PL93698B1 - - Google Patents
Download PDFInfo
- Publication number
- PL93698B1 PL93698B1 PL16243473A PL16243473A PL93698B1 PL 93698 B1 PL93698 B1 PL 93698B1 PL 16243473 A PL16243473 A PL 16243473A PL 16243473 A PL16243473 A PL 16243473A PL 93698 B1 PL93698 B1 PL 93698B1
- Authority
- PL
- Poland
- Prior art keywords
- group
- formula
- hydrogen atom
- lower alkyl
- atom
- Prior art date
Links
- 125000000217 alkyl group Chemical group 0.000 claims description 39
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 27
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 20
- 125000003545 alkoxy group Chemical group 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 16
- 125000004414 alkyl thio group Chemical group 0.000 claims description 15
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 14
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 13
- 150000002148 esters Chemical class 0.000 claims description 13
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 13
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 claims description 13
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 125000002947 alkylene group Chemical group 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 8
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 7
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 7
- 125000005842 heteroatom Chemical group 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 6
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 6
- 125000005041 acyloxyalkyl group Chemical group 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 claims description 6
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 claims description 3
- 239000002841 Lewis acid Substances 0.000 claims description 3
- PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 150000007517 lewis acids Chemical class 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 6
- 239000001301 oxygen Substances 0.000 claims 6
- 229910052760 oxygen Inorganic materials 0.000 claims 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 3
- 150000002431 hydrogen Chemical group 0.000 claims 3
- 238000006243 chemical reaction Methods 0.000 claims 2
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 claims 2
- XSUYIZJJKIKWFN-UHFFFAOYSA-N 5,7-Dihydro-2-methylthieno[3,4-d]pyrimidine Chemical class CC1=NC=C2CSCC2=N1 XSUYIZJJKIKWFN-UHFFFAOYSA-N 0.000 claims 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 125000000879 imine group Chemical group 0.000 claims 1
- 150000003230 pyrimidines Chemical class 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 64
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 57
- 239000000203 mixture Substances 0.000 description 48
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 46
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 40
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 36
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 33
- 239000013078 crystal Substances 0.000 description 33
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 30
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 30
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- 229910052938 sodium sulfate Inorganic materials 0.000 description 26
- 235000011152 sodium sulphate Nutrition 0.000 description 26
- -1 aliphatic hydrocarbon radicals Chemical class 0.000 description 19
- 239000011541 reaction mixture Substances 0.000 description 19
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- 238000001816 cooling Methods 0.000 description 18
- 239000000284 extract Substances 0.000 description 17
- 125000004432 carbon atom Chemical group C* 0.000 description 15
- 238000001953 recrystallisation Methods 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- 239000011592 zinc chloride Substances 0.000 description 15
- 235000005074 zinc chloride Nutrition 0.000 description 15
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 12
- 229910002027 silica gel Inorganic materials 0.000 description 12
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 9
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 9
- 239000003480 eluent Substances 0.000 description 9
- 229940116269 uric acid Drugs 0.000 description 9
- 239000007858 starting material Substances 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- 230000009858 acid secretion Effects 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- RBNBDIMXFJYDLQ-UHFFFAOYSA-N thieno[3,2-d]pyrimidine Chemical class C1=NC=C2SC=CC2=N1 RBNBDIMXFJYDLQ-UHFFFAOYSA-N 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 5
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 5
- 239000012346 acetyl chloride Substances 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 239000002026 chloroform extract Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 210000002700 urine Anatomy 0.000 description 4
- BOVQHSNGZZKMTM-UHFFFAOYSA-N (2-aminothiophen-3-yl)-(2-fluorophenyl)methanone Chemical compound S1C=CC(C(=O)C=2C(=CC=CC=2)F)=C1N BOVQHSNGZZKMTM-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 238000000862 absorption spectrum Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000002027 dichloromethane extract Substances 0.000 description 3
- NCPCWIBRBDKKLV-UHFFFAOYSA-N n-(3-propanoylthiophen-2-yl)acetamide Chemical compound CCC(=O)C=1C=CSC=1NC(C)=O NCPCWIBRBDKKLV-UHFFFAOYSA-N 0.000 description 3
- DBABZHXKTCFAPX-UHFFFAOYSA-N probenecid Chemical compound CCCN(CCC)S(=O)(=O)C1=CC=C(C(O)=O)C=C1 DBABZHXKTCFAPX-UHFFFAOYSA-N 0.000 description 3
- 229960003081 probenecid Drugs 0.000 description 3
- QJCQJXOEXKINTC-UHFFFAOYSA-N (2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-phenylmethanone Chemical compound NC=1SC=2CCCCC=2C=1C(=O)C1=CC=CC=C1 QJCQJXOEXKINTC-UHFFFAOYSA-N 0.000 description 2
- WIYIZXULKQILJU-UHFFFAOYSA-N (2-amino-4-methylthiophen-3-yl)-(2-chlorophenyl)methanone Chemical compound CC1=CSC(N)=C1C(=O)C1=CC=CC=C1Cl WIYIZXULKQILJU-UHFFFAOYSA-N 0.000 description 2
- AAPKMBGJSPVNDW-UHFFFAOYSA-N (2-amino-4-methylthiophen-3-yl)-(2-fluorophenyl)methanone Chemical compound CC1=CSC(N)=C1C(=O)C1=CC=CC=C1F AAPKMBGJSPVNDW-UHFFFAOYSA-N 0.000 description 2
- RFCCZAHPNNJKKR-UHFFFAOYSA-N (2-amino-5-ethylthiophen-3-yl)-(2-chlorophenyl)methanone Chemical compound S1C(CC)=CC(C(=O)C=2C(=CC=CC=2)Cl)=C1N RFCCZAHPNNJKKR-UHFFFAOYSA-N 0.000 description 2
- NBCSNRZONHHXIO-UHFFFAOYSA-N (2-amino-5-methylthiophen-3-yl)-(2-fluorophenyl)methanone Chemical compound S1C(C)=CC(C(=O)C=2C(=CC=CC=2)F)=C1N NBCSNRZONHHXIO-UHFFFAOYSA-N 0.000 description 2
- PYKUZKXKWBHTCO-UHFFFAOYSA-N (2-aminothiophen-3-yl)-(2-chlorophenyl)methanone Chemical compound S1C=CC(C(=O)C=2C(=CC=CC=2)Cl)=C1N PYKUZKXKWBHTCO-UHFFFAOYSA-N 0.000 description 2
- VXIMIQNIBMDZCM-UHFFFAOYSA-N (2-aminothiophen-3-yl)-phenylmethanone Chemical compound S1C=CC(C(=O)C=2C=CC=CC=2)=C1N VXIMIQNIBMDZCM-UHFFFAOYSA-N 0.000 description 2
- SDUCESPBRYMJBC-UHFFFAOYSA-N (2-chlorophenyl)-[4-methyl-2-(methylamino)thiophen-3-yl]methanone Chemical compound S1C=C(C)C(C(=O)C=2C(=CC=CC=2)Cl)=C1NC SDUCESPBRYMJBC-UHFFFAOYSA-N 0.000 description 2
- GONPMZRYALNCAZ-UHFFFAOYSA-N (2-chlorophenyl)-[5-ethyl-2-(methylamino)thiophen-3-yl]methanone Chemical compound S1C(CC)=CC(C(=O)C=2C(=CC=CC=2)Cl)=C1NC GONPMZRYALNCAZ-UHFFFAOYSA-N 0.000 description 2
- WTLCVEKKDZFAKR-UHFFFAOYSA-N (2-fluorophenyl)-[2-(methylamino)thiophen-3-yl]methanone Chemical compound S1C=CC(C(=O)C=2C(=CC=CC=2)F)=C1NC WTLCVEKKDZFAKR-UHFFFAOYSA-N 0.000 description 2
- OHNCULUAABZHAW-UHFFFAOYSA-N 1-(2-aminothiophen-3-yl)propan-1-one Chemical compound CCC(=O)C=1C=CSC=1N OHNCULUAABZHAW-UHFFFAOYSA-N 0.000 description 2
- MGFVSBVUCIPQKK-UHFFFAOYSA-N 1-[2-(methylamino)thiophen-3-yl]propan-1-one Chemical compound CCC(=O)C=1C=CSC=1NC MGFVSBVUCIPQKK-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- DFTXQILRMNYKEI-UHFFFAOYSA-N [2-(methylamino)-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-phenylmethanone Chemical compound CNC=1SC=2CCCCC=2C=1C(=O)C1=CC=CC=C1 DFTXQILRMNYKEI-UHFFFAOYSA-N 0.000 description 2
- NEKSZHBVIPNTPA-UHFFFAOYSA-N [5-chloro-2-(methylamino)thiophen-3-yl]-(2-fluorophenyl)methanone Chemical compound S1C(Cl)=CC(C(=O)C=2C(=CC=CC=2)F)=C1NC NEKSZHBVIPNTPA-UHFFFAOYSA-N 0.000 description 2
- 230000003444 anaesthetic effect Effects 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 230000000840 anti-viral effect Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- DOALBJDTZPDTPE-UHFFFAOYSA-N n-(3-benzoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide Chemical compound CC(=O)NC=1SC=2CCCCC=2C=1C(=O)C1=CC=CC=C1 DOALBJDTZPDTPE-UHFFFAOYSA-N 0.000 description 2
- SJQAPGBXCQYJLS-UHFFFAOYSA-N n-(3-benzoyl-4-methylthiophen-2-yl)-n-methylacetamide Chemical compound S1C=C(C)C(C(=O)C=2C=CC=CC=2)=C1N(C(C)=O)C SJQAPGBXCQYJLS-UHFFFAOYSA-N 0.000 description 2
- AYKASOBMCKXOAG-UHFFFAOYSA-N n-(3-benzoyl-4-methylthiophen-2-yl)acetamide Chemical compound S1C=C(C)C(C(=O)C=2C=CC=CC=2)=C1NC(=O)C AYKASOBMCKXOAG-UHFFFAOYSA-N 0.000 description 2
- JODHPLVTKVXNEE-UHFFFAOYSA-N n-[3-(2-chlorobenzoyl)-4-methylthiophen-2-yl]acetamide Chemical compound S1C=C(C)C(C(=O)C=2C(=CC=CC=2)Cl)=C1NC(=O)C JODHPLVTKVXNEE-UHFFFAOYSA-N 0.000 description 2
- IHGZCHIESDICBO-UHFFFAOYSA-N n-[3-(2-chlorobenzoyl)-4-methylthiophen-2-yl]propanamide Chemical compound S1C=C(C)C(C(=O)C=2C(=CC=CC=2)Cl)=C1NC(=O)CC IHGZCHIESDICBO-UHFFFAOYSA-N 0.000 description 2
- BSJFNDPAURKHKU-UHFFFAOYSA-N n-[3-(2-chlorobenzoyl)-5-ethylthiophen-2-yl]acetamide Chemical compound S1C(CC)=CC(C(=O)C=2C(=CC=CC=2)Cl)=C1NC(C)=O BSJFNDPAURKHKU-UHFFFAOYSA-N 0.000 description 2
- GYWQDQARPOVWDK-UHFFFAOYSA-N n-[3-(2-chlorobenzoyl)-5-ethylthiophen-2-yl]propanamide Chemical compound S1C(CC)=CC(C(=O)C=2C(=CC=CC=2)Cl)=C1NC(=O)CC GYWQDQARPOVWDK-UHFFFAOYSA-N 0.000 description 2
- KNUUOFGAWQIGHY-UHFFFAOYSA-N n-[3-(2-fluorobenzoyl)thiophen-2-yl]acetamide Chemical compound S1C=CC(C(=O)C=2C(=CC=CC=2)F)=C1NC(=O)C KNUUOFGAWQIGHY-UHFFFAOYSA-N 0.000 description 2
- NHLQIXTWOLMXAC-UHFFFAOYSA-N n-methyl-n-(3-propanoylthiophen-2-yl)acetamide Chemical compound CCC(=O)C=1C=CSC=1N(C)C(C)=O NHLQIXTWOLMXAC-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 230000002485 urinary effect Effects 0.000 description 2
- OYCRFVNTURZAGI-UHFFFAOYSA-N (2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(2-fluorophenyl)methanone Chemical compound NC=1SC=2CCCCC=2C=1C(=O)C1=CC=CC=C1F OYCRFVNTURZAGI-UHFFFAOYSA-N 0.000 description 1
- PEBGIHXZACIBNZ-UHFFFAOYSA-N (2-amino-4-methylthiophen-3-yl)-phenylmethanone Chemical compound CC1=CSC(N)=C1C(=O)C1=CC=CC=C1 PEBGIHXZACIBNZ-UHFFFAOYSA-N 0.000 description 1
- KTHDRSYKYMKNEY-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1-benzothiophene Chemical compound C1=CCCC2=C1SCC2 KTHDRSYKYMKNEY-UHFFFAOYSA-N 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- YCIPQJTZJGUXND-UHFFFAOYSA-N Aglaia odorata Alkaloid Natural products C1=CC(OC)=CC=C1C1(C(C=2C(=O)N3CCCC3=NC=22)C=3C=CC=CC=3)C2(O)C2=C(OC)C=C(OC)C=C2O1 YCIPQJTZJGUXND-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 208000004880 Polyuria Diseases 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 108010092464 Urate Oxidase Proteins 0.000 description 1
- AKIUSQYTNPDFBI-UHFFFAOYSA-N [4-methyl-2-(methylamino)thiophen-3-yl]-phenylmethanone Chemical compound S1C=C(C)C(C(=O)C=2C=CC=CC=2)=C1NC AKIUSQYTNPDFBI-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000005243 carbonyl alkyl group Chemical group 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- JVMGVIGKARNAGS-UHFFFAOYSA-N n-[3-(2-fluorobenzoyl)thiophen-2-yl]propanamide Chemical compound S1C=CC(C(=O)C=2C(=CC=CC=2)F)=C1NC(=O)CC JVMGVIGKARNAGS-UHFFFAOYSA-N 0.000 description 1
- RRLNPYGFVRXJPG-UHFFFAOYSA-N n-[5-chloro-3-(2-fluorobenzoyl)thiophen-2-yl]propanamide Chemical compound S1C(Cl)=CC(C(=O)C=2C(=CC=CC=2)F)=C1NC(=O)CC RRLNPYGFVRXJPG-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 238000002798 spectrophotometry method Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 150000003577 thiophenes Chemical class 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Landscapes
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6682872A JPS4926294A (OSRAM) | 1972-07-03 | 1972-07-03 | |
| JP12594672A JPS4981390A (OSRAM) | 1972-12-14 | 1972-12-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL93698B1 true PL93698B1 (OSRAM) | 1977-06-30 |
Family
ID=26408028
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL16243473A PL93698B1 (OSRAM) | 1972-07-03 | 1973-05-09 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL93698B1 (OSRAM) |
-
1973
- 1973-05-09 PL PL16243473A patent/PL93698B1/pl unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU594739B2 (en) | Thieno-1,4-diazepines | |
| EP3080118B1 (en) | Tetrahydroimidazopyridine derivatives as modulators of tnf activity | |
| WO1988009333A1 (fr) | Compose a base de thieno(triazolo)diazepine et applications medicales de ce compose | |
| CA2537545A1 (en) | Thienopyrroles as antiviral agents | |
| LV10451B (en) | Benzocycloheptenes, benzoxepines and benzothiepines and methods for preparation thereof | |
| US3957783A (en) | Thieno[2,3-d]pyrimidine derivatives | |
| US4608384A (en) | Thieno[2,3-b] pyrrole compounds and analgesic use thereof | |
| EP0150469B1 (en) | Thieno(2,3-d)pyrimidine derivatives and salts thereof | |
| GB2243832A (en) | 2-substituted 4-acetamido-5-chloro-n-[2-(diethylamino)ethyl]-benzamide derivative | |
| US3953430A (en) | Substituted benzodiazepin-10-ones and method of use | |
| US3530139A (en) | Process for producing certain intermediates for 1,4-benzodiazepines | |
| NZ233574A (en) | Thieno-triazolo-diazepine derivatives | |
| US4201712A (en) | Process for preparation of 6-aryl-4H-s-triazolo-[3,4-c]-thieno-[2,3-e]-1,4-diazepines | |
| US3849405A (en) | Thieno-(2,3-e)(1,4)diazepin-2-ones | |
| PL93698B1 (OSRAM) | ||
| US3950526A (en) | Quinazoline derivatives in pharmaceutical compositions for treating pain and inflammation | |
| US3764600A (en) | 1-substituted-quinazoline-2(1h)-thiones | |
| US3920687A (en) | 2,3,6,7-tetrahydro-6-phenyl-5h-imidazo(1,2-d)+8 1,4)benzodiazepin-5-ones and diazepines | |
| KR850000452B1 (ko) | 카바모일옥시아미노-1, 4-벤조디아제핀의 제조방법 | |
| PL115380B1 (en) | Process for preparing novel derivatives of nitropyrrole | |
| RogeráTulley | Preparation and chemistry of some 1, 5-diphenyl-1λ 4, 2, 4-thiadiazine 1-oxides | |
| US4333944A (en) | 8-Halo-6-phenyl-4H-s-triazolo (3,4-c) thieno 1,4-diazepin-1-ones | |
| CA1157018A (en) | Benzodiazepinones, a process for their preparation, their use and medicaments containing them | |
| AU625915B2 (en) | Synthesis of (1)-benzothiopyrano (4,3-c)-pyrazoles | |
| AU625779B2 (en) | Imidazodiazepine derivatives |