PL74590B1 - Diamond-studded drilling tool[us3696875a] - Google Patents
Diamond-studded drilling tool[us3696875a] Download PDFInfo
- Publication number
- PL74590B1 PL74590B1 PL1970139159A PL13915970A PL74590B1 PL 74590 B1 PL74590 B1 PL 74590B1 PL 1970139159 A PL1970139159 A PL 1970139159A PL 13915970 A PL13915970 A PL 13915970A PL 74590 B1 PL74590 B1 PL 74590B1
- Authority
- PL
- Poland
- Prior art keywords
- cutting inserts
- tool
- cutting
- drilling tool
- blades
- Prior art date
Links
- 238000005553 drilling Methods 0.000 title claims abstract description 26
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 36
- 229910052759 nickel Inorganic materials 0.000 claims description 18
- 229910052751 metal Inorganic materials 0.000 claims description 17
- 239000002184 metal Substances 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 16
- UONOETXJSWQNOL-UHFFFAOYSA-N tungsten carbide Chemical compound [W+]#[C-] UONOETXJSWQNOL-UHFFFAOYSA-N 0.000 claims description 15
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 14
- 229910017052 cobalt Inorganic materials 0.000 claims description 14
- 239000010941 cobalt Substances 0.000 claims description 14
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 14
- 229910052750 molybdenum Inorganic materials 0.000 claims description 14
- 239000011733 molybdenum Substances 0.000 claims description 14
- 229910000679 solder Inorganic materials 0.000 claims description 13
- 239000010432 diamond Substances 0.000 claims description 11
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 6
- 229910052804 chromium Inorganic materials 0.000 claims description 6
- 239000011651 chromium Substances 0.000 claims description 6
- 229910003460 diamond Inorganic materials 0.000 claims description 6
- 229910052715 tantalum Inorganic materials 0.000 claims description 6
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 6
- 229910052758 niobium Inorganic materials 0.000 claims description 5
- 239000010955 niobium Substances 0.000 claims description 5
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 5
- 239000002245 particle Substances 0.000 claims description 5
- MTPVUVINMAGMJL-UHFFFAOYSA-N trimethyl(1,1,2,2,2-pentafluoroethyl)silane Chemical compound C[Si](C)(C)C(F)(F)C(F)(F)F MTPVUVINMAGMJL-UHFFFAOYSA-N 0.000 claims description 5
- 229910052720 vanadium Inorganic materials 0.000 claims description 5
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 4
- 229910052802 copper Inorganic materials 0.000 claims description 4
- 239000010949 copper Substances 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 239000010936 titanium Substances 0.000 claims description 4
- 229910052719 titanium Inorganic materials 0.000 claims description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 4
- 229910052721 tungsten Inorganic materials 0.000 claims description 4
- 239000010937 tungsten Substances 0.000 claims description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052782 aluminium Inorganic materials 0.000 claims description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 3
- UFGZSIPAQKLCGR-UHFFFAOYSA-N chromium carbide Chemical compound [Cr]#C[Cr]C#[Cr] UFGZSIPAQKLCGR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 3
- 229910052710 silicon Inorganic materials 0.000 claims description 3
- 239000010703 silicon Substances 0.000 claims description 3
- 229910052718 tin Inorganic materials 0.000 claims description 3
- 229910003470 tongbaite Inorganic materials 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- INZDTEICWPZYJM-UHFFFAOYSA-N 1-(chloromethyl)-4-[4-(chloromethyl)phenyl]benzene Chemical compound C1=CC(CCl)=CC=C1C1=CC=C(CCl)C=C1 INZDTEICWPZYJM-UHFFFAOYSA-N 0.000 claims description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- UNASZPQZIFZUSI-UHFFFAOYSA-N methylidyneniobium Chemical compound [Nb]#C UNASZPQZIFZUSI-UHFFFAOYSA-N 0.000 claims description 2
- 229910052709 silver Inorganic materials 0.000 claims description 2
- 239000004332 silver Substances 0.000 claims description 2
- 239000011135 tin Substances 0.000 claims description 2
- 238000005192 partition Methods 0.000 claims 2
- VQYPKWOGIPDGPN-UHFFFAOYSA-N [C].[Ta] Chemical compound [C].[Ta] VQYPKWOGIPDGPN-UHFFFAOYSA-N 0.000 claims 1
- 229910052788 barium Inorganic materials 0.000 claims 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims 1
- 238000011010 flushing procedure Methods 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 claims 1
- 238000011144 upstream manufacturing Methods 0.000 claims 1
- 238000002347 injection Methods 0.000 abstract description 2
- 239000007924 injection Substances 0.000 abstract description 2
- 239000010802 sludge Substances 0.000 abstract 1
- 239000002689 soil Substances 0.000 description 18
- 150000002739 metals Chemical class 0.000 description 7
- 238000005245 sintering Methods 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 4
- CYKMNKXPYXUVPR-UHFFFAOYSA-N [C].[Ti] Chemical compound [C].[Ti] CYKMNKXPYXUVPR-UHFFFAOYSA-N 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 238000010276 construction Methods 0.000 description 3
- 230000002787 reinforcement Effects 0.000 description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- FXNGWBDIVIGISM-UHFFFAOYSA-N methylidynechromium Chemical compound [Cr]#[C] FXNGWBDIVIGISM-UHFFFAOYSA-N 0.000 description 2
- NFFIWVVINABMKP-UHFFFAOYSA-N methylidynetantalum Chemical compound [Ta]#C NFFIWVVINABMKP-UHFFFAOYSA-N 0.000 description 2
- 229910003468 tantalcarbide Inorganic materials 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229910000684 Cobalt-chrome Inorganic materials 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- XACAZEWCMFHVBX-UHFFFAOYSA-N [C].[Mo] Chemical compound [C].[Mo] XACAZEWCMFHVBX-UHFFFAOYSA-N 0.000 description 1
- QISGROBHHFQWKS-UHFFFAOYSA-N [C].[Nb] Chemical compound [C].[Nb] QISGROBHHFQWKS-UHFFFAOYSA-N 0.000 description 1
- WAIPAZQMEIHHTJ-UHFFFAOYSA-N [Cr].[Co] Chemical compound [Cr].[Co] WAIPAZQMEIHHTJ-UHFFFAOYSA-N 0.000 description 1
- 238000003491 array Methods 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- ICPIKPGERJWARK-UHFFFAOYSA-N cobalt copper molybdenum Chemical compound [Co][Cu][Mo] ICPIKPGERJWARK-UHFFFAOYSA-N 0.000 description 1
- WHDPTDWLEKQKKX-UHFFFAOYSA-N cobalt molybdenum Chemical compound [Co].[Co].[Mo] WHDPTDWLEKQKKX-UHFFFAOYSA-N 0.000 description 1
- 239000010952 cobalt-chrome Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- YOCUPQPZWBBYIX-UHFFFAOYSA-N copper nickel Chemical compound [Ni].[Cu] YOCUPQPZWBBYIX-UHFFFAOYSA-N 0.000 description 1
- YCKOAAUKSGOOJH-UHFFFAOYSA-N copper silver Chemical compound [Cu].[Ag].[Ag] YCKOAAUKSGOOJH-UHFFFAOYSA-N 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-AHCXROLUSA-N copper-60 Chemical compound [60Cu] RYGMFSIKBFXOCR-AHCXROLUSA-N 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- UGKDIUIOSMUOAW-UHFFFAOYSA-N iron nickel Chemical compound [Fe].[Ni] UGKDIUIOSMUOAW-UHFFFAOYSA-N 0.000 description 1
- LQBJWKCYZGMFEV-UHFFFAOYSA-N lead tin Chemical compound [Sn].[Pb] LQBJWKCYZGMFEV-UHFFFAOYSA-N 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 235000019988 mead Nutrition 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- DDTIGTPWGISMKL-UHFFFAOYSA-N molybdenum nickel Chemical compound [Ni].[Mo] DDTIGTPWGISMKL-UHFFFAOYSA-N 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E21—EARTH OR ROCK DRILLING; MINING
- E21B—EARTH OR ROCK DRILLING; OBTAINING OIL, GAS, WATER, SOLUBLE OR MELTABLE MATERIALS OR A SLURRY OF MINERALS FROM WELLS
- E21B10/00—Drill bits
- E21B10/46—Drill bits characterised by wear resisting parts, e.g. diamond inserts
- E21B10/54—Drill bits characterised by wear resisting parts, e.g. diamond inserts the bit being of the rotary drag type, e.g. fork-type bits
-
- E—FIXED CONSTRUCTIONS
- E21—EARTH OR ROCK DRILLING; MINING
- E21B—EARTH OR ROCK DRILLING; OBTAINING OIL, GAS, WATER, SOLUBLE OR MELTABLE MATERIALS OR A SLURRY OF MINERALS FROM WELLS
- E21B10/00—Drill bits
- E21B10/46—Drill bits characterised by wear resisting parts, e.g. diamond inserts
Landscapes
- Engineering & Computer Science (AREA)
- Geology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Mining & Mineral Resources (AREA)
- Physics & Mathematics (AREA)
- Environmental & Geological Engineering (AREA)
- Fluid Mechanics (AREA)
- Mechanical Engineering (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Geochemistry & Mineralogy (AREA)
- Earth Drilling (AREA)
- Processing Of Stones Or Stones Resemblance Materials (AREA)
- Drilling Tools (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR6907864A FR2029963A5 (enFirst) | 1969-03-19 | 1969-03-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL74590B1 true PL74590B1 (en) | 1974-12-31 |
Family
ID=9030879
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970139159A PL74590B1 (en) | 1969-03-19 | 1970-03-03 | Diamond-studded drilling tool[us3696875a] |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3696875A (enFirst) |
| BE (1) | BE740959A (enFirst) |
| BR (1) | BR7017010D0 (enFirst) |
| CH (1) | CH528008A (enFirst) |
| CS (1) | CS193458B2 (enFirst) |
| DE (1) | DE1954576C3 (enFirst) |
| ES (1) | ES375650A1 (enFirst) |
| FR (1) | FR2029963A5 (enFirst) |
| GB (1) | GB1310883A (enFirst) |
| NL (1) | NL152053B (enFirst) |
| PL (1) | PL74590B1 (enFirst) |
| RO (1) | RO58895A (enFirst) |
| SU (1) | SU547179A3 (enFirst) |
| YU (1) | YU33125B (enFirst) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2105219C3 (de) * | 1971-02-04 | 1981-06-11 | Shell Internationale Research Maatschappij B.V., 's-Gravenhage | Diamantbohrmeißel |
| FR2135053B1 (enFirst) * | 1971-05-04 | 1974-08-19 | Petroles Cie Francaise | |
| SU483863A1 (ru) * | 1973-01-03 | 1980-06-15 | Всесоюзный Научно-Исследоваельский И Проектный Институт Тугоплавких Металлов И Твердых Сплавов | Способ изготовлени алмазного бурового инструмента |
| US3938599A (en) * | 1974-03-27 | 1976-02-17 | Hycalog, Inc. | Rotary drill bit |
| JPS5410325B2 (enFirst) * | 1974-06-10 | 1979-05-04 | ||
| DE2633779C3 (de) * | 1976-07-28 | 1983-11-03 | Richard 5383 Kierspe Karnebogen | Schlagbohrkrone |
| US4073354A (en) * | 1976-11-26 | 1978-02-14 | Christensen, Inc. | Earth-boring drill bits |
| GB1548499A (en) * | 1977-05-17 | 1979-07-18 | Shell Int Research | Rotary drilling bit for deephole drilling and method of manufacturing the same |
| GB1537000A (en) * | 1977-08-17 | 1978-12-29 | Shell Int Research | Rotary drilling bit |
| US4244432A (en) * | 1978-06-08 | 1981-01-13 | Christensen, Inc. | Earth-boring drill bits |
| US4351401A (en) * | 1978-06-08 | 1982-09-28 | Christensen, Inc. | Earth-boring drill bits |
| US4234048A (en) * | 1978-06-12 | 1980-11-18 | Christensen, Inc. | Drill bits embodying impregnated segments |
| FR2433130A1 (fr) * | 1978-08-11 | 1980-03-07 | Petroles Cie Francaise | Dispositif antifriction, notamment pour turbine, et procede de realisation |
| US4241798A (en) * | 1979-01-29 | 1980-12-30 | Reed Tool Company | Drilling bits for plastic formations |
| DE2916347C3 (de) * | 1979-04-23 | 1981-12-03 | Christensen, Inc., 84114 Salt Lake City, Utah | Lagerstuhl für Direktantriebe von Tiefbohrmeißeln o.dgl. in einem Bohrloch arbeitenden Werkzeugen oder Geräten |
| US4550790A (en) * | 1983-02-28 | 1985-11-05 | Norton Christensen, Inc. | Diamond rotating bit |
| DE3687798T2 (de) * | 1986-05-19 | 1993-08-05 | Smith International | Kuehlnetzwerke fuer lagerflaechen aus polykristallinem diamant. |
| US5175988A (en) * | 1988-06-23 | 1993-01-05 | Kanai Juyo Kogyo Company Ltd. | Ring for spinning machinery |
| DE9308443U1 (de) * | 1993-06-05 | 1993-08-19 | Bilfinger + Berger Bauaktiengesellschaft, 68165 Mannheim | Vollbohrkrone zum Herstellen von verrohrten Erdbohrungen |
| GB2307918B (en) * | 1995-12-05 | 1999-02-10 | Smith International | Pressure molded powder metal "milled tooth" rock bit cone |
| US6394202B2 (en) | 1999-06-30 | 2002-05-28 | Smith International, Inc. | Drill bit having diamond impregnated inserts primary cutting structure |
| US8327956B2 (en) * | 2008-12-19 | 2012-12-11 | Varel International, Ind., L.P. | Multi-set PDC drill bit and method |
| US8439136B2 (en) * | 2009-04-02 | 2013-05-14 | Atlas Copco Secoroc Llc | Drill bit for earth boring |
| GB201008093D0 (en) * | 2010-05-14 | 2010-06-30 | Element Six Production Pty Ltd | Polycrystalline diamond |
| US9194189B2 (en) | 2011-09-19 | 2015-11-24 | Baker Hughes Incorporated | Methods of forming a cutting element for an earth-boring tool, a related cutting element, and an earth-boring tool including such a cutting element |
| CA2861918C (en) | 2012-01-20 | 2017-02-14 | Baker Hughes Incorporated | Superabrasive-impregnated earth-boring tools with extended features and aggressive compositions, and related methods |
| US9731358B2 (en) | 2013-06-06 | 2017-08-15 | Milwaukee Electric Tool Corporation | Step drill bit |
| US11273501B2 (en) | 2018-04-26 | 2022-03-15 | Milwaukee Electric Tool Corporation | Step drill bit |
| CN116122859B (zh) * | 2022-12-30 | 2025-10-21 | 宁波大学 | 异型体高压旋喷加固装备及方法 |
| CN119266719B (zh) * | 2024-09-23 | 2025-10-03 | 深圳大学 | 一种复合式冲击钻具 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA659574A (en) * | 1963-03-19 | H. Davis Sidney | Drilling bit | |
| US2381415A (en) * | 1943-11-19 | 1945-08-07 | Jr Edward B Williams | Drill bit |
| US2607562A (en) * | 1951-03-19 | 1952-08-19 | Phipps Orville | Self-piloted rotary drill bit |
| US2800302A (en) * | 1952-01-23 | 1957-07-23 | Austin Powder Co | Auger head |
| US3059708A (en) * | 1959-08-07 | 1962-10-23 | Jersey Prod Res Co | Abrasion resistant stepped blade rotary drill bit |
| US3106973A (en) * | 1960-09-26 | 1963-10-15 | Christensen Diamond Prod Co | Rotary drill bits |
| US3158216A (en) * | 1961-04-27 | 1964-11-24 | Inst Francais Du Petrole | High speed drill bit |
| US3180440A (en) * | 1962-12-31 | 1965-04-27 | Jersey Prod Res Co | Drag bit |
| GB996796A (en) * | 1963-03-09 | 1965-06-30 | P & V Mining & Engineering Ltd | Improvements in and relating to tools for operating in rock, coal and other material |
| US3280927A (en) * | 1964-01-31 | 1966-10-25 | Petersen Anita E | Finger-type pilot bit |
-
1969
- 1969-03-19 FR FR6907864A patent/FR2029963A5/fr not_active Expired
- 1969-10-29 BE BE740959D patent/BE740959A/xx not_active IP Right Cessation
- 1969-10-30 DE DE1954576A patent/DE1954576C3/de not_active Expired
- 1969-11-17 US US877341A patent/US3696875A/en not_active Expired - Lifetime
- 1969-11-21 SU SU1378834A patent/SU547179A3/ru active
- 1969-12-22 NL NL696919217A patent/NL152053B/xx not_active IP Right Cessation
- 1969-12-31 ES ES375650A patent/ES375650A1/es not_active Expired
-
1970
- 1970-01-08 YU YU34/70A patent/YU33125B/xx unknown
- 1970-01-15 CS CS70315A patent/CS193458B2/cs unknown
- 1970-01-23 RO RO62233A patent/RO58895A/ro unknown
- 1970-02-09 CH CH181870A patent/CH528008A/fr not_active IP Right Cessation
- 1970-02-26 BR BR217010/70A patent/BR7017010D0/pt unknown
- 1970-03-03 PL PL1970139159A patent/PL74590B1/pl unknown
- 1970-03-18 GB GB5615669A patent/GB1310883A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL152053B (nl) | 1977-01-17 |
| US3696875A (en) | 1972-10-10 |
| CH528008A (fr) | 1972-09-15 |
| FR2029963A5 (enFirst) | 1970-10-23 |
| DE1954576A1 (de) | 1970-10-01 |
| YU33125B (en) | 1976-04-30 |
| DE1954576B2 (de) | 1973-04-12 |
| SU547179A3 (ru) | 1977-02-15 |
| NL6919217A (enFirst) | 1970-09-22 |
| BE740959A (enFirst) | 1970-04-01 |
| CS193458B2 (en) | 1979-10-31 |
| RO58895A (enFirst) | 1976-01-15 |
| ES375650A1 (es) | 1972-05-16 |
| BR7017010D0 (pt) | 1973-04-10 |
| GB1310883A (en) | 1973-03-21 |
| YU3470A (en) | 1975-10-31 |
| DE1954576C3 (de) | 1973-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL74590B1 (en) | Diamond-studded drilling tool[us3696875a] | |
| CA2538545C (en) | Fixed cutter drill bit for abrasive applications | |
| US6033295A (en) | Segmented cutting tools | |
| US10472899B2 (en) | Cutting tools with rotating elements | |
| CA2595048C (en) | Cutter geometry for increased bit life and bits incorporating the same | |
| EP2122111B1 (en) | Core drill bit with extended matrix height | |
| EP1236861A1 (en) | Mill/drill bit | |
| EP0822318A1 (en) | Improvements in or relating to rotary drill bits | |
| EP0149530A2 (en) | Self sharpening drag bit assembly | |
| CA2790523C (en) | Rotary drag bit | |
| DE3040840A1 (de) | Variables verschleissfutter fuer querstrom-ausraeumbohrer | |
| EA032667B1 (ru) | Скважинный породоразрушающий инструмент | |
| AU2017258988A1 (en) | Infiltrated diamond wear resistant bodies and tools | |
| CN112969839B (zh) | 钻头 | |
| WO2013101578A1 (en) | Spacing of rolling cutters on a fixed cutter bit | |
| GB2313863A (en) | A steel body PDC bit | |
| WO2017106488A1 (en) | Cutting elements, earth-boring tools including cutting elements, and methods of forming cutting elements | |
| EP0605151A1 (en) | Rotary drill bit with stabilizing elements | |
| US3605924A (en) | Drill bit | |
| CA2291747A1 (en) | Drag-type rotary drill bit | |
| GB1572543A (en) | Drilling tools | |
| EP3348781B1 (en) | Earth-boring tools having impregnated cutting structures and methods of forming and using the same | |
| EP1006257B1 (en) | A drag-type Rotary Drill Bit | |
| EP0546523A1 (en) | Earth-boring drill bit with enlarged junk slots | |
| EP1191000B1 (en) | Rotary drill bit |