PL76179B1 - - Google Patents
Download PDFInfo
- Publication number
- PL76179B1 PL76179B1 PL1970141635A PL14163570A PL76179B1 PL 76179 B1 PL76179 B1 PL 76179B1 PL 1970141635 A PL1970141635 A PL 1970141635A PL 14163570 A PL14163570 A PL 14163570A PL 76179 B1 PL76179 B1 PL 76179B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- imidazolidin
- pattern
- active
- plants
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 17
- 230000002363 herbicidal effect Effects 0.000 claims description 8
- 239000004009 herbicide Substances 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 5
- DSARFHOMZQKBFZ-UHFFFAOYSA-N 2-oxoimidazolidine-1-carboxamide Chemical class NC(=O)N1CCNC1=O DSARFHOMZQKBFZ-UHFFFAOYSA-N 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 2
- 150000003141 primary amines Chemical class 0.000 claims description 2
- 241000196324 Embryophyta Species 0.000 description 17
- 239000013543 active substance Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- -1 radical Hydrocarbon Chemical class 0.000 description 10
- 239000004480 active ingredient Substances 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 239000003995 emulsifying agent Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 241000209140 Triticum Species 0.000 description 5
- 235000021307 Triticum Nutrition 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 244000042664 Matricaria chamomilla Species 0.000 description 4
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- 241000209149 Zea Species 0.000 description 4
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 3
- 244000056139 Brassica cretica Species 0.000 description 3
- 235000003351 Brassica cretica Nutrition 0.000 description 3
- 235000003343 Brassica rupestris Nutrition 0.000 description 3
- 241000234642 Festuca Species 0.000 description 3
- 241000748465 Galinsoga Species 0.000 description 3
- 235000017945 Matricaria Nutrition 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 240000006694 Stellaria media Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 235000010460 mustard Nutrition 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- NXJZQSRAFBHNLI-UHFFFAOYSA-N 2-oxoimidazolidine-1-carbonyl chloride Chemical compound ClC(=O)N1CCNC1=O NXJZQSRAFBHNLI-UHFFFAOYSA-N 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 241000723377 Coffea Species 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000219146 Gossypium Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241000209094 Oryza Species 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 2
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- AVWRKZWQTYIKIY-UHFFFAOYSA-N urea-1-carboxylic acid Chemical compound NC(=O)NC(O)=O AVWRKZWQTYIKIY-UHFFFAOYSA-N 0.000 description 2
- FEUISMYEFPANSS-UHFFFAOYSA-N 2-methylcyclohexan-1-amine Chemical compound CC1CCCCC1N FEUISMYEFPANSS-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- KSMVBYPXNKCPAJ-UHFFFAOYSA-N 4-Methylcyclohexylamine Chemical compound CC1CCC(N)CC1 KSMVBYPXNKCPAJ-UHFFFAOYSA-N 0.000 description 1
- 241000254032 Acrididae Species 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical class [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 235000021537 Beetroot Nutrition 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 235000007866 Chamaemelum nobile Nutrition 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 240000006162 Chenopodium quinoa Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- 241000208175 Daucus Species 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 235000007351 Eleusine Nutrition 0.000 description 1
- 241000209215 Eleusine Species 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 206010017711 Gangrene Diseases 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- JHGWZPZEGFSFJI-UHFFFAOYSA-N O=C(NC1CCCC1)N(CCN1)C1=O Chemical compound O=C(NC1CCCC1)N(CCN1)C1=O JHGWZPZEGFSFJI-UHFFFAOYSA-N 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 235000008753 Papaver somniferum Nutrition 0.000 description 1
- 241000218180 Papaveraceae Species 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 241000746981 Phleum Species 0.000 description 1
- 241000209051 Saccharum Species 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 241000243774 Trichinella Species 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 244000274883 Urtica dioica Species 0.000 description 1
- 235000009108 Urtica dioica Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- CNWSQCLBDWYLAN-UHFFFAOYSA-N butylurea Chemical compound CCCCNC(N)=O CNWSQCLBDWYLAN-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- AVKNGPAMCBSNSO-UHFFFAOYSA-N cyclohexylmethanamine Chemical compound NCC1CCCCC1 AVKNGPAMCBSNSO-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- HWDVTQAXQJQROO-UHFFFAOYSA-N cyclopropylazanide Chemical compound [NH-]C1CC1 HWDVTQAXQJQROO-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
- C07D233/38—One oxygen atom with acyl radicals or hetero atoms directly attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1932827A DE1932827C3 (de) | 1969-06-28 | 1969-06-28 | Cycloaliphatische Imidazolidin-2-on-1-carbonsäure-amide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL76179B1 true PL76179B1 (en, 2012) | 1975-02-28 |
Family
ID=5738240
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970141635A PL76179B1 (en, 2012) | 1969-06-28 | 1970-06-27 |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3686204A (en, 2012) |
| JP (1) | JPS5011452B1 (en, 2012) |
| AT (1) | AT298876B (en, 2012) |
| BE (1) | BE752624A (en, 2012) |
| BR (1) | BR7019277D0 (en, 2012) |
| CA (1) | CA927386A (en, 2012) |
| CH (1) | CH532583A (en, 2012) |
| CS (1) | CS161756B2 (en, 2012) |
| DE (1) | DE1932827C3 (en, 2012) |
| DK (1) | DK126995B (en, 2012) |
| ES (1) | ES381228A1 (en, 2012) |
| FR (1) | FR2051412A5 (en, 2012) |
| GB (1) | GB1259050A (en, 2012) |
| IL (1) | IL34610A (en, 2012) |
| NL (1) | NL7009294A (en, 2012) |
| PL (1) | PL76179B1 (en, 2012) |
| RO (1) | RO56762A (en, 2012) |
| SE (1) | SE366312B (en, 2012) |
| ZA (1) | ZA703635B (en, 2012) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4578107A (en) * | 1982-09-27 | 1986-03-25 | Otsuka Kagaku Kabushiki Kaisha | Herbicidal imidazolidine-2-one derivatives |
| JP2641280B2 (ja) * | 1988-12-29 | 1997-08-13 | 日本ペイント株式会社 | 新規な環状ウレア誘導体 |
| CA2006849A1 (en) * | 1988-12-29 | 1990-06-29 | Hiroyuki Sakamoto | Aqueous coating composition |
| HU214333B (hu) * | 1991-01-21 | 1998-03-02 | Shionogi Seiyaku Kabushiki Kaisha | Eljárás benzilidén-karbamoil-2-pirrolidon, -4-tiazolidinon, -4-oxazolidinon, -3-izotiazolidinon- és -3-izoxazolidinon-analógok és az ezeket tartalmazó gyógyszerkészítmények előállítására |
-
1969
- 1969-06-28 DE DE1932827A patent/DE1932827C3/de not_active Expired
-
1970
- 1970-05-26 BR BR219277/70A patent/BR7019277D0/pt unknown
- 1970-05-27 IL IL7034610A patent/IL34610A/xx unknown
- 1970-05-27 CH CH788570A patent/CH532583A/de not_active IP Right Cessation
- 1970-05-28 ZA ZA703635A patent/ZA703635B/xx unknown
- 1970-06-02 RO RO63528A patent/RO56762A/ro unknown
- 1970-06-12 CA CA085346A patent/CA927386A/en not_active Expired
- 1970-06-17 CS CS4237A patent/CS161756B2/cs unknown
- 1970-06-22 US US48473A patent/US3686204A/en not_active Expired - Lifetime
- 1970-06-22 AT AT557770A patent/AT298876B/de active
- 1970-06-24 GB GB1259050D patent/GB1259050A/en not_active Expired
- 1970-06-24 NL NL7009294A patent/NL7009294A/xx unknown
- 1970-06-26 BE BE752624D patent/BE752624A/xx unknown
- 1970-06-26 FR FR7023890A patent/FR2051412A5/fr not_active Expired
- 1970-06-26 DK DK333670AA patent/DK126995B/da unknown
- 1970-06-27 JP JP45055881A patent/JPS5011452B1/ja active Pending
- 1970-06-27 ES ES381228A patent/ES381228A1/es not_active Expired
- 1970-06-27 PL PL1970141635A patent/PL76179B1/pl unknown
- 1970-06-29 SE SE08981/70A patent/SE366312B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE366312B (en, 2012) | 1974-04-22 |
| IL34610A (en) | 1974-01-14 |
| US3686204A (en) | 1972-08-22 |
| AT298876B (de) | 1972-05-25 |
| DE1932827C3 (de) | 1978-10-05 |
| GB1259050A (en, 2012) | 1972-01-05 |
| IL34610A0 (en) | 1970-07-19 |
| NL7009294A (en, 2012) | 1970-12-30 |
| CS161756B2 (en, 2012) | 1975-06-10 |
| DE1932827B2 (de) | 1978-01-26 |
| CA927386A (en) | 1973-05-29 |
| ES381228A1 (es) | 1972-12-01 |
| BR7019277D0 (pt) | 1973-02-20 |
| DK126995B (da) | 1973-09-10 |
| FR2051412A5 (en, 2012) | 1971-04-02 |
| JPS5011452B1 (en, 2012) | 1975-05-01 |
| ZA703635B (en) | 1971-01-27 |
| BE752624A (fr) | 1970-12-28 |
| DE1932827A1 (de) | 1971-01-07 |
| CH532583A (de) | 1973-01-15 |
| RO56762A (en, 2012) | 1974-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3629275A (en) | Carboxylic acid (1 2 4-thiadiazol-5-yl)-amides | |
| PL82048B1 (en, 2012) | ||
| PL76443B1 (pl) | Środek chwastobójczy | |
| US3657264A (en) | Heterocyclically substituted thiadiazoles | |
| US3686198A (en) | 1,2,4-thiadiazolyl-ureas | |
| PL126774B1 (en) | Herbicide | |
| PL76179B1 (en, 2012) | ||
| US3823006A (en) | Method for selective weed control in beets | |
| IL30586A (en) | N-substituted 5-amino-1,3,4-thiadiazoles | |
| US3873299A (en) | 1,2,4-thiodiazolyl-urea herbicidal agents | |
| PL93285B1 (en, 2012) | ||
| US4128412A (en) | Herbicidal composition and method using N-(2-ethylsulfonyl-1,3,4-thiadiazol-5-yl)-N-methyl-N'-methyl urea | |
| US3933463A (en) | Herbicidally active imidazolidin-2-on-1-carboxylic acid amides | |
| US3984468A (en) | Herbicidal N-trifluoromethylmercaptophenyl ureas | |
| PL79493B1 (en, 2012) | ||
| US3763209A (en) | 2,4-dicyano-6-nitro-benzene amines | |
| US3454393A (en) | Nortricyclic-3-ureas and their herbicidal compositions and methods of use | |
| US4639526A (en) | N-substituted 5-amino-1,3,4-thiadiazoles | |
| US3981714A (en) | Cyclic N-thiadiazolyl-(2)-carboxylic acid compounds and herbicidal compositions | |
| HU187373B (en) | Herbicide compositions and process for preparing the active substances thereof, substituted 6-/halo-tert.butyl/-1,2,4-triatin-5-ones | |
| US3898262A (en) | Substituted O-{8 aminosulfonyl{9 -glycolic anilides | |
| PL81808B1 (en, 2012) | ||
| US3962304A (en) | Alkoxy-substituted benzyl dithiocarbamic acid esters | |
| US4049670A (en) | N-(2-Ethylsulfonyl-1,3,4-thiadiazol-5-yl)-N-methyl-N'-methylurea | |
| US4075235A (en) | N-Aryl-urea compounds and herbicidal compositions |