PL64502B1 - - Google Patents
Download PDFInfo
- Publication number
- PL64502B1 PL64502B1 PL124738A PL12473868A PL64502B1 PL 64502 B1 PL64502 B1 PL 64502B1 PL 124738 A PL124738 A PL 124738A PL 12473868 A PL12473868 A PL 12473868A PL 64502 B1 PL64502 B1 PL 64502B1
- Authority
- PL
- Poland
- Prior art keywords
- gas
- container
- discharge pipes
- user
- cooling
- Prior art date
Links
- 238000001816 cooling Methods 0.000 claims description 24
- CURLTUGMZLYLDI-UHFFFAOYSA-N carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 12
- 230000000241 respiratory Effects 0.000 claims description 11
- 239000002826 coolant Substances 0.000 claims description 10
- 239000001569 carbon dioxide Substances 0.000 claims description 8
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 8
- 239000007789 gas Substances 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- 235000011089 carbon dioxide Nutrition 0.000 claims description 4
- 238000010521 absorption reaction Methods 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 235000019796 monopotassium phosphate Nutrition 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 3
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000011148 porous material Substances 0.000 claims 1
- 230000001681 protective Effects 0.000 description 5
- 230000029058 respiratory gaseous exchange Effects 0.000 description 4
- 210000000614 Ribs Anatomy 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000008929 regeneration Effects 0.000 description 3
- 238000011069 regeneration method Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000001172 regenerating Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- OENIXTHWZWFYIV-UHFFFAOYSA-N 2-[4-[2-[5-(cyclopentylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(C=C1)=CC=C1CCC(N1)=NC=C1CC1CCCC1 OENIXTHWZWFYIV-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N Carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 210000004392 Genitalia Anatomy 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 210000000056 organs Anatomy 0.000 description 1
- 239000003507 refrigerant Substances 0.000 description 1
- 238000009834 vaporization Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL64502B1 true PL64502B1 (et) | 1971-12-31 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3642059A (en) | Heating and cooling unit | |
| US3779310A (en) | High efficiency heat transit system | |
| US4294244A (en) | Respirator with a cooling device | |
| EP1457746A2 (en) | Absorption-type air conditioner core structure | |
| PL123947B1 (en) | Thermally protective clothing for cooling the human body | |
| PL64502B1 (et) | ||
| DE2700492B1 (de) | Atemschutzgeraet mit einer Kuehlvorrichtung | |
| US2088277A (en) | Absorption refrigerating apparatus | |
| JPS6227351B2 (et) | ||
| JPS5848480Y2 (ja) | 金属水素化物を用いた水素貯蔵装置 | |
| DE3015597A1 (de) | Kuehlweste | |
| JPH057638B2 (et) | ||
| US2404511A (en) | Refrigerating method and apparatus | |
| DE7700343U1 (de) | Atemschutzgeraet mit einer kuehlvorrichtung | |
| US3188832A (en) | Portable refrigeration and water purifying apparatus | |
| US2520027A (en) | Absorption refrigeration system | |
| JPS56150808A (en) | Prevention device of formation of dew in case body | |
| PL50525B1 (et) | ||
| US3411573A (en) | Air replacement in heat-storage containers | |
| DE2633431C3 (de) | Kohlendioxid-Absorber | |
| US710623A (en) | Refrigerating apparatus. | |
| PL16784B1 (pl) | Oziebiarka. | |
| US3293873A (en) | Refrigerant control for absorption refrigeration systems | |
| RU2045301C1 (ru) | Маска для защиты органов дыхания от холода | |
| SU14889A1 (ru) | Способ действи абсорбционной (поглощательной) установки |