PL68699B1 - - Google Patents
Download PDFInfo
- Publication number
- PL68699B1 PL68699B1 PL12647768D PL12647768D PL68699B1 PL 68699 B1 PL68699 B1 PL 68699B1 PL 12647768 D PL12647768 D PL 12647768D PL 12647768 D PL12647768 D PL 12647768D PL 68699 B1 PL68699 B1 PL 68699B1
- Authority
- PL
- Poland
- Prior art keywords
- alkali metal
- weight
- mixture
- compound
- rotary kiln
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 30
- 239000000243 solution Substances 0.000 claims description 26
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 16
- 229910019142 PO4 Inorganic materials 0.000 claims description 15
- 235000021317 phosphate Nutrition 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 13
- 239000003337 fertilizer Substances 0.000 claims description 10
- 239000010452 phosphate Substances 0.000 claims description 10
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 9
- 239000007864 aqueous solution Substances 0.000 claims description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 9
- 230000029087 digestion Effects 0.000 claims description 8
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 6
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 6
- 239000007789 gas Substances 0.000 claims description 6
- 235000012239 silicon dioxide Nutrition 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 5
- 238000004537 pulping Methods 0.000 claims description 5
- 239000002994 raw material Substances 0.000 claims description 5
- 150000003112 potassium compounds Chemical class 0.000 claims description 4
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 4
- 239000000377 silicon dioxide Substances 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 238000002156 mixing Methods 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- 238000001354 calcination Methods 0.000 claims description 2
- 229910052681 coesite Inorganic materials 0.000 claims description 2
- 229910052906 cristobalite Inorganic materials 0.000 claims description 2
- 229910052909 inorganic silicate Inorganic materials 0.000 claims description 2
- 229910052682 stishovite Inorganic materials 0.000 claims description 2
- 229910052905 tridymite Inorganic materials 0.000 claims description 2
- 150000003388 sodium compounds Chemical class 0.000 claims 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical class [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 239000004576 sand Substances 0.000 description 8
- 239000003513 alkali Substances 0.000 description 7
- 238000005245 sintering Methods 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 235000011118 potassium hydroxide Nutrition 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000001506 calcium phosphate Substances 0.000 description 3
- 235000011010 calcium phosphates Nutrition 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 2
- 229910052586 apatite Inorganic materials 0.000 description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- VSIIXMUUUJUKCM-UHFFFAOYSA-D pentacalcium;fluoride;triphosphate Chemical compound [F-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O VSIIXMUUUJUKCM-UHFFFAOYSA-D 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000010205 Cola acuminata Nutrition 0.000 description 1
- 244000228088 Cola acuminata Species 0.000 description 1
- 235000015438 Cola nitida Nutrition 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 101100088138 Pinus taeda RPL10 gene Proteins 0.000 description 1
- 229910020169 SiOa Inorganic materials 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000003763 carbonization Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 239000003546 flue gas Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000021049 nutrient content Nutrition 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- YWYZEGXAUVWDED-UHFFFAOYSA-N triammonium citrate Chemical compound [NH4+].[NH4+].[NH4+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O YWYZEGXAUVWDED-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Fertilizers (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL12647768D PL68699B1 (enExample) | 1968-01-01 | 1968-01-01 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL12647768D PL68699B1 (enExample) | 1968-01-01 | 1968-01-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL68699B1 true PL68699B1 (enExample) | 1973-02-28 |
Family
ID=19949963
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL12647768D PL68699B1 (enExample) | 1968-01-01 | 1968-01-01 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL68699B1 (enExample) |
-
1968
- 1968-01-01 PL PL12647768D patent/PL68699B1/pl unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL235904B1 (pl) | Sposób ciągłego wytwarzania granulowanego nawozu azotowo- fosforowego typu USP | |
| TR201807720T4 (tr) | Amonyum nitrat bazlı partiküllere inorganik bir kaplama sağlanmasına yönelik yöntem. | |
| Ando | Thermal phosphate | |
| US10723632B2 (en) | Magnesium sulfate granulates based on synthetic magnesium sulphate | |
| EA030295B1 (ru) | Фосфор-калий-азотсодержащее npk-удобрение и способ получения гранулированного фосфор-калий-азотсодержащего npk-удобрения | |
| CA2016048C (en) | Method for the production of potassium magnesium phosphate | |
| US4106922A (en) | Alkaline decomposition process for producing calcined phosphate fertilizer | |
| CN108473309A (zh) | 固体磷酸盐及其制备方法 | |
| PL68699B1 (enExample) | ||
| US3719464A (en) | Preparation of alkali containing calcined phosphate fertilizers | |
| PL94344B1 (enExample) | ||
| PL112591B1 (en) | Process for manufacturing alkalis containing thermophosphatic fertilizer | |
| Karapetyan et al. | Technology of processing of apatites in the production of fused phosphates as modern highly effective fertilizers | |
| Young et al. | Phosphate fertilizers and process technology | |
| US3226184A (en) | Manufacture of solid ammonium phosphates | |
| RU2628292C1 (ru) | Фосфор-калий-азотсодержащее npk-удобрение и способ получения гранулированного фосфор-калий-азотсодержащего npk-удобрения | |
| US3000724A (en) | Manufacture of nitrogen containing complex fertilizers | |
| US3194632A (en) | Process for the manufacture of magnesium phosphates or of salt mixtures containing magnesium phosphates | |
| PL81825B1 (enExample) | ||
| PL101814B1 (pl) | Method of manufacturing phosphatic fertilizers sposob wytwarzania nawozu fosforowego | |
| US3301658A (en) | Fertilizer | |
| JPS6117795B2 (enExample) | ||
| Baniel et al. | Fertilizer materials, low cost magnesium phosphate by novel process | |
| NO169706B (no) | Storsekk med beskyttelseshette og fremgangsmaate for dens fremstilling. | |
| PL69537B1 (enExample) |