PL88979B1 - - Google Patents
Download PDFInfo
- Publication number
- PL88979B1 PL88979B1 PL1972153518A PL15351872A PL88979B1 PL 88979 B1 PL88979 B1 PL 88979B1 PL 1972153518 A PL1972153518 A PL 1972153518A PL 15351872 A PL15351872 A PL 15351872A PL 88979 B1 PL88979 B1 PL 88979B1
- Authority
- PL
- Poland
- Prior art keywords
- acetaldehyde
- acrylonitrile
- alkali metal
- imide
- toluene
- Prior art date
Links
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 48
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 24
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Natural products CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 21
- -1 acetaldehyde imides Chemical class 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 19
- GWHJZXXIDMPWGX-UHFFFAOYSA-N 1,2,4-trimethylbenzene Chemical compound CC1=CC=C(C)C(C)=C1 GWHJZXXIDMPWGX-UHFFFAOYSA-N 0.000 claims description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- 150000001340 alkali metals Chemical class 0.000 claims description 9
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 9
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 6
- 239000012454 non-polar solvent Substances 0.000 claims description 6
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 claims description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 4
- 150000001341 alkaline earth metal compounds Chemical class 0.000 claims description 3
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 claims description 3
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 claims description 3
- 229910001863 barium hydroxide Inorganic materials 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- PXXNTAGJWPJAGM-VCOUNFBDSA-N Decaline Chemical compound C=1([C@@H]2C3)C=C(OC)C(OC)=CC=1OC(C=C1)=CC=C1CCC(=O)O[C@H]3C[C@H]1N2CCCC1 PXXNTAGJWPJAGM-VCOUNFBDSA-N 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 2
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 claims description 2
- 238000010494 dissociation reaction Methods 0.000 claims description 2
- 230000005593 dissociations Effects 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims 1
- QWMYJOXBVBZDJM-UHFFFAOYSA-N n-cyclohexylethanimine Chemical compound CC=NC1CCCCC1 QWMYJOXBVBZDJM-UHFFFAOYSA-N 0.000 description 12
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 10
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 10
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 10
- 238000009835 boiling Methods 0.000 description 9
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 8
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N valeric aldehyde Natural products CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- NKGJJLDEORZFKJ-UHFFFAOYSA-N n-butylethanimine Chemical compound CCCCN=CC NKGJJLDEORZFKJ-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000003940 butylamines Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7102136.A NL166255C (nl) | 1971-02-18 | 1971-02-18 | Werkwijze voor de bereiding van 2-(beta-cynoethyl)-n- gesubstitueerde aceetaldiminen. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL88979B1 true PL88979B1 (OSRAM) | 1976-10-30 |
Family
ID=19812505
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972153518A PL88979B1 (OSRAM) | 1971-02-18 | 1972-02-16 |
Country Status (19)
| Country | Link |
|---|---|
| JP (1) | JPS5426526B1 (OSRAM) |
| AT (1) | AT313867B (OSRAM) |
| BE (1) | BE779487A (OSRAM) |
| BR (1) | BR7200895D0 (OSRAM) |
| CA (1) | CA952919A (OSRAM) |
| CH (1) | CH563966A5 (OSRAM) |
| CS (1) | CS157139B2 (OSRAM) |
| DD (1) | DD98916A5 (OSRAM) |
| DE (1) | DE2207768A1 (OSRAM) |
| DK (1) | DK134397B (OSRAM) |
| ES (1) | ES399883A1 (OSRAM) |
| FR (1) | FR2125993A5 (OSRAM) |
| GB (1) | GB1328055A (OSRAM) |
| IT (1) | IT986029B (OSRAM) |
| NL (1) | NL166255C (OSRAM) |
| PL (1) | PL88979B1 (OSRAM) |
| SE (1) | SE404794B (OSRAM) |
| SU (1) | SU400083A3 (OSRAM) |
| ZA (1) | ZA72782B (OSRAM) |
-
1971
- 1971-02-18 NL NL7102136.A patent/NL166255C/xx active
-
1972
- 1972-02-04 SU SU1745174A patent/SU400083A3/ru active
- 1972-02-07 ZA ZA720782A patent/ZA72782B/xx unknown
- 1972-02-08 GB GB588672A patent/GB1328055A/en not_active Expired
- 1972-02-08 CA CA134,143A patent/CA952919A/en not_active Expired
- 1972-02-11 AT AT112872A patent/AT313867B/de not_active IP Right Cessation
- 1972-02-11 CH CH199772A patent/CH563966A5/xx not_active IP Right Cessation
- 1972-02-11 DK DK63472AA patent/DK134397B/da unknown
- 1972-02-16 PL PL1972153518A patent/PL88979B1/pl unknown
- 1972-02-16 DD DD160911A patent/DD98916A5/xx unknown
- 1972-02-16 CS CS100172A patent/CS157139B2/cs unknown
- 1972-02-17 JP JP1686272A patent/JPS5426526B1/ja active Pending
- 1972-02-17 FR FR7205380A patent/FR2125993A5/fr not_active Expired
- 1972-02-17 ES ES399883A patent/ES399883A1/es not_active Expired
- 1972-02-17 BE BE779487A patent/BE779487A/xx not_active IP Right Cessation
- 1972-02-17 IT IT48389/72A patent/IT986029B/it active
- 1972-02-18 SE SE7202032A patent/SE404794B/xx unknown
- 1972-02-18 BR BR895/72A patent/BR7200895D0/pt unknown
- 1972-02-18 DE DE19722207768 patent/DE2207768A1/de not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| NL7102136A (OSRAM) | 1972-08-22 |
| SE404794B (sv) | 1978-10-30 |
| BR7200895D0 (pt) | 1973-07-17 |
| FR2125993A5 (OSRAM) | 1972-09-29 |
| JPS5426526B1 (OSRAM) | 1979-09-04 |
| DK134397C (OSRAM) | 1977-03-28 |
| AT313867B (de) | 1974-03-11 |
| GB1328055A (en) | 1973-08-30 |
| NL166255C (nl) | 1981-07-15 |
| IT986029B (it) | 1975-01-10 |
| ZA72782B (en) | 1972-10-25 |
| CS157139B2 (OSRAM) | 1974-08-23 |
| DK134397B (da) | 1976-11-01 |
| CA952919A (en) | 1974-08-13 |
| DE2207768A1 (de) | 1972-08-31 |
| DD98916A5 (OSRAM) | 1973-07-12 |
| NL166255B (nl) | 1981-02-16 |
| SU400083A3 (OSRAM) | 1973-10-03 |
| ES399883A1 (es) | 1974-12-01 |
| BE779487A (fr) | 1972-08-17 |
| CH563966A5 (OSRAM) | 1975-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6223741B2 (OSRAM) | ||
| JPS6225138B2 (OSRAM) | ||
| JPH0455418B2 (OSRAM) | ||
| EP0164786B1 (en) | A process for the preparation of p-isononanoyloxybenzenenesulphonate | |
| RU2003136765A (ru) | Синтез 4-фенилмасляной кислоты | |
| US5302767A (en) | [2.2] paracyclophane and derivatives thereof | |
| US2598562A (en) | Nu-mercuri-1, 2, 3, 6-tetrahydro-3, 6-endomethano-3, 4, 5, 6, 7, 7-hexachlorophthalimide | |
| US2765322A (en) | Preparation of bis(4-glycidyloxyphenyl)-sulfone | |
| US4897482A (en) | Process for the preparation of oligomeric 2,2,4-trimethyl-1,2-dihydroquinoline | |
| US4560772A (en) | Preparation of substituted phthalic anhydrides | |
| US5229521A (en) | Process for the preparation of symmetrical 2,2-methylenebisbenzotriazolyl phenols | |
| US2714117A (en) | Production of acetoacetic acid amides | |
| US4478759A (en) | Preparation of aminoitriles | |
| US5106980A (en) | Preparation of quinophthalones | |
| SU516341A3 (ru) | Способ получени замещенных бензофенонов | |
| US2475097A (en) | Process for the preparation of sub | |
| CA2352120A1 (en) | Process for producing aliphatic tricarbonitriles | |
| JPH01165580A (ja) | 置換された無水コハク酸の製造方法 | |
| EP0101625B1 (en) | Process for preparing the 2',4'-difluoro-4-hydroxy-(1,1'-diphenyl)-3-carboxylic acid | |
| US3644410A (en) | Preparation of triallyl cyanurate | |
| US3130218A (en) | Process for the preparation of 4-nitrostilbene carbonitriles | |
| US4165322A (en) | Alkylation of aniline with a lactone in the presence of water | |
| US3326912A (en) | Process for the production of 2-mercapto-4, 6-bis-amino-s-triazine derivatives | |
| US4203904A (en) | Alkylation of aniline with a lactone in the presence of a base | |
| US3337581A (en) | Bridged ring carbazoles |