RU2371069C1 - Средство ухода за полостью рта, содержащее эластомерный полипропиленэтиленовый сополимер - Google Patents
Средство ухода за полостью рта, содержащее эластомерный полипропиленэтиленовый сополимер Download PDFInfo
- Publication number
- RU2371069C1 RU2371069C1 RU2008107322/12A RU2008107322A RU2371069C1 RU 2371069 C1 RU2371069 C1 RU 2371069C1 RU 2008107322/12 A RU2008107322/12 A RU 2008107322/12A RU 2008107322 A RU2008107322 A RU 2008107322A RU 2371069 C1 RU2371069 C1 RU 2371069C1
- Authority
- RU
- Russia
- Prior art keywords
- copolymer
- oral care
- care product
- head
- handle
- Prior art date
Links
- 229920005653 propylene-ethylene copolymer Polymers 0.000 title claims abstract description 22
- 229920001577 copolymer Polymers 0.000 claims abstract description 24
- 235000010585 Ammi visnaga Nutrition 0.000 claims abstract description 11
- 244000153158 Ammi visnaga Species 0.000 claims abstract description 11
- 230000001680 brushing effect Effects 0.000 claims abstract description 11
- 210000003128 head Anatomy 0.000 claims description 29
- 238000004140 cleaning Methods 0.000 claims description 20
- 229920006342 thermoplastic vulcanizate Polymers 0.000 claims description 8
- 229920000098 polyolefin Polymers 0.000 claims description 7
- 238000005452 bending Methods 0.000 claims description 4
- 230000009477 glass transition Effects 0.000 claims description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 3
- 239000005977 Ethylene Substances 0.000 claims description 3
- 238000009826 distribution Methods 0.000 claims description 3
- 239000002667 nucleating agent Substances 0.000 claims description 3
- 239000012968 metallocene catalyst Substances 0.000 claims description 2
- 210000000214 mouth Anatomy 0.000 claims description 2
- 229920001198 elastomeric copolymer Polymers 0.000 claims 3
- 239000000126 substance Substances 0.000 abstract description 4
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- 229920001971 elastomer Polymers 0.000 description 34
- 239000000806 elastomer Substances 0.000 description 34
- -1 polypropylene Polymers 0.000 description 11
- 239000004743 Polypropylene Substances 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 229920001155 polypropylene Polymers 0.000 description 9
- 238000000465 moulding Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 239000000654 additive Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000002775 capsule Substances 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 229920002725 thermoplastic elastomer Polymers 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 4
- 230000000704 physical effect Effects 0.000 description 4
- 239000013536 elastomeric material Substances 0.000 description 3
- 235000013355 food flavoring agent Nutrition 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 229920002397 thermoplastic olefin Polymers 0.000 description 3
- 241000628997 Flos Species 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 239000005454 flavour additive Substances 0.000 description 2
- 229920001684 low density polyethylene Polymers 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000008375 oral care agent Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 229920008347 Cellulose acetate propionate Polymers 0.000 description 1
- 235000002505 Centaurea nigra Nutrition 0.000 description 1
- 240000003323 Centaurea nigra Species 0.000 description 1
- 229920002943 EPDM rubber Polymers 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 229920000181 Ethylene propylene rubber Polymers 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000010835 comparative analysis Methods 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 239000000551 dentifrice Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000005038 ethylene vinyl acetate Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 210000005224 forefinger Anatomy 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000012766 organic filler Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920006124 polyolefin elastomer Polymers 0.000 description 1
- 229920005606 polypropylene copolymer Polymers 0.000 description 1
- 229920005629 polypropylene homopolymer Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 230000035807 sensation Effects 0.000 description 1
- 235000019615 sensations Nutrition 0.000 description 1
- 210000004872 soft tissue Anatomy 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229920006132 styrene block copolymer Polymers 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 210000003813 thumb Anatomy 0.000 description 1
Images
Classifications
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B15/00—Other brushes; Brushes with additional arrangements
- A46B15/0055—Brushes combined with other articles normally separate from the brushing process, e.g. combs, razors, mirrors
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B15/00—Other brushes; Brushes with additional arrangements
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B15/00—Other brushes; Brushes with additional arrangements
- A46B15/0055—Brushes combined with other articles normally separate from the brushing process, e.g. combs, razors, mirrors
- A46B15/0069—Brushes fitted with a interdental devices, e.g. toothpick
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B15/00—Other brushes; Brushes with additional arrangements
- A46B15/0055—Brushes combined with other articles normally separate from the brushing process, e.g. combs, razors, mirrors
- A46B15/0081—Brushes with a scraper, e.g. tongue scraper
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B5/00—Brush bodies; Handles integral with brushware
- A46B5/002—Brush bodies; Handles integral with brushware having articulations, joints or flexible portions
- A46B5/0025—Brushes with elastically deformable heads that change shape during use
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B5/00—Brush bodies; Handles integral with brushware
- A46B5/02—Brush bodies; Handles integral with brushware specially shaped for holding by the hand
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B5/00—Brush bodies; Handles integral with brushware
- A46B5/02—Brush bodies; Handles integral with brushware specially shaped for holding by the hand
- A46B5/026—Grips or handles having a nonslip section
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B2200/00—Brushes characterized by their functions, uses or applications
- A46B2200/10—For human or animal care
- A46B2200/1066—Toothbrush for cleaning the teeth or dentures
Landscapes
- Brushes (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Materials For Medical Uses (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US70273605P | 2005-07-27 | 2005-07-27 | |
| US60/702,736 | 2005-07-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RU2008107322A RU2008107322A (ru) | 2009-09-10 |
| RU2371069C1 true RU2371069C1 (ru) | 2009-10-27 |
Family
ID=37428616
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU2008107322/12A RU2371069C1 (ru) | 2005-07-27 | 2006-07-26 | Средство ухода за полостью рта, содержащее эластомерный полипропиленэтиленовый сополимер |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US20070163064A1 (pt) |
| EP (1) | EP1906790A1 (pt) |
| KR (1) | KR20080026657A (pt) |
| CN (1) | CN101296635A (pt) |
| AU (1) | AU2006275960A1 (pt) |
| BR (1) | BRPI0614159A2 (pt) |
| CA (1) | CA2616518A1 (pt) |
| MX (1) | MX2008001108A (pt) |
| RU (1) | RU2371069C1 (pt) |
| TW (1) | TW200722006A (pt) |
| WO (1) | WO2007016066A1 (pt) |
Families Citing this family (64)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20070174985A1 (en) * | 2006-01-27 | 2007-08-02 | Steven Joe Jr | Toothbrush with tongue scraper/cleaner |
| GB0613135D0 (en) * | 2006-06-30 | 2006-08-09 | Glaxosmithkline Consumer Healt | Toothbrush |
| RU2428907C2 (ru) | 2007-02-02 | 2011-09-20 | Дзе Жиллетт Компани | Принадлежности для гигиены полости рта, имеющие гибкие элементы, и способы их изготовления |
| WO2009002583A1 (en) * | 2007-06-26 | 2008-12-31 | Live-Right, Llc | Infant toothbrush |
| US9808227B2 (en) * | 2008-01-14 | 2017-11-07 | Q-In Medical Technologies, Llc | Tongue retraction and cleaning method and apparatus |
| US8510893B2 (en) | 2008-06-20 | 2013-08-20 | Colgate-Palmolive Company | Toothbrush with visual and/or other sensory effects |
| USD645252S1 (en) | 2008-08-15 | 2011-09-20 | Mcneil-Ppc, Inc. | Toothbrush |
| USD658885S1 (en) | 2008-09-30 | 2012-05-08 | Mcneil-Ppc, Inc. | Toothbrush handle |
| EP2759227B1 (de) * | 2009-03-18 | 2016-10-05 | Braun GmbH | Zahnbürste |
| USD606806S1 (en) | 2009-08-26 | 2009-12-29 | Le Creuset Sas | Utensil handle |
| US8235435B2 (en) * | 2009-08-26 | 2012-08-07 | Le Creuset Sas | Utensil handle |
| DE102009058608B4 (de) * | 2009-12-17 | 2023-02-02 | Gb Boucherie Nv | Verfahren zum Verbinden von Bürstenkopfplatten mit Bürstenkörpern |
| US8500766B2 (en) * | 2009-12-18 | 2013-08-06 | Colgate-Palmolive Company | Oral care implement multiple soft tissue cleaner components |
| USD675830S1 (en) * | 2009-12-18 | 2013-02-12 | Colgate-Palmolive Company | Toothbrush |
| US8740788B1 (en) | 2010-06-04 | 2014-06-03 | Gil Mettler | Tongue retraction method and apparatus with relief notch |
| US20120055497A1 (en) * | 2010-09-03 | 2012-03-08 | Marni Markell Hurwitz | Oral hygiene implement and method of use |
| PL2642886T3 (pl) * | 2010-11-22 | 2017-12-29 | Braun Gmbh | Szczoteczka do zębów |
| RU2560002C2 (ru) | 2010-12-21 | 2015-08-20 | Колгейт-Палмолив Компани | Устройство для ухода за полостью рта |
| US8590095B2 (en) | 2011-02-10 | 2013-11-26 | Ranir, Llc | Toothbrush with movable head portion |
| DE102011011323A1 (de) * | 2011-02-16 | 2012-08-16 | Interbros Gmbh | Mund- oder Zahnreinigungsgerät |
| USD689286S1 (en) * | 2011-05-02 | 2013-09-10 | Colgate-Palmolive Company | Toothbrush |
| USD712155S1 (en) * | 2011-05-02 | 2014-09-02 | Colgate-Palmolive Company | Toothbrush |
| US11963833B2 (en) * | 2011-07-18 | 2024-04-23 | G And E International Llc | Imitation lipstick with concealed tooth cleaning implement |
| USD689345S1 (en) | 2011-10-10 | 2013-09-10 | Le Creuset Sas | Sauté spoon |
| USD677129S1 (en) | 2011-10-10 | 2013-03-05 | Le Creuset Sas | Sauté spoon |
| US9510664B2 (en) * | 2011-11-22 | 2016-12-06 | The Procter & Gamble Co | Toothbrush having an inner cavity |
| US9420877B2 (en) | 2011-11-22 | 2016-08-23 | The Procter & Gamble Company | Method for producing a toothbrush having an inner cavity |
| US9463593B2 (en) | 2011-11-22 | 2016-10-11 | The Procter & Gamble Company | Method for producing a toothbrush having an inner cavity |
| EP2782474B1 (en) * | 2011-11-22 | 2018-10-10 | The Procter and Gamble Company | Method for producing a toothbrush having an inner cavity |
| US9756931B2 (en) | 2011-11-22 | 2017-09-12 | The Procter & Gamble Company | Method for producing a toothbrush having an inner cavity |
| US20130220363A1 (en) * | 2012-02-23 | 2013-08-29 | Saam Zarrabi | Disposable teeth cleaning system |
| US9427074B2 (en) | 2012-12-10 | 2016-08-30 | Colgate-Palmolive Company | Oral care implement |
| US20150047672A1 (en) * | 2013-08-13 | 2015-02-19 | Fatimah Giwa | Removable tip oral hygiene device |
| US11089862B2 (en) | 2013-11-13 | 2021-08-17 | The Gillette Company Llc | Oral-care implement and method for manufacturing the same |
| EP2873343B1 (en) * | 2013-11-13 | 2024-01-24 | The Gillette Company LLC | Oral care implement and method for manufacturing the same |
| EP3062657A4 (en) * | 2013-11-25 | 2017-06-28 | Colgate-Palmolive Company | Oral care implement |
| USD764177S1 (en) | 2014-07-31 | 2016-08-23 | Colgate-Palmolive Company | Oral care implement |
| USD764176S1 (en) * | 2014-07-31 | 2016-08-23 | Colgate-Palmolive Company | Oral care implement |
| EP3174428A1 (en) | 2014-08-28 | 2017-06-07 | Colgate-Palmolive Company | Oral care implement having collapsible elastomeric element |
| USD751296S1 (en) * | 2014-09-02 | 2016-03-15 | Colgate-Palmolive Company | Oral care implement |
| AU2015383809B2 (en) * | 2015-02-18 | 2018-04-12 | Colgate-Palmolive Company | Oral care implement |
| CN105476256A (zh) * | 2015-11-18 | 2016-04-13 | 华文蔚 | 一种台阶式牙刷 |
| JP1600692S (pt) * | 2016-07-14 | 2018-03-26 | ||
| USD790701S1 (en) | 2016-12-23 | 2017-06-27 | Henry Figueredo | Handle for a tongue cleaner |
| EP3470015B1 (de) * | 2017-10-11 | 2021-07-07 | Trisa Holding AG | Elektrisches zahnbürstenhandteil und elektrische zahnbürste mit dem elektrischen zahnbürstenhandteil und mit einer aufsteckbürste |
| USD960581S1 (en) | 2018-02-09 | 2022-08-16 | The Gillette Company Llc | Toothbrush head |
| USD912988S1 (en) * | 2018-02-09 | 2021-03-16 | The Gillette Company Llc | Toothbrush handle |
| USD931617S1 (en) | 2018-09-03 | 2021-09-28 | The Gillette Company Llc | Toothbrush head |
| USD867763S1 (en) * | 2018-10-30 | 2019-11-26 | Yangzhou E.S. Toothbrush Co., Ltd. | Antibacterial toothbrush |
| CA3119552A1 (en) | 2018-12-13 | 2020-06-18 | Colgate-Palmolive Company | Oral care implement |
| USD883677S1 (en) | 2018-12-13 | 2020-05-12 | Colgate-Palmolive Company | Toothbrush |
| US11622618B2 (en) | 2018-12-13 | 2023-04-11 | Colgate-Palmolive Company | Oral care implement |
| USD901183S1 (en) | 2019-03-22 | 2020-11-10 | The Gillette Company Llc | Toothbrush |
| USD1014095S1 (en) | 2020-07-02 | 2024-02-13 | The Gillette Company Llc. | Toothbrush |
| USD957135S1 (en) | 2020-07-02 | 2022-07-12 | The Gillette Company Llc | Toothbrush head |
| USD961269S1 (en) | 2020-07-31 | 2022-08-23 | Colgate-Palmolive Company | Oral care implement |
| CA218833S (en) | 2020-11-06 | 2023-11-08 | Gillette Co Llc | Toothbrush head |
| USD1051608S1 (en) | 2021-05-04 | 2024-11-19 | The Gillette Company Llc | Handle for battery operated toothbrush |
| US12245686B2 (en) | 2021-06-23 | 2025-03-11 | The Wooster Brush Company | Paint brush handle with integrated grip pads |
| USD1033910S1 (en) | 2021-07-02 | 2024-07-09 | Braun Gmbh | Handle for electric toothbrush |
| USD1024571S1 (en) | 2022-06-17 | 2024-04-30 | Colgate-Palmolive Company | Oral care implement |
| USD1019158S1 (en) | 2022-06-22 | 2024-03-26 | The Wooster Brush Company | Paint brush with integrated grip pad |
| USD1024572S1 (en) | 2022-06-24 | 2024-04-30 | Colgate-Palmolive Company | Oral care implement |
| US12521215B1 (en) * | 2023-11-29 | 2026-01-13 | Charles L. Urso | Sensuous oral cleaner |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2152158C1 (ru) * | 1995-12-29 | 2000-07-10 | Колгейт-Палмолив Компани | Зубная щетка (варианты) |
| KR20000047321A (ko) * | 1998-12-31 | 2000-07-25 | 성재갑 | 아아치 형태의 유연성 있는 칫솔헤드의 칫솔 |
| JP2002095526A (ja) * | 2000-09-26 | 2002-04-02 | Lion Corp | 歯ブラシ |
| WO2003030680A1 (en) * | 2001-10-05 | 2003-04-17 | Glaxosmithkline Consumer Healthcare Gmbh & Co Kg | Toothbrush |
| JP2003189935A (ja) * | 2001-12-25 | 2003-07-08 | Lion Corp | 歯ブラシ |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1811833A (en) * | 1930-03-01 | 1931-06-23 | Edward J Boardman | Capsule toothbrush |
| US1896982A (en) * | 1930-11-20 | 1933-02-07 | Richard J Talbot | Toothbrush |
| US1925818A (en) * | 1931-06-27 | 1933-09-05 | Chester E Primeau | Toothbrush |
| US3798699A (en) * | 1971-06-17 | 1974-03-26 | Tucel Industries | Synthetic tufted constructions |
| US4691404A (en) * | 1985-02-21 | 1987-09-08 | John O. Butler Company | Toothbrush |
| US5061106A (en) * | 1988-03-08 | 1991-10-29 | Colgate-Palmolive Company | Toothbrush with slow release of disinfectant and antibacterial agents and method of manufacturing the same |
| US5340581A (en) * | 1991-08-23 | 1994-08-23 | Gillette Canada, Inc. | Sustained-release matrices for dental application |
| US5213428A (en) * | 1992-05-05 | 1993-05-25 | Elisabetta Molari | Biodegradable toothbrush |
| IT1271530B (it) * | 1993-10-14 | 1997-05-30 | Ponzini Spa | Spazzolino da denti con testa ad angolazione variabile |
| US5987688A (en) * | 1995-11-09 | 1999-11-23 | Gillette Canada Inc. | Gum-massaging oral brush |
| US6996870B2 (en) * | 1995-12-29 | 2006-02-14 | Colgate-Palmolive Company | Contouring toothbrush head |
| US6601272B2 (en) * | 1998-05-08 | 2003-08-05 | John O. Butler Company | Dental hygiene system handle |
| US6721987B2 (en) * | 2000-04-06 | 2004-04-20 | Kimberly-Clark Worldwide, Inc. | Dental wipe |
| FR2812176B1 (fr) * | 2000-07-26 | 2003-01-10 | Oreal | Applicateur pour l'application d'un produit sur des fibres keratiniques, ensemble d'application equipe d'un tel applicateur, et utilisation de cet ensemble |
| US20030088931A1 (en) * | 2001-11-14 | 2003-05-15 | Colgate-Palmolive Company | Hot air welding of toothbrush components |
| US7331731B2 (en) * | 2002-09-05 | 2008-02-19 | Colgate-Palmolive Company | Oral care toothbrush |
| US6948209B2 (en) * | 2002-09-13 | 2005-09-27 | The Procter & Gamble Company | Electric toothbrushes having flexible necks |
| US7089621B2 (en) * | 2002-09-20 | 2006-08-15 | Colgate-Palmolive Company | Toothbrush |
| US7430776B2 (en) * | 2002-09-27 | 2008-10-07 | Colgate-Palmolive | Toothbrush with resilient head section |
| US7459500B2 (en) * | 2002-11-05 | 2008-12-02 | Dow Global Technologies Inc. | Thermoplastic elastomer compositions |
| US6851882B1 (en) * | 2003-07-31 | 2005-02-08 | Ray Andrew Maloney | Disposable toothbrush with reservoir |
| US7964670B2 (en) * | 2003-09-05 | 2011-06-21 | Teknor Apex Company | Film comprising an ethylene/alpha-olefin copolymer and its use in medical or hygienic applications |
| US7334286B2 (en) * | 2004-08-18 | 2008-02-26 | Loops, Llc | Toothbrush and methods of making and using same |
| DE602005020803D1 (de) * | 2005-10-13 | 2010-06-02 | Mitsubishi Electric Corp | Verfahren zur Bestimmung ob ein Weiterreichungsverfahren eines mobilen Terminals ausgeführt werden muss |
-
2006
- 2006-07-26 EP EP06788374A patent/EP1906790A1/en not_active Withdrawn
- 2006-07-26 TW TW095127191A patent/TW200722006A/zh unknown
- 2006-07-26 BR BRPI0614159A patent/BRPI0614159A2/pt not_active IP Right Cessation
- 2006-07-26 CA CA002616518A patent/CA2616518A1/en not_active Abandoned
- 2006-07-26 RU RU2008107322/12A patent/RU2371069C1/ru not_active IP Right Cessation
- 2006-07-26 KR KR1020087003848A patent/KR20080026657A/ko not_active Abandoned
- 2006-07-26 CN CNA2006800354368A patent/CN101296635A/zh active Pending
- 2006-07-26 AU AU2006275960A patent/AU2006275960A1/en not_active Abandoned
- 2006-07-26 MX MX2008001108A patent/MX2008001108A/es unknown
- 2006-07-26 WO PCT/US2006/028764 patent/WO2007016066A1/en not_active Ceased
- 2006-07-27 US US11/460,411 patent/US20070163064A1/en not_active Abandoned
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2152158C1 (ru) * | 1995-12-29 | 2000-07-10 | Колгейт-Палмолив Компани | Зубная щетка (варианты) |
| KR20000047321A (ko) * | 1998-12-31 | 2000-07-25 | 성재갑 | 아아치 형태의 유연성 있는 칫솔헤드의 칫솔 |
| JP2002095526A (ja) * | 2000-09-26 | 2002-04-02 | Lion Corp | 歯ブラシ |
| WO2003030680A1 (en) * | 2001-10-05 | 2003-04-17 | Glaxosmithkline Consumer Healthcare Gmbh & Co Kg | Toothbrush |
| JP2003189935A (ja) * | 2001-12-25 | 2003-07-08 | Lion Corp | 歯ブラシ |
Also Published As
| Publication number | Publication date |
|---|---|
| TW200722006A (en) | 2007-06-16 |
| MX2008001108A (es) | 2008-03-11 |
| KR20080026657A (ko) | 2008-03-25 |
| CA2616518A1 (en) | 2007-02-08 |
| BRPI0614159A2 (pt) | 2016-11-22 |
| WO2007016066A1 (en) | 2007-02-08 |
| EP1906790A1 (en) | 2008-04-09 |
| AU2006275960A1 (en) | 2007-02-08 |
| RU2008107322A (ru) | 2009-09-10 |
| US20070163064A1 (en) | 2007-07-19 |
| CN101296635A (zh) | 2008-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2371069C1 (ru) | Средство ухода за полостью рта, содержащее эластомерный полипропиленэтиленовый сополимер | |
| JP5269351B2 (ja) | 歯ブラシ | |
| AU2005267921B2 (en) | Oral care implement | |
| AU2009357643B2 (en) | Toothbrush having a closed-loop arrangement of cleaning elements | |
| AU2005277467B2 (en) | Toothbrush and methods of making and using same | |
| CN1184255C (zh) | 含有聚合物混合物的可弯曲刷子 | |
| RU2504315C1 (ru) | Инструмент для ухода за полостью рта с каналом из емкости для хранения к первой и второй поверхности головки | |
| EP1416823B1 (en) | Dental hygiene system handle | |
| AU2008218865B2 (en) | Oral care implement | |
| RU2560002C2 (ru) | Устройство для ухода за полостью рта | |
| EP2537436A2 (en) | Disposable toothbrush | |
| RU2297196C2 (ru) | Усовершенствованная конструкция корпуса электрической зубной щетки | |
| KR20120096937A (ko) | 구강 관리 시스템 | |
| AU2009357642B2 (en) | Oral care implement having multiple soft tissue cleaner components | |
| TW201400054A (zh) | 具有撓性握柄之口腔保健用具 | |
| CN108366665A (zh) | 口腔护理器具 | |
| TW201143674A (en) | Oral care implement | |
| AU2015402891A1 (en) | Oral care implement | |
| CN110418590A (zh) | 口腔护理器具 | |
| TW202031171A (zh) | 牙刷 | |
| US20130333134A1 (en) | Toothbrush Head and Ergonomic Toothbrush Handle | |
| EP4069032B1 (en) | Oral care implement | |
| KR20180036692A (ko) | 의치들로부터 의치 접착제를 제거하기 위해 적응된 툴을 갖는 구강 세정 기구 | |
| JP7349324B2 (ja) | 液状歯磨き剤塗布ブラシ | |
| KR100350325B1 (ko) | 유연한 손잡이를 갖는 칫솔 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | The patent is invalid due to non-payment of fees |
Effective date: 20100727 |