PL93437B1 - - Google Patents
Download PDFInfo
- Publication number
- PL93437B1 PL93437B1 PL18559774A PL18559774A PL93437B1 PL 93437 B1 PL93437 B1 PL 93437B1 PL 18559774 A PL18559774 A PL 18559774A PL 18559774 A PL18559774 A PL 18559774A PL 93437 B1 PL93437 B1 PL 93437B1
- Authority
- PL
- Poland
- Prior art keywords
- general formula
- group
- acid
- aqueous solution
- salt
- Prior art date
Links
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 51
- 239000007864 aqueous solution Substances 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 20
- -1 alkali metal salt Chemical class 0.000 claims description 19
- 239000000243 solution Substances 0.000 claims description 18
- 230000003115 biocidal effect Effects 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical class CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 239000012074 organic phase Substances 0.000 claims description 7
- 229930182555 Penicillin Natural products 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 239000003782 beta lactam antibiotic agent Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 238000002955 isolation Methods 0.000 claims description 5
- 239000002132 β-lactam antibiotic Substances 0.000 claims description 5
- 229940124586 β-lactam antibiotics Drugs 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 229940049954 penicillin Drugs 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 239000000725 suspension Substances 0.000 claims description 4
- 229930186147 Cephalosporin Natural products 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 3
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 3
- 150000003863 ammonium salts Chemical class 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229940124587 cephalosporin Drugs 0.000 claims description 3
- 150000001780 cephalosporins Chemical class 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 150000003977 halocarboxylic acids Chemical class 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 3
- 229940071870 hydroiodic acid Drugs 0.000 claims description 3
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 2
- 150000004675 formic acid derivatives Chemical class 0.000 claims description 2
- 150000002960 penicillins Chemical class 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 2
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 claims 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- 230000000630 rising effect Effects 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical class C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 6
- 238000000605 extraction Methods 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 229940088710 antibiotic agent Drugs 0.000 description 3
- YNLZKJXZEZFHDO-UHFFFAOYSA-M potassium;2,2,2-trichloroacetate Chemical compound [K+].[O-]C(=O)C(Cl)(Cl)Cl YNLZKJXZEZFHDO-UHFFFAOYSA-M 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 2
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 2
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 2
- SRUHMUYHDLWOOS-UHFFFAOYSA-N CC(C)(C)NC(C(Cl)(Cl)Cl)C1=CC=C(C=NNC(N)=N)C=C1 Chemical compound CC(C)(C)NC(C(Cl)(Cl)Cl)C1=CC=C(C=NNC(N)=N)C=C1 SRUHMUYHDLWOOS-UHFFFAOYSA-N 0.000 description 2
- RXSBZQYIALQXPH-UHFFFAOYSA-N NC(NN=CC1=CC=C(C(C(Cl)(Cl)Cl)NC2CCCCC2)C=C1)=N Chemical compound NC(NN=CC1=CC=C(C(C(Cl)(Cl)Cl)NC2CCCCC2)C=C1)=N RXSBZQYIALQXPH-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229960000723 ampicillin Drugs 0.000 description 2
- KLOHDWPABZXLGI-YWUHCJSESA-M ampicillin sodium Chemical compound [Na+].C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C([O-])=O)(C)C)=CC=CC=C1 KLOHDWPABZXLGI-YWUHCJSESA-M 0.000 description 2
- 229960003311 ampicillin trihydrate Drugs 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- IYNDLOXRXUOGIU-LQDWTQKMSA-M benzylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)CC1=CC=CC=C1 IYNDLOXRXUOGIU-LQDWTQKMSA-M 0.000 description 2
- 235000010633 broth Nutrition 0.000 description 2
- 229960003669 carbenicillin Drugs 0.000 description 2
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 2
- 229960000603 cefalotin Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000000855 fermentation Methods 0.000 description 2
- 230000004151 fermentation Effects 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000012451 post-reaction mixture Substances 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 125000006318 tert-butyl amino group Chemical group [H]N(*)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- WNPXUCYRKHVMAD-UHFFFAOYSA-N 2-(benzylideneamino)guanidine Chemical compound NC(N)=NN=CC1=CC=CC=C1 WNPXUCYRKHVMAD-UHFFFAOYSA-N 0.000 description 1
- OBCUSTCTKLTMBX-UHFFFAOYSA-N 2-acetyloxy-2-phenylacetic acid Chemical compound CC(=O)OC(C(O)=O)C1=CC=CC=C1 OBCUSTCTKLTMBX-UHFFFAOYSA-N 0.000 description 1
- ALRHLSYJTWAHJZ-UHFFFAOYSA-N 3-hydroxypropionic acid Chemical compound OCCC(O)=O ALRHLSYJTWAHJZ-UHFFFAOYSA-N 0.000 description 1
- 229930195708 Penicillin V Natural products 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- SAQSTQBVENFSKT-UHFFFAOYSA-M TCA-sodium Chemical compound [Na+].[O-]C(=O)C(Cl)(Cl)Cl SAQSTQBVENFSKT-UHFFFAOYSA-M 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229960001931 ampicillin sodium Drugs 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- FCPVYOBCFFNJFS-LQDWTQKMSA-M benzylpenicillin sodium Chemical compound [Na+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)CC1=CC=CC=C1 FCPVYOBCFFNJFS-LQDWTQKMSA-M 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229940056367 penicillin v Drugs 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- BPLBGHOLXOTWMN-MBNYWOFBSA-N phenoxymethylpenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)COC1=CC=CC=C1 BPLBGHOLXOTWMN-MBNYWOFBSA-N 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- CUNPJFGIODEJLQ-UHFFFAOYSA-M potassium;2,2,2-trifluoroacetate Chemical compound [K+].[O-]C(=O)C(F)(F)F CUNPJFGIODEJLQ-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- LFBBSWBQNQXKPF-LQDWTQKMSA-M sodium;(2s,5r,6r)-3,3-dimethyl-7-oxo-6-[(2-phenoxyacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound [Na+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)COC1=CC=CC=C1 LFBBSWBQNQXKPF-LQDWTQKMSA-M 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-M trichloroacetate Chemical compound [O-]C(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-M 0.000 description 1
- 150000003952 β-lactams Chemical class 0.000 description 1
Landscapes
- Cephalosporin Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL18559774A PL93437B1 (show.php) | 1974-03-07 | 1974-03-07 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL18559774A PL93437B1 (show.php) | 1974-03-07 | 1974-03-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL93437B1 true PL93437B1 (show.php) | 1977-05-30 |
Family
ID=19974729
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL18559774A PL93437B1 (show.php) | 1974-03-07 | 1974-03-07 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL93437B1 (show.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2007128213A1 (en) * | 2006-05-08 | 2007-11-15 | Qiming Ma | Solid powder of penicillin sodium salt with high purity and/or content and its manufacture |
-
1974
- 1974-03-07 PL PL18559774A patent/PL93437B1/pl unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2007128213A1 (en) * | 2006-05-08 | 2007-11-15 | Qiming Ma | Solid powder of penicillin sodium salt with high purity and/or content and its manufacture |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3174964A (en) | Derivatives of 6-aminopenicillanic acid | |
| EP0019345A1 (en) | Process for the preparation of a (D-alpha-amino-(p-hydroxyphenyl)-acetamido) group containing cephalosporanic acid derivatives | |
| CA1051799A (en) | Antibacterial agents | |
| US3954733A (en) | Naphthyridine-3-carboxamido-benzylpenicillins and salts thereof | |
| US3316247A (en) | Process for the preparation of penicillins | |
| NO146203B (no) | Fremgangsmaate til fremstilling av cephalexin eller salter derav | |
| US4312982A (en) | α-Acylureidocephalosporins and salts and esters thereof | |
| US3780031A (en) | Process for preparing cephalosporin compounds | |
| US3862181A (en) | Process for preparing cephalosporins | |
| PL93437B1 (show.php) | ||
| US4145418A (en) | Thienopyridine substituted cephalosporins | |
| GB2179348A (en) | Process for the preparation of 6-D-( alpha )-(4-ethyl-2,3-dioxo-1 1-piperazinylcarbonylamin)- alpha -phenylacetamido- penicillanic acid | |
| US3996236A (en) | Methoxymethyl D-6-(2,2-dimethyl-5-oxo-4-phenyl-1-imidazolidinyl)penicillanate | |
| PL82809B1 (en) | Process for the preparation of 7-substituted amino-desacetoxycephalosporanic acid compounds[us3852281a] | |
| EP0019067B1 (en) | 5,10-dioxo-5,10-dihydrodiimidazo(1,5-a,1',5'-d)pyrazine-1,6-dicarboxylic acid and a process for producing imidazoledicarboxylic acid amido-derivatives | |
| US4322526A (en) | Process for producing 7-aminocephalosporanic acid | |
| US4258183A (en) | Process for the preparation of cephalosporin compounds | |
| EP0023045B1 (en) | Imidazolecarboxylic acid derivatives of penicillins and cephalosporins | |
| US4158733A (en) | 7β-Acyloxy-3-acetoxymethyl cephalosporins | |
| US3926984A (en) | 7-{8 2-(2-Thioxo-4-thiazolin-3-yl)-acetamido{9 {0 cephalosporanic acid derivatives | |
| CZ149198A3 (cs) | Způsob výroby farmaceuticky přijatelné soli klavulanové kyseliny | |
| US4625021A (en) | High yield process for preparing beta-lactam antibiotics having a high purity degree | |
| US3071576A (en) | Synthetic penicillins | |
| US4236001A (en) | 7β-Acyloxy-3-heterocyclicthiomethyl cephalosporins | |
| US4185015A (en) | Methoxymethyl 6-[D-2,2-dimethyl-4-(4-hydroxyphenyl)-5-oxo-1-imidazolyl]penicillanate |