
- 125000000753 cycloalkyl group Chemical group 0.000 description 23
- AVYVHIKSFXVDBG-UHFFFAOYSA-N N-benzyl-N-hydroxy-2,2-dimethylbutanamide Chemical compound C(C1=CC=CC=C1)N(C(C(CC)(C)C)=O)O AVYVHIKSFXVDBG-UHFFFAOYSA-N 0.000 description 22
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 21
- 239000000725 suspension Substances 0.000 description 20
- 150000002500 ions Chemical class 0.000 description 19
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 18
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 18
- 238000012360 testing method Methods 0.000 description 18
- 229910004298 SiO 2 Inorganic materials 0.000 description 17
- 125000003545 alkoxy group Chemical group 0.000 description 17
- 229910052799 carbon Inorganic materials 0.000 description 17
- 239000007788 liquid Substances 0.000 description 17
- 239000000651 prodrug Substances 0.000 description 17
- 229940002612 prodrug Drugs 0.000 description 17
- 241001465754 Metazoa Species 0.000 description 16
- 125000003342 alkenyl group Chemical group 0.000 description 16
- 201000010099 disease Diseases 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 15
- 125000001424 substituent group Chemical group 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- 238000011282 treatment Methods 0.000 description 14
- DWTHYSZSRJOMSC-UHFFFAOYSA-N 1-(6-amino-1,3-benzodioxol-5-yl)ethanone Chemical compound C1=C(N)C(C(=O)C)=CC2=C1OCO2 DWTHYSZSRJOMSC-UHFFFAOYSA-N 0.000 description 13
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 13
- 230000000259 anti-tumor effect Effects 0.000 description 13
- 125000004432 carbon atom Chemical group C* 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- 239000002253 acid Substances 0.000 description 12
- 125000003282 alkyl amino group Chemical group 0.000 description 12
- 125000004429 atom Chemical group 0.000 description 12
- 239000003814 drug Substances 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 11
- NSBNXCZCLRBQTA-UHFFFAOYSA-N dibenzyl bis(phenylmethoxy)phosphoryl phosphate Chemical compound C=1C=CC=CC=1COP(OP(=O)(OCC=1C=CC=CC=1)OCC=1C=CC=CC=1)(=O)OCC1=CC=CC=C1 NSBNXCZCLRBQTA-UHFFFAOYSA-N 0.000 description 11
- 229940079593 drug Drugs 0.000 description 11
- 125000001188 haloalkyl group Chemical group 0.000 description 11
- 150000003254 radicals Chemical class 0.000 description 11
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 10
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 10
- 230000037396 body weight Effects 0.000 description 10
- 229910052763 palladium Inorganic materials 0.000 description 10
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 9
- SPXSEZMVRJLHQG-XMMPIXPASA-N [(2R)-1-[[4-[(3-phenylmethoxyphenoxy)methyl]phenyl]methyl]pyrrolidin-2-yl]methanol Chemical compound C(C1=CC=CC=C1)OC=1C=C(OCC2=CC=C(CN3[C@H](CCC3)CO)C=C2)C=CC=1 SPXSEZMVRJLHQG-XMMPIXPASA-N 0.000 description 9
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 9
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 9
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 9
- 125000004414 alkyl thio group Chemical group 0.000 description 9
- 125000001589 carboacyl group Chemical group 0.000 description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 229940127271 compound 49 Drugs 0.000 description 9
- 239000013058 crude material Substances 0.000 description 9
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 9
- 229960004679 doxorubicin Drugs 0.000 description 9
- 229910052736 halogen Inorganic materials 0.000 description 9
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 9
- 150000004712 monophosphates Chemical class 0.000 description 9
- PIDFDZJZLOTZTM-KHVQSSSXSA-N ombitasvir Chemical compound COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C([C@H]2N([C@@H](CC2)C=2C=CC(NC(=O)[C@H]3N(CCC3)C(=O)[C@@H](NC(=O)OC)C(C)C)=CC=2)C=2C=CC(=CC=2)C(C)(C)C)C=C1 PIDFDZJZLOTZTM-KHVQSSSXSA-N 0.000 description 9
- 238000000746 purification Methods 0.000 description 9
- 238000004809 thin layer chromatography Methods 0.000 description 9
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- 241000699670 Mus sp. Species 0.000 description 8
- HEMHJVSKTPXQMS-DYCDLGHISA-M Sodium hydroxide-d Chemical compound [Na+].[2H][O-] HEMHJVSKTPXQMS-DYCDLGHISA-M 0.000 description 8
- XTEOJPUYZWEXFI-UHFFFAOYSA-N butyl n-[3-[4-(imidazol-1-ylmethyl)phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate Chemical compound S1C(CC(C)C)=CC(C=2C=CC(CN3C=NC=C3)=CC=2)=C1S(=O)(=O)NC(=O)OCCCC XTEOJPUYZWEXFI-UHFFFAOYSA-N 0.000 description 8
- 229940127573 compound 38 Drugs 0.000 description 8
- 238000011161 development Methods 0.000 description 8
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- 125000005843 halogen group Chemical group 0.000 description 8
- 238000000338 in vitro Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- DAVQRPLIYCFEJK-UHFFFAOYSA-N methyl 3-methoxy-5-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(OC)=CC(OCC=2C=CC=CC=2)=C1 DAVQRPLIYCFEJK-UHFFFAOYSA-N 0.000 description 8
- 238000013298 xenograft nude mouse model Methods 0.000 description 8
- 0 *c1c(*)c(*)c2c(O*)cc(C=C)nc2c1 Chemical compound *c1c(*)c(*)c2c(O*)cc(C=C)nc2c1 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- ZYRGNJPZDQKYFY-UHFFFAOYSA-N 3-methoxy-5-phenylmethoxybenzoyl chloride Chemical compound ClC(=O)C1=CC(OC)=CC(OCC=2C=CC=CC=2)=C1 ZYRGNJPZDQKYFY-UHFFFAOYSA-N 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 7
- 150000002367 halogens Chemical class 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 7
- BOLDJAUMGUJJKM-LSDHHAIUSA-N renifolin D Natural products CC(=C)[C@@H]1Cc2c(O)c(O)ccc2[C@H]1CC(=O)c3ccc(O)cc3O BOLDJAUMGUJJKM-LSDHHAIUSA-N 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 230000036962 time dependent Effects 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 125000004442 acylamino group Chemical group 0.000 description 6
- 239000002246 antineoplastic agent Substances 0.000 description 6
- 125000001769 aryl amino group Chemical group 0.000 description 6
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 6
- BJXYHBKEQFQVES-NWDGAFQWSA-N enpatoran Chemical compound N[C@H]1CN(C[C@H](C1)C(F)(F)F)C1=C2C=CC=NC2=C(C=C1)C#N BJXYHBKEQFQVES-NWDGAFQWSA-N 0.000 description 6
- TYQKHCZKVCIXAJ-UHFFFAOYSA-N ethyl 1,3-benzodioxole-4-carboxylate Chemical compound CCOC(=O)C1=CC=CC2=C1OCO2 TYQKHCZKVCIXAJ-UHFFFAOYSA-N 0.000 description 6
- 238000001727 in vivo Methods 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- RNVFYQUEEMZKLR-UHFFFAOYSA-N methyl 3,5-dihydroxybenzoate Chemical compound COC(=O)C1=CC(O)=CC(O)=C1 RNVFYQUEEMZKLR-UHFFFAOYSA-N 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 125000006239 protecting group Chemical group 0.000 description 6
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 6
- 125000006413 ring segment Chemical group 0.000 description 6
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 6
- 210000004881 tumor cell Anatomy 0.000 description 6
- 230000004614 tumor growth Effects 0.000 description 6
- WYFCZWSWFGJODV-MIANJLSGSA-N 4-[[(1s)-2-[(e)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(4-methyl-2-oxopiperazin-1-yl)-3,4-dihydro-1h-isoquinoline-1-carbonyl]amino]benzoic acid Chemical compound O=C1CN(C)CCN1C1=CC=CC2=C1CCN(C(=O)\C=C\C=1C(=CC=C(Cl)C=1F)N1N=NN=C1)[C@@H]2C(=O)NC1=CC=C(C(O)=O)C=C1 WYFCZWSWFGJODV-MIANJLSGSA-N 0.000 description 5
- DQAZPZIYEOGZAF-UHFFFAOYSA-N 4-ethyl-n-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperazine-1-carboxamide Chemical compound C1CN(CC)CCN1C(=O)NC(C(=CC1=NC=N2)OC)=CC1=C2NC1=CC=CC(C#C)=C1 DQAZPZIYEOGZAF-UHFFFAOYSA-N 0.000 description 5
- GDUANFXPOZTYKS-UHFFFAOYSA-N 6-bromo-8-[(2,6-difluoro-4-methoxybenzoyl)amino]-4-oxochromene-2-carboxylic acid Chemical compound FC1=CC(OC)=CC(F)=C1C(=O)NC1=CC(Br)=CC2=C1OC(C(O)=O)=CC2=O GDUANFXPOZTYKS-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 125000004450 alkenylene group Chemical group 0.000 description 5
- 125000002947 alkylene group Chemical group 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 150000001721 carbon Chemical group 0.000 description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 5
- 125000004181 carboxyalkyl group Chemical group 0.000 description 5
- 125000002579 carboxylato group Chemical group [O-]C(*)=O 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 238000013461 design Methods 0.000 description 5
- 208000035475 disorder Diseases 0.000 description 5
- 150000002466 imines Chemical class 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- DDPIXQLSJXBHGF-UHFFFAOYSA-N methyl 3-hydroxy-5-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(O)=CC(OCC=2C=CC=CC=2)=C1 DDPIXQLSJXBHGF-UHFFFAOYSA-N 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 239000001301 oxygen Chemical group 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 5
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- UUWJBXKHMMQDED-UHFFFAOYSA-N 1-(3-chlorophenyl)ethanone Chemical compound CC(=O)C1=CC=CC(Cl)=C1 UUWJBXKHMMQDED-UHFFFAOYSA-N 0.000 description 4
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 4
- LBXGBNHUNHWYRM-UHFFFAOYSA-N 2,3-dimethoxybenzonitrile Chemical compound COC1=CC=CC(C#N)=C1OC LBXGBNHUNHWYRM-UHFFFAOYSA-N 0.000 description 4
- JQNBCSPQVSUBSR-UHFFFAOYSA-N 2,3-dimethoxybenzoyl chloride Chemical compound COC1=CC=CC(C(Cl)=O)=C1OC JQNBCSPQVSUBSR-UHFFFAOYSA-N 0.000 description 4
- FMKGJQHNYMWDFJ-CVEARBPZSA-N 2-[[4-(2,2-difluoropropoxy)pyrimidin-5-yl]methylamino]-4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]pyrimidine-5-carbonitrile Chemical compound FC(COC1=NC=NC=C1CNC1=NC=C(C(=N1)N[C@H]1CC([C@H](CC1)O)(C)C)C#N)(C)F FMKGJQHNYMWDFJ-CVEARBPZSA-N 0.000 description 4
- JGMSVHVTXWPXGD-UHFFFAOYSA-N 2-phenyl-3h-quinolin-4-one Chemical class N=1C2=CC=CC=C2C(=O)CC=1C1=CC=CC=C1 JGMSVHVTXWPXGD-UHFFFAOYSA-N 0.000 description 4
- AZKSAVLVSZKNRD-UHFFFAOYSA-M 3-(4,5-dimethylthiazol-2-yl)-2,5-diphenyltetrazolium bromide Chemical compound [Br-].S1C(C)=C(C)N=C1[N+]1=NC(C=2C=CC=CC=2)=NN1C1=CC=CC=C1 AZKSAVLVSZKNRD-UHFFFAOYSA-M 0.000 description 4
- SYBXNDVVWNSKKF-UHFFFAOYSA-N 3-methoxy-5-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(OC)=CC(OCC=2C=CC=CC=2)=C1 SYBXNDVVWNSKKF-UHFFFAOYSA-N 0.000 description 4
- CISXCTKEQYOZAM-UHFFFAOYSA-N 3-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC=CC(OCC=2C=CC=CC=2)=C1 CISXCTKEQYOZAM-UHFFFAOYSA-N 0.000 description 4
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- 201000009030 Carcinoma Diseases 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 238000002965 ELISA Methods 0.000 description 4
- MWAYRGBWOVHDDZ-UHFFFAOYSA-N Ethyl vanillate Chemical compound CCOC(=O)C1=CC=C(O)C(OC)=C1 MWAYRGBWOVHDDZ-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- LVDRREOUMKACNJ-BKMJKUGQSA-N N-[(2R,3S)-2-(4-chlorophenyl)-1-(1,4-dimethyl-2-oxoquinolin-7-yl)-6-oxopiperidin-3-yl]-2-methylpropane-1-sulfonamide Chemical compound CC(C)CS(=O)(=O)N[C@H]1CCC(=O)N([C@@H]1c1ccc(Cl)cc1)c1ccc2c(C)cc(=O)n(C)c2c1 LVDRREOUMKACNJ-BKMJKUGQSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- 239000003463 adsorbent Substances 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 4
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical class ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 4
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 229940125904 compound 1 Drugs 0.000 description 4
- 229940126545 compound 53 Drugs 0.000 description 4
- 229940127113 compound 57 Drugs 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- NZZFYRREKKOMAT-UHFFFAOYSA-N diiodomethane Chemical compound ICI NZZFYRREKKOMAT-UHFFFAOYSA-N 0.000 description 4
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 4
- RHMQSXRCGOZYND-UHFFFAOYSA-N ethyl 2,3-dihydroxybenzoate Chemical compound CCOC(=O)C1=CC=CC(O)=C1O RHMQSXRCGOZYND-UHFFFAOYSA-N 0.000 description 4
- NCMSHHQTVHPWPA-UHFFFAOYSA-N ethyl 3-methoxy-4-phenylmethoxybenzoate Chemical compound COC1=CC(C(=O)OCC)=CC=C1OCC1=CC=CC=C1 NCMSHHQTVHPWPA-UHFFFAOYSA-N 0.000 description 4
- 125000001153 fluoro group Chemical group F* 0.000 description 4
- 125000000524 functional group Chemical group 0.000 description 4
- 125000002541 furyl group Chemical group 0.000 description 4
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 4
- LSIYHXBUEHOOCW-UHFFFAOYSA-N n-(2-acetyl-4-morpholin-4-ylphenyl)-2-methoxybenzamide Chemical compound COC1=CC=CC=C1C(=O)NC1=CC=C(N2CCOCC2)C=C1C(C)=O LSIYHXBUEHOOCW-UHFFFAOYSA-N 0.000 description 4
- YCJZWBZJSYLMPB-UHFFFAOYSA-N n-(2-chloropyrimidin-4-yl)-2,5-dimethyl-1-phenylimidazole-4-carboxamide Chemical compound CC=1N(C=2C=CC=CC=2)C(C)=NC=1C(=O)NC1=CC=NC(Cl)=N1 YCJZWBZJSYLMPB-UHFFFAOYSA-N 0.000 description 4
- NSGHEJFRIQIQRW-UHFFFAOYSA-N n-(6-acetyl-1,3-benzodioxol-5-yl)-3-methoxy-5-phenylmethoxybenzamide Chemical compound C=1C(C(=O)NC=2C(=CC=3OCOC=3C=2)C(C)=O)=CC(OC)=CC=1OCC1=CC=CC=C1 NSGHEJFRIQIQRW-UHFFFAOYSA-N 0.000 description 4
- YBOWWIXCRGFDHB-UHFFFAOYSA-N n-[2-acetyl-4-(dimethylamino)phenyl]-2-phenylmethoxybenzamide Chemical compound CC(=O)C1=CC(N(C)C)=CC=C1NC(=O)C1=CC=CC=C1OCC1=CC=CC=C1 YBOWWIXCRGFDHB-UHFFFAOYSA-N 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 239000008188 pellet Substances 0.000 description 4
- 239000002953 phosphate buffered saline Substances 0.000 description 4
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 230000035755 proliferation Effects 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000012453 solvate Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- 229910052717 sulfur Chemical group 0.000 description 4
- GCTFTMWXZFLTRR-GFCCVEGCSA-N (2r)-2-amino-n-[3-(difluoromethoxy)-4-(1,3-oxazol-5-yl)phenyl]-4-methylpentanamide Chemical compound FC(F)OC1=CC(NC(=O)[C@H](N)CC(C)C)=CC=C1C1=CN=CO1 GCTFTMWXZFLTRR-GFCCVEGCSA-N 0.000 description 3
- VIJSPAIQWVPKQZ-BLECARSGSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4,4-dimethylpentanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid Chemical compound NC(=N)NCCC[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(C)=O VIJSPAIQWVPKQZ-BLECARSGSA-N 0.000 description 3
- STBLNCCBQMHSRC-BATDWUPUSA-N (2s)-n-[(3s,4s)-5-acetyl-7-cyano-4-methyl-1-[(2-methylnaphthalen-1-yl)methyl]-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide Chemical compound O=C1[C@@H](NC(=O)[C@H](C)NC)[C@H](C)N(C(C)=O)C2=CC(C#N)=CC=C2N1CC1=C(C)C=CC2=CC=CC=C12 STBLNCCBQMHSRC-BATDWUPUSA-N 0.000 description 3
- MPDDTAJMJCESGV-CTUHWIOQSA-M (3r,5r)-7-[2-(4-fluorophenyl)-5-[methyl-[(1r)-1-phenylethyl]carbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate Chemical compound C1([C@@H](C)N(C)C(=O)C2=NN(C(CC[C@@H](O)C[C@@H](O)CC([O-])=O)=C2C(C)C)C=2C=CC(F)=CC=2)=CC=CC=C1 MPDDTAJMJCESGV-CTUHWIOQSA-M 0.000 description 3
- LVBLTFSJUMJXBI-UHFFFAOYSA-N 1,3-benzodioxole-4-carbonyl chloride Chemical compound ClC(=O)C1=CC=CC2=C1OCO2 LVBLTFSJUMJXBI-UHFFFAOYSA-N 0.000 description 3
- DBUAYOWCIUQXQW-UHFFFAOYSA-N 1,3-benzodioxole-4-carboxylic acid Chemical compound OC(=O)C1=CC=CC2=C1OCO2 DBUAYOWCIUQXQW-UHFFFAOYSA-N 0.000 description 3
- HRUAWSQBQLYDKH-UHFFFAOYSA-N 1-(3-methoxy-4-phenylmethoxyphenyl)ethanone Chemical compound COC1=CC(C(C)=O)=CC=C1OCC1=CC=CC=C1 HRUAWSQBQLYDKH-UHFFFAOYSA-N 0.000 description 3
- HVXQVXNQKCPSLH-UHFFFAOYSA-N 1-(5-chloro-2-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC(Cl)=CC=C1[N+]([O-])=O HVXQVXNQKCPSLH-UHFFFAOYSA-N 0.000 description 3
- KQZLRWGGWXJPOS-NLFPWZOASA-N 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(4S,5R)-4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-5-methylcyclohexen-1-yl]pyrazolo[3,4-b]pyrazine-3-carbonitrile Chemical compound ClC1=C(C=CC(=C1)Cl)[C@@H](C)N1N=C(C=2C1=NC(=CN=2)C1=CC[C@@H]([C@@H](C1)C)N1[C@@H](CCC1)CO)C#N KQZLRWGGWXJPOS-NLFPWZOASA-N 0.000 description 3
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 3
- HPVUGOBQRQUWMK-UHFFFAOYSA-N 3-phenylmethoxybenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(OCC=2C=CC=CC=2)=C1 HPVUGOBQRQUWMK-UHFFFAOYSA-N 0.000 description 3
- XFJBGINZIMNZBW-CRAIPNDOSA-N 5-chloro-2-[4-[(1r,2s)-2-[2-(5-methylsulfonylpyridin-2-yl)oxyethyl]cyclopropyl]piperidin-1-yl]pyrimidine Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OCC[C@H]1[C@@H](C2CCN(CC2)C=2N=CC(Cl)=CN=2)C1 XFJBGINZIMNZBW-CRAIPNDOSA-N 0.000 description 3
- PKMUHQIDVVOXHQ-HXUWFJFHSA-N C[C@H](C1=CC(C2=CC=C(CNC3CCCC3)S2)=CC=C1)NC(C1=C(C)C=CC(NC2CNC2)=C1)=O Chemical compound C[C@H](C1=CC(C2=CC=C(CNC3CCCC3)S2)=CC=C1)NC(C1=C(C)C=CC(NC2CNC2)=C1)=O PKMUHQIDVVOXHQ-HXUWFJFHSA-N 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 3
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 3
- 231100000002 MTT assay Toxicity 0.000 description 3
- 238000000134 MTT assay Methods 0.000 description 3
- LIMFPAAAIVQRRD-BCGVJQADSA-N N-[2-[(3S,4R)-3-fluoro-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-8-[(2R,3S)-2-methyl-3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinolin-3-amine Chemical compound F[C@H]1CN(CC[C@H]1OC)C1=NC=CC(=N1)NC=1N=CC2=C(C=CC(=C2C=1)C(C)C)N1[C@@H]([C@H](C1)CS(=O)(=O)C)C LIMFPAAAIVQRRD-BCGVJQADSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 238000002835 absorbance Methods 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 238000010171 animal model Methods 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- 125000002619 bicyclic group Chemical group 0.000 description 3
- 229940125877 compound 31 Drugs 0.000 description 3
- 229940125878 compound 36 Drugs 0.000 description 3
- 229940125900 compound 59 Drugs 0.000 description 3
- 229940126179 compound 72 Drugs 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 3
- 238000002451 electron ionisation mass spectrometry Methods 0.000 description 3
- 238000000119 electrospray ionisation mass spectrum Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- CCMYUYXLFVKXTD-UHFFFAOYSA-N ethyl 3-phenylmethoxybenzoate Chemical compound CCOC(=O)C1=CC=CC(OCC=2C=CC=CC=2)=C1 CCMYUYXLFVKXTD-UHFFFAOYSA-N 0.000 description 3
- NUVBSKCKDOMJSU-UHFFFAOYSA-N ethylparaben Chemical compound CCOC(=O)C1=CC=C(O)C=C1 NUVBSKCKDOMJSU-UHFFFAOYSA-N 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 239000003269 fluorescent indicator Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 206010073071 hepatocellular carcinoma Diseases 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 210000005260 human cell Anatomy 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 238000005040 ion trap Methods 0.000 description 3
- 230000003902 lesion Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000002207 metabolite Substances 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- VMGAPWLDMVPYIA-HIDZBRGKSA-N n'-amino-n-iminomethanimidamide Chemical compound N\N=C\N=N VMGAPWLDMVPYIA-HIDZBRGKSA-N 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 125000004043 oxo group Chemical group O=* 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 3
- 230000026731 phosphorylation Effects 0.000 description 3
- 238000006366 phosphorylation reaction Methods 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 125000001544 thienyl group Chemical group 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- FNHHVPPSBFQMEL-KQHDFZBMSA-N (3S)-5-N-[(1S,5R)-3-hydroxy-6-bicyclo[3.1.0]hexanyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide Chemical compound CNC(=O)c1cc(cc2c1OC[C@@]2(C)c1ccccc1)C(=O)NC1[C@H]2CC(O)C[C@@H]12 FNHHVPPSBFQMEL-KQHDFZBMSA-N 0.000 description 2
- HUWSZNZAROKDRZ-RRLWZMAJSA-N (3r,4r)-3-azaniumyl-5-[[(2s,3r)-1-[(2s)-2,3-dicarboxypyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentane-1-sulfonate Chemical compound OS(=O)(=O)CC[C@@H](N)[C@@H](S)C(=O)N[C@@H]([C@H](C)CC)C(=O)N1CCC(C(O)=O)[C@H]1C(O)=O HUWSZNZAROKDRZ-RRLWZMAJSA-N 0.000 description 2
- STPKWKPURVSAJF-LJEWAXOPSA-N (4r,5r)-5-[4-[[4-(1-aza-4-azoniabicyclo[2.2.2]octan-4-ylmethyl)phenyl]methoxy]phenyl]-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-4,5-dihydro-2h-1$l^{6}-benzothiepin-4-ol Chemical compound O[C@H]1C(CCCC)(CCCC)CS(=O)(=O)C2=CC=C(N(C)C)C=C2[C@H]1C(C=C1)=CC=C1OCC(C=C1)=CC=C1C[N+]1(CC2)CCN2CC1 STPKWKPURVSAJF-LJEWAXOPSA-N 0.000 description 2
- DEVSOMFAQLZNKR-RJRFIUFISA-N (z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-n'-pyrazin-2-ylprop-2-enehydrazide Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(C2=NN(\C=C/C(=O)NNC=3N=CC=NC=3)C=N2)=C1 DEVSOMFAQLZNKR-RJRFIUFISA-N 0.000 description 2
- WOAHJDHKFWSLKE-UHFFFAOYSA-N 1,2-benzoquinone Chemical compound O=C1C=CC=CC1=O WOAHJDHKFWSLKE-UHFFFAOYSA-N 0.000 description 2
- LOZWAPSEEHRYPG-UHFFFAOYSA-N 1,4-dithiane Chemical compound C1CSCCS1 LOZWAPSEEHRYPG-UHFFFAOYSA-N 0.000 description 2
- FODUVZQSLRHUMC-UHFFFAOYSA-N 1-(2,3-dimethoxyphenyl)ethanone Chemical compound COC1=CC=CC(C(C)=O)=C1OC FODUVZQSLRHUMC-UHFFFAOYSA-N 0.000 description 2
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 2
- HEJLFBLJYFSKCE-UHFFFAOYSA-N 2',3'-Dihydroxyacetophenone Chemical compound CC(=O)C1=CC=CC(O)=C1O HEJLFBLJYFSKCE-UHFFFAOYSA-N 0.000 description 2
- YARKPRSRXZGKNI-UHFFFAOYSA-N 2,5-dimethoxybenzoyl chloride Chemical compound COC1=CC=C(OC)C(C(Cl)=O)=C1 YARKPRSRXZGKNI-UHFFFAOYSA-N 0.000 description 2
- HGHQOXUVVZQHLG-UHFFFAOYSA-N 2-(1,3-benzodioxol-4-yl)-6-morpholin-4-yl-3h-quinolin-4-one Chemical compound C1=C2C(=O)CC(C=3C=4OCOC=4C=CC=3)=NC2=CC=C1N1CCOCC1 HGHQOXUVVZQHLG-UHFFFAOYSA-N 0.000 description 2
- VCUXVXLUOHDHKK-UHFFFAOYSA-N 2-(2-aminopyrimidin-4-yl)-4-(2-chloro-4-methoxyphenyl)-1,3-thiazole-5-carboxamide Chemical compound ClC1=CC(OC)=CC=C1C1=C(C(N)=O)SC(C=2N=C(N)N=CC=2)=N1 VCUXVXLUOHDHKK-UHFFFAOYSA-N 0.000 description 2
- IPEAJTIHOIYYOG-UHFFFAOYSA-N 2-(2-phenylmethoxyphenyl)-6-pyrrolidin-1-yl-3h-quinolin-4-one Chemical compound C1=C2C(=O)CC(C=3C(=CC=CC=3)OCC=3C=CC=CC=3)=NC2=CC=C1N1CCCC1 IPEAJTIHOIYYOG-UHFFFAOYSA-N 0.000 description 2
- CUEZJFIHTJIKRF-UHFFFAOYSA-N 2-(3-methoxy-4-phenylmethoxyphenyl)-6-morpholin-4-yl-3h-quinolin-4-one Chemical compound COC1=CC(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCOCC2)=CC=C1OCC1=CC=CC=C1 CUEZJFIHTJIKRF-UHFFFAOYSA-N 0.000 description 2
- RKLGEPQKYJOBTF-UHFFFAOYSA-N 2-(3-methoxy-4-phenylmethoxyphenyl)-6-pyrrolidin-1-yl-3h-quinolin-4-one Chemical compound COC1=CC(C=2CC(=O)C3=CC(=CC=C3N=2)N2CCCC2)=CC=C1OCC1=CC=CC=C1 RKLGEPQKYJOBTF-UHFFFAOYSA-N 0.000 description 2
- ZJPZENZFVFSTMC-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-6-pyrrolidin-1-yl-3h-quinolin-4-one Chemical compound C1=C2C(=O)CC(C=3C=C(OCC=4C=CC=CC=4)C=CC=3)=NC2=CC=C1N1CCCC1 ZJPZENZFVFSTMC-UHFFFAOYSA-N 0.000 description 2
- BJSMRJLXFYARJL-UHFFFAOYSA-N 2-(4-phenylmethoxyphenyl)-6-pyrrolidin-1-yl-3h-quinolin-4-one Chemical compound C1=C2C(=O)CC(C=3C=CC(OCC=4C=CC=CC=4)=CC=3)=NC2=CC=C1N1CCCC1 BJSMRJLXFYARJL-UHFFFAOYSA-N 0.000 description 2
- RAAGZOYMEQDCTD-UHFFFAOYSA-N 2-fluorobenzoyl chloride Chemical compound FC1=CC=CC=C1C(Cl)=O RAAGZOYMEQDCTD-UHFFFAOYSA-N 0.000 description 2
- LODHFNUFVRVKTH-ZHACJKMWSA-N 2-hydroxy-n'-[(e)-3-phenylprop-2-enoyl]benzohydrazide Chemical compound OC1=CC=CC=C1C(=O)NNC(=O)\C=C\C1=CC=CC=C1 LODHFNUFVRVKTH-ZHACJKMWSA-N 0.000 description 2
- WFOVEDJTASPCIR-UHFFFAOYSA-N 3-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)methylamino]-n-[[2-(trifluoromethyl)phenyl]methyl]benzamide Chemical compound N=1N=C(C=2C=CN=CC=2)N(C)C=1CNC(C=1)=CC=CC=1C(=O)NCC1=CC=CC=C1C(F)(F)F WFOVEDJTASPCIR-UHFFFAOYSA-N 0.000 description 2
- JGMBQAGNZLBZCE-UHFFFAOYSA-N 3-methoxy-4-phenylmethoxybenzoic acid Chemical compound COC1=CC(C(O)=O)=CC=C1OCC1=CC=CC=C1 JGMBQAGNZLBZCE-UHFFFAOYSA-N 0.000 description 2
- VRJLWFYHYPQLLO-UHFFFAOYSA-N 3-methoxy-4-phenylmethoxybenzoyl chloride Chemical compound COC1=CC(C(Cl)=O)=CC=C1OCC1=CC=CC=C1 VRJLWFYHYPQLLO-UHFFFAOYSA-N 0.000 description 2
- MPMKMQHJHDHPBE-RUZDIDTESA-N 4-[[(2r)-1-(1-benzothiophene-3-carbonyl)-2-methylazetidine-2-carbonyl]-[(3-chlorophenyl)methyl]amino]butanoic acid Chemical compound O=C([C@@]1(N(CC1)C(=O)C=1C2=CC=CC=C2SC=1)C)N(CCCC(O)=O)CC1=CC=CC(Cl)=C1 MPMKMQHJHDHPBE-RUZDIDTESA-N 0.000 description 2
- AQSCHALQLXXKKC-UHFFFAOYSA-N 4-phenylmethoxybenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OCC1=CC=CC=C1 AQSCHALQLXXKKC-UHFFFAOYSA-N 0.000 description 2
- ICEKEZSKMGHZNT-UHFFFAOYSA-N 4-phenylmethoxybenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1OCC1=CC=CC=C1 ICEKEZSKMGHZNT-UHFFFAOYSA-N 0.000 description 2
- NDORYXVVJMDFDI-UHFFFAOYSA-N 6-(3-methoxy-5-phenylmethoxyphenyl)-7h-[1,3]dioxolo[4,5-g]quinolin-8-one Chemical compound C=1C(C=2CC(=O)C3=CC=4OCOC=4C=C3N=2)=CC(OC)=CC=1OCC1=CC=CC=C1 NDORYXVVJMDFDI-UHFFFAOYSA-N 0.000 description 2
- APDRYKCGTUYAEU-UHFFFAOYSA-N 6-(dimethylamino)-2-(2-phenylmethoxyphenyl)-3h-quinolin-4-one Chemical compound C1C(=O)C2=CC(N(C)C)=CC=C2N=C1C1=CC=CC=C1OCC1=CC=CC=C1 APDRYKCGTUYAEU-UHFFFAOYSA-N 0.000 description 2
- MZNVAQRNNLSUMW-UHFFFAOYSA-N 6-(dimethylamino)-2-(3-phenylmethoxyphenyl)-3h-quinolin-4-one Chemical compound C1C(=O)C2=CC(N(C)C)=CC=C2N=C1C(C=1)=CC=CC=1OCC1=CC=CC=C1 MZNVAQRNNLSUMW-UHFFFAOYSA-N 0.000 description 2
- BLTYVVSNXHULTI-UHFFFAOYSA-N 6-(dimethylamino)-2-(4-phenylmethoxyphenyl)-3h-quinolin-4-one Chemical compound C1C(=O)C2=CC(N(C)C)=CC=C2N=C1C(C=C1)=CC=C1OCC1=CC=CC=C1 BLTYVVSNXHULTI-UHFFFAOYSA-N 0.000 description 2
- MSKKVIKSSVIOSD-UHFFFAOYSA-N 6-morpholin-4-yl-2-(4-phenylmethoxyphenyl)-3h-quinolin-4-one Chemical compound C1=C2C(=O)CC(C=3C=CC(OCC=4C=CC=CC=4)=CC=3)=NC2=CC=C1N1CCOCC1 MSKKVIKSSVIOSD-UHFFFAOYSA-N 0.000 description 2
- MEUGOWIVNURXOE-UHFFFAOYSA-N 6-naphthalen-1-yl-7h-[1,3]dioxolo[4,5-g]quinolin-8-one Chemical compound C1=CC=C2C(C=3CC(C4=CC=5OCOC=5C=C4N=3)=O)=CC=CC2=C1 MEUGOWIVNURXOE-UHFFFAOYSA-N 0.000 description 2
- IRBAWVGZNJIROV-SFHVURJKSA-N 9-(2-cyclopropylethynyl)-2-[[(2s)-1,4-dioxan-2-yl]methoxy]-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one Chemical compound C1=C2C3=CC=C(C#CC4CC4)C=C3CCN2C(=O)N=C1OC[C@@H]1COCCO1 IRBAWVGZNJIROV-SFHVURJKSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- 238000011729 BALB/c nude mouse Methods 0.000 description 2
- IYHHRZBKXXKDDY-UHFFFAOYSA-N BI-605906 Chemical compound N=1C=2SC(C(N)=O)=C(N)C=2C(C(F)(F)CC)=CC=1N1CCC(S(C)(=O)=O)CC1 IYHHRZBKXXKDDY-UHFFFAOYSA-N 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 2
- BGGALFIXXQOTPY-NRFANRHFSA-N C1(=C(C2=C(C=C1)N(C(C#N)=C2)C[C@@H](N1CCN(CC1)S(=O)(=O)C)C)C)CN1CCC(CC1)NC1=NC(=NC2=C1C=C(S2)CC(F)(F)F)NC Chemical compound C1(=C(C2=C(C=C1)N(C(C#N)=C2)C[C@@H](N1CCN(CC1)S(=O)(=O)C)C)C)CN1CCC(CC1)NC1=NC(=NC2=C1C=C(S2)CC(F)(F)F)NC BGGALFIXXQOTPY-NRFANRHFSA-N 0.000 description 2
- UHNRLQRZRNKOKU-UHFFFAOYSA-N CCN(CC1=NC2=C(N1)C1=CC=C(C=C1N=C2N)C1=NNC=C1)C(C)=O Chemical compound CCN(CC1=NC2=C(N1)C1=CC=C(C=C1N=C2N)C1=NNC=C1)C(C)=O UHNRLQRZRNKOKU-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- GYCKQBWUSACYIF-UHFFFAOYSA-N Ethyl salicylate Chemical compound CCOC(=O)C1=CC=CC=C1O GYCKQBWUSACYIF-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- POFVJRKJJBFPII-UHFFFAOYSA-N N-cyclopentyl-5-[2-[[5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-yl]amino]-5-fluoropyrimidin-4-yl]-4-methyl-1,3-thiazol-2-amine Chemical compound C1(CCCC1)NC=1SC(=C(N=1)C)C1=NC(=NC=C1F)NC1=NC=C(C=C1)CN1CCN(CC1)CC POFVJRKJJBFPII-UHFFFAOYSA-N 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- DQUMRZRJSSIVLZ-UHFFFAOYSA-N [6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(OC=1C2=CC=3OCOC=3C=C2N=C(C=1)C=1C2=CC=CC=C2OC=1)(=O)OCC1=CC=CC=C1 DQUMRZRJSSIVLZ-UHFFFAOYSA-N 0.000 description 2
- WREOTYWODABZMH-DTZQCDIJSA-N [[(2r,3s,4r,5r)-3,4-dihydroxy-5-[2-oxo-4-(2-phenylethoxyamino)pyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N(C=C\1)C(=O)NC/1=N\OCCC1=CC=CC=C1 WREOTYWODABZMH-DTZQCDIJSA-N 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- QBYJBZPUGVGKQQ-SJJAEHHWSA-N aldrin Chemical compound C1[C@H]2C=C[C@@H]1[C@H]1[C@@](C3(Cl)Cl)(Cl)C(Cl)=C(Cl)[C@@]3(Cl)[C@H]12 QBYJBZPUGVGKQQ-SJJAEHHWSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000005574 benzylation reaction Methods 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 230000005907 cancer growth Effects 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 229940125758 compound 15 Drugs 0.000 description 2
- 229940126142 compound 16 Drugs 0.000 description 2
- 125000006310 cycloalkyl amino group Chemical group 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 230000020335 dealkylation Effects 0.000 description 2
- 238000006900 dealkylation reaction Methods 0.000 description 2
- UZPSCKYQCDMXJR-UHFFFAOYSA-N dibenzyl (6-naphthalen-1-yl-[1,3]dioxolo[4,5-g]quinolin-8-yl) phosphate Chemical compound C=1C=CC=CC=1COP(OC=1C2=CC=3OCOC=3C=C2N=C(C=1)C=1C2=CC=CC=C2C=CC=1)(=O)OCC1=CC=CC=C1 UZPSCKYQCDMXJR-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- GWNFQAKCJYEJEW-UHFFFAOYSA-N ethyl 3-[8-[[4-methyl-5-[(3-methyl-4-oxophthalazin-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]octanoylamino]benzoate Chemical compound CCOC(=O)C1=CC(NC(=O)CCCCCCCSC2=NN=C(CC3=NN(C)C(=O)C4=CC=CC=C34)N2C)=CC=C1 GWNFQAKCJYEJEW-UHFFFAOYSA-N 0.000 description 2
- MWSMNBYIEBRXAL-UHFFFAOYSA-N ethyl 3-hydroxybenzoate Chemical compound CCOC(=O)C1=CC=CC(O)=C1 MWSMNBYIEBRXAL-UHFFFAOYSA-N 0.000 description 2
- UMOKJIWMQFEFJE-UHFFFAOYSA-N ethyl 4-phenylmethoxybenzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1=CC=CC=C1 UMOKJIWMQFEFJE-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000012894 fetal calf serum Substances 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 239000001963 growth medium Substances 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- 231100000844 hepatocellular carcinoma Toxicity 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000005917 in vivo anti-tumor Effects 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- 150000008040 ionic compounds Chemical class 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 238000012544 monitoring process Methods 0.000 description 2
- AXYKZHXKGGMYKM-UHFFFAOYSA-N n-(2-acetyl-3,4-dimethoxyphenyl)-3-fluorobenzamide Chemical compound CC(=O)C1=C(OC)C(OC)=CC=C1NC(=O)C1=CC=CC(F)=C1 AXYKZHXKGGMYKM-UHFFFAOYSA-N 0.000 description 2
- QPOSEEHTSIDDBR-UHFFFAOYSA-N n-(2-acetyl-3,4-dimethoxyphenyl)-4-fluorobenzamide Chemical compound CC(=O)C1=C(OC)C(OC)=CC=C1NC(=O)C1=CC=C(F)C=C1 QPOSEEHTSIDDBR-UHFFFAOYSA-N 0.000 description 2
- BBPQSXDQANPGRQ-UHFFFAOYSA-N n-(2-acetyl-4-methoxy-5-phenylmethoxyphenyl)-2-fluorobenzamide Chemical compound C1=C(OCC=2C=CC=CC=2)C(OC)=CC(C(C)=O)=C1NC(=O)C1=CC=CC=C1F BBPQSXDQANPGRQ-UHFFFAOYSA-N 0.000 description 2
- WRDCYAZWHDMACO-UHFFFAOYSA-N n-(2-acetyl-4-methoxy-5-phenylmethoxyphenyl)-3-fluorobenzamide Chemical compound C1=C(OCC=2C=CC=CC=2)C(OC)=CC(C(C)=O)=C1NC(=O)C1=CC=CC(F)=C1 WRDCYAZWHDMACO-UHFFFAOYSA-N 0.000 description 2
- SEPYWBYIDOCTDT-UHFFFAOYSA-N n-(2-acetyl-4-methoxy-5-phenylmethoxyphenyl)-4-fluorobenzamide Chemical compound C1=C(OCC=2C=CC=CC=2)C(OC)=CC(C(C)=O)=C1NC(=O)C1=CC=C(F)C=C1 SEPYWBYIDOCTDT-UHFFFAOYSA-N 0.000 description 2
- JGPAHEBYIFCOES-UHFFFAOYSA-N n-(2-acetyl-4-morpholin-4-ylphenyl)-1,3-benzodioxole-4-carboxamide Chemical compound C=1C=C(NC(=O)C=2C=3OCOC=3C=CC=2)C(C(=O)C)=CC=1N1CCOCC1 JGPAHEBYIFCOES-UHFFFAOYSA-N 0.000 description 2
- UCRSXYYVHJDUNU-UHFFFAOYSA-N n-(2-acetyl-4-morpholin-4-ylphenyl)-2,3-dimethoxybenzamide Chemical compound COC1=CC=CC(C(=O)NC=2C(=CC(=CC=2)N2CCOCC2)C(C)=O)=C1OC UCRSXYYVHJDUNU-UHFFFAOYSA-N 0.000 description 2
- LJSLQCYCPFBSOG-UHFFFAOYSA-N n-(2-acetyl-4-morpholin-4-ylphenyl)-2,5-dimethoxybenzamide Chemical compound COC1=CC=C(OC)C(C(=O)NC=2C(=CC(=CC=2)N2CCOCC2)C(C)=O)=C1 LJSLQCYCPFBSOG-UHFFFAOYSA-N 0.000 description 2
- PNJRCLWSUITKNM-UHFFFAOYSA-N n-(2-acetyl-4-morpholin-4-ylphenyl)-3-methoxy-4-phenylmethoxybenzamide Chemical compound COC1=CC(C(=O)NC=2C(=CC(=CC=2)N2CCOCC2)C(C)=O)=CC=C1OCC1=CC=CC=C1 PNJRCLWSUITKNM-UHFFFAOYSA-N 0.000 description 2
- CGNXNRMNKFKWAN-UHFFFAOYSA-N n-(2-acetyl-4-morpholin-4-ylphenyl)-3-phenylmethoxybenzamide Chemical compound CC(=O)C1=CC(N2CCOCC2)=CC=C1NC(=O)C(C=1)=CC=CC=1OCC1=CC=CC=C1 CGNXNRMNKFKWAN-UHFFFAOYSA-N 0.000 description 2
- KOFRWCBHUHKXGB-UHFFFAOYSA-N n-(2-acetyl-4-morpholin-4-ylphenyl)-4-phenylmethoxybenzamide Chemical compound CC(=O)C1=CC(N2CCOCC2)=CC=C1NC(=O)C(C=C1)=CC=C1OCC1=CC=CC=C1 KOFRWCBHUHKXGB-UHFFFAOYSA-N 0.000 description 2
- LTWIUDUTZBBPSP-UHFFFAOYSA-N n-(2-acetyl-4-pyrrolidin-1-ylphenyl)-1,3-benzodioxole-4-carboxamide Chemical compound C=1C=C(NC(=O)C=2C=3OCOC=3C=CC=2)C(C(=O)C)=CC=1N1CCCC1 LTWIUDUTZBBPSP-UHFFFAOYSA-N 0.000 description 2
- KUBROTLKCSFITO-UHFFFAOYSA-N n-(2-acetyl-4-pyrrolidin-1-ylphenyl)-2,3-dimethoxybenzamide Chemical compound COC1=CC=CC(C(=O)NC=2C(=CC(=CC=2)N2CCCC2)C(C)=O)=C1OC KUBROTLKCSFITO-UHFFFAOYSA-N 0.000 description 2
- OJBRWDNNGKYNNV-UHFFFAOYSA-N n-(2-acetyl-4-pyrrolidin-1-ylphenyl)-2,5-dimethoxybenzamide Chemical compound COC1=CC=C(OC)C(C(=O)NC=2C(=CC(=CC=2)N2CCCC2)C(C)=O)=C1 OJBRWDNNGKYNNV-UHFFFAOYSA-N 0.000 description 2
- NPDSTOWTDIBCNB-UHFFFAOYSA-N n-(2-acetyl-4-pyrrolidin-1-ylphenyl)-2-methoxybenzamide Chemical compound COC1=CC=CC=C1C(=O)NC1=CC=C(N2CCCC2)C=C1C(C)=O NPDSTOWTDIBCNB-UHFFFAOYSA-N 0.000 description 2
- JPZQGBFDHNSMNL-UHFFFAOYSA-N n-(2-acetyl-4-pyrrolidin-1-ylphenyl)-2-phenylmethoxybenzamide Chemical compound CC(=O)C1=CC(N2CCCC2)=CC=C1NC(=O)C1=CC=CC=C1OCC1=CC=CC=C1 JPZQGBFDHNSMNL-UHFFFAOYSA-N 0.000 description 2
- GPDCPYNPKMGNEZ-UHFFFAOYSA-N n-(2-acetyl-4-pyrrolidin-1-ylphenyl)-3-methoxy-4-phenylmethoxybenzamide Chemical compound COC1=CC(C(=O)NC=2C(=CC(=CC=2)N2CCCC2)C(C)=O)=CC=C1OCC1=CC=CC=C1 GPDCPYNPKMGNEZ-UHFFFAOYSA-N 0.000 description 2
- HUFOWXAJXQEAEL-UHFFFAOYSA-N n-(2-acetyl-4-pyrrolidin-1-ylphenyl)-3-phenylmethoxybenzamide Chemical compound CC(=O)C1=CC(N2CCCC2)=CC=C1NC(=O)C(C=1)=CC=CC=1OCC1=CC=CC=C1 HUFOWXAJXQEAEL-UHFFFAOYSA-N 0.000 description 2
- BAKYZYCIXCNWCM-UHFFFAOYSA-N n-(2-acetyl-4-pyrrolidin-1-ylphenyl)-4-methoxybenzamide Chemical compound C1=CC(OC)=CC=C1C(=O)NC1=CC=C(N2CCCC2)C=C1C(C)=O BAKYZYCIXCNWCM-UHFFFAOYSA-N 0.000 description 2
- CUTMDEJSYUZRQW-UHFFFAOYSA-N n-(2-acetyl-4-pyrrolidin-1-ylphenyl)-4-phenylmethoxybenzamide Chemical compound CC(=O)C1=CC(N2CCCC2)=CC=C1NC(=O)C(C=C1)=CC=C1OCC1=CC=CC=C1 CUTMDEJSYUZRQW-UHFFFAOYSA-N 0.000 description 2
- KTLYJGHYGWUJCE-UHFFFAOYSA-N n-(4-acetyl-1,3-benzodioxol-5-yl)-2-fluorobenzamide Chemical compound CC(=O)C1=C2OCOC2=CC=C1NC(=O)C1=CC=CC=C1F KTLYJGHYGWUJCE-UHFFFAOYSA-N 0.000 description 2
- JSIACFFMVALCPL-UHFFFAOYSA-N n-(4-acetyl-1,3-benzodioxol-5-yl)-3-fluorobenzamide Chemical compound CC(=O)C1=C2OCOC2=CC=C1NC(=O)C1=CC=CC(F)=C1 JSIACFFMVALCPL-UHFFFAOYSA-N 0.000 description 2
- OHFUWEIKQGHBSQ-UHFFFAOYSA-N n-(4-acetyl-1,3-benzodioxol-5-yl)-4-fluorobenzamide Chemical compound CC(=O)C1=C2OCOC2=CC=C1NC(=O)C1=CC=C(F)C=C1 OHFUWEIKQGHBSQ-UHFFFAOYSA-N 0.000 description 2
- GGYUTFIUYFTDOW-UHFFFAOYSA-N n-(6-acetyl-1,3-benzodioxol-5-yl)-1-benzofuran-3-carboxamide Chemical compound C1=CC=C2C(C(=O)NC3=CC=4OCOC=4C=C3C(=O)C)=COC2=C1 GGYUTFIUYFTDOW-UHFFFAOYSA-N 0.000 description 2
- VMFMRLYMJMAIEB-UHFFFAOYSA-N n-(6-acetyl-1,3-benzodioxol-5-yl)naphthalene-1-carboxamide Chemical compound C1=CC=C2C(C(=O)NC3=CC=4OCOC=4C=C3C(=O)C)=CC=CC2=C1 VMFMRLYMJMAIEB-UHFFFAOYSA-N 0.000 description 2
- YBIIAVQBRUNEHV-UHFFFAOYSA-N n-[2-acetyl-4-(dimethylamino)phenyl]-3-phenylmethoxybenzamide Chemical compound CC(=O)C1=CC(N(C)C)=CC=C1NC(=O)C1=CC=CC(OCC=2C=CC=CC=2)=C1 YBIIAVQBRUNEHV-UHFFFAOYSA-N 0.000 description 2
- PRUPNJIXGBXLHS-UHFFFAOYSA-N n-[2-acetyl-4-(dimethylamino)phenyl]-4-phenylmethoxybenzamide Chemical compound CC(=O)C1=CC(N(C)C)=CC=C1NC(=O)C(C=C1)=CC=C1OCC1=CC=CC=C1 PRUPNJIXGBXLHS-UHFFFAOYSA-N 0.000 description 2
- YGBMCLDVRUGXOV-UHFFFAOYSA-N n-[6-[6-chloro-5-[(4-fluorophenyl)sulfonylamino]pyridin-3-yl]-1,3-benzothiazol-2-yl]acetamide Chemical compound C1=C2SC(NC(=O)C)=NC2=CC=C1C(C=1)=CN=C(Cl)C=1NS(=O)(=O)C1=CC=C(F)C=C1 YGBMCLDVRUGXOV-UHFFFAOYSA-N 0.000 description 2
- 230000017066 negative regulation of growth Effects 0.000 description 2
- GTDQGKWDWVUKTI-UHFFFAOYSA-N o-aminoacetophenone Chemical class CC(=O)C1=CC=CC=C1N GTDQGKWDWVUKTI-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- RQKYHDHLEMEVDR-UHFFFAOYSA-N oxo-bis(phenylmethoxy)phosphanium Chemical compound C=1C=CC=CC=1CO[P+](=O)OCC1=CC=CC=C1 RQKYHDHLEMEVDR-UHFFFAOYSA-N 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 230000001717 pathogenic effect Effects 0.000 description 2
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthridine Chemical compound C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 229940005657 pyrophosphoric acid Drugs 0.000 description 2
- 125000004159 quinolin-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C([H])C(*)=NC2=C1[H] 0.000 description 2
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 description 2
- 125000004549 quinolin-4-yl group Chemical group N1=CC=C(C2=CC=CC=C12)* 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- KSAVQLQVUXSOCR-UHFFFAOYSA-M sodium lauroyl sarcosinate Chemical compound [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O KSAVQLQVUXSOCR-UHFFFAOYSA-M 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 229960005322 streptomycin Drugs 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 238000001308 synthesis method Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 238000002495 two-dimensional nuclear magnetic resonance spectrum Methods 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- PFTAWBLQPZVEMU-DZGCQCFKSA-N (+)-catechin Chemical compound C1([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC=C(O)C(O)=C1 PFTAWBLQPZVEMU-DZGCQCFKSA-N 0.000 description 1
- ASGMFNBUXDJWJJ-JLCFBVMHSA-N (1R,3R)-3-[[3-bromo-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-yl]amino]-N,1-dimethylcyclopentane-1-carboxamide Chemical compound BrC1=NN(C2=NC(=NC=C21)N[C@H]1C[C@@](CC1)(C(=O)NC)C)C1=CC=C(C=C1)C=1SC(=NN=1)C ASGMFNBUXDJWJJ-JLCFBVMHSA-N 0.000 description 1
- AOSZTAHDEDLTLQ-AZKQZHLXSA-N (1S,2S,4R,8S,9S,11S,12R,13S,19S)-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one Chemical compound C([C@@H]1C[C@H]2[C@H]3[C@]([C@]4(C=CC(=O)C=C4[C@@H](F)C3)C)(F)[C@@H](O)C[C@@]2([C@@]1(C1)C(=O)CO)C)N1CC1=CC=CC(Cl)=C1 AOSZTAHDEDLTLQ-AZKQZHLXSA-N 0.000 description 1
- ABJSOROVZZKJGI-OCYUSGCXSA-N (1r,2r,4r)-2-(4-bromophenyl)-n-[(4-chlorophenyl)-(2-fluoropyridin-4-yl)methyl]-4-morpholin-4-ylcyclohexane-1-carboxamide Chemical compound C1=NC(F)=CC(C(NC(=O)[C@H]2[C@@H](C[C@@H](CC2)N2CCOCC2)C=2C=CC(Br)=CC=2)C=2C=CC(Cl)=CC=2)=C1 ABJSOROVZZKJGI-OCYUSGCXSA-N 0.000 description 1
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- IUSARDYWEPUTPN-OZBXUNDUSA-N (2r)-n-[(2s,3r)-4-[[(4s)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-[3-(1,3-thiazol-2-yl)phenyl]butan-2-yl]-2-methoxypropanamide Chemical compound C([C@H](NC(=O)[C@@H](C)OC)[C@H](O)CN[C@@H]1C2=CC(CC(C)(C)C)=CN=C2OC2(CCC2)C1)C(C=1)=CC=CC=1C1=NC=CS1 IUSARDYWEPUTPN-OZBXUNDUSA-N 0.000 description 1
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 1
- OOKAZRDERJMRCJ-KOUAFAAESA-N (3r)-7-[(1s,2s,4ar,6s,8s)-2,6-dimethyl-8-[(2s)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-hydroxy-5-oxoheptanoic acid Chemical compound C1=C[C@H](C)[C@H](CCC(=O)C[C@@H](O)CC(O)=O)C2[C@@H](OC(=O)[C@@H](C)CC)C[C@@H](C)C[C@@H]21 OOKAZRDERJMRCJ-KOUAFAAESA-N 0.000 description 1
- OIIOPWHTJZYKIL-PMACEKPBSA-N (5S)-5-[[[5-[2-chloro-3-[2-chloro-3-[6-methoxy-5-[[[(2S)-5-oxopyrrolidin-2-yl]methylamino]methyl]pyrazin-2-yl]phenyl]phenyl]-3-methoxypyrazin-2-yl]methylamino]methyl]pyrrolidin-2-one Chemical compound C1(=C(N=C(C2=C(C(C3=CC=CC(=C3Cl)C3=NC(OC)=C(N=C3)CNC[C@H]3NC(=O)CC3)=CC=C2)Cl)C=N1)OC)CNC[C@H]1NC(=O)CC1 OIIOPWHTJZYKIL-PMACEKPBSA-N 0.000 description 1
- ALEPHFDQWSSCBZ-UHFFFAOYSA-N (6-naphthalen-1-yl-[1,3]dioxolo[4,5-g]quinolin-8-yl) dihydrogen phosphate Chemical compound C1=CC=C2C(C=3C=C(C4=CC=5OCOC=5C=C4N=3)OP(O)(=O)O)=CC=CC2=C1 ALEPHFDQWSSCBZ-UHFFFAOYSA-N 0.000 description 1
- 125000006736 (C6-C20) aryl group Chemical group 0.000 description 1
- 125000006738 (C6-C20) heteroaryl group Chemical group 0.000 description 1
- DJMOXMNDXFFONV-UHFFFAOYSA-N 1,3-dimethyl-7-[2-(n-methylanilino)ethyl]purine-2,6-dione Chemical compound C1=NC=2N(C)C(=O)N(C)C(=O)C=2N1CCN(C)C1=CC=CC=C1 DJMOXMNDXFFONV-UHFFFAOYSA-N 0.000 description 1
- KKHFRAFPESRGGD-UHFFFAOYSA-N 1,3-dimethyl-7-[3-(n-methylanilino)propyl]purine-2,6-dione Chemical compound C1=NC=2N(C)C(=O)N(C)C(=O)C=2N1CCCN(C)C1=CC=CC=C1 KKHFRAFPESRGGD-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- YUHWSRVMUQSCNL-UHFFFAOYSA-N 1-benzofuran-3-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=COC2=C1 YUHWSRVMUQSCNL-UHFFFAOYSA-N 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- TZMSYXZUNZXBOL-UHFFFAOYSA-N 10H-phenoxazine Chemical compound C1=CC=C2NC3=CC=CC=C3OC2=C1 TZMSYXZUNZXBOL-UHFFFAOYSA-N 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical compound C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 1
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
- WGFNXGPBPIJYLI-UHFFFAOYSA-N 2,6-difluoro-3-[(3-fluorophenyl)sulfonylamino]-n-(3-methoxy-1h-pyrazolo[3,4-b]pyridin-5-yl)benzamide Chemical compound C1=C2C(OC)=NNC2=NC=C1NC(=O)C(C=1F)=C(F)C=CC=1NS(=O)(=O)C1=CC=CC(F)=C1 WGFNXGPBPIJYLI-UHFFFAOYSA-N 0.000 description 1
- FQMZXMVHHKXGTM-UHFFFAOYSA-N 2-(1-adamantyl)-n-[2-[2-(2-hydroxyethylamino)ethylamino]quinolin-5-yl]acetamide Chemical compound C1C(C2)CC(C3)CC2CC13CC(=O)NC1=CC=CC2=NC(NCCNCCO)=CC=C21 FQMZXMVHHKXGTM-UHFFFAOYSA-N 0.000 description 1
- QEBYEVQKHRUYPE-UHFFFAOYSA-N 2-(2-chlorophenyl)-5-[(1-methylpyrazol-3-yl)methyl]-4-[[methyl(pyridin-3-ylmethyl)amino]methyl]-1h-pyrazolo[4,3-c]pyridine-3,6-dione Chemical compound C1=CN(C)N=C1CN1C(=O)C=C2NN(C=3C(=CC=CC=3)Cl)C(=O)C2=C1CN(C)CC1=CC=CN=C1 QEBYEVQKHRUYPE-UHFFFAOYSA-N 0.000 description 1
- PAYROHWFGZADBR-UHFFFAOYSA-N 2-[[4-amino-5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)pyrimidin-2-yl]amino]propane-1,3-diol Chemical compound C1=C(I)C(OC)=CC(C(C)C)=C1OC1=CN=C(NC(CO)CO)N=C1N PAYROHWFGZADBR-UHFFFAOYSA-N 0.000 description 1
- 125000005273 2-acetoxybenzoic acid group Chemical class 0.000 description 1
- VVCMGAUPZIKYTH-VGHSCWAPSA-N 2-acetyloxybenzoic acid;[(2s,3r)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] propanoate;1,3,7-trimethylpurine-2,6-dione Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O.CN1C(=O)N(C)C(=O)C2=C1N=CN2C.C([C@](OC(=O)CC)([C@H](C)CN(C)C)C=1C=CC=CC=1)C1=CC=CC=C1 VVCMGAUPZIKYTH-VGHSCWAPSA-N 0.000 description 1
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 description 1
- LFOIDLOIBZFWDO-UHFFFAOYSA-N 2-methoxy-6-[6-methoxy-4-[(3-phenylmethoxyphenyl)methoxy]-1-benzofuran-2-yl]imidazo[2,1-b][1,3,4]thiadiazole Chemical compound N1=C2SC(OC)=NN2C=C1C(OC1=CC(OC)=C2)=CC1=C2OCC(C=1)=CC=CC=1OCC1=CC=CC=C1 LFOIDLOIBZFWDO-UHFFFAOYSA-N 0.000 description 1
- 125000004398 2-methyl-2-butyl group Chemical group CC(C)(CC)* 0.000 description 1
- 125000004918 2-methyl-2-pentyl group Chemical group CC(C)(CCC)* 0.000 description 1
- 125000004922 2-methyl-3-pentyl group Chemical group CC(C)C(CC)* 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- GMOYUTKNPLBTMT-UHFFFAOYSA-N 2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OCC1=CC=CC=C1 GMOYUTKNPLBTMT-UHFFFAOYSA-N 0.000 description 1
- ITDFRSCTQXOUAC-UHFFFAOYSA-N 2-phenylmethoxybenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1OCC1=CC=CC=C1 ITDFRSCTQXOUAC-UHFFFAOYSA-N 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- DFRAKBCRUYUFNT-UHFFFAOYSA-N 3,8-dicyclohexyl-2,4,7,9-tetrahydro-[1,3]oxazino[5,6-h][1,3]benzoxazine Chemical compound C1CCCCC1N1CC(C=CC2=C3OCN(C2)C2CCCCC2)=C3OC1 DFRAKBCRUYUFNT-UHFFFAOYSA-N 0.000 description 1
- MWDVCHRYCKXEBY-LBPRGKRZSA-N 3-chloro-n-[2-oxo-2-[[(1s)-1-phenylethyl]amino]ethyl]benzamide Chemical compound N([C@@H](C)C=1C=CC=CC=1)C(=O)CNC(=O)C1=CC=CC(Cl)=C1 MWDVCHRYCKXEBY-LBPRGKRZSA-N 0.000 description 1
- SYVNVEGIRVXRQH-UHFFFAOYSA-N 3-fluorobenzoyl chloride Chemical compound FC1=CC=CC(C(Cl)=O)=C1 SYVNVEGIRVXRQH-UHFFFAOYSA-N 0.000 description 1
- 125000004917 3-methyl-2-butyl group Chemical group CC(C(C)*)C 0.000 description 1
- 125000004919 3-methyl-2-pentyl group Chemical group CC(C(C)*)CC 0.000 description 1
- 125000004921 3-methyl-3-pentyl group Chemical group CC(CC)(CC)* 0.000 description 1
- MCGBIXXDQFWVDW-UHFFFAOYSA-N 4,5-dihydro-1h-pyrazole Chemical compound C1CC=NN1 MCGBIXXDQFWVDW-UHFFFAOYSA-N 0.000 description 1
- RLRKXZGNQWPXRC-UHFFFAOYSA-N 4,7,7-trimethylbicyclo[2.2.1]heptan-3-one;hydrochloride Chemical compound Cl.C1CC2(C)C(=O)CC1C2(C)C RLRKXZGNQWPXRC-UHFFFAOYSA-N 0.000 description 1
- GSDQYSSLIKJJOG-UHFFFAOYSA-N 4-chloro-2-(3-chloroanilino)benzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1NC1=CC=CC(Cl)=C1 GSDQYSSLIKJJOG-UHFFFAOYSA-N 0.000 description 1
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 1
- OURXRFYZEOUCRM-UHFFFAOYSA-N 4-hydroxymorpholine Chemical compound ON1CCOCC1 OURXRFYZEOUCRM-UHFFFAOYSA-N 0.000 description 1
- 125000004920 4-methyl-2-pentyl group Chemical group CC(CC(C)*)C 0.000 description 1
- 125000004937 4H-carbazolyl group Chemical group C=1(C=CCC2=C3C=CC=CC3=NC12)* 0.000 description 1
- MRUWJENAYHTDQG-UHFFFAOYSA-N 4H-pyran Chemical compound C1C=COC=C1 MRUWJENAYHTDQG-UHFFFAOYSA-N 0.000 description 1
- GDRVFDDBLLKWRI-UHFFFAOYSA-N 4H-quinolizine Chemical compound C1=CC=CN2CC=CC=C21 GDRVFDDBLLKWRI-UHFFFAOYSA-N 0.000 description 1
- VKLKXFOZNHEBSW-UHFFFAOYSA-N 5-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methoxy]pyridine-3-carboxamide Chemical compound O1CCN(CC1)C1=CC=C(C(=O)NC=2C=C(COC=3C=NC=C(C(=O)N)C=3)C=CC=2)C=C1 VKLKXFOZNHEBSW-UHFFFAOYSA-N 0.000 description 1
- IJRKLHTZAIFUTB-UHFFFAOYSA-N 5-nitro-2-(2-phenylethylamino)benzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1NCCC1=CC=CC=C1 IJRKLHTZAIFUTB-UHFFFAOYSA-N 0.000 description 1
- WKGMOKBNWXDQND-UHFFFAOYSA-N 6-(2-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinolin-8-one Chemical compound FC1=CC=CC=C1C(CC(=O)C1=C2)=NC1=CC1=C2OCO1 WKGMOKBNWXDQND-UHFFFAOYSA-N 0.000 description 1
- RSIWALKZYXPAGW-NSHDSACASA-N 6-(3-fluorophenyl)-3-methyl-7-[(1s)-1-(7h-purin-6-ylamino)ethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one Chemical compound C=1([C@@H](NC=2C=3N=CNC=3N=CN=2)C)N=C2SC=C(C)N2C(=O)C=1C1=CC=CC(F)=C1 RSIWALKZYXPAGW-NSHDSACASA-N 0.000 description 1
- SZNHGQRKYLETSR-UHFFFAOYSA-N 6-morpholin-4-yl-2-(2-phenylmethoxyphenyl)-3h-quinolin-4-one Chemical compound C1=C2C(=O)CC(C=3C(=CC=CC=3)OCC=3C=CC=CC=3)=NC2=CC=C1N1CCOCC1 SZNHGQRKYLETSR-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 1
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 1
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- JQUCWIWWWKZNCS-LESHARBVSA-N C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F Chemical compound C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F JQUCWIWWWKZNCS-LESHARBVSA-N 0.000 description 1
- FWDBZJBJTDRIIY-UHFFFAOYSA-N CC(C)(C)[K] Chemical compound CC(C)(C)[K] FWDBZJBJTDRIIY-UHFFFAOYSA-N 0.000 description 1
- KCBAMQOKOLXLOX-BSZYMOERSA-N CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O Chemical compound CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O KCBAMQOKOLXLOX-BSZYMOERSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229940126657 Compound 17 Drugs 0.000 description 1
- 229940127007 Compound 39 Drugs 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical group O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 241001125671 Eretmochelys imbricata Species 0.000 description 1
- RRSNDVCODIMOFX-MPKOGUQCSA-N Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O Chemical compound Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O RRSNDVCODIMOFX-MPKOGUQCSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 230000005526 G1 to G0 transition Effects 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 206010021143 Hypoxia Diseases 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 102000051628 Interleukin-1 receptor antagonist Human genes 0.000 description 1
- 108700021006 Interleukin-1 receptor antagonist Proteins 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 102000004243 Tubulin Human genes 0.000 description 1
- 108090000704 Tubulin Proteins 0.000 description 1
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- VRNJXPOGYKYCMG-UHFFFAOYSA-N [6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] dihydrogen phosphate Chemical compound C1=CC=C2C(C=3C=C(C4=CC=5OCOC=5C=C4N=3)OP(O)(=O)O)=COC2=C1 VRNJXPOGYKYCMG-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 239000012042 active reagent Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- ADRVNXBAWSRFAJ-UHFFFAOYSA-N catechin Natural products OC1Cc2cc(O)cc(O)c2OC1c3ccc(O)c(O)c3 ADRVNXBAWSRFAJ-UHFFFAOYSA-N 0.000 description 1
- 235000005487 catechin Nutrition 0.000 description 1
- 230000030833 cell death Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000005829 chemical entities Chemical class 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000013626 chemical specie Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 229950001002 cianidanol Drugs 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 229940125851 compound 27 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125807 compound 37 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000006165 cyclic alkyl group Chemical group 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- 230000001472 cytotoxic effect Effects 0.000 description 1
- 230000020176 deacylation Effects 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 230000009615 deamination Effects 0.000 description 1
- 238000006481 deamination reaction Methods 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000030609 dephosphorylation Effects 0.000 description 1
- 238000006209 dephosphorylation reaction Methods 0.000 description 1
- 238000005906 dihydroxylation reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 239000001177 diphosphate Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 229940000406 drug candidate Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- 238000000132 electrospray ionisation Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- YJOMWIXHFKAFOB-UHFFFAOYSA-N ethyl 2-phenylmethoxybenzoate Chemical compound CCOC(=O)C1=CC=CC=C1OCC1=CC=CC=C1 YJOMWIXHFKAFOB-UHFFFAOYSA-N 0.000 description 1
- 235000010228 ethyl p-hydroxybenzoate Nutrition 0.000 description 1
- 210000001723 extracellular space Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 235000015220 hamburgers Nutrition 0.000 description 1
- 125000005549 heteroarylene group Chemical group 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000033444 hydroxylation Effects 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- 230000001146 hypoxic effect Effects 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000003547 immunosorbent Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- HOBCFUWDNJPFHB-UHFFFAOYSA-N indolizine Chemical compound C1=CC=CN2C=CC=C21 HOBCFUWDNJPFHB-UHFFFAOYSA-N 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000003407 interleukin 1 receptor blocking agent Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000001620 monocyclic carbocycle group Chemical group 0.000 description 1
- 210000000214 mouth Anatomy 0.000 description 1
- OKDQKPLMQBXTNH-UHFFFAOYSA-N n,n-dimethyl-2h-pyridin-1-amine Chemical compound CN(C)N1CC=CC=C1 OKDQKPLMQBXTNH-UHFFFAOYSA-N 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- FBTZYOORSUJXLZ-UHFFFAOYSA-N n-(2-acetyl-3,4-dimethoxyphenyl)-2-fluorobenzamide Chemical compound CC(=O)C1=C(OC)C(OC)=CC=C1NC(=O)C1=CC=CC=C1F FBTZYOORSUJXLZ-UHFFFAOYSA-N 0.000 description 1
- AECWHNZTOLDBEF-UHFFFAOYSA-N n-(2-acetyl-4-morpholin-4-ylphenyl)-2-phenylmethoxybenzamide Chemical compound CC(=O)C1=CC(N2CCOCC2)=CC=C1NC(=O)C1=CC=CC=C1OCC1=CC=CC=C1 AECWHNZTOLDBEF-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- NSNPSJGHTQIXDO-UHFFFAOYSA-N naphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=CC2=C1 NSNPSJGHTQIXDO-UHFFFAOYSA-N 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 229940127073 nucleoside analogue Drugs 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000005954 phenoxathiinyl group Chemical group 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- CPNGPNLZQNNVQM-UHFFFAOYSA-N pteridine Chemical compound N1=CN=CC2=NC=CN=C21 CPNGPNLZQNNVQM-UHFFFAOYSA-N 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- SBYHFKPVCBCYGV-UHFFFAOYSA-N quinuclidine Chemical compound C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 230000009747 swallowing Effects 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000011885 synergistic combination Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- YJBKVPRVZAQTPY-UHFFFAOYSA-J tetrachlorostannane;dihydrate Chemical compound O.O.Cl[Sn](Cl)(Cl)Cl YJBKVPRVZAQTPY-UHFFFAOYSA-J 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 125000000464 thioxo group Chemical group S=* 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 238000011269 treatment regimen Methods 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 125000006168 tricyclic group Chemical group 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
- 125000004933 β-carbolinyl group Chemical group C1(=NC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/4709—Non-condensed quinolines and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/4738—Quinolines; Isoquinolines ortho- or peri-condensed with heterocyclic ring systems
- A61K31/4741—Quinolines; Isoquinolines ortho- or peri-condensed with heterocyclic ring systems condensed with ring systems having oxygen as a ring hetero atom, e.g. tubocuraran derivatives, noscapine, bicuculline
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/233—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
- C07D491/056—Ortho-condensed systems with two or more oxygen atoms as ring hetero atoms in the oxygen-containing ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having one nitrogen atom as the only ring hetero atom
- C07F9/576—Six-membered rings
- C07F9/60—Quinoline or hydrogenated quinoline ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6558—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing at least two different or differently substituted hetero rings neither condensed among themselves nor condensed with a common carbocyclic ring or ring system
- C07F9/65583—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing at least two different or differently substituted hetero rings neither condensed among themselves nor condensed with a common carbocyclic ring or ring system each of the hetero rings containing nitrogen as ring hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6561—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing systems of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring or ring system, with or without other non-condensed hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- Molecular Biology (AREA)
- Pharmacology & Pharmacy (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Epidemiology (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oncology (AREA)
- Hematology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US36476010P | 2010-07-15 | 2010-07-15 | |
| US61/364,760 | 2010-07-15 | ||
| PCT/US2011/043985 WO2012009519A1 (en) | 2010-07-15 | 2011-07-14 | Synthesis and anticancer activity of aryl and heteroaryl-quinolin derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RU2013105151A RU2013105151A (ru) | 2014-08-20 |
| RU2584688C2 true RU2584688C2 (ru) | 2016-05-20 |
Family
ID=44533096
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU2013105151/04A RU2584688C2 (ru) | 2010-07-15 | 2011-07-14 | Синтез и противораковая активность производных арил и гетероарилхинолинов |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US8524740B2 (enExample) |
| EP (2) | EP2593435B1 (enExample) |
| JP (3) | JP2013532634A (enExample) |
| KR (2) | KR101913194B1 (enExample) |
| CN (1) | CN103347859B (enExample) |
| AU (1) | AU2011279118B2 (enExample) |
| BR (1) | BR112013000716B1 (enExample) |
| CA (2) | CA2805590C (enExample) |
| RU (1) | RU2584688C2 (enExample) |
| TW (1) | TWI499417B (enExample) |
| WO (1) | WO2012009519A1 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20150370707A1 (en) * | 2014-06-24 | 2015-12-24 | Qualcomm Incorporated | Disunited shared-information and private-information caches |
| EP3302488B1 (en) * | 2015-06-03 | 2020-09-30 | Tairx, Inc. | Novel use of aryl-quinolin derivatives as inhibitors of vasculogenic mimicry |
| CN108911967A (zh) * | 2018-08-03 | 2018-11-30 | 上海华堇生物技术有限责任公司 | 2,5–二甲氧基苯甲酰氯的制备方法 |
| CN112358462B (zh) * | 2020-11-10 | 2023-11-10 | 成都伊诺达博医药科技有限公司 | 一种胡椒环衍生物的合成方法 |
| AU2022380979A1 (en) | 2021-11-02 | 2024-06-06 | Flare Therapeutics Inc. | Pparg inverse agonists and uses thereof |
| CN116789567A (zh) * | 2023-05-18 | 2023-09-22 | 福建凯昕药业有限公司 | 抗血小板减少症药芦曲泊帕中间体及其制备方法 |
| CN120695016B (zh) * | 2025-08-29 | 2025-12-02 | 北京大学 | 一种二氢喹啉衍生物在制备预防或治疗脂肪肝产品中的用途 |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1996010563A1 (en) * | 1994-09-30 | 1996-04-11 | The University Of North Carolina At Chapel Hill | 2-aryl-4-quinolones as antitumor compounds |
| WO2002026730A2 (en) * | 2000-09-25 | 2002-04-04 | University Of North Carolina At Chapel Hill | Fluorinated quinolones as antimitotic and antitumor agents |
| US20050171138A1 (en) * | 2003-02-24 | 2005-08-04 | Kuo-Hsiung Lee | Flavone acetic acid analogs and methods of use thereof |
| RU2004112777A (ru) * | 2001-11-01 | 2005-10-27 | Астразенека Аб (Se) | Терапевтические хинолоновые соединения с 5-ht-антагонистическими свойствами |
| WO2008070176A1 (en) * | 2006-12-07 | 2008-06-12 | China Medical University | Novel hydrophilic derivatives of 2-aryl-4-quinolones as anticancer agents |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1994002145A2 (en) | 1992-07-22 | 1994-02-03 | Genelabs Technologies, Inc. | 2-aryl-4-quinolones as antitumor compounds |
| JPH0733743A (ja) * | 1993-07-22 | 1995-02-03 | Kyorin Pharmaceut Co Ltd | 2−アリール−4−キノリノール誘導体 |
| US6897316B2 (en) * | 2003-08-08 | 2005-05-24 | China Medical University | Substituted 2-phenyl-4-quinolone-3-carboxylic acid compounds and their use as antitumor agents |
| AU2008345225A1 (en) * | 2007-12-21 | 2009-07-09 | University Of Rochester | Method for altering the lifespan of eukaryotic organisms |
-
2011
- 2011-07-13 US US13/181,978 patent/US8524740B2/en active Active
- 2011-07-14 KR KR1020177029236A patent/KR101913194B1/ko active Active
- 2011-07-14 KR KR1020137003810A patent/KR20130043194A/ko not_active Ceased
- 2011-07-14 CA CA2805590A patent/CA2805590C/en active Active
- 2011-07-14 AU AU2011279118A patent/AU2011279118B2/en active Active
- 2011-07-14 JP JP2013519818A patent/JP2013532634A/ja active Pending
- 2011-07-14 WO PCT/US2011/043985 patent/WO2012009519A1/en not_active Ceased
- 2011-07-14 BR BR112013000716-8A patent/BR112013000716B1/pt active IP Right Grant
- 2011-07-14 RU RU2013105151/04A patent/RU2584688C2/ru active
- 2011-07-14 CA CA2963390A patent/CA2963390C/en active Active
- 2011-07-14 EP EP11740761.9A patent/EP2593435B1/en active Active
- 2011-07-14 EP EP16181738.2A patent/EP3112348A1/en not_active Withdrawn
- 2011-07-14 CN CN201180033144.1A patent/CN103347859B/zh active Active
- 2011-07-15 TW TW100125130A patent/TWI499417B/zh active
-
2015
- 2015-08-07 JP JP2015157760A patent/JP6371741B2/ja active Active
-
2017
- 2017-05-24 JP JP2017102672A patent/JP6457584B2/ja active Active
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1996010563A1 (en) * | 1994-09-30 | 1996-04-11 | The University Of North Carolina At Chapel Hill | 2-aryl-4-quinolones as antitumor compounds |
| WO2002026730A2 (en) * | 2000-09-25 | 2002-04-04 | University Of North Carolina At Chapel Hill | Fluorinated quinolones as antimitotic and antitumor agents |
| RU2004112777A (ru) * | 2001-11-01 | 2005-10-27 | Астразенека Аб (Se) | Терапевтические хинолоновые соединения с 5-ht-антагонистическими свойствами |
| US20050171138A1 (en) * | 2003-02-24 | 2005-08-04 | Kuo-Hsiung Lee | Flavone acetic acid analogs and methods of use thereof |
| WO2008070176A1 (en) * | 2006-12-07 | 2008-06-12 | China Medical University | Novel hydrophilic derivatives of 2-aryl-4-quinolones as anticancer agents |
Non-Patent Citations (1)
| Title |
|---|
| Yu-Hsun Chang et al. "Design and Synthesis of 2-(3-Benzo[b]thienyl)-6,7-methylenedioxyquinolin-4-one Analogues as Potent Antitumor Agents that Inhibit Tubulin Assembly" JOURNAL OF MEDICINAL CHEMISTRY, vol.52, N15, 2009, 4883-4891. Leping Li et al. "Antitumor Agents. 150. 2',3',4',5',5,6,7-Substituted 2-Phenyl-4-quinolones and related Compounds: Their Synthesis, Cytotoxicity, and Inhibition of Tubulin Polymerization" JOURNAL OF MEDICINAL CHEMISTRY, vol.37, N8, 1994, 1126-1135. * |
Also Published As
| Publication number | Publication date |
|---|---|
| KR20130043194A (ko) | 2013-04-29 |
| CN103347859A (zh) | 2013-10-09 |
| CN103347859B (zh) | 2015-12-02 |
| KR101913194B1 (ko) | 2018-10-31 |
| EP3112348A1 (en) | 2017-01-04 |
| JP2016028032A (ja) | 2016-02-25 |
| RU2013105151A (ru) | 2014-08-20 |
| CA2963390A1 (en) | 2012-01-19 |
| JP6371741B2 (ja) | 2018-08-08 |
| US20120015908A1 (en) | 2012-01-19 |
| AU2011279118A1 (en) | 2012-12-20 |
| KR20170118244A (ko) | 2017-10-24 |
| CA2963390C (en) | 2020-02-11 |
| US8524740B2 (en) | 2013-09-03 |
| BR112013000716B1 (pt) | 2021-10-05 |
| EP2593435A1 (en) | 2013-05-22 |
| CA2805590C (en) | 2017-05-16 |
| TWI499417B (zh) | 2015-09-11 |
| AU2011279118B2 (en) | 2014-12-18 |
| EP2593435B1 (en) | 2016-09-07 |
| JP2017206511A (ja) | 2017-11-24 |
| BR112013000716A2 (pt) | 2019-10-01 |
| WO2012009519A1 (en) | 2012-01-19 |
| CA2805590A1 (en) | 2012-01-19 |
| JP6457584B2 (ja) | 2019-01-23 |
| TW201206439A (en) | 2012-02-16 |
| JP2013532634A (ja) | 2013-08-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP6457584B2 (ja) | アリール及びヘテロアリール−キノリン誘導体の合成及び抗癌活性 | |
| AU2013246278B2 (en) | Histone deacetylases (HDAC) inhibitors | |
| RU2498981C2 (ru) | 7-пиперидиноалкил-3,4-дигидрохинолоновые производные, обладающие антагонистическим действием на рецептор мсн (меланин-концентрирующего гормона) | |
| EP2915806B1 (en) | Quinoline compound and use thereof | |
| KR20100014845A (ko) | 심혈관 질환을 예방 및 치료하기 위한 화합물 | |
| CA2984974A1 (en) | Indenoindole derivatives, pharmaceutically acceptable salts or optical isomers thereof, preparation method for same, and pharmaceutical compositions containing same as active ingredient for preventing or treating viral diseases | |
| EP4149510A1 (en) | Novel intermediates and synthesis for endochin-like quinolone compounds | |
| ITMI941494A1 (it) | Derivati del fenilcarbammato atti all'impiego come anticolinesterasici | |
| EP1541149A1 (en) | Phosphodiesterase inhibitor | |
| EP3242881B1 (en) | Furoquinolinediones as inhibitors of tdp2 | |
| FI96417B (fi) | Menetelmä uusien terapeuttisesti käyttökelpoisten isokinoliinijohdannaisten valmistamiseksi | |
| WO2014179401A1 (en) | 2-arylnaphthyridin-4-ones as potent antitumor agents targeting tumorigenic cell lines | |
| KR20100097940A (ko) | 신규 ck2 저해제 및 그의 제조 방법 |